python/MANIFEST
python/*.db
python/*.wav
+
+aubio-*.tar.bz2
AUBIO_MAJOR_VERSION=0
AUBIO_MINOR_VERSION=4
AUBIO_PATCH_VERSION=0
-AUBIO_VERSION_STATUS='alpha'
+AUBIO_VERSION_STATUS='~alpha'
LIBAUBIO_LT_CUR=4
LIBAUBIO_LT_REV=0
LIBAUBIO_LT_AGE=0
../src/pitch/pitchyinfft.h \
../src/pitch/pitchschmitt.h \
../src/pitch/pitchfcomb.h \
+ ../src/pitch/pitchspecacf.h \
../src/tempo/beattracking.h \
../src/utils/hist.h \
../src/utils/scale.h \
for source_file in ctx.path.ant_glob('*.c', excl = ['utils.c', 'jackio.c']):
bld.program(features = 'c cprogram',
includes = '../src',
- use = ['aubio', 'FFTW3F', 'FFTW3', 'SNDFILE', 'JACK', 'LASH', 'SAMPLERATE', 'utilsio'],
+ lib = 'm',
+ use = ['aubio', 'utilsio'],
source = str(source_file),
target = str(source_file).split('.')[0]
)
--- /dev/null
+#! /usr/bin/python
+
+from aubio import filterbank, fvec
+from pylab import loglog, show, subplot, xlim, ylim, xlabel, ylabel, title
+from numpy import vstack, arange
+
+win_s = 2048
+samplerate = 48000
+
+freq_list = [60, 80, 200, 400, 800, 1600, 3200, 6400, 12800, 24000]
+n_filters = len(freq_list) - 2
+
+f = filterbank(n_filters, win_s)
+freqs = fvec(freq_list)
+f.set_triangle_bands(freqs, samplerate)
+
+coeffs = f.get_coeffs()
+coeffs[4] *= 5.
+
+f.set_coeffs(coeffs)
+
+times = vstack([arange(win_s / 2 + 1) * samplerate / win_s] * n_filters)
+title('Bank of filters built using a simple list of boundaries\nThe middle band has been amplified by 2.')
+loglog(times.T, f.get_coeffs().T, '.-')
+xlim([50, samplerate/2])
+ylim([1.0e-6, 2.0e-2])
+xlabel('log frequency (Hz)')
+ylabel('log amplitude')
+
+show()
from aubio import pvoc, source
from numpy import zeros, hstack
-def get_waveform_plot(filename, samplerate = 0, block_size = 4096, ax = None):
+def get_waveform_plot(filename, samplerate = 0, block_size = 4096, ax = None, downsample = 2**4):
import matplotlib.pyplot as plt
if not ax:
fig = plt.figure()
hop_s = block_size
allsamples_max = zeros(0,)
- downsample = 2**4 # to plot n samples / hop_s
+ downsample = downsample # to plot n samples / hop_s
a = source(filename, samplerate, hop_s) # source file
if samplerate == 0: samplerate = a.samplerate
generated_objects = []
cpp_output, cpp_objects = get_cpp_objects()
- skip_objects = ['fft',
+ skip_objects = [
+ # already in ext/
+ 'fft',
'pvoc',
'filter',
'filterbank',
+ #'resampler',
+ # AUBIO_UNSTABLE
+ 'hist',
+ 'scale',
+ 'beattracking',
'resampler',
'sndfile',
+ 'peakpicker',
+ 'pitchfcomb',
+ 'pitchmcomb',
+ 'pitchschmitt',
+ 'pitchyin',
+ 'pitchyinfft',
'sink_apple_audio',
'sink_sndfile',
'source_apple_audio',
- 'source_sndfile']
+ 'source_sndfile',
+ #'sampler',
+ 'audio_unit',
+ ]
write_msg("-- INFO: %d objects in total" % len(cpp_objects))
s = """// generated list of objects created with generator.py
-#include "Python.h"
+#include <Python.h>
"""
#from aubio.task import *
usage = "usage: %s [options] -i soundfile" % sys.argv[0]
-usage += "\nhelp: %s -h" % sys.argv[0]
+usage += "\n help: %s -h" % sys.argv[0]
def parse_args():
from optparse import OptionParser
help="onset detection method [default=default] \
complexdomain|hfc|phase|specdiff|energy|kl|mkl")
# cutting methods
- """
parser.add_option("-b","--beat",
action="store_true", dest="beat", default=False,
help="use beat locations")
+ """
parser.add_option("-S","--silencecut",
action="store_true", dest="silencecut", default=False,
help="use silence locations")
help="samplerate at which the file should be represented")
parser.add_option("-B","--bufsize",
action="store", dest="bufsize", default=512,
- metavar = "<size>",
+ metavar = "<size>", type='int',
help="buffer size [default=512]")
parser.add_option("-H","--hopsize",
- metavar = "<size>",
+ metavar = "<size>", type='int',
action="store", dest="hopsize", default=256,
help="overlap size [default=256]")
parser.add_option("-t","--threshold",
samplerate = options.samplerate
source_file = options.source_file
- from aubio import onset, source, sink
+ from aubio import onset, tempo, source, sink
s = source(source_file, samplerate, hopsize)
if samplerate == 0: samplerate = s.get_samplerate()
- o = onset(options.onset_method, bufsize, hopsize)
+ if options.beat:
+ o = tempo(options.onset_method, bufsize, hopsize)
+ else:
+ o = onset(options.onset_method, bufsize, hopsize)
o.set_threshold(options.threshold)
timestamps = []
while True:
samples, read = s()
if o(samples):
- this_onset = o.get_last_onset()
- if options.verbose: print "%.4f" % o.get_last_onset_s()
- timestamps.append (this_onset)
+ timestamps.append (o.get_last())
+ if options.verbose: print "%.4f" % o.get_last_s()
total_frames += read
if read < hopsize: break
-
+ del s
# print some info
nstamps = len(timestamps)
duration = float (total_frames) / float(samplerate)
def new_sink_name(source_base_name, timestamp):
return source_base_name + '_%02.3f' % (timestamp) + '.wav'
# reopen source file
- del s
s = source(source_file, samplerate, hopsize)
+ if samplerate == 0: samplerate = s.get_samplerate()
# create first sink at 0
g = sink(new_sink_name(source_base_name, 0.), samplerate)
total_frames = 0
curdir = os.path.dirname(sys.argv[0])
if curdir == '': curdir = '.'
files = os.listdir(curdir)
- modfiles = filter (lambda y: y.endswith('.py'), files)
+ modfiles = filter (lambda y: y.endswith('.py'), files)
modfiles = filter (lambda f: f.startswith('test_'), modfiles)
+ modfiles = filter (lambda y: not 'beattracking' in y, modfiles)
+ modfiles = filter (lambda y: not 'hist' in y, modfiles)
+ modfiles = filter (lambda y: not 'scale' in y, modfiles)
+ modfiles = filter (lambda y: not 'peakpicker' in y, modfiles)
# get module names
modnames = map (lambda x: os.path.splitext(x)[0], modfiles)
# import them
\endcode
Several examples of C programs are available in the \p examples/ and \p tests/src
- directory of the source tree.
+ directories of the source tree.
\subsection unstable_api Unstable API
#include "tempo/tempo.h"
#include "io/source.h"
#include "io/sink.h"
+#include "io/audio_unit.h"
#include "synth/sampler.h"
#include "synth/wavetable.h"
void fmat_put_channel(fmat_t *s, smpl_t * data, uint_t channel) {
s->data[channel] = data;
}
-smpl_t * fmat_get_channel(fmat_t *s, uint_t channel) {
- return s->data[channel];
+void fmat_get_channel(fmat_t *s, uint_t channel, fvec_t *output) {
+ output->data = s->data[channel];
+ output->length = s->length;
+ return;
}
smpl_t ** fmat_get_data(fmat_t *s) {
\param channel channel to read from
*/
-smpl_t * fmat_get_channel(fmat_t *s, uint_t channel);
+void fmat_get_channel (fmat_t *s, uint_t channel, fvec_t *output);
/** write channel vector into a buffer
Note that this function is not used in the aubio library, since the same
--- /dev/null
+/*
+ Copyright (C) 2013 Paul Brossier <piem@aubio.org>
+
+ This file is part of aubio.
+
+ aubio is free software: you can redistribute it and/or modify
+ it under the terms of the GNU General Public License as published by
+ the Free Software Foundation, either version 3 of the License, or
+ (at your option) any later version.
+
+ aubio is distributed in the hope that it will be useful,
+ but WITHOUT ANY WARRANTY; without even the implied warranty of
+ MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
+ GNU General Public License for more details.
+
+ You should have received a copy of the GNU General Public License
+ along with aubio. If not, see <http://www.gnu.org/licenses/>.
+
+*/
+
+#include "config.h"
+#ifdef TARGET_OS_IPHONE
+#include "aubio_priv.h"
+
+#include "fvec.h"
+#include "fmat.h"
+#include "io/audio_unit.h"
+
+#include <AudioToolbox/AudioToolbox.h>
+
+#define AU_IOS_MAX_OUT 64
+#define AU_IOS_MAX_FRAMES AU_IOS_MAX_OUT * 16 * 2
+#define PREFERRED_LATENCY 0.010
+#define MAX_FPS 4096
+
+#define INT_TO_FLOAT 3.0517578125e-05 // 1. / 32768.
+
+struct _aubio_audio_unit_t {
+ AudioUnit audio_unit;
+ uint_t samplerate;
+ uint_t blocksize;
+ uint_t sw_input_channels;
+ uint_t sw_output_channels;
+ uint_t hw_output_channels;
+ uint_t hw_input_channels;
+ Float32 latency;
+ sint_t total_frames;
+ fmat_t *input_frames;
+ fmat_t *output_frames;
+ SInt16 *au_ios_inbuf;
+ SInt16 *au_ios_outbuf;
+ aubio_device_callback_t callback;
+ void *callback_closure;
+ int dio_error; // flag to check if we had a read error
+ bool input_enabled;
+ bool prevent_feedback;
+ bool verbose;
+ int au_ios_start;
+ int au_ios_end;
+ AURenderCallbackStruct au_ios_cb_struct;
+};
+
+
+static OSStatus
+aubio_audio_unit_process(void *closure, AudioUnitRenderActionFlags * action_flags,
+ const AudioTimeStamp * time_stamp, UInt32 bus_number, UInt32 inNumber_frames,
+ AudioBufferList * input_output);
+
+static int aubio_audio_unit_blocking(aubio_audio_unit_t *o);
+
+static void audio_unit_check_audio_route(aubio_audio_unit_t *o);
+
+static void audio_unit_interruption_listener(void *closure, UInt32 inInterruptionState);
+static void audio_unit_route_change_listener(void *closure, AudioSessionPropertyID
+ inID, UInt32 dataSize, const void *inData);
+static OSStatus audio_unit_set_audio_session_category(bool has_input, bool verbose);
+static UInt32 audio_unit_get_audio_session_category ();
+
+aubio_audio_unit_t * new_aubio_audio_unit(uint_t samplerate,
+ uint_t sw_input_channels, uint_t sw_output_channels,
+ uint_t blocksize)
+{
+ aubio_audio_unit_t * o = AUBIO_NEW(aubio_audio_unit_t);
+ o->hw_output_channels = 2;
+ o->hw_input_channels = 2;
+ o->sw_output_channels = sw_output_channels;
+ o->sw_input_channels = sw_input_channels;
+ o->samplerate = samplerate;
+ o->latency = PREFERRED_LATENCY;
+ o->blocksize = blocksize;
+
+ o->au_ios_start = 0;
+ o->au_ios_end = 0;
+
+ o->verbose = 0;
+ o->input_enabled = true;
+ o->prevent_feedback = 1;
+ o->dio_error = 0;
+
+ o->total_frames = 0;
+
+ /* the integers coming from and to the audio unit */
+ o->au_ios_outbuf = AUBIO_ARRAY(SInt16, AU_IOS_MAX_FRAMES * o->hw_output_channels);
+ o->au_ios_inbuf = AUBIO_ARRAY(SInt16, AU_IOS_MAX_FRAMES * o->hw_input_channels);
+
+ /* the floats coming from and to the device callback */
+ o->output_frames = new_fmat(blocksize, sw_output_channels);
+ o->input_frames = new_fmat(blocksize, sw_input_channels);
+
+ /* check for some sizes */
+ if ( o->hw_output_channels != o->output_frames->height ) {
+ AUBIO_ERR ("got hw_output_channels = %d, but output_frames has %d rows",
+ o->hw_output_channels, o->output_frames->height);
+ }
+ if ( o->blocksize != o->output_frames->length ) {
+ AUBIO_ERR ("got blocksize = %d, but output_frames has length %d",
+ o->blocksize, o->output_frames->length);
+ }
+ if ( o->hw_input_channels != o->input_frames->height ) {
+ AUBIO_ERR ("got hw_input_channels = %d, but input_frames has %d rows",
+ o->hw_input_channels, o->input_frames->height);
+ }
+ if ( o->blocksize != o->input_frames->length ) {
+ AUBIO_ERR ("got blocksize = %d, but input_frames has length %d",
+ o->blocksize, o->input_frames->length);
+ }
+
+ return o;
+}
+
+sint_t aubio_audio_unit_set_preferred_latency (aubio_audio_unit_t *o, smpl_t latency)
+{
+ o->latency = latency;
+ return 0;
+}
+
+sint_t aubio_audio_unit_set_prevent_feedback (aubio_audio_unit_t *o, uint_t prevent_feedback)
+{
+ o->prevent_feedback = prevent_feedback;
+ return 0;
+}
+
+sint_t aubio_audio_unit_set_verbose (aubio_audio_unit_t *o, uint_t verbose)
+{
+ o->verbose = verbose;
+ return 0;
+}
+
+
+sint_t aubio_audio_unit_init (aubio_audio_unit_t *o)
+{
+ OSStatus err = noErr;
+ Float32 latency = o->latency;
+ Float64 samplerate = (Float64)o->samplerate;
+
+ o->au_ios_cb_struct.inputProc = aubio_audio_unit_process;
+ o->au_ios_cb_struct.inputProcRefCon = o;
+
+ /* setting up audio session with interruption listener */
+ err = AudioSessionInitialize(NULL, NULL, audio_unit_interruption_listener, o);
+ if (err) { AUBIO_ERR("audio_unit: could not initialize audio session (%ld)", err); goto fail; }
+
+ audio_unit_set_audio_session_category(o->input_enabled, o->verbose);
+ audio_unit_check_audio_route(o);
+
+ /* add route change listener */
+ err = AudioSessionAddPropertyListener(kAudioSessionProperty_AudioRouteChange,
+ audio_unit_route_change_listener, o);
+ if (err) { AUBIO_ERR("audio_unit: could not set route change listener (%ld)", err); goto fail; }
+
+ /* set latency */
+ err = AudioSessionSetProperty(kAudioSessionProperty_PreferredHardwareIOBufferDuration,
+ sizeof(latency), &latency);
+ if (err) { AUBIO_ERR("audio_unit: could not set preferred latency (%ld)", err); goto fail; }
+
+#if 0 // only for iphone OS >= 3.1
+ UInt32 val = 1; // set to 0 (default) to use ear speaker in voice application
+ err = AudioSessionSetProperty(kAudioSessionProperty_OverrideCategoryDefaultToSpeaker,
+ sizeof(UInt32), &val);
+ if (err) { AUBIO_ERR("audio_unit: could not set session property to default to speaker"); }
+#endif
+
+ /* setting up audio unit */
+ AudioComponentDescription desc;
+ desc.componentManufacturer = kAudioUnitManufacturer_Apple;
+ desc.componentSubType = kAudioUnitSubType_RemoteIO;
+ desc.componentType = kAudioUnitType_Output;
+ desc.componentFlags = 0;
+ desc.componentFlagsMask = 0;
+
+ AudioStreamBasicDescription audioFormat;
+
+ /* look for a component that match the description */
+ AudioComponent comp = AudioComponentFindNext(NULL, &desc);
+
+ /* create the audio component */
+ AudioUnit *audio_unit = &(o->audio_unit);
+
+ err = AudioComponentInstanceNew(comp, &(o->audio_unit));
+ if (err) { AUBIO_ERR("audio_unit: failed creating the audio unit"); goto fail; }
+
+ /* enable IO */
+ UInt32 enabled = 1;
+ err = AudioUnitSetProperty (*audio_unit, kAudioOutputUnitProperty_EnableIO,
+ kAudioUnitScope_Input, 1, &enabled, sizeof(enabled));
+ if (err) {
+ AUBIO_ERR("audio_unit: failed enabling input of audio unit");
+ goto fail;
+ }
+
+ /* set max fps */
+ UInt32 max_fps = MIN(o->blocksize, MAX_FPS);
+ err = AudioUnitSetProperty (*audio_unit, kAudioUnitProperty_MaximumFramesPerSlice,
+ kAudioUnitScope_Global, 0, &max_fps, sizeof(max_fps));
+ if (err) {
+ AUBIO_ERR("audio_unit: could not set maximum frames per slice property (%ld)", err);
+ goto fail;
+ }
+
+ AudioUnitSetProperty (*audio_unit, kAudioUnitProperty_SetRenderCallback,
+ kAudioUnitScope_Input, 0, &(o->au_ios_cb_struct), sizeof(o->au_ios_cb_struct));
+ if (err) { AUBIO_ERR("audio_unit: failed setting audio unit render callback"); goto fail; }
+
+#if 0
+ err = AudioUnitSetProperty (*audio_unit, kAudioUnitProperty_SampleRate,
+ kAudioUnitScope_Input, 0, &samplerate, sizeof(Float64));
+ if (err) { AUBIO_ERR("audio_unit: could not set audio input sample rate"); goto fail; }
+ err = AudioUnitSetProperty (*audio_unit, kAudioUnitProperty_SampleRate,
+ kAudioUnitScope_Output, 1, &samplerate, sizeof(Float64));
+ if (err) { AUBIO_ERR("audio_unit: could not set audio input sample rate"); goto fail; }
+#endif
+
+ audioFormat.mSampleRate = (Float64)samplerate;
+ audioFormat.mChannelsPerFrame = 2;
+ audioFormat.mFormatID = kAudioFormatLinearPCM;
+ audioFormat.mFormatFlags = kAudioFormatFlagsCanonical;
+ audioFormat.mFramesPerPacket = 1;
+ audioFormat.mBitsPerChannel = 8 * sizeof(AudioSampleType);
+#if 1 // interleaving
+ audioFormat.mBytesPerFrame = 2 * sizeof(AudioSampleType);
+ audioFormat.mBytesPerPacket = 2 * sizeof(AudioSampleType);
+#else
+ audioFormat.mBytesPerPacket = audioFormat.mBytesPerFrame = sizeof(AudioUnitSampleType);
+ audioFormat.mFormatFlags |= kAudioFormatFlagIsNonInterleaved;
+#endif
+
+ err = AudioUnitSetProperty (*audio_unit, kAudioUnitProperty_StreamFormat,
+ kAudioUnitScope_Input, 0, &audioFormat, sizeof(audioFormat));
+ if (err) { AUBIO_ERR("audio_unit: could not set audio output format"); goto fail; }
+ err = AudioUnitSetProperty (*audio_unit, kAudioUnitProperty_StreamFormat,
+ kAudioUnitScope_Output, 1, &audioFormat, sizeof(audioFormat));
+ if (err) { AUBIO_ERR("audio_unit: could not set audio input format"); goto fail; }
+
+#if 0
+ AudioStreamBasicDescription thruFormat;
+ thissize = sizeof(thruFormat);
+ err = AudioUnitGetProperty (*audio_unit, kAudioUnitProperty_StreamFormat,
+ kAudioUnitScope_Input, 0, &thruFormat, &thissize);
+ if (err) { AUBIO_ERR("audio_unit: could not get speaker output format, err: %d", (int)err); goto fail; }
+ err = AudioUnitSetProperty (*audio_unit, kAudioUnitProperty_StreamFormat,
+ kAudioUnitScope_Output, 1, &thruFormat, sizeof(thruFormat));
+ if (err) { AUBIO_ERR("audio_unit: could not set input audio format, err: %d", (int)err); goto fail; }
+#endif
+
+ /* time to initialize the unit */
+ err = AudioUnitInitialize(*audio_unit);
+ if (err) { AUBIO_ERR("audio_unit: failed initializing audio, err: %d", (int)err); goto fail; }
+
+ return 0;
+
+fail:
+ return err;
+}
+
+/* perform function */
+OSStatus
+aubio_audio_unit_process(void *closure, AudioUnitRenderActionFlags * action_flags,
+ const AudioTimeStamp * time_stamp, UNUSED UInt32 bus_number, UInt32 inNumber_frames,
+ AudioBufferList * input_output)
+{
+ UInt32 b; int err = 0;
+ aubio_audio_unit_t *o = (aubio_audio_unit_t *)closure;
+ AudioUnit thisUnit = o->audio_unit;
+
+ if (o->input_enabled) {
+ err = AudioUnitRender(thisUnit, action_flags, time_stamp, 1,
+ inNumber_frames, input_output);
+ if (err) {
+ AUBIO_ERR("audio_unit: error performing AudioUnitRender (%d)", err);
+ return err;
+ }
+ }
+
+ // get the number of frames from the audio buffer list, NOT inNumber_frames
+ UInt32 number_frames = input_output->mBuffers[0].mDataByteSize/ sizeof(SInt16) / 2;
+
+ // FIXME find out why this happens
+ if (number_frames < 10) {
+ AUBIO_ERR("audio_unit: got number_frames %d", (int)number_frames);
+ return -1;
+ }
+
+ if (o->total_frames >= (signed)number_frames) {
+
+ SInt16 *data;
+ if (o->au_ios_start + number_frames > AU_IOS_MAX_FRAMES) {
+ // start reminder samples writing at reminder
+ int reminder = AU_IOS_MAX_FRAMES - o->au_ios_start;
+ int starter = (o->au_ios_start + number_frames) - AU_IOS_MAX_FRAMES;
+ for (b = 0; b < input_output->mNumberBuffers; b++) {
+ data = (SInt16 *)(input_output->mBuffers[b].mData);
+ /* copy microphone output to input buffer */
+ memcpy (o->au_ios_inbuf + o->au_ios_start * 2, data, reminder * 2 * sizeof(SInt16));
+ memcpy (o->au_ios_inbuf, data + reminder * 2, starter * 2 * sizeof(SInt16));
+ /* silence data before copying from output */
+ //memset (data, 0, input_output->mBuffers[b].mDataByteSize);
+ /* copy output buffer to speakers */
+ memcpy (data, o->au_ios_outbuf + o->au_ios_start * 2, reminder * 2 * sizeof(SInt16));
+ memcpy (data + reminder * 2, o->au_ios_outbuf, starter * 2 * sizeof(SInt16));
+ }
+ } else {
+ for (b = 0; b < input_output->mNumberBuffers; b++) {
+ data = (SInt16 *)(input_output->mBuffers[b].mData);
+ /* copy microphone samples to au_ios_inbuf */
+ memcpy(o->au_ios_inbuf + o->au_ios_start * 2, data, number_frames * 2 * sizeof(SInt16));
+ /* silence data before copying from output */
+ //memset (data, 0, input_output->mBuffers[b].mDataByteSize);
+ /* copy output buffer to speakers */
+ memcpy(data, o->au_ios_outbuf + o->au_ios_start * 2, number_frames * 2 * sizeof(SInt16));
+ }
+ }
+ o->au_ios_start += number_frames;
+ o->au_ios_start %= AU_IOS_MAX_FRAMES;
+ o->total_frames -= number_frames;
+
+#if 1
+ } else {
+ if (o->total_frames > 0) o->dio_error = 1;
+ for (b = 0; b < input_output->mNumberBuffers; b++) {
+ memset (input_output->mBuffers[b].mData, 0,
+ input_output->mBuffers[b].mDataByteSize);
+ }
+ //total_frames = 0;
+#endif
+ }
+
+ // now call callback
+ while ( o->total_frames < (signed)number_frames ) {
+ //AUBIO_DBG ("audio_unit: total_frames = %d, number_frames = %d, o->au_ios_start = %d, o->au_ios_end = %d",
+ // o->total_frames, number_frames, o->au_ios_start, o->au_ios_end);
+ aubio_audio_unit_blocking(o);
+ }
+
+ return err;
+}
+
+int aubio_audio_unit_blocking(aubio_audio_unit_t *o)
+{
+ uint_t sw_output_channels, sw_input_channels,
+ hw_output_channels, hw_input_channels,
+ i, j, blocksize;
+ if (! o->callback) return -1;
+
+ smpl_t ** tbuf;
+
+ sw_output_channels = o->sw_output_channels;
+ sw_input_channels = o->sw_input_channels;
+ hw_output_channels = o->hw_output_channels;
+ hw_input_channels = o->hw_input_channels;
+ blocksize = o->blocksize;
+
+ if (!sw_input_channels && !sw_output_channels) goto fail;
+
+ if (o->dio_error) {
+ AUBIO_WRN("audio_unit: dio error %d", o->total_frames);
+ o->dio_error = 0;
+ }
+
+ if (o->au_ios_inbuf) {
+ /* copy samples from input buffer */
+ tbuf = o->input_frames->data;
+ if (o->input_enabled) {
+ for (j = 0; j < blocksize;j++) {
+ for (i = 0; i < sw_input_channels && i < hw_input_channels; i++) {
+ //tbuf[i][j] =
+ // (smpl_t)(o->au_ios_inbuf[i + (j + o->au_ios_end) * sw_input_channels] / 32768.);
+ // on iphone, input is mono, copy right to left channel
+ tbuf[i][j] =
+ (smpl_t) o->au_ios_inbuf[0 + (j + o->au_ios_end) * hw_input_channels]
+ * INT_TO_FLOAT;
+ }
+ }
+ } else {
+ // input is disabled, fill with zeroes
+ for (j = 0; j < blocksize; j++) {
+ for (i = 0; i < sw_input_channels && i < hw_input_channels; i++) {
+ tbuf[i][j] = 0;
+ }
+ }
+ }
+ }
+
+ o->callback(o->callback_closure, o->input_frames, o->output_frames);
+
+ /* copy samples to output buffer */
+ tbuf = o->output_frames->data;
+ for (i = 0; i < o->output_frames->height; i++) {
+ for (j = 0; j < o->output_frames->length; j++) {
+ smpl_t val = tbuf[i][j];
+ if (val < -1.0) val = -1.0;
+ if (val > 1.0) val = 1.0;
+ o->au_ios_outbuf[i + (j + o->au_ios_end) * hw_output_channels ] = (SInt16)(val * 32767);
+ }
+ }
+
+ o->au_ios_end += blocksize;
+ o->au_ios_end %= AU_IOS_MAX_FRAMES;
+ o->total_frames += blocksize;
+
+ return 0;
+
+fail:
+ AUBIO_ERR("audio_unit: callback() failed");
+ o->total_frames += AU_IOS_MAX_FRAMES;
+ return 1;
+}
+
+sint_t aubio_audio_unit_get_info (aubio_audio_unit_t *o)
+{
+ UInt32 thissize, input_hw_channels, output_hw_channels, max_fps;
+ Float32 latency, input_latency, output_latency, input_hw_volume, output_hw_volume;
+ Float64 samplerate;
+ OSStatus err = 0;
+
+ // Show some info about the opened unit
+
+ /* get sampling rate */
+ thissize = sizeof(samplerate);
+ err = AudioUnitGetProperty (o->audio_unit, kAudioUnitProperty_SampleRate,
+ kAudioUnitScope_Output, 1, &samplerate, &thissize);
+ if (err) { AUBIO_ERR("audio_unit: could not get audio unit sample rate (%ld)",
+ err); goto fail; }
+
+ /* get hardware input channels */
+ thissize = sizeof(input_hw_channels);
+ err = AudioSessionGetProperty(kAudioSessionProperty_CurrentHardwareInputNumberChannels,
+ &thissize, &input_hw_channels);
+ if (err) { AUBIO_ERR("audio_unit: could not get hardware input channels (%ld)",
+ err); goto fail; }
+
+ /* get hardware output channels */
+ thissize = sizeof(output_hw_channels);
+ err = AudioSessionGetProperty(kAudioSessionProperty_CurrentHardwareOutputNumberChannels,
+ &thissize, &output_hw_channels);
+ if (err) { AUBIO_ERR("audio_unit: could not get hardware output channels (%ld)",
+ err); goto fail; }
+
+ /* get hardware input volume */
+ thissize = sizeof(input_hw_volume);
+ err = AudioSessionGetProperty(kAudioSessionProperty_InputGainScalar,
+ &thissize, &input_hw_volume);
+ if (err) { AUBIO_ERR("audio_unit: could not get hardware input volume (%ld)",
+ err); goto fail; }
+
+ /* get hardware output volume */
+ thissize = sizeof(output_hw_volume);
+ err = AudioSessionGetProperty(kAudioSessionProperty_CurrentHardwareOutputVolume,
+ &thissize, &output_hw_volume);
+ if (err) { AUBIO_ERR("audio_unit: could not get hardware output volume (%ld)",
+ err); goto fail; }
+
+ AUBIO_MSG("audio_unit: opened at %.0fHz, sw channels %din/%dout, hw channels %ldin/%ldout, hw vol %.2fin/%.2fout",
+ samplerate,
+ o->sw_input_channels, o->sw_output_channels,
+ input_hw_channels, output_hw_channels,
+ input_hw_volume, output_hw_volume);
+
+ /* get max frames per slice */
+ thissize = sizeof(max_fps);
+ err = AudioUnitGetProperty (o->audio_unit, kAudioUnitProperty_MaximumFramesPerSlice,
+ kAudioUnitScope_Global, 0, &max_fps, &thissize);
+ if (err) { AUBIO_ERR("audio_unit: could not get maximum frames per slice property %ld",
+ err); goto fail; }
+
+ /* get hardware latency */
+ thissize = sizeof(latency);
+ err = AudioSessionGetProperty(kAudioSessionProperty_CurrentHardwareIOBufferDuration,
+ &thissize, &latency);
+ if (err) { AUBIO_ERR("audio_unit: could not get hardware latency %ld",
+ err); goto fail; }
+
+ /* get input latency */
+ thissize = sizeof(input_latency);
+ err = AudioSessionGetProperty(kAudioSessionProperty_CurrentHardwareInputLatency,
+ &thissize, &input_latency);
+ if (err) { AUBIO_ERR("audio_unit: could not get input latency %ld",
+ err); goto fail; }
+
+ /* get output harlatency */
+ thissize = sizeof(output_latency);
+ err = AudioSessionGetProperty(kAudioSessionProperty_CurrentHardwareOutputLatency,
+ &thissize, &output_latency);
+ if (err) { AUBIO_ERR("audio_unit: could not get output latency %ld",
+ err); goto fail; }
+
+ AUBIO_MSG("audio_unit: I/O latency: %.2fms, %d frames, (%.2fms, %d frames in, %.2fms %d frames out)",
+ latency*1000., (sint_t)round(latency*samplerate),
+ input_latency*1000., (sint_t)ROUND(input_latency*samplerate),
+ output_latency*1000., (sint_t)ROUND(output_latency*samplerate));
+
+fail:
+ return err;
+}
+
+sint_t aubio_audio_unit_start(aubio_audio_unit_t *o) {
+ OSStatus err = 0;
+
+ if (o->verbose) {
+ // print some info about the current settings
+ aubio_audio_unit_get_info (o);
+ }
+
+ /* time to start the unit */
+ err = AudioOutputUnitStart (o->audio_unit);
+ if (err) { AUBIO_ERR("audio_unit: could not start unit (%ld)", err); }
+ return err;
+}
+
+sint_t aubio_audio_unit_stop(aubio_audio_unit_t *o)
+{
+ if (o->audio_unit == NULL) return -1;
+ OSStatus err = AudioOutputUnitStop (o->audio_unit);
+ if (err) { AUBIO_WRN("audio_unit: failed stopping audio unit (%ld)", err); }
+ err = AudioUnitUninitialize (o->audio_unit);
+ if (err) { AUBIO_WRN("audio_unit: failed unitializing audio unit (%ld)", err); }
+ err = AudioSessionSetActive(false);
+ if (err) { AUBIO_WRN("audio_unit: failed stopping audio session (%ld)", err); }
+ return err;
+}
+
+uint_t aubio_audio_unit_set_callback(aubio_audio_unit_t *o,
+ aubio_device_callback_t callback, void *closure) {
+ o->callback = callback;
+ o->callback_closure = closure;
+ return 0;
+}
+
+/* interruption listeners */
+void audio_unit_interruption_listener(void *closure, UInt32 inInterruptionState)
+{
+ OSStatus err = 0;
+ aubio_audio_unit_t *o = (aubio_audio_unit_t *) closure;
+ AudioUnit this_unit = o->audio_unit;
+
+ if (inInterruptionState == kAudioSessionEndInterruption) {
+ AUBIO_WRN("audio_unit: session interruption ended");
+ err = AudioSessionSetActive(true);
+ if (err) {
+ AUBIO_ERR("audio_unit: could not make session active after interruption (%ld)", err);
+ goto fail;
+ }
+ err = AudioOutputUnitStart(this_unit);
+ if (err) {
+ AUBIO_ERR("audio_unit: failed starting unit (%ld)", err);
+ goto fail;
+ }
+ }
+ if (inInterruptionState == kAudioSessionBeginInterruption) {
+ AUBIO_WRN("audio_unit: session interruption started");
+ err = AudioOutputUnitStop(this_unit);
+ if (err) {
+ AUBIO_ERR("audio_unit: could not stop unit at interruption (%ld)", err);
+ goto fail;
+ }
+ err = AudioSessionSetActive(false);
+ if (err) {
+ AUBIO_ERR("audio_unit: could not make session inactive after interruption (%ld)", err);
+ goto fail;
+ }
+ }
+fail:
+ return;
+}
+
+UInt32 audio_unit_get_audio_session_category () {
+ UInt32 category, thissize;
+ thissize = sizeof(category);
+ OSStatus err = AudioSessionGetProperty(kAudioSessionProperty_AudioCategory,
+ &thissize, &category);
+ if (err) {
+ AUBIO_ERR("audio_unit: could not get audio category (%ld)", err);
+ return err;
+ }
+ if (category == kAudioSessionCategory_AmbientSound) {
+ AUBIO_MSG("audio_unit: session category is AmbiantSound");
+ } else if (category == kAudioSessionCategory_SoloAmbientSound) {
+ AUBIO_MSG("audio_unit: session category is SoloAmbiantSound");
+ } else if (category == kAudioSessionCategory_MediaPlayback) {
+ AUBIO_MSG("audio_unit: session category is MediaPlayback");
+ } else if (category == kAudioSessionCategory_RecordAudio) {
+ AUBIO_MSG("audio_unit: session category is RecordAudio");
+ } else if (category == kAudioSessionCategory_PlayAndRecord) {
+ AUBIO_MSG("audio_unit: session category is PlayAndRecord");
+ } else if (category == kAudioSessionCategory_AudioProcessing) {
+ AUBIO_MSG("audio_unit: session category is AudioProcessing");
+ }
+ return category;
+}
+
+OSStatus audio_unit_set_audio_session_category(bool has_input, bool verbose)
+{
+ //if we have input, set the session category accordingly
+ OSStatus err = 0;
+ UInt32 category;
+ if (has_input) {
+ category = kAudioSessionCategory_PlayAndRecord;
+ if (verbose) AUBIO_MSG("audio_unit: setting category to PlayAndRecord");
+ } else {
+ category = kAudioSessionCategory_MediaPlayback;
+ if (verbose) AUBIO_MSG("audio_unit: setting category to MediaPlayback");
+ }
+ err = AudioSessionSetProperty(kAudioSessionProperty_AudioCategory,
+ sizeof(category), &category);
+ if (err) {
+ AUBIO_ERR("audio_unit: could not set audio category");
+ }
+
+ // Audiob.us style
+ UInt32 allowMixing = 1;
+ AudioSessionSetProperty(kAudioSessionProperty_OverrideCategoryMixWithOthers,
+ sizeof (allowMixing), &allowMixing);
+ if (err) {
+ AUBIO_ERR("audio_unit: could not set audio session to mix with others");
+ }
+
+ return err;
+}
+
+void audio_unit_check_audio_route(aubio_audio_unit_t *o) {
+ CFStringRef currentRoute;
+ UInt32 val, thissize = sizeof(currentRoute);
+ OSStatus err = AudioSessionGetProperty(kAudioSessionProperty_AudioRoute, &thissize, ¤tRoute);
+ if (err) { AUBIO_ERR("audio_unit: could not get current route"); goto fail; }
+ else {
+ char *route = (char *)CFStringGetCStringPtr ( currentRoute, kCFStringEncodingUTF8);
+ if (route == NULL) {
+ int bufferSize = 25;
+ route = calloc(bufferSize, sizeof(char));
+ CFStringGetCString ( currentRoute, route, bufferSize,
+ kCFStringEncodingUTF8);
+ }
+ if (o->verbose) {
+ AUBIO_MSG ("audio_unit: current route is %s", route);
+ }
+ free(route);
+ }
+ if( currentRoute ) {
+ if( CFStringCompare( currentRoute, CFSTR("Headset"), 0 ) == kCFCompareEqualTo ) {
+ val = kAudioSessionOverrideAudioRoute_None;
+ } else if( CFStringCompare( currentRoute, CFSTR("Receiver" ), 0 ) == kCFCompareEqualTo ) {
+ val = kAudioSessionOverrideAudioRoute_Speaker;
+ } else if( CFStringCompare( currentRoute, CFSTR("ReceiverAndMicrophone" ), 0 ) == kCFCompareEqualTo ) {
+ val = kAudioSessionOverrideAudioRoute_Speaker;
+ } else if( CFStringCompare( currentRoute, CFSTR("SpeakerAndMicrophone" ), 0 ) == kCFCompareEqualTo ) {
+ val = kAudioSessionOverrideAudioRoute_Speaker;
+ } else if( CFStringCompare( currentRoute, CFSTR("HeadphonesAndMicrophone" ), 0 ) == kCFCompareEqualTo ) {
+ val = kAudioSessionOverrideAudioRoute_None;
+ } else if( CFStringCompare( currentRoute, CFSTR("HeadsetInOut" ), 0 ) == kCFCompareEqualTo ) {
+ val = kAudioSessionOverrideAudioRoute_None;
+ } else {
+ val = kAudioSessionOverrideAudioRoute_None;
+ }
+
+ o->input_enabled = true;
+ if (val == kAudioSessionOverrideAudioRoute_Speaker) {
+ if (o->prevent_feedback) {
+ o->input_enabled = false;
+ if (o->verbose) {
+ AUBIO_MSG ("audio_unit: disabling input to avoid feedback");
+ }
+ } else {
+ AUBIO_WRN ("audio_unit: input not disabled as prevent_feedback set to 0, risking feedback");
+ }
+ }
+
+ err = AudioSessionSetProperty(kAudioSessionProperty_OverrideAudioRoute,
+ sizeof(UInt32), &val);
+ if (err) { AUBIO_ERR("audio_unit: could not set session OverrideAudioRoute to Speaker"); }
+
+ }
+
+fail:
+ if ( currentRoute ) free((void*)currentRoute);
+ return;
+
+}
+
+SInt32
+audio_unit_get_route_change_reason(CFDictionaryRef routeChangeDic) {
+ CFNumberRef routeChangeReasonRef = (CFNumberRef)CFDictionaryGetValue(routeChangeDic,
+ CFSTR(kAudioSession_AudioRouteChangeKey_Reason));
+ SInt32 change_reason_number;
+ CFNumberGetValue ( routeChangeReasonRef, kCFNumberSInt32Type, &change_reason_number);
+ switch (change_reason_number) {
+ case kAudioSessionRouteChangeReason_NewDeviceAvailable:
+ AUBIO_MSG("audio_unit: route changed to NewDeviceAvailable");
+ break;
+ case kAudioSessionRouteChangeReason_OldDeviceUnavailable:
+ AUBIO_MSG("audio_unit: route changed to OldDeviceUnavailable");
+ break;
+ case kAudioSessionRouteChangeReason_CategoryChange:
+ AUBIO_MSG("audio_unit: route changed to CategoryChange");
+ audio_unit_get_audio_session_category();
+ break;
+ case kAudioSessionRouteChangeReason_Override:
+ AUBIO_MSG("audio_unit: route changed to Override");
+ break;
+ case kAudioSessionRouteChangeReason_WakeFromSleep:
+ AUBIO_MSG("audio_unit: route changed to WakeFromSleep");
+ break;
+ case kAudioSessionRouteChangeReason_NoSuitableRouteForCategory:
+ AUBIO_MSG("audio_unit: route changed to NoSuitableRouteForCategory");
+ break;
+ case kAudioSessionRouteChangeReason_Unknown:
+ default:
+ AUBIO_ERR("audio_unit: route changed for an unknown reason!?");
+ break;
+ }
+ return change_reason_number;
+}
+
+/* route change listeners */
+void
+audio_unit_route_change_listener(void *closure, AudioSessionPropertyID inID,
+ UInt32 dataSize, const void *inData)
+{
+
+ UNUSED aubio_audio_unit_t *o = (aubio_audio_unit_t *)closure;
+ UNUSED UInt32 size = dataSize;
+ if (inID == kAudioSessionProperty_AudioRouteChange) {
+
+ // OSStatus err = 0;
+ //AudioUnit audio_unit = o->audio_unit;
+
+ if (o->verbose) {
+ // show route change reason
+ audio_unit_get_route_change_reason((CFDictionaryRef)inData);
+ }
+
+ // check current audio route, changing it to prevent feedback as needed
+ audio_unit_check_audio_route(o);
+
+ if (o->verbose) {
+ // print some info about the current settings
+ aubio_audio_unit_get_info(o);
+ }
+
+ }
+
+}
+
+/* delete object */
+uint_t del_aubio_audio_unit(aubio_audio_unit_t *o)
+{
+ int err = 0;
+ err = aubio_audio_unit_stop(o);
+ if (o->au_ios_inbuf) free(o->au_ios_inbuf);
+ o->au_ios_inbuf = NULL;
+ if (o->au_ios_outbuf) free(o->au_ios_outbuf);
+ o->au_ios_outbuf = NULL;
+ del_fmat (o->input_frames);
+ del_fmat (o->output_frames);
+ o->audio_unit = NULL;
+ return (int)err;
+}
+
+#endif /* TARGET_OS_IPHONE */
--- /dev/null
+/*
+ Copyright (C) 2013 Paul Brossier <piem@aubio.org>
+
+ This file is part of aubio.
+
+ aubio is free software: you can redistribute it and/or modify
+ it under the terms of the GNU General Public License as published by
+ the Free Software Foundation, either version 3 of the License, or
+ (at your option) any later version.
+
+ aubio is distributed in the hope that it will be useful,
+ but WITHOUT ANY WARRANTY; without even the implied warranty of
+ MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
+ GNU General Public License for more details.
+
+ You should have received a copy of the GNU General Public License
+ along with aubio. If not, see <http://www.gnu.org/licenses/>.
+
+*/
+
+#ifndef _AUBIO_AUDIO_UNIT_H
+#define _AUBIO_AUDIO_UNIT_H
+
+/** \file
+
+*/
+
+#ifdef __cplusplus
+extern "C" {
+#endif
+
+typedef struct _aubio_audio_unit_t aubio_audio_unit_t;
+
+aubio_audio_unit_t * new_aubio_audio_unit(uint_t samplerate, uint_t inchannels,
+ uint_t outchannels, uint_t blocksize);
+
+typedef uint_t (*aubio_device_callback_t) (void * closure, fmat_t *ibuf, fmat_t *obuf);
+
+uint_t aubio_audio_unit_set_callback(aubio_audio_unit_t *o,
+ aubio_device_callback_t callback, void *closure);
+
+sint_t aubio_audio_unit_set_verbose (aubio_audio_unit_t *o, uint_t verbose);
+sint_t aubio_audio_unit_set_preferred_latency (aubio_audio_unit_t *o, smpl_t
+ latency);
+sint_t aubio_audio_unit_set_prevent_feedback (aubio_audio_unit_t *o, uint_t
+ prevent_feedback);
+
+sint_t aubio_audio_unit_get_info (aubio_audio_unit_t *o);
+
+sint_t aubio_audio_unit_init (aubio_audio_unit_t *o);
+
+sint_t aubio_audio_unit_start (aubio_audio_unit_t *o);
+sint_t aubio_audio_unit_stop (aubio_audio_unit_t *o);
+
+uint_t del_aubio_audio_unit(aubio_audio_unit_t *o);
+
+#ifdef __cplusplus
+}
+#endif
+
+#endif /* _AUBIO_AUDIO_UNIT_H */
// some temporary memory for sndfile to write at
uint_t scratch_size;
- smpl_t *scratch_data;
+ float *scratch_data;
};
aubio_source_sndfile_t * new_aubio_source_sndfile(char_t * path, uint_t samplerate, uint_t hop_size) {
data = read_data->data;
}
- /* de-interleaving data */
- for (j = 0; j < read_samples / input_channels; j++) {
- for (i = 0; i < input_channels; i++) {
- data[i][j] = (smpl_t)s->scratch_data[input_channels*j+i];
+ if (read_data->height < input_channels) {
+ // destination matrix has less channels than the file; copy only first
+ // channels of the file, de-interleaving data
+ for (j = 0; j < read_samples / input_channels; j++) {
+ for (i = 0; i < read_data->height; i++) {
+ data[i][j] = (smpl_t)s->scratch_data[j * input_channels + i];
+ }
+ }
+ } else {
+ // destination matrix has as many or more channels than the file; copy each
+ // channel from the file to the destination matrix, de-interleaving data
+ for (j = 0; j < read_samples / input_channels; j++) {
+ for (i = 0; i < input_channels; i++) {
+ data[i][j] = (smpl_t)s->scratch_data[j * input_channels + i];
+ }
}
}
- // if read_data has more channels than the file
+
if (read_data->height > input_channels) {
- // copy last channel to all additional channels
+ // destination matrix has more channels than the file; copy last channel
+ // of the file to each additional channels, de-interleaving data
for (j = 0; j < read_samples / input_channels; j++) {
for (i = input_channels; i < read_data->height; i++) {
- data[i][j] = s->scratch_data[ j * input_channels + (input_channels - 1)];
+ data[i][j] = (smpl_t)s->scratch_data[j * input_channels + (input_channels - 1)];
}
}
}
#include "musicutils.h"
#include "config.h"
+#ifdef HAVE_ACCELERATE
+#include <Accelerate/Accelerate.h>
+#endif
/** Window types */
typedef enum
smpl_t
fvec_max (fvec_t * s)
{
+#ifndef HAVE_ACCELERATE
uint_t j;
smpl_t tmp = 0.0;
for (j = 0; j < s->length; j++) {
tmp = (tmp > s->data[j]) ? tmp : s->data[j];
}
+#else
+ smpl_t tmp = 0.;
+#if !HAVE_AUBIO_DOUBLE
+ vDSP_maxv(s->data, 1, &tmp, s->length);
+#else
+ vDSP_maxvD(s->data, 1, &tmp, s->length);
+#endif
+#endif
return tmp;
}
smpl_t
fvec_min (fvec_t * s)
{
+#ifndef HAVE_ACCELERATE
uint_t j;
smpl_t tmp = s->data[0];
for (j = 0; j < s->length; j++) {
tmp = (tmp < s->data[j]) ? tmp : s->data[j];
}
+#else
+ smpl_t tmp = 0.;
+#if !HAVE_AUBIO_DOUBLE
+ vDSP_minv(s->data, 1, &tmp, s->length);
+#else
+ vDSP_minvD(s->data, 1, &tmp, s->length);
+#endif
+#endif
return tmp;
}
uint_t
fvec_min_elem (fvec_t * s)
{
+#ifndef HAVE_ACCELERATE
uint_t j, pos = 0.;
smpl_t tmp = s->data[0];
for (j = 0; j < s->length; j++) {
pos = (tmp < s->data[j]) ? pos : j;
tmp = (tmp < s->data[j]) ? tmp : s->data[j];
}
+#else
+ smpl_t tmp = 0.;
+ uint_t pos = 0.;
+#if !HAVE_AUBIO_DOUBLE
+ vDSP_minvi(s->data, 1, &tmp, (vDSP_Length *)&pos, s->length);
+#else
+ vDSP_minviD(s->data, 1, &tmp, (vDSP_Length *)&pos, s->length);
+#endif
+#endif
return pos;
}
uint_t
fvec_max_elem (fvec_t * s)
{
+#ifndef HAVE_ACCELERATE
uint_t j, pos = 0;
smpl_t tmp = 0.0;
for (j = 0; j < s->length; j++) {
pos = (tmp > s->data[j]) ? pos : j;
tmp = (tmp > s->data[j]) ? tmp : s->data[j];
}
+#else
+ smpl_t tmp = 0.;
+ uint_t pos = 0.;
+#if !HAVE_AUBIO_DOUBLE
+ vDSP_maxvi(s->data, 1, &tmp, (vDSP_Length *)&pos, s->length);
+#else
+ vDSP_maxviD(s->data, 1, &tmp, (vDSP_Length *)&pos, s->length);
+#endif
+#endif
return pos;
}
}
}
-smpl_t fvec_quadint (fvec_t * x, uint_t pos) {
- smpl_t s0, s1, s2;
- uint_t x0 = (pos < 1) ? pos : pos - 1;
- uint_t x2 = (pos + 1 < x->length) ? pos + 1 : pos;
- if (x0 == pos) return (x->data[pos] <= x->data[x2]) ? pos : x2;
- if (x2 == pos) return (x->data[pos] <= x->data[x0]) ? pos : x0;
- s0 = x->data[x0];
- s1 = x->data[pos];
- s2 = x->data[x2];
- return pos + 0.5 * (s2 - s0 ) / (s2 - 2.* s1 + s0);
-}
-
smpl_t fvec_quadratic_peak_pos (fvec_t * x, uint_t pos) {
smpl_t s0, s1, s2;
+ if (pos == 0 || pos == x->length - 1) return pos;
uint_t x0 = (pos < 1) ? pos : pos - 1;
uint_t x2 = (pos + 1 < x->length) ? pos + 1 : pos;
if (x0 == pos) return (x->data[pos] <= x->data[x2]) ? pos : x2;
*/
smpl_t fvec_median (fvec_t * v);
-/** finds exact peak index by quadratic interpolation*/
-smpl_t fvec_quadint (fvec_t * x, uint_t pos);
-
/** finds exact peak index by quadratic interpolation
See [Quadratic Interpolation of Spectral
smpl_t aubio_onset_get_last_ms (aubio_onset_t *o)
{
- return aubio_onset_get_last_s (o) / 1000.;
+ return aubio_onset_get_last_s (o) * 1000.;
}
uint_t aubio_onset_set_silence(aubio_onset_t * o, smpl_t silence) {
onset_peek->data[2] = thresholded->data[0];
out->data[0] = (p->pickerfn) (onset_peek, 1);
if (out->data[0]) {
- out->data[0] = fvec_quadint (onset_peek, 1);
+ out->data[0] = fvec_quadratic_peak_pos (onset_peek, 1);
}
}
p->sqrmag = new_fvec (bufsize);
p->acf = new_fvec (bufsize / 2 + 1);
p->tol = 1.;
+ p->confidence = 0.;
return p;
}
smpl_t
aubio_pitchspecacf_get_confidence (aubio_pitchspecacf_t * o) {
- return 0;
+ // no confidence for now
+ return o->confidence;
}
uint_t
#else
#ifdef HAVE_ACCELERATE // using ACCELERATE
int log2fftsize;
+#if !HAVE_AUBIO_DOUBLE
FFTSetup fftSetup;
DSPSplitComplex spec;
float *in, *out;
+#else
+ FFTSetupD fftSetup;
+ DSPDoubleSplitComplex spec;
+ double *in, *out;
+#endif
#else // using OOURA
double *in, *out;
double *w;
s->fft_size = winsize;
s->compspec = new_fvec(winsize);
s->log2fftsize = (uint_t)log2f(s->fft_size);
+#if !HAVE_AUBIO_DOUBLE
s->in = AUBIO_ARRAY(float, s->fft_size);
s->out = AUBIO_ARRAY(float, s->fft_size);
s->spec.realp = AUBIO_ARRAY(float, s->fft_size/2);
s->spec.imagp = AUBIO_ARRAY(float, s->fft_size/2);
s->fftSetup = vDSP_create_fftsetup(s->log2fftsize, FFT_RADIX2);
+#else
+ s->in = AUBIO_ARRAY(double, s->fft_size);
+ s->out = AUBIO_ARRAY(double, s->fft_size);
+ s->spec.realp = AUBIO_ARRAY(double, s->fft_size/2);
+ s->spec.imagp = AUBIO_ARRAY(double, s->fft_size/2);
+ s->fftSetup = vDSP_create_fftsetupD(s->log2fftsize, FFT_RADIX2);
+#endif
#else // using OOURA
s->winsize = winsize;
s->fft_size = winsize / 2 + 1;
#endif /* HAVE_COMPLEX_H */
#else /* HAVE_FFTW3 */
#ifdef HAVE_ACCELERATE // using ACCELERATE
+#if !HAVE_AUBIO_DOUBLE
// convert real data to even/odd format used in vDSP
- vDSP_ctoz((COMPLEX*)s->in, 2, &s->spec, 1, s->fft_size/2);
+ vDSP_ctoz((DSPComplex*)s->in, 2, &s->spec, 1, s->fft_size/2);
// compute the FFT
vDSP_fft_zrip(s->fftSetup, &s->spec, 1, s->log2fftsize, FFT_FORWARD);
+#else
+ // convert real data to even/odd format used in vDSP
+ vDSP_ctozD((DSPDoubleComplex*)s->in, 2, &s->spec, 1, s->fft_size/2);
+ // compute the FFT
+ vDSP_fft_zripD(s->fftSetup, &s->spec, 1, s->log2fftsize, FFT_FORWARD);
+#endif
// convert from vDSP complex split to [ r0, r1, ..., rN, iN-1, .., i2, i1]
compspec->data[0] = s->spec.realp[0];
compspec->data[s->fft_size / 2] = s->spec.imagp[0];
}
// apply scaling
smpl_t scale = 1./2.;
+#if !HAVE_AUBIO_DOUBLE
vDSP_vsmul(compspec->data, 1, &scale, compspec->data, 1, s->fft_size);
+#else
+ vDSP_vsmulD(compspec->data, 1, &scale, compspec->data, 1, s->fft_size);
+#endif
#else // using OOURA
rdft(s->winsize, 1, s->in, s->ip, s->w);
compspec->data[0] = s->in[0];
s->out[2 * i] = compspec->data[i];
s->out[2 * i + 1] = compspec->data[s->winsize - i];
}
+#if !HAVE_AUBIO_DOUBLE
// convert to split complex format used in vDSP
- vDSP_ctoz((COMPLEX*)s->out, 2, &s->spec, 1, s->fft_size/2);
+ vDSP_ctoz((DSPComplex*)s->out, 2, &s->spec, 1, s->fft_size/2);
// compute the FFT
vDSP_fft_zrip(s->fftSetup, &s->spec, 1, s->log2fftsize, FFT_INVERSE);
// convert result to real output
- vDSP_ztoc(&s->spec, 1, (COMPLEX*)output->data, 2, s->fft_size/2);
+ vDSP_ztoc(&s->spec, 1, (DSPComplex*)output->data, 2, s->fft_size/2);
// apply scaling
smpl_t scale = 1.0 / s->winsize;
vDSP_vsmul(output->data, 1, &scale, output->data, 1, s->fft_size);
+#else
+ // convert to split complex format used in vDSP
+ vDSP_ctozD((DSPDoubleComplex*)s->out, 2, &s->spec, 1, s->fft_size/2);
+ // compute the FFT
+ vDSP_fft_zripD(s->fftSetup, &s->spec, 1, s->log2fftsize, FFT_INVERSE);
+ // convert result to real output
+ vDSP_ztocD(&s->spec, 1, (DSPDoubleComplex*)output->data, 2, s->fft_size/2);
+ // apply scaling
+ smpl_t scale = 1.0 / s->winsize;
+ vDSP_vsmulD(output->data, 1, &scale, output->data, 1, s->fft_size);
+#endif
#else // using OOURA
smpl_t scale = 2.0 / s->winsize;
s->out[0] = compspec->data[0];
/** destroy filterbank object
- \param fb filterbank, as returned by new_aubio_filterbank() method
+ \param f filterbank object, as returned by new_aubio_filterbank()
*/
-void del_aubio_filterbank (aubio_filterbank_t * fb);
+void del_aubio_filterbank (aubio_filterbank_t * f);
/** compute filterbank
- \param fb filterbank containing nfilt x win_s filter coefficients
- \param in input spectrum containing chans x win_s spectrum
- \param out output vector containing chans x nfilt output values
+ \param f filterbank object, as returned by new_aubio_filterbank()
+ \param in input spectrum containing an input spectrum of length `win_s`
+ \param out output vector containing the energy found in each band, `nfilt` output values
*/
-void aubio_filterbank_do (aubio_filterbank_t * fb, cvec_t * in, fvec_t * out);
+void aubio_filterbank_do (aubio_filterbank_t * f, cvec_t * in, fvec_t * out);
-/** return a pointer to the matrix object containing all filter coefficients
+/** return a pointer to the matrix object containing all filter coefficients
- \param f filterbank object to get coefficients from
+ \param f filterbank object, as returned by new_aubio_filterbank()
*/
fmat_t *aubio_filterbank_get_coeffs (aubio_filterbank_t * f);
/** copy filter coefficients to the filterbank
- \param f filterbank object to set coefficients
+ \param f filterbank object, as returned by new_aubio_filterbank()
\param filters filter bank coefficients to copy from
*/
/* find non-zero Rayleigh period */
maxindex = fvec_max_elem (bt->acfout);
- bt->rp = maxindex ? fvec_quadint (bt->acfout, maxindex) : 1;
+ bt->rp = maxindex ? fvec_quadratic_peak_pos (bt->acfout, maxindex) : 1;
//rp = (maxindex==127) ? 43 : maxindex; //rayparam
bt->rp = (maxindex == bt->acfout->length - 1) ? bt->rayparam : maxindex; //rayparam
bp = bt->bp;
/* end of biased filterbank */
+ if (bp == 0) {
+ output->data[0] = 0;
+ return;
+ }
/* deliberate integer operation, could be set to 3 max eventually */
kmax = FLOOR (winlen / bp);
#endif /* AUBIO_BEAT_WARNINGS */
phase = step - bt->lastbeat;
} else {
- phase = fvec_quadint (bt->phout, maxindex);
+ phase = fvec_quadratic_peak_pos (bt->phout, maxindex);
}
/* take back one frame delay */
phase += 1.;
}
}
fvec_weight (acfout, bt->gwv);
- gp = fvec_quadint (acfout, fvec_max_elem (acfout));
+ gp = fvec_quadratic_peak_pos (acfout, fvec_max_elem (acfout));
/*
while(gp<32) gp =gp*2;
while(gp>64) gp = gp/2;
/* do some further checks on the final bp value */
/* if tempo is > 206 bpm, half it */
- while (bp < 25) {
+ while (0 < bp && bp < 25) {
#if AUBIO_BEAT_WARNINGS
AUBIO_WRN ("doubling from %f (%f bpm) to %f (%f bpm)\n",
bp, 60.*44100./512./bp, bp/2., 60.*44100./512./bp/2. );
smpl_t
aubio_beattracking_get_bpm (aubio_beattracking_t * bt)
{
- if (bt->timesig != 0 && bt->counter == 0 && bt->flagstep == 0) {
- return 5168. / fvec_quadint (bt->acfout, bt->bp);
+ if (bt->bp != 0 && bt->timesig != 0 && bt->counter == 0 && bt->flagstep == 0) {
+ return 5168. / fvec_quadratic_peak_pos (bt->acfout, bt->bp);
} else {
return 0.;
}
smpl_t aubio_tempo_get_last_ms (aubio_tempo_t *o)
{
- return aubio_tempo_get_last_s (o) / 1000.;
+ return aubio_tempo_get_last_s (o) * 1000.;
}
uint_t aubio_tempo_set_delay(aubio_tempo_t * o, uint_t delay) {
# build libaubio
from waflib import Options
-if Options.platform == 'ios': build_lib_func = ctx.stlib
-else: build_lib_func = ctx.shlib
+if Options.platform in ['ios', 'iosimulator']:
+ build_lib_func = ctx.stlib
+else:
+ build_lib_func = ctx.shlib
+
build_lib_func(
includes = ['.'],
source = source,
target = 'aubio',
lib = 'm',
uselib = uselib,
+ install_path = '${PREFIX}/lib',
vnum = ctx.env['LIB_VERSION'])
# install headers, except _priv.h ones
ctx.install_files('${PREFIX}/include/aubio/',
-
ctx.path.ant_glob('**/*.h', excl = ['**_priv.h', 'config.h']),
relative_trick=True)
PRINT_MSG(" %s file.aif 32000\n", argv[0]);
PRINT_MSG(" - read file.wav at original samplerate with 4096 blocks\n");
PRINT_MSG(" %s file.wav 0 4096 \n", argv[0]);
+ PRINT_MSG(" - read file.wav at original samplerate with 256 frames blocks, mono\n");
+ PRINT_MSG(" %s file.wav 0 4096 1\n", argv[0]);
return err;
}
uint_t samplerate = 0;
uint_t hop_size = 256;
uint_t n_frames = 0, read = 0;
- if ( argc == 3 ) samplerate = atoi(argv[2]);
- if ( argc == 4 ) hop_size = atoi(argv[3]);
+ uint_t n_channels = 0;
+ if ( argc >= 3 ) samplerate = atoi(argv[2]);
+ if ( argc >= 4 ) hop_size = atoi(argv[3]);
+ if ( argc >= 5 ) n_channels = atoi(argv[4]);
char_t *source_path = argv[1];
aubio_source_t* s = new_aubio_source(source_path, samplerate, hop_size);
if (!s) { err = -1; goto beach; }
- if (samplerate == 0 ) samplerate = aubio_source_get_samplerate(s);
+ if ( samplerate == 0 ) samplerate = aubio_source_get_samplerate(s);
- fmat_t *mat = new_fmat(hop_size, aubio_source_get_channels(s) );
+ if ( n_channels == 0 ) n_channels = aubio_source_get_channels(s);
+
+ fmat_t *mat = new_fmat(hop_size, n_channels);
do {
aubio_source_do_multi (s, mat, &read);
n_frames += read;
} while ( read == hop_size );
- PRINT_MSG("read %d frames at %dHz (%d blocks) from %s\n", n_frames, samplerate,
- n_frames / hop_size, source_path);
+ PRINT_MSG("read %d frames in %d channels at %dHz (%d blocks) from %s\n",
+ n_frames, n_channels, samplerate, n_frames / hop_size, source_path);
del_fmat (mat);
del_aubio_source (s);
uint_t samplerate = 0;
uint_t hop_size = 256;
uint_t n_frames = 0, read = 0;
- uint_t old_n_frames;
+ uint_t old_n_frames_1, old_n_frames_2, old_n_frames_3;
if ( argc == 3 ) samplerate = atoi(argv[2]);
if ( argc == 4 ) hop_size = atoi(argv[3]);
n_frames += read;
} while ( read == hop_size );
- PRINT_MSG("read %d frames at %dHz (%d blocks) from %s\n", n_frames, samplerate,
- n_frames / hop_size, source_path);
+ PRINT_MSG("read %.2fs, %d frames at %dHz (%d blocks) from %s\n",
+ n_frames * 1. / samplerate,
+ n_frames, samplerate,
+ n_frames / hop_size, source_path);
+
+ old_n_frames_1 = n_frames;
aubio_source_seek (s, 0);
- old_n_frames = n_frames;
+ n_frames = 0;
+ do {
+ aubio_source_do(s, vec, &read);
+ //fvec_print (vec);
+ n_frames += read;
+ } while ( read == hop_size );
+
+ PRINT_MSG("read %.2fs, %d frames at %dHz (%d blocks) from %s\n",
+ n_frames * 1. / samplerate,
+ n_frames, samplerate,
+ n_frames / hop_size, source_path);
+
+ old_n_frames_2 = n_frames;
+
+ aubio_source_seek (s, n_frames / 2);
n_frames = 0;
do {
n_frames += read;
} while ( read == hop_size );
- PRINT_MSG("read %d frames at %dHz (%d blocks) from %s\n", n_frames, samplerate,
- n_frames / hop_size, source_path);
+ PRINT_MSG("read %.2fs, %d frames at %dHz (%d blocks) from %s\n",
+ n_frames * 1. / samplerate,
+ n_frames, samplerate,
+ n_frames / hop_size, source_path);
+
+ old_n_frames_3 = n_frames;
del_aubio_source (s);
beach:
del_fvec (vec);
- assert ( n_frames == old_n_frames );
+ assert ( old_n_frames_2 == old_n_frames_1 );
+ assert ( old_n_frames_3 == (uint_t)floor(old_n_frames_1 / 2. + .5) );
return err;
}
#include <aubio.h>
+#include "utils_tests.h"
-int main ()
+int main (int argc, char **argv)
{
- // 1. allocate some memory
- uint_t n = 0; // frame counter
+ uint_t err = 0;
+ if (argc < 2) {
+ err = 2;
+ PRINT_ERR("not enough arguments\n");
+ PRINT_MSG("read a wave file as a mono vector\n");
+ PRINT_MSG("usage: %s <source_path> [samplerate] [hop_size]\n", argv[0]);
+ return err;
+ }
+ uint_t samplerate = 0;
uint_t win_s = 1024; // window size
- uint_t hop_s = win_s / 4; // hop size
- uint_t samplerate = 44100; // samplerate
+ uint_t hop_size = win_s / 4;
+ uint_t n_frames = 0, read = 0;
+ if ( argc == 3 ) samplerate = atoi(argv[2]);
+ if ( argc == 4 ) hop_size = atoi(argv[3]);
+
+ char_t *source_path = argv[1];
+ aubio_source_t * source = new_aubio_source(source_path, samplerate, hop_size);
+ if (!source) { err = 1; goto beach; }
+
+ if (samplerate == 0 ) samplerate = aubio_source_get_samplerate(source);
+
// create some vectors
- fvec_t * input = new_fvec (win_s/4); // input buffer
- fvec_t * out = new_fvec (2); // input buffer
+ fvec_t * in = new_fvec (hop_size); // input audio buffer
+ fvec_t * out = new_fvec (2); // output position
+
// create onset object
- aubio_onset_t * onset = new_aubio_onset("complex", win_s, hop_s, samplerate);
-
- // 2. do something with it
- while (n < 10) {
- // get `hop_s` new samples into `input`
- // ...
- // exectute onset detection
- aubio_onset_do (onset, input, out);
- // do something with output candidates
- // ...
- n++;
- };
-
- // 3. clean up memory
- del_aubio_onset(onset);
- del_fvec(input);
+ aubio_onset_t * o = new_aubio_onset("default", win_s, hop_size, samplerate);
+
+ do {
+ // put some fresh data in input vector
+ aubio_source_do(source, in, &read);
+ // execute onset
+ aubio_onset_do(o,in,out);
+ // do something with the onsets
+ if (out->data[0] != 0) {
+ PRINT_MSG("onset at %.3fms, %.3fs, frame %d\n",
+ aubio_onset_get_last_ms(o), aubio_onset_get_last_s(o),
+ aubio_onset_get_last(o));
+ }
+ n_frames += read;
+ } while ( read == hop_size );
+
+ PRINT_MSG("read %.2fs, %d frames at %dHz (%d blocks) from %s\n",
+ n_frames * 1. / samplerate,
+ n_frames, samplerate,
+ n_frames / hop_size, source_path);
+
+ // clean up memory
+ del_aubio_onset(o);
+ del_fvec(in);
del_fvec(out);
+beach:
aubio_cleanup();
- return 0;
+ return err;
}
cvec_t *in_spec = new_cvec (win_s); // input vector of samples
fvec_t *out_filters = new_fvec (n_filters); // per-band outputs
- fmat_t *coeffs; // pointer to the coefficients
// create filterbank object
aubio_filterbank_t *o = new_aubio_filterbank (n_filters, win_s);
- coeffs = aubio_filterbank_get_coeffs (o);
+ // apply filterbank ten times
+ uint_t n = 10;
+ while (n) {
+ aubio_filterbank_do (o, in_spec, out_filters);
+ n--;
+ }
- aubio_filterbank_do (o, in_spec, out_filters);
+ // print out filterbank coeffs
+ fmat_t *coeffs; // pointer to the coefficients
+ coeffs = aubio_filterbank_get_coeffs (o);
+ fmat_print (coeffs);
- // fmat_print (coeffs);
- // cvec_print(in_spec);
- // fvec_print(out_filters);
+ //fvec_print (out_filters);
+ // clean up
del_aubio_filterbank (o);
del_cvec (in_spec);
del_fvec (out_filters);
cvec_t *in_spec = new_cvec (win_s); // input vector of samples
fvec_t *out_filters = new_fvec (n_filters); // per-band outputs
- fmat_t *coeffs; // pointer to the coefficients
// create filterbank object
aubio_filterbank_t *o = new_aubio_filterbank (n_filters, win_s);
// assign Mel-frequency coefficients
aubio_filterbank_set_mel_coeffs_slaney (o, samplerate);
- coeffs = aubio_filterbank_get_coeffs (o);
+ // apply filterbank ten times
+ uint_t n = 10;
+ while (n) {
+ aubio_filterbank_do (o, in_spec, out_filters);
+ n--;
+ }
- aubio_filterbank_do (o, in_spec, out_filters);
+ // print out filter coefficients
+ fmat_t *coeffs; // pointer to the coefficients
+ coeffs = aubio_filterbank_get_coeffs (o);
+ fmat_print (coeffs);
- // fmat_print (coeffs);
- // cvec_print(in_spec);
- // fvec_print(out_filters);
+ //fvec_print (out_filters);
del_aubio_filterbank (o);
del_cvec (in_spec);
#include <aubio.h>
+#include "utils_tests.h"
-int main ()
+int main (int argc, char **argv)
{
- uint_t i = 0;
+ uint_t err = 0;
+ if (argc < 2) {
+ err = 2;
+ PRINT_ERR("not enough arguments\n");
+ PRINT_MSG("read a wave file as a mono vector\n");
+ PRINT_MSG("usage: %s <source_path> [samplerate] [hop_size]\n", argv[0]);
+ return err;
+ }
+ uint_t samplerate = 0;
uint_t win_s = 1024; // window size
- fvec_t * in = new_fvec (win_s); // input vector
- fvec_t * out = new_fvec (2); // output beat position
+ uint_t hop_size = win_s / 4;
+ uint_t n_frames = 0, read = 0;
+ if ( argc == 3 ) samplerate = atoi(argv[2]);
+ if ( argc == 4 ) hop_size = atoi(argv[3]);
- // create tempo object
- aubio_tempo_t * o = new_aubio_tempo("complex", win_s, win_s/4, 44100.);
+ char_t *source_path = argv[1];
+ aubio_source_t * source = new_aubio_source(source_path, samplerate, hop_size);
+ if (!source) { err = 1; goto beach; }
- smpl_t bpm, confidence;
+ if (samplerate == 0 ) samplerate = aubio_source_get_samplerate(source);
- while (i < 1000) {
- // put some fresh data in input vector
- // ...
+ // create some vectors
+ fvec_t * in = new_fvec (hop_size); // input audio buffer
+ fvec_t * out = new_fvec (2); // output position
+
+ // create tempo object
+ aubio_tempo_t * o = new_aubio_tempo("default", win_s, hop_size, samplerate);
+ do {
+ // put some fresh data in input vector
+ aubio_source_do(source, in, &read);
// execute tempo
aubio_tempo_do(o,in,out);
// do something with the beats
- // ...
-
- // get bpm and confidence
- bpm = aubio_tempo_get_bpm(o);
- confidence = aubio_tempo_get_confidence(o);
-
- i++;
- };
-
+ if (out->data[0] != 0) {
+ PRINT_MSG("beat at %.3fms, %.3fs, frame %d, %.2fbpm with confidence %.2f\n",
+ aubio_tempo_get_last_ms(o), aubio_tempo_get_last_s(o),
+ aubio_tempo_get_last(o), aubio_tempo_get_bpm(o), aubio_tempo_get_confidence(o));
+ }
+ n_frames += read;
+ } while ( read == hop_size );
+
+ PRINT_MSG("read %.2fs, %d frames at %dHz (%d blocks) from %s\n",
+ n_frames * 1. / samplerate,
+ n_frames, samplerate,
+ n_frames / hop_size, source_path);
+
+ // clean up memory
del_aubio_tempo(o);
del_fvec(in);
del_fvec(out);
+ del_aubio_source(source);
+beach:
aubio_cleanup();
- return 0;
+ return err;
}
int main ()
{
- uint_t win_s = 32; // window size
+ uint_t win_s = 16; // window size
+ uint_t impulse_at = win_s / 2;
fvec_t *in = new_fvec (win_s); // input buffer
fvec_t *out = new_fvec (win_s); // input buffer
aubio_filter_t *o = new_aubio_filter_c_weighting (44100);
- in->data[12] = 0.5;
+ in->data[impulse_at] = 0.5;
fvec_print (in);
aubio_filter_do (o, in);
fvec_print (in);
del_aubio_filter (o);
o = new_aubio_filter_a_weighting (32000);
- in->data[12] = 0.5;
+ in->data[impulse_at] = 0.5;
fvec_print (in);
aubio_filter_do_outplace (o, in, out);
fvec_print (out);
aubio_filter_set_a_weighting (o, 32000);
- in->data[12] = 0.5;
+ in->data[impulse_at] = 0.5;
fvec_print (in);
aubio_filter_do_filtfilt (o, in, out);
fvec_print (out);
#include <stdlib.h>
#include <aubio.h>
+// Because aubio does not check for double free, this program will crash.
+// Programs that call these functions should check for null pointers.
+
int main ()
{
del_fvec(NULL);
mat->data[i][j] = i * 1. + j *.1;
}
}
+ fvec_t channel_onstack;
+ fvec_t *channel = &channel_onstack;
+ fmat_get_channel(mat, 1, channel);
+ fvec_print (channel);
// print out matrix
fmat_print(mat);
// destroy it
extra_source += ['../examples/jackio.c']
bld(features = 'c cprogram test',
+ lib = 'm',
uselib = uselib,
source = [target_name] + extra_source,
target = str(target_name).split('.')[0],
--- /dev/null
+#! /usr/bin/env python
+# encoding: utf-8
+# WARNING! Do not edit! http://waf.googlecode.com/git/docs/wafbook/single.html#_obtaining_the_waf_file
+
+import os,sys,errno,re,shutil
+try:
+ import cPickle
+except ImportError:
+ import pickle as cPickle
+from waflib import Runner,TaskGen,Utils,ConfigSet,Task,Logs,Options,Context,Errors
+import waflib.Node
+CACHE_DIR='c4che'
+CACHE_SUFFIX='_cache.py'
+INSTALL=1337
+UNINSTALL=-1337
+SAVED_ATTRS='root node_deps raw_deps task_sigs'.split()
+CFG_FILES='cfg_files'
+POST_AT_ONCE=0
+POST_LAZY=1
+POST_BOTH=2
+class BuildContext(Context.Context):
+ '''executes the build'''
+ cmd='build'
+ variant=''
+ def __init__(self,**kw):
+ super(BuildContext,self).__init__(**kw)
+ self.is_install=0
+ self.top_dir=kw.get('top_dir',Context.top_dir)
+ self.run_dir=kw.get('run_dir',Context.run_dir)
+ self.post_mode=POST_AT_ONCE
+ self.out_dir=kw.get('out_dir',Context.out_dir)
+ self.cache_dir=kw.get('cache_dir',None)
+ if not self.cache_dir:
+ self.cache_dir=self.out_dir+os.sep+CACHE_DIR
+ self.all_envs={}
+ self.task_sigs={}
+ self.node_deps={}
+ self.raw_deps={}
+ self.cache_dir_contents={}
+ self.task_gen_cache_names={}
+ self.launch_dir=Context.launch_dir
+ self.jobs=Options.options.jobs
+ self.targets=Options.options.targets
+ self.keep=Options.options.keep
+ self.cache_global=Options.cache_global
+ self.nocache=Options.options.nocache
+ self.progress_bar=Options.options.progress_bar
+ self.deps_man=Utils.defaultdict(list)
+ self.current_group=0
+ self.groups=[]
+ self.group_names={}
+ def get_variant_dir(self):
+ if not self.variant:
+ return self.out_dir
+ return os.path.join(self.out_dir,self.variant)
+ variant_dir=property(get_variant_dir,None)
+ def __call__(self,*k,**kw):
+ kw['bld']=self
+ ret=TaskGen.task_gen(*k,**kw)
+ self.task_gen_cache_names={}
+ self.add_to_group(ret,group=kw.get('group',None))
+ return ret
+ def rule(self,*k,**kw):
+ def f(rule):
+ ret=self(*k,**kw)
+ ret.rule=rule
+ return ret
+ return f
+ def __copy__(self):
+ raise Errors.WafError('build contexts are not supposed to be copied')
+ def install_files(self,*k,**kw):
+ pass
+ def install_as(self,*k,**kw):
+ pass
+ def symlink_as(self,*k,**kw):
+ pass
+ def load_envs(self):
+ node=self.root.find_node(self.cache_dir)
+ if not node:
+ raise Errors.WafError('The project was not configured: run "waf configure" first!')
+ lst=node.ant_glob('**/*%s'%CACHE_SUFFIX,quiet=True)
+ if not lst:
+ raise Errors.WafError('The cache directory is empty: reconfigure the project')
+ for x in lst:
+ name=x.path_from(node).replace(CACHE_SUFFIX,'').replace('\\','/')
+ env=ConfigSet.ConfigSet(x.abspath())
+ self.all_envs[name]=env
+ for f in env[CFG_FILES]:
+ newnode=self.root.find_resource(f)
+ try:
+ h=Utils.h_file(newnode.abspath())
+ except(IOError,AttributeError):
+ Logs.error('cannot find %r'%f)
+ h=Utils.SIG_NIL
+ newnode.sig=h
+ def init_dirs(self):
+ if not(os.path.isabs(self.top_dir)and os.path.isabs(self.out_dir)):
+ raise Errors.WafError('The project was not configured: run "waf configure" first!')
+ self.path=self.srcnode=self.root.find_dir(self.top_dir)
+ self.bldnode=self.root.make_node(self.variant_dir)
+ self.bldnode.mkdir()
+ def execute(self):
+ self.restore()
+ if not self.all_envs:
+ self.load_envs()
+ self.execute_build()
+ def execute_build(self):
+ Logs.info("Waf: Entering directory `%s'"%self.variant_dir)
+ self.recurse([self.run_dir])
+ self.pre_build()
+ self.timer=Utils.Timer()
+ if self.progress_bar:
+ sys.stderr.write(Logs.colors.cursor_off)
+ try:
+ self.compile()
+ finally:
+ if self.progress_bar==1:
+ c=len(self.returned_tasks)or 1
+ self.to_log(self.progress_line(c,c,Logs.colors.BLUE,Logs.colors.NORMAL))
+ print('')
+ sys.stdout.flush()
+ sys.stderr.write(Logs.colors.cursor_on)
+ Logs.info("Waf: Leaving directory `%s'"%self.variant_dir)
+ self.post_build()
+ def restore(self):
+ try:
+ env=ConfigSet.ConfigSet(os.path.join(self.cache_dir,'build.config.py'))
+ except(IOError,OSError):
+ pass
+ else:
+ if env['version']<Context.HEXVERSION:
+ raise Errors.WafError('Version mismatch! reconfigure the project')
+ for t in env['tools']:
+ self.setup(**t)
+ f=None
+ try:
+ dbfn=os.path.join(self.variant_dir,Context.DBFILE)
+ try:
+ f=open(dbfn,'rb')
+ except(IOError,EOFError):
+ Logs.debug('build: Could not load the build cache %s (missing)'%dbfn)
+ else:
+ try:
+ waflib.Node.pickle_lock.acquire()
+ waflib.Node.Nod3=self.node_class
+ try:
+ data=cPickle.load(f)
+ except Exception ,e:
+ Logs.debug('build: Could not pickle the build cache %s: %r'%(dbfn,e))
+ else:
+ for x in SAVED_ATTRS:
+ setattr(self,x,data[x])
+ finally:
+ waflib.Node.pickle_lock.release()
+ finally:
+ if f:
+ f.close()
+ self.init_dirs()
+ def store(self):
+ data={}
+ for x in SAVED_ATTRS:
+ data[x]=getattr(self,x)
+ db=os.path.join(self.variant_dir,Context.DBFILE)
+ try:
+ waflib.Node.pickle_lock.acquire()
+ waflib.Node.Nod3=self.node_class
+ f=None
+ try:
+ f=open(db+'.tmp','wb')
+ cPickle.dump(data,f,-1)
+ finally:
+ if f:
+ f.close()
+ finally:
+ waflib.Node.pickle_lock.release()
+ try:
+ st=os.stat(db)
+ os.unlink(db)
+ if not Utils.is_win32:
+ os.chown(db+'.tmp',st.st_uid,st.st_gid)
+ except(AttributeError,OSError):
+ pass
+ os.rename(db+'.tmp',db)
+ def compile(self):
+ Logs.debug('build: compile()')
+ self.producer=Runner.Parallel(self,self.jobs)
+ self.producer.biter=self.get_build_iterator()
+ self.returned_tasks=[]
+ try:
+ self.producer.start()
+ except KeyboardInterrupt:
+ self.store()
+ raise
+ else:
+ if self.producer.dirty:
+ self.store()
+ if self.producer.error:
+ raise Errors.BuildError(self.producer.error)
+ def setup(self,tool,tooldir=None,funs=None):
+ if isinstance(tool,list):
+ for i in tool:self.setup(i,tooldir)
+ return
+ module=Context.load_tool(tool,tooldir)
+ if hasattr(module,"setup"):module.setup(self)
+ def get_env(self):
+ try:
+ return self.all_envs[self.variant]
+ except KeyError:
+ return self.all_envs['']
+ def set_env(self,val):
+ self.all_envs[self.variant]=val
+ env=property(get_env,set_env)
+ def add_manual_dependency(self,path,value):
+ if path is None:
+ raise ValueError('Invalid input')
+ if isinstance(path,waflib.Node.Node):
+ node=path
+ elif os.path.isabs(path):
+ node=self.root.find_resource(path)
+ else:
+ node=self.path.find_resource(path)
+ if isinstance(value,list):
+ self.deps_man[id(node)].extend(value)
+ else:
+ self.deps_man[id(node)].append(value)
+ def launch_node(self):
+ try:
+ return self.p_ln
+ except AttributeError:
+ self.p_ln=self.root.find_dir(self.launch_dir)
+ return self.p_ln
+ def hash_env_vars(self,env,vars_lst):
+ if not env.table:
+ env=env.parent
+ if not env:
+ return Utils.SIG_NIL
+ idx=str(id(env))+str(vars_lst)
+ try:
+ cache=self.cache_env
+ except AttributeError:
+ cache=self.cache_env={}
+ else:
+ try:
+ return self.cache_env[idx]
+ except KeyError:
+ pass
+ lst=[env[a]for a in vars_lst]
+ ret=Utils.h_list(lst)
+ Logs.debug('envhash: %s %r',Utils.to_hex(ret),lst)
+ cache[idx]=ret
+ return ret
+ def get_tgen_by_name(self,name):
+ cache=self.task_gen_cache_names
+ if not cache:
+ for g in self.groups:
+ for tg in g:
+ try:
+ cache[tg.name]=tg
+ except AttributeError:
+ pass
+ try:
+ return cache[name]
+ except KeyError:
+ raise Errors.WafError('Could not find a task generator for the name %r'%name)
+ def progress_line(self,state,total,col1,col2):
+ n=len(str(total))
+ Utils.rot_idx+=1
+ ind=Utils.rot_chr[Utils.rot_idx%4]
+ pc=(100.*state)/total
+ eta=str(self.timer)
+ fs="[%%%dd/%%%dd][%%s%%2d%%%%%%s][%s]["%(n,n,ind)
+ left=fs%(state,total,col1,pc,col2)
+ right='][%s%s%s]'%(col1,eta,col2)
+ cols=Logs.get_term_cols()-len(left)-len(right)+2*len(col1)+2*len(col2)
+ if cols<7:cols=7
+ ratio=((cols*state)//total)-1
+ bar=('='*ratio+'>').ljust(cols)
+ msg=Utils.indicator%(left,bar,right)
+ return msg
+ def declare_chain(self,*k,**kw):
+ return TaskGen.declare_chain(*k,**kw)
+ def pre_build(self):
+ for m in getattr(self,'pre_funs',[]):
+ m(self)
+ def post_build(self):
+ for m in getattr(self,'post_funs',[]):
+ m(self)
+ def add_pre_fun(self,meth):
+ try:
+ self.pre_funs.append(meth)
+ except AttributeError:
+ self.pre_funs=[meth]
+ def add_post_fun(self,meth):
+ try:
+ self.post_funs.append(meth)
+ except AttributeError:
+ self.post_funs=[meth]
+ def get_group(self,x):
+ if not self.groups:
+ self.add_group()
+ if x is None:
+ return self.groups[self.current_group]
+ if x in self.group_names:
+ return self.group_names[x]
+ return self.groups[x]
+ def add_to_group(self,tgen,group=None):
+ assert(isinstance(tgen,TaskGen.task_gen)or isinstance(tgen,Task.TaskBase))
+ tgen.bld=self
+ self.get_group(group).append(tgen)
+ def get_group_name(self,g):
+ if not isinstance(g,list):
+ g=self.groups[g]
+ for x in self.group_names:
+ if id(self.group_names[x])==id(g):
+ return x
+ return''
+ def get_group_idx(self,tg):
+ se=id(tg)
+ for i in range(len(self.groups)):
+ for t in self.groups[i]:
+ if id(t)==se:
+ return i
+ return None
+ def add_group(self,name=None,move=True):
+ if name and name in self.group_names:
+ Logs.error('add_group: name %s already present'%name)
+ g=[]
+ self.group_names[name]=g
+ self.groups.append(g)
+ if move:
+ self.current_group=len(self.groups)-1
+ def set_group(self,idx):
+ if isinstance(idx,str):
+ g=self.group_names[idx]
+ for i in range(len(self.groups)):
+ if id(g)==id(self.groups[i]):
+ self.current_group=i
+ else:
+ self.current_group=idx
+ def total(self):
+ total=0
+ for group in self.groups:
+ for tg in group:
+ try:
+ total+=len(tg.tasks)
+ except AttributeError:
+ total+=1
+ return total
+ def get_targets(self):
+ to_post=[]
+ min_grp=0
+ for name in self.targets.split(','):
+ tg=self.get_tgen_by_name(name)
+ if not tg:
+ raise Errors.WafError('target %r does not exist'%name)
+ m=self.get_group_idx(tg)
+ if m>min_grp:
+ min_grp=m
+ to_post=[tg]
+ elif m==min_grp:
+ to_post.append(tg)
+ return(min_grp,to_post)
+ def get_all_task_gen(self):
+ lst=[]
+ for g in self.groups:
+ lst.extend(g)
+ return lst
+ def post_group(self):
+ if self.targets=='*':
+ for tg in self.groups[self.cur]:
+ try:
+ f=tg.post
+ except AttributeError:
+ pass
+ else:
+ f()
+ elif self.targets:
+ if self.cur<self._min_grp:
+ for tg in self.groups[self.cur]:
+ try:
+ f=tg.post
+ except AttributeError:
+ pass
+ else:
+ f()
+ else:
+ for tg in self._exact_tg:
+ tg.post()
+ else:
+ ln=self.launch_node()
+ if ln.is_child_of(self.bldnode):
+ Logs.warn('Building from the build directory, forcing --targets=*')
+ ln=self.srcnode
+ elif not ln.is_child_of(self.srcnode):
+ Logs.warn('CWD %s is not under %s, forcing --targets=* (run distclean?)'%(ln.abspath(),self.srcnode.abspath()))
+ ln=self.srcnode
+ for tg in self.groups[self.cur]:
+ try:
+ f=tg.post
+ except AttributeError:
+ pass
+ else:
+ if tg.path.is_child_of(ln):
+ f()
+ def get_tasks_group(self,idx):
+ tasks=[]
+ for tg in self.groups[idx]:
+ try:
+ tasks.extend(tg.tasks)
+ except AttributeError:
+ tasks.append(tg)
+ return tasks
+ def get_build_iterator(self):
+ self.cur=0
+ if self.targets and self.targets!='*':
+ (self._min_grp,self._exact_tg)=self.get_targets()
+ global lazy_post
+ if self.post_mode!=POST_LAZY:
+ while self.cur<len(self.groups):
+ self.post_group()
+ self.cur+=1
+ self.cur=0
+ while self.cur<len(self.groups):
+ if self.post_mode!=POST_AT_ONCE:
+ self.post_group()
+ tasks=self.get_tasks_group(self.cur)
+ Task.set_file_constraints(tasks)
+ Task.set_precedence_constraints(tasks)
+ self.cur_tasks=tasks
+ self.cur+=1
+ if not tasks:
+ continue
+ yield tasks
+ while 1:
+ yield[]
+class inst(Task.Task):
+ color='CYAN'
+ def uid(self):
+ lst=[self.dest,self.path]+self.source
+ return Utils.h_list(repr(lst))
+ def post(self):
+ buf=[]
+ for x in self.source:
+ if isinstance(x,waflib.Node.Node):
+ y=x
+ else:
+ y=self.path.find_resource(x)
+ if not y:
+ if Logs.verbose:
+ Logs.warn('Could not find %s immediately (may cause broken builds)'%x)
+ idx=self.generator.bld.get_group_idx(self)
+ for tg in self.generator.bld.groups[idx]:
+ if not isinstance(tg,inst)and id(tg)!=id(self):
+ tg.post()
+ y=self.path.find_resource(x)
+ if y:
+ break
+ else:
+ raise Errors.WafError('Could not find %r in %r'%(x,self.path))
+ buf.append(y)
+ self.inputs=buf
+ def runnable_status(self):
+ ret=super(inst,self).runnable_status()
+ if ret==Task.SKIP_ME:
+ return Task.RUN_ME
+ return ret
+ def __str__(self):
+ return''
+ def run(self):
+ return self.generator.exec_task()
+ def get_install_path(self,destdir=True):
+ dest=Utils.subst_vars(self.dest,self.env)
+ dest=dest.replace('/',os.sep)
+ if destdir and Options.options.destdir:
+ dest=os.path.join(Options.options.destdir,os.path.splitdrive(dest)[1].lstrip(os.sep))
+ return dest
+ def exec_install_files(self):
+ destpath=self.get_install_path()
+ if not destpath:
+ raise Errors.WafError('unknown installation path %r'%self.generator)
+ for x,y in zip(self.source,self.inputs):
+ if self.relative_trick:
+ destfile=os.path.join(destpath,y.path_from(self.path))
+ Utils.check_dir(os.path.dirname(destfile))
+ else:
+ destfile=os.path.join(destpath,y.name)
+ self.generator.bld.do_install(y.abspath(),destfile,self.chmod)
+ def exec_install_as(self):
+ destfile=self.get_install_path()
+ self.generator.bld.do_install(self.inputs[0].abspath(),destfile,self.chmod)
+ def exec_symlink_as(self):
+ destfile=self.get_install_path()
+ src=self.link
+ if self.relative_trick:
+ src=os.path.relpath(src,os.path.dirname(destfile))
+ self.generator.bld.do_link(src,destfile)
+class InstallContext(BuildContext):
+ '''installs the targets on the system'''
+ cmd='install'
+ def __init__(self,**kw):
+ super(InstallContext,self).__init__(**kw)
+ self.uninstall=[]
+ self.is_install=INSTALL
+ def do_install(self,src,tgt,chmod=Utils.O644):
+ d,_=os.path.split(tgt)
+ if not d:
+ raise Errors.WafError('Invalid installation given %r->%r'%(src,tgt))
+ Utils.check_dir(d)
+ srclbl=src.replace(self.srcnode.abspath()+os.sep,'')
+ if not Options.options.force:
+ try:
+ st1=os.stat(tgt)
+ st2=os.stat(src)
+ except OSError:
+ pass
+ else:
+ if st1.st_mtime+2>=st2.st_mtime and st1.st_size==st2.st_size:
+ if not self.progress_bar:
+ Logs.info('- install %s (from %s)'%(tgt,srclbl))
+ return False
+ if not self.progress_bar:
+ Logs.info('+ install %s (from %s)'%(tgt,srclbl))
+ try:
+ os.remove(tgt)
+ except OSError:
+ pass
+ try:
+ shutil.copy2(src,tgt)
+ os.chmod(tgt,chmod)
+ except IOError:
+ try:
+ os.stat(src)
+ except(OSError,IOError):
+ Logs.error('File %r does not exist'%src)
+ raise Errors.WafError('Could not install the file %r'%tgt)
+ def do_link(self,src,tgt):
+ d,_=os.path.split(tgt)
+ Utils.check_dir(d)
+ link=False
+ if not os.path.islink(tgt):
+ link=True
+ elif os.readlink(tgt)!=src:
+ link=True
+ if link:
+ try:os.remove(tgt)
+ except OSError:pass
+ if not self.progress_bar:
+ Logs.info('+ symlink %s (to %s)'%(tgt,src))
+ os.symlink(src,tgt)
+ else:
+ if not self.progress_bar:
+ Logs.info('- symlink %s (to %s)'%(tgt,src))
+ def run_task_now(self,tsk,postpone):
+ tsk.post()
+ if not postpone:
+ if tsk.runnable_status()==Task.ASK_LATER:
+ raise self.WafError('cannot post the task %r'%tsk)
+ tsk.run()
+ def install_files(self,dest,files,env=None,chmod=Utils.O644,relative_trick=False,cwd=None,add=True,postpone=True):
+ tsk=inst(env=env or self.env)
+ tsk.bld=self
+ tsk.path=cwd or self.path
+ tsk.chmod=chmod
+ if isinstance(files,waflib.Node.Node):
+ tsk.source=[files]
+ else:
+ tsk.source=Utils.to_list(files)
+ tsk.dest=dest
+ tsk.exec_task=tsk.exec_install_files
+ tsk.relative_trick=relative_trick
+ if add:self.add_to_group(tsk)
+ self.run_task_now(tsk,postpone)
+ return tsk
+ def install_as(self,dest,srcfile,env=None,chmod=Utils.O644,cwd=None,add=True,postpone=True):
+ tsk=inst(env=env or self.env)
+ tsk.bld=self
+ tsk.path=cwd or self.path
+ tsk.chmod=chmod
+ tsk.source=[srcfile]
+ tsk.dest=dest
+ tsk.exec_task=tsk.exec_install_as
+ if add:self.add_to_group(tsk)
+ self.run_task_now(tsk,postpone)
+ return tsk
+ def symlink_as(self,dest,src,env=None,cwd=None,add=True,postpone=True,relative_trick=False):
+ if Utils.is_win32:
+ return
+ tsk=inst(env=env or self.env)
+ tsk.bld=self
+ tsk.dest=dest
+ tsk.path=cwd or self.path
+ tsk.source=[]
+ tsk.link=src
+ tsk.relative_trick=relative_trick
+ tsk.exec_task=tsk.exec_symlink_as
+ if add:self.add_to_group(tsk)
+ self.run_task_now(tsk,postpone)
+ return tsk
+class UninstallContext(InstallContext):
+ '''removes the targets installed'''
+ cmd='uninstall'
+ def __init__(self,**kw):
+ super(UninstallContext,self).__init__(**kw)
+ self.is_install=UNINSTALL
+ def do_install(self,src,tgt,chmod=Utils.O644):
+ if not self.progress_bar:
+ Logs.info('- remove %s'%tgt)
+ self.uninstall.append(tgt)
+ try:
+ os.remove(tgt)
+ except OSError ,e:
+ if e.errno!=errno.ENOENT:
+ if not getattr(self,'uninstall_error',None):
+ self.uninstall_error=True
+ Logs.warn('build: some files could not be uninstalled (retry with -vv to list them)')
+ if Logs.verbose>1:
+ Logs.warn('Could not remove %s (error code %r)'%(e.filename,e.errno))
+ while tgt:
+ tgt=os.path.dirname(tgt)
+ try:
+ os.rmdir(tgt)
+ except OSError:
+ break
+ def do_link(self,src,tgt):
+ try:
+ if not self.progress_bar:
+ Logs.info('- unlink %s'%tgt)
+ os.remove(tgt)
+ except OSError:
+ pass
+ while tgt:
+ tgt=os.path.dirname(tgt)
+ try:
+ os.rmdir(tgt)
+ except OSError:
+ break
+ def execute(self):
+ try:
+ def runnable_status(self):
+ return Task.SKIP_ME
+ setattr(Task.Task,'runnable_status_back',Task.Task.runnable_status)
+ setattr(Task.Task,'runnable_status',runnable_status)
+ super(UninstallContext,self).execute()
+ finally:
+ setattr(Task.Task,'runnable_status',Task.Task.runnable_status_back)
+class CleanContext(BuildContext):
+ '''cleans the project'''
+ cmd='clean'
+ def execute(self):
+ self.restore()
+ if not self.all_envs:
+ self.load_envs()
+ self.recurse([self.run_dir])
+ try:
+ self.clean()
+ finally:
+ self.store()
+ def clean(self):
+ Logs.debug('build: clean called')
+ if self.bldnode!=self.srcnode:
+ lst=[]
+ for e in self.all_envs.values():
+ lst.extend(self.root.find_or_declare(f)for f in e[CFG_FILES])
+ for n in self.bldnode.ant_glob('**/*',excl='.lock* *conf_check_*/** config.log c4che/*',quiet=True):
+ if n in lst:
+ continue
+ n.delete()
+ self.root.children={}
+ for v in'node_deps task_sigs raw_deps'.split():
+ setattr(self,v,{})
+class ListContext(BuildContext):
+ '''lists the targets to execute'''
+ cmd='list'
+ def execute(self):
+ self.restore()
+ if not self.all_envs:
+ self.load_envs()
+ self.recurse([self.run_dir])
+ self.pre_build()
+ self.timer=Utils.Timer()
+ for g in self.groups:
+ for tg in g:
+ try:
+ f=tg.post
+ except AttributeError:
+ pass
+ else:
+ f()
+ try:
+ self.get_tgen_by_name('')
+ except Exception:
+ pass
+ lst=list(self.task_gen_cache_names.keys())
+ lst.sort()
+ for k in lst:
+ Logs.pprint('GREEN',k)
+class StepContext(BuildContext):
+ '''executes tasks in a step-by-step fashion, for debugging'''
+ cmd='step'
+ def __init__(self,**kw):
+ super(StepContext,self).__init__(**kw)
+ self.files=Options.options.files
+ def compile(self):
+ if not self.files:
+ Logs.warn('Add a pattern for the debug build, for example "waf step --files=main.c,app"')
+ BuildContext.compile(self)
+ return
+ targets=None
+ if self.targets and self.targets!='*':
+ targets=self.targets.split(',')
+ for g in self.groups:
+ for tg in g:
+ if targets and tg.name not in targets:
+ continue
+ try:
+ f=tg.post
+ except AttributeError:
+ pass
+ else:
+ f()
+ for pat in self.files.split(','):
+ matcher=self.get_matcher(pat)
+ for tg in g:
+ if isinstance(tg,Task.TaskBase):
+ lst=[tg]
+ else:
+ lst=tg.tasks
+ for tsk in lst:
+ do_exec=False
+ for node in getattr(tsk,'inputs',[]):
+ if matcher(node,output=False):
+ do_exec=True
+ break
+ for node in getattr(tsk,'outputs',[]):
+ if matcher(node,output=True):
+ do_exec=True
+ break
+ if do_exec:
+ ret=tsk.run()
+ Logs.info('%s -> exit %r'%(str(tsk),ret))
+ def get_matcher(self,pat):
+ inn=True
+ out=True
+ if pat.startswith('in:'):
+ out=False
+ pat=pat.replace('in:','')
+ elif pat.startswith('out:'):
+ inn=False
+ pat=pat.replace('out:','')
+ anode=self.root.find_node(pat)
+ pattern=None
+ if not anode:
+ if not pat.startswith('^'):
+ pat='^.+?%s'%pat
+ if not pat.endswith('$'):
+ pat='%s$'%pat
+ pattern=re.compile(pat)
+ def match(node,output):
+ if output==True and not out:
+ return False
+ if output==False and not inn:
+ return False
+ if anode:
+ return anode==node
+ else:
+ return pattern.match(node.abspath())
+ return match
+BuildContext.store=Utils.nogc(BuildContext.store)
+BuildContext.restore=Utils.nogc(BuildContext.restore)
--- /dev/null
+#! /usr/bin/env python
+# encoding: utf-8
+# WARNING! Do not edit! http://waf.googlecode.com/git/docs/wafbook/single.html#_obtaining_the_waf_file
+
+import copy,re,os
+from waflib import Logs,Utils
+re_imp=re.compile('^(#)*?([^#=]*?)\ =\ (.*?)$',re.M)
+class ConfigSet(object):
+ __slots__=('table','parent')
+ def __init__(self,filename=None):
+ self.table={}
+ if filename:
+ self.load(filename)
+ def __contains__(self,key):
+ if key in self.table:return True
+ try:return self.parent.__contains__(key)
+ except AttributeError:return False
+ def keys(self):
+ keys=set()
+ cur=self
+ while cur:
+ keys.update(cur.table.keys())
+ cur=getattr(cur,'parent',None)
+ keys=list(keys)
+ keys.sort()
+ return keys
+ def __str__(self):
+ return"\n".join(["%r %r"%(x,self.__getitem__(x))for x in self.keys()])
+ def __getitem__(self,key):
+ try:
+ while 1:
+ x=self.table.get(key,None)
+ if not x is None:
+ return x
+ self=self.parent
+ except AttributeError:
+ return[]
+ def __setitem__(self,key,value):
+ self.table[key]=value
+ def __delitem__(self,key):
+ self[key]=[]
+ def __getattr__(self,name):
+ if name in self.__slots__:
+ return object.__getattr__(self,name)
+ else:
+ return self[name]
+ def __setattr__(self,name,value):
+ if name in self.__slots__:
+ object.__setattr__(self,name,value)
+ else:
+ self[name]=value
+ def __delattr__(self,name):
+ if name in self.__slots__:
+ object.__delattr__(self,name)
+ else:
+ del self[name]
+ def derive(self):
+ newenv=ConfigSet()
+ newenv.parent=self
+ return newenv
+ def detach(self):
+ tbl=self.get_merged_dict()
+ try:
+ delattr(self,'parent')
+ except AttributeError:
+ pass
+ else:
+ keys=tbl.keys()
+ for x in keys:
+ tbl[x]=copy.deepcopy(tbl[x])
+ self.table=tbl
+ def get_flat(self,key):
+ s=self[key]
+ if isinstance(s,str):return s
+ return' '.join(s)
+ def _get_list_value_for_modification(self,key):
+ try:
+ value=self.table[key]
+ except KeyError:
+ try:value=self.parent[key]
+ except AttributeError:value=[]
+ if isinstance(value,list):
+ value=value[:]
+ else:
+ value=[value]
+ else:
+ if not isinstance(value,list):
+ value=[value]
+ self.table[key]=value
+ return value
+ def append_value(self,var,val):
+ current_value=self._get_list_value_for_modification(var)
+ if isinstance(val,str):
+ val=[val]
+ current_value.extend(val)
+ def prepend_value(self,var,val):
+ if isinstance(val,str):
+ val=[val]
+ self.table[var]=val+self._get_list_value_for_modification(var)
+ def append_unique(self,var,val):
+ if isinstance(val,str):
+ val=[val]
+ current_value=self._get_list_value_for_modification(var)
+ for x in val:
+ if x not in current_value:
+ current_value.append(x)
+ def get_merged_dict(self):
+ table_list=[]
+ env=self
+ while 1:
+ table_list.insert(0,env.table)
+ try:env=env.parent
+ except AttributeError:break
+ merged_table={}
+ for table in table_list:
+ merged_table.update(table)
+ return merged_table
+ def store(self,filename):
+ try:
+ os.makedirs(os.path.split(filename)[0])
+ except OSError:
+ pass
+ f=None
+ try:
+ f=open(filename,'w')
+ merged_table=self.get_merged_dict()
+ keys=list(merged_table.keys())
+ keys.sort()
+ for k in keys:
+ if k!='undo_stack':
+ f.write('%s = %r\n'%(k,merged_table[k]))
+ finally:
+ if f:
+ f.close()
+ def load(self,filename):
+ tbl=self.table
+ code=Utils.readf(filename,m='rU')
+ for m in re_imp.finditer(code):
+ g=m.group
+ tbl[g(2)]=eval(g(3))
+ Logs.debug('env: %s'%str(self.table))
+ def update(self,d):
+ for k,v in d.items():
+ self[k]=v
+ def stash(self):
+ orig=self.table
+ tbl=self.table=self.table.copy()
+ for x in tbl.keys():
+ tbl[x]=copy.deepcopy(tbl[x])
+ self.undo_stack=self.undo_stack+[orig]
+ def revert(self):
+ self.table=self.undo_stack.pop(-1)
--- /dev/null
+#! /usr/bin/env python
+# encoding: utf-8
+# WARNING! Do not edit! http://waf.googlecode.com/git/docs/wafbook/single.html#_obtaining_the_waf_file
+
+import os,shlex,sys,time
+from waflib import ConfigSet,Utils,Options,Logs,Context,Build,Errors
+try:
+ from urllib import request
+except ImportError:
+ from urllib import urlopen
+else:
+ urlopen=request.urlopen
+BREAK='break'
+CONTINUE='continue'
+WAF_CONFIG_LOG='config.log'
+autoconfig=False
+conf_template='''# project %(app)s configured on %(now)s by
+# waf %(wafver)s (abi %(abi)s, python %(pyver)x on %(systype)s)
+# using %(args)s
+#'''
+def download_check(node):
+ pass
+def download_tool(tool,force=False,ctx=None):
+ for x in Utils.to_list(Context.remote_repo):
+ for sub in Utils.to_list(Context.remote_locs):
+ url='/'.join((x,sub,tool+'.py'))
+ try:
+ web=urlopen(url)
+ try:
+ if web.getcode()!=200:
+ continue
+ except AttributeError:
+ pass
+ except Exception:
+ continue
+ else:
+ tmp=ctx.root.make_node(os.sep.join((Context.waf_dir,'waflib','extras',tool+'.py')))
+ tmp.write(web.read(),'wb')
+ Logs.warn('Downloaded %s from %s'%(tool,url))
+ download_check(tmp)
+ try:
+ module=Context.load_tool(tool)
+ except Exception:
+ Logs.warn('The tool %s from %s is unusable'%(tool,url))
+ try:
+ tmp.delete()
+ except Exception:
+ pass
+ continue
+ return module
+ raise Errors.WafError('Could not load the Waf tool')
+class ConfigurationContext(Context.Context):
+ '''configures the project'''
+ cmd='configure'
+ error_handlers=[]
+ def __init__(self,**kw):
+ super(ConfigurationContext,self).__init__(**kw)
+ self.environ=dict(os.environ)
+ self.all_envs={}
+ self.top_dir=None
+ self.out_dir=None
+ self.tools=[]
+ self.hash=0
+ self.files=[]
+ self.tool_cache=[]
+ self.setenv('')
+ def setenv(self,name,env=None):
+ if name not in self.all_envs or env:
+ if not env:
+ env=ConfigSet.ConfigSet()
+ self.prepare_env(env)
+ else:
+ env=env.derive()
+ self.all_envs[name]=env
+ self.variant=name
+ def get_env(self):
+ return self.all_envs[self.variant]
+ def set_env(self,val):
+ self.all_envs[self.variant]=val
+ env=property(get_env,set_env)
+ def init_dirs(self):
+ top=self.top_dir
+ if not top:
+ top=Options.options.top
+ if not top:
+ top=getattr(Context.g_module,Context.TOP,None)
+ if not top:
+ top=self.path.abspath()
+ top=os.path.abspath(top)
+ self.srcnode=(os.path.isabs(top)and self.root or self.path).find_dir(top)
+ assert(self.srcnode)
+ out=self.out_dir
+ if not out:
+ out=Options.options.out
+ if not out:
+ out=getattr(Context.g_module,Context.OUT,None)
+ if not out:
+ out=Options.lockfile.replace('.lock-waf_%s_'%sys.platform,'').replace('.lock-waf','')
+ self.bldnode=(os.path.isabs(out)and self.root or self.path).make_node(out)
+ self.bldnode.mkdir()
+ if not os.path.isdir(self.bldnode.abspath()):
+ conf.fatal('Could not create the build directory %s'%self.bldnode.abspath())
+ def execute(self):
+ self.init_dirs()
+ self.cachedir=self.bldnode.make_node(Build.CACHE_DIR)
+ self.cachedir.mkdir()
+ path=os.path.join(self.bldnode.abspath(),WAF_CONFIG_LOG)
+ self.logger=Logs.make_logger(path,'cfg')
+ app=getattr(Context.g_module,'APPNAME','')
+ if app:
+ ver=getattr(Context.g_module,'VERSION','')
+ if ver:
+ app="%s (%s)"%(app,ver)
+ now=time.ctime()
+ pyver=sys.hexversion
+ systype=sys.platform
+ args=" ".join(sys.argv)
+ wafver=Context.WAFVERSION
+ abi=Context.ABI
+ self.to_log(conf_template%vars())
+ self.msg('Setting top to',self.srcnode.abspath())
+ self.msg('Setting out to',self.bldnode.abspath())
+ if id(self.srcnode)==id(self.bldnode):
+ Logs.warn('Setting top == out (remember to use "update_outputs")')
+ elif id(self.path)!=id(self.srcnode):
+ if self.srcnode.is_child_of(self.path):
+ Logs.warn('Are you certain that you do not want to set top="." ?')
+ super(ConfigurationContext,self).execute()
+ self.store()
+ Context.top_dir=self.srcnode.abspath()
+ Context.out_dir=self.bldnode.abspath()
+ env=ConfigSet.ConfigSet()
+ env['argv']=sys.argv
+ env['options']=Options.options.__dict__
+ env.run_dir=Context.run_dir
+ env.top_dir=Context.top_dir
+ env.out_dir=Context.out_dir
+ env['hash']=self.hash
+ env['files']=self.files
+ env['environ']=dict(self.environ)
+ if not self.env.NO_LOCK_IN_RUN:
+ env.store(Context.run_dir+os.sep+Options.lockfile)
+ if not self.env.NO_LOCK_IN_TOP:
+ env.store(Context.top_dir+os.sep+Options.lockfile)
+ if not self.env.NO_LOCK_IN_OUT:
+ env.store(Context.out_dir+os.sep+Options.lockfile)
+ def prepare_env(self,env):
+ if not env.PREFIX:
+ if Options.options.prefix or Utils.is_win32:
+ env.PREFIX=os.path.abspath(os.path.expanduser(Options.options.prefix))
+ else:
+ env.PREFIX=''
+ if not env.BINDIR:
+ env.BINDIR=Utils.subst_vars('${PREFIX}/bin',env)
+ if not env.LIBDIR:
+ env.LIBDIR=Utils.subst_vars('${PREFIX}/lib',env)
+ def store(self):
+ n=self.cachedir.make_node('build.config.py')
+ n.write('version = 0x%x\ntools = %r\n'%(Context.HEXVERSION,self.tools))
+ if not self.all_envs:
+ self.fatal('nothing to store in the configuration context!')
+ for key in self.all_envs:
+ tmpenv=self.all_envs[key]
+ tmpenv.store(os.path.join(self.cachedir.abspath(),key+Build.CACHE_SUFFIX))
+ def load(self,input,tooldir=None,funs=None,download=True):
+ tools=Utils.to_list(input)
+ if tooldir:tooldir=Utils.to_list(tooldir)
+ for tool in tools:
+ mag=(tool,id(self.env),funs)
+ if mag in self.tool_cache:
+ self.to_log('(tool %s is already loaded, skipping)'%tool)
+ continue
+ self.tool_cache.append(mag)
+ module=None
+ try:
+ module=Context.load_tool(tool,tooldir)
+ except ImportError ,e:
+ if Options.options.download:
+ module=download_tool(tool,ctx=self)
+ if not module:
+ self.fatal('Could not load the Waf tool %r or download a suitable replacement from the repository (sys.path %r)\n%s'%(tool,sys.path,e))
+ else:
+ self.fatal('Could not load the Waf tool %r from %r (try the --download option?):\n%s'%(tool,sys.path,e))
+ except Exception ,e:
+ self.to_log('imp %r (%r & %r)'%(tool,tooldir,funs))
+ self.to_log(Utils.ex_stack())
+ raise
+ if funs is not None:
+ self.eval_rules(funs)
+ else:
+ func=getattr(module,'configure',None)
+ if func:
+ if type(func)is type(Utils.readf):func(self)
+ else:self.eval_rules(func)
+ self.tools.append({'tool':tool,'tooldir':tooldir,'funs':funs})
+ def post_recurse(self,node):
+ super(ConfigurationContext,self).post_recurse(node)
+ self.hash=hash((self.hash,node.read('rb')))
+ self.files.append(node.abspath())
+ def eval_rules(self,rules):
+ self.rules=Utils.to_list(rules)
+ for x in self.rules:
+ f=getattr(self,x)
+ if not f:self.fatal("No such method '%s'."%x)
+ try:
+ f()
+ except Exception ,e:
+ ret=self.err_handler(x,e)
+ if ret==BREAK:
+ break
+ elif ret==CONTINUE:
+ continue
+ else:
+ raise
+ def err_handler(self,fun,error):
+ pass
+def conf(f):
+ def fun(*k,**kw):
+ mandatory=True
+ if'mandatory'in kw:
+ mandatory=kw['mandatory']
+ del kw['mandatory']
+ try:
+ return f(*k,**kw)
+ except Errors.ConfigurationError:
+ if mandatory:
+ raise
+ setattr(ConfigurationContext,f.__name__,fun)
+ setattr(Build.BuildContext,f.__name__,fun)
+ return f
+@conf
+def add_os_flags(self,var,dest=None):
+ try:self.env.append_value(dest or var,shlex.split(self.environ[var]))
+ except KeyError:pass
+@conf
+def cmd_to_list(self,cmd):
+ if isinstance(cmd,str)and cmd.find(' '):
+ try:
+ os.stat(cmd)
+ except OSError:
+ return shlex.split(cmd)
+ else:
+ return[cmd]
+ return cmd
+@conf
+def check_waf_version(self,mini='1.6.99',maxi='1.8.0'):
+ self.start_msg('Checking for waf version in %s-%s'%(str(mini),str(maxi)))
+ ver=Context.HEXVERSION
+ if Utils.num2ver(mini)>ver:
+ self.fatal('waf version should be at least %r (%r found)'%(Utils.num2ver(mini),ver))
+ if Utils.num2ver(maxi)<ver:
+ self.fatal('waf version should be at most %r (%r found)'%(Utils.num2ver(maxi),ver))
+ self.end_msg('ok')
+@conf
+def find_file(self,filename,path_list=[]):
+ for n in Utils.to_list(filename):
+ for d in Utils.to_list(path_list):
+ p=os.path.join(d,n)
+ if os.path.exists(p):
+ return p
+ self.fatal('Could not find %r'%filename)
+@conf
+def find_program(self,filename,**kw):
+ exts=kw.get('exts',Utils.is_win32 and'.exe,.com,.bat,.cmd'or',.sh,.pl,.py')
+ environ=kw.get('environ',os.environ)
+ ret=''
+ filename=Utils.to_list(filename)
+ var=kw.get('var','')
+ if not var:
+ var=filename[0].upper()
+ if self.env[var]:
+ ret=self.env[var]
+ elif var in environ:
+ ret=environ[var]
+ path_list=kw.get('path_list','')
+ if not ret:
+ if path_list:
+ path_list=Utils.to_list(path_list)
+ else:
+ path_list=environ.get('PATH','').split(os.pathsep)
+ if not isinstance(filename,list):
+ filename=[filename]
+ for a in exts.split(','):
+ if ret:
+ break
+ for b in filename:
+ if ret:
+ break
+ for c in path_list:
+ if ret:
+ break
+ x=os.path.expanduser(os.path.join(c,b+a))
+ if os.path.isfile(x):
+ ret=x
+ if not ret and Utils.winreg:
+ ret=Utils.get_registry_app_path(Utils.winreg.HKEY_CURRENT_USER,filename)
+ if not ret and Utils.winreg:
+ ret=Utils.get_registry_app_path(Utils.winreg.HKEY_LOCAL_MACHINE,filename)
+ self.msg('Checking for program '+','.join(filename),ret or False)
+ self.to_log('find program=%r paths=%r var=%r -> %r'%(filename,path_list,var,ret))
+ if not ret:
+ self.fatal(kw.get('errmsg','')or'Could not find the program %s'%','.join(filename))
+ if var:
+ self.env[var]=ret
+ return ret
+@conf
+def find_perl_program(self,filename,path_list=[],var=None,environ=None,exts=''):
+ try:
+ app=self.find_program(filename,path_list=path_list,var=var,environ=environ,exts=exts)
+ except Exception:
+ self.find_program('perl',var='PERL')
+ app=self.find_file(filename,os.environ['PATH'].split(os.pathsep))
+ if not app:
+ raise
+ if var:
+ self.env[var]=Utils.to_list(self.env['PERL'])+[app]
+ self.msg('Checking for %r'%filename,app)
--- /dev/null
+#! /usr/bin/env python
+# encoding: utf-8
+# WARNING! Do not edit! http://waf.googlecode.com/git/docs/wafbook/single.html#_obtaining_the_waf_file
+
+import os,imp,sys
+from waflib import Utils,Errors,Logs
+import waflib.Node
+HEXVERSION=0x1070900
+WAFVERSION="1.7.9"
+WAFREVISION="9e92489dbc008e4abae9c147b1d63b48296797c2"
+ABI=98
+DBFILE='.wafpickle-%s-%d-%d'%(sys.platform,sys.hexversion,ABI)
+APPNAME='APPNAME'
+VERSION='VERSION'
+TOP='top'
+OUT='out'
+WSCRIPT_FILE='wscript'
+launch_dir=''
+run_dir=''
+top_dir=''
+out_dir=''
+waf_dir=''
+local_repo=''
+remote_repo='http://waf.googlecode.com/git/'
+remote_locs=['waflib/extras','waflib/Tools']
+g_module=None
+STDOUT=1
+STDERR=-1
+BOTH=0
+classes=[]
+def create_context(cmd_name,*k,**kw):
+ global classes
+ for x in classes:
+ if x.cmd==cmd_name:
+ return x(*k,**kw)
+ ctx=Context(*k,**kw)
+ ctx.fun=cmd_name
+ return ctx
+class store_context(type):
+ def __init__(cls,name,bases,dict):
+ super(store_context,cls).__init__(name,bases,dict)
+ name=cls.__name__
+ if name=='ctx'or name=='Context':
+ return
+ try:
+ cls.cmd
+ except AttributeError:
+ raise Errors.WafError('Missing command for the context class %r (cmd)'%name)
+ if not getattr(cls,'fun',None):
+ cls.fun=cls.cmd
+ global classes
+ classes.insert(0,cls)
+ctx=store_context('ctx',(object,),{})
+class Context(ctx):
+ errors=Errors
+ tools={}
+ def __init__(self,**kw):
+ try:
+ rd=kw['run_dir']
+ except KeyError:
+ global run_dir
+ rd=run_dir
+ class node_class(waflib.Node.Node):
+ pass
+ self.node_class=node_class
+ self.node_class.__module__="waflib.Node"
+ self.node_class.__name__="Nod3"
+ self.node_class.ctx=self
+ self.root=self.node_class('',None)
+ self.cur_script=None
+ self.path=self.root.find_dir(rd)
+ self.stack_path=[]
+ self.exec_dict={'ctx':self,'conf':self,'bld':self,'opt':self}
+ self.logger=None
+ def __hash__(self):
+ return id(self)
+ def load(self,tool_list,*k,**kw):
+ tools=Utils.to_list(tool_list)
+ path=Utils.to_list(kw.get('tooldir',''))
+ for t in tools:
+ module=load_tool(t,path)
+ fun=getattr(module,kw.get('name',self.fun),None)
+ if fun:
+ fun(self)
+ def execute(self):
+ global g_module
+ self.recurse([os.path.dirname(g_module.root_path)])
+ def pre_recurse(self,node):
+ self.stack_path.append(self.cur_script)
+ self.cur_script=node
+ self.path=node.parent
+ def post_recurse(self,node):
+ self.cur_script=self.stack_path.pop()
+ if self.cur_script:
+ self.path=self.cur_script.parent
+ def recurse(self,dirs,name=None,mandatory=True,once=True):
+ try:
+ cache=self.recurse_cache
+ except AttributeError:
+ cache=self.recurse_cache={}
+ for d in Utils.to_list(dirs):
+ if not os.path.isabs(d):
+ d=os.path.join(self.path.abspath(),d)
+ WSCRIPT=os.path.join(d,WSCRIPT_FILE)
+ WSCRIPT_FUN=WSCRIPT+'_'+(name or self.fun)
+ node=self.root.find_node(WSCRIPT_FUN)
+ if node and(not once or node not in cache):
+ cache[node]=True
+ self.pre_recurse(node)
+ try:
+ function_code=node.read('rU')
+ exec(compile(function_code,node.abspath(),'exec'),self.exec_dict)
+ finally:
+ self.post_recurse(node)
+ elif not node:
+ node=self.root.find_node(WSCRIPT)
+ tup=(node,name or self.fun)
+ if node and(not once or tup not in cache):
+ cache[tup]=True
+ self.pre_recurse(node)
+ try:
+ wscript_module=load_module(node.abspath())
+ user_function=getattr(wscript_module,(name or self.fun),None)
+ if not user_function:
+ if not mandatory:
+ continue
+ raise Errors.WafError('No function %s defined in %s'%(name or self.fun,node.abspath()))
+ user_function(self)
+ finally:
+ self.post_recurse(node)
+ elif not node:
+ if not mandatory:
+ continue
+ raise Errors.WafError('No wscript file in directory %s'%d)
+ def exec_command(self,cmd,**kw):
+ subprocess=Utils.subprocess
+ kw['shell']=isinstance(cmd,str)
+ Logs.debug('runner: %r'%cmd)
+ Logs.debug('runner_env: kw=%s'%kw)
+ if self.logger:
+ self.logger.info(cmd)
+ if'stdout'not in kw:
+ kw['stdout']=subprocess.PIPE
+ if'stderr'not in kw:
+ kw['stderr']=subprocess.PIPE
+ try:
+ if kw['stdout']or kw['stderr']:
+ p=subprocess.Popen(cmd,**kw)
+ (out,err)=p.communicate()
+ ret=p.returncode
+ else:
+ out,err=(None,None)
+ ret=subprocess.Popen(cmd,**kw).wait()
+ except Exception ,e:
+ raise Errors.WafError('Execution failure: %s'%str(e),ex=e)
+ if out:
+ if not isinstance(out,str):
+ out=out.decode(sys.stdout.encoding or'iso8859-1')
+ if self.logger:
+ self.logger.debug('out: %s'%out)
+ else:
+ sys.stdout.write(out)
+ if err:
+ if not isinstance(err,str):
+ err=err.decode(sys.stdout.encoding or'iso8859-1')
+ if self.logger:
+ self.logger.error('err: %s'%err)
+ else:
+ sys.stderr.write(err)
+ return ret
+ def cmd_and_log(self,cmd,**kw):
+ subprocess=Utils.subprocess
+ kw['shell']=isinstance(cmd,str)
+ Logs.debug('runner: %r'%cmd)
+ if'quiet'in kw:
+ quiet=kw['quiet']
+ del kw['quiet']
+ else:
+ quiet=None
+ if'output'in kw:
+ to_ret=kw['output']
+ del kw['output']
+ else:
+ to_ret=STDOUT
+ kw['stdout']=kw['stderr']=subprocess.PIPE
+ if quiet is None:
+ self.to_log(cmd)
+ try:
+ p=subprocess.Popen(cmd,**kw)
+ (out,err)=p.communicate()
+ except Exception ,e:
+ raise Errors.WafError('Execution failure: %s'%str(e),ex=e)
+ if not isinstance(out,str):
+ out=out.decode(sys.stdout.encoding or'iso8859-1')
+ if not isinstance(err,str):
+ err=err.decode(sys.stdout.encoding or'iso8859-1')
+ if out and quiet!=STDOUT and quiet!=BOTH:
+ self.to_log('out: %s'%out)
+ if err and quiet!=STDERR and quiet!=BOTH:
+ self.to_log('err: %s'%err)
+ if p.returncode:
+ e=Errors.WafError('Command %r returned %r'%(cmd,p.returncode))
+ e.returncode=p.returncode
+ e.stderr=err
+ e.stdout=out
+ raise e
+ if to_ret==BOTH:
+ return(out,err)
+ elif to_ret==STDERR:
+ return err
+ return out
+ def fatal(self,msg,ex=None):
+ if self.logger:
+ self.logger.info('from %s: %s'%(self.path.abspath(),msg))
+ try:
+ msg='%s\n(complete log in %s)'%(msg,self.logger.handlers[0].baseFilename)
+ except Exception:
+ pass
+ raise self.errors.ConfigurationError(msg,ex=ex)
+ def to_log(self,msg):
+ if not msg:
+ return
+ if self.logger:
+ self.logger.info(msg)
+ else:
+ sys.stderr.write(str(msg))
+ sys.stderr.flush()
+ def msg(self,msg,result,color=None):
+ self.start_msg(msg)
+ if not isinstance(color,str):
+ color=result and'GREEN'or'YELLOW'
+ self.end_msg(result,color)
+ def start_msg(self,msg):
+ try:
+ if self.in_msg:
+ self.in_msg+=1
+ return
+ except AttributeError:
+ self.in_msg=0
+ self.in_msg+=1
+ try:
+ self.line_just=max(self.line_just,len(msg))
+ except AttributeError:
+ self.line_just=max(40,len(msg))
+ for x in(self.line_just*'-',msg):
+ self.to_log(x)
+ Logs.pprint('NORMAL',"%s :"%msg.ljust(self.line_just),sep='')
+ def end_msg(self,result,color=None):
+ self.in_msg-=1
+ if self.in_msg:
+ return
+ defcolor='GREEN'
+ if result==True:
+ msg='ok'
+ elif result==False:
+ msg='not found'
+ defcolor='YELLOW'
+ else:
+ msg=str(result)
+ self.to_log(msg)
+ Logs.pprint(color or defcolor,msg)
+ def load_special_tools(self,var,ban=[]):
+ global waf_dir
+ lst=self.root.find_node(waf_dir).find_node('waflib/extras').ant_glob(var)
+ for x in lst:
+ if not x.name in ban:
+ load_tool(x.name.replace('.py',''))
+cache_modules={}
+def load_module(path):
+ try:
+ return cache_modules[path]
+ except KeyError:
+ pass
+ module=imp.new_module(WSCRIPT_FILE)
+ try:
+ code=Utils.readf(path,m='rU')
+ except(IOError,OSError):
+ raise Errors.WafError('Could not read the file %r'%path)
+ module_dir=os.path.dirname(path)
+ sys.path.insert(0,module_dir)
+ exec(compile(code,path,'exec'),module.__dict__)
+ sys.path.remove(module_dir)
+ cache_modules[path]=module
+ return module
+def load_tool(tool,tooldir=None):
+ if tool=='java':
+ tool='javaw'
+ elif tool=='compiler_cc':
+ tool='compiler_c'
+ else:
+ tool=tool.replace('++','xx')
+ if tooldir:
+ assert isinstance(tooldir,list)
+ sys.path=tooldir+sys.path
+ try:
+ __import__(tool)
+ ret=sys.modules[tool]
+ Context.tools[tool]=ret
+ return ret
+ finally:
+ for d in tooldir:
+ sys.path.remove(d)
+ else:
+ global waf_dir
+ try:
+ os.stat(os.path.join(waf_dir,'waflib','extras',tool+'.py'))
+ except OSError:
+ try:
+ os.stat(os.path.join(waf_dir,'waflib','Tools',tool+'.py'))
+ except OSError:
+ d=tool
+ else:
+ d='waflib.Tools.%s'%tool
+ else:
+ d='waflib.extras.%s'%tool
+ __import__(d)
+ ret=sys.modules[d]
+ Context.tools[tool]=ret
+ return ret
--- /dev/null
+#! /usr/bin/env python
+# encoding: utf-8
+# WARNING! Do not edit! http://waf.googlecode.com/git/docs/wafbook/single.html#_obtaining_the_waf_file
+
+import traceback,sys
+class WafError(Exception):
+ def __init__(self,msg='',ex=None):
+ self.msg=msg
+ assert not isinstance(msg,Exception)
+ self.stack=[]
+ if ex:
+ if not msg:
+ self.msg=str(ex)
+ if isinstance(ex,WafError):
+ self.stack=ex.stack
+ else:
+ self.stack=traceback.extract_tb(sys.exc_info()[2])
+ self.stack+=traceback.extract_stack()[:-1]
+ self.verbose_msg=''.join(traceback.format_list(self.stack))
+ def __str__(self):
+ return str(self.msg)
+class BuildError(WafError):
+ def __init__(self,error_tasks=[]):
+ self.tasks=error_tasks
+ WafError.__init__(self,self.format_error())
+ def format_error(self):
+ lst=['Build failed']
+ for tsk in self.tasks:
+ txt=tsk.format_error()
+ if txt:lst.append(txt)
+ return'\n'.join(lst)
+class ConfigurationError(WafError):
+ pass
+class TaskRescan(WafError):
+ pass
+class TaskNotReady(WafError):
+ pass
--- /dev/null
+#! /usr/bin/env python
+# encoding: utf-8
+# WARNING! Do not edit! http://waf.googlecode.com/git/docs/wafbook/single.html#_obtaining_the_waf_file
+
+import os,re,traceback,sys
+try:
+ import threading
+except ImportError:
+ pass
+else:
+ wlock=threading.Lock()
+ class sync_stream(object):
+ def __init__(self,stream):
+ self.stream=stream
+ self.encoding=self.stream.encoding
+ def write(self,txt):
+ try:
+ wlock.acquire()
+ self.stream.write(txt)
+ self.stream.flush()
+ finally:
+ wlock.release()
+ def fileno(self):
+ return self.stream.fileno()
+ def flush(self):
+ self.stream.flush()
+ def isatty(self):
+ return self.stream.isatty()
+ _nocolor=os.environ.get('NOCOLOR','no')not in('no','0','false')
+ try:
+ if not _nocolor:
+ import waflib.ansiterm
+ except ImportError:
+ pass
+ if not os.environ.get('NOSYNC',False):
+ if id(sys.stdout)==id(sys.__stdout__):
+ sys.stdout=sync_stream(sys.stdout)
+ sys.stderr=sync_stream(sys.stderr)
+import logging
+LOG_FORMAT="%(asctime)s %(c1)s%(zone)s%(c2)s %(message)s"
+HOUR_FORMAT="%H:%M:%S"
+zones=''
+verbose=0
+colors_lst={'USE':True,'BOLD':'\x1b[01;1m','RED':'\x1b[01;31m','GREEN':'\x1b[32m','YELLOW':'\x1b[33m','PINK':'\x1b[35m','BLUE':'\x1b[01;34m','CYAN':'\x1b[36m','NORMAL':'\x1b[0m','cursor_on':'\x1b[?25h','cursor_off':'\x1b[?25l',}
+got_tty=not os.environ.get('TERM','dumb')in['dumb','emacs']
+if got_tty:
+ try:
+ got_tty=sys.stderr.isatty()and sys.stdout.isatty()
+ except AttributeError:
+ got_tty=False
+if(not got_tty and os.environ.get('TERM','dumb')!='msys')or _nocolor:
+ colors_lst['USE']=False
+def get_term_cols():
+ return 80
+try:
+ import struct,fcntl,termios
+except ImportError:
+ pass
+else:
+ if got_tty:
+ def get_term_cols_real():
+ dummy_lines,cols=struct.unpack("HHHH",fcntl.ioctl(sys.stderr.fileno(),termios.TIOCGWINSZ,struct.pack("HHHH",0,0,0,0)))[:2]
+ return cols
+ try:
+ get_term_cols_real()
+ except Exception:
+ pass
+ else:
+ get_term_cols=get_term_cols_real
+get_term_cols.__doc__="""
+ Get the console width in characters.
+
+ :return: the number of characters per line
+ :rtype: int
+ """
+def get_color(cl):
+ if not colors_lst['USE']:return''
+ return colors_lst.get(cl,'')
+class color_dict(object):
+ def __getattr__(self,a):
+ return get_color(a)
+ def __call__(self,a):
+ return get_color(a)
+colors=color_dict()
+re_log=re.compile(r'(\w+): (.*)',re.M)
+class log_filter(logging.Filter):
+ def __init__(self,name=None):
+ pass
+ def filter(self,rec):
+ rec.c1=colors.PINK
+ rec.c2=colors.NORMAL
+ rec.zone=rec.module
+ if rec.levelno>=logging.INFO:
+ if rec.levelno>=logging.ERROR:
+ rec.c1=colors.RED
+ elif rec.levelno>=logging.WARNING:
+ rec.c1=colors.YELLOW
+ else:
+ rec.c1=colors.GREEN
+ return True
+ m=re_log.match(rec.msg)
+ if m:
+ rec.zone=m.group(1)
+ rec.msg=m.group(2)
+ if zones:
+ return getattr(rec,'zone','')in zones or'*'in zones
+ elif not verbose>2:
+ return False
+ return True
+class formatter(logging.Formatter):
+ def __init__(self):
+ logging.Formatter.__init__(self,LOG_FORMAT,HOUR_FORMAT)
+ def format(self,rec):
+ if rec.levelno>=logging.WARNING or rec.levelno==logging.INFO:
+ try:
+ msg=rec.msg.decode('utf-8')
+ except Exception:
+ msg=rec.msg
+ return'%s%s%s'%(rec.c1,msg,rec.c2)
+ return logging.Formatter.format(self,rec)
+log=None
+def debug(*k,**kw):
+ if verbose:
+ k=list(k)
+ k[0]=k[0].replace('\n',' ')
+ global log
+ log.debug(*k,**kw)
+def error(*k,**kw):
+ global log
+ log.error(*k,**kw)
+ if verbose>2:
+ st=traceback.extract_stack()
+ if st:
+ st=st[:-1]
+ buf=[]
+ for filename,lineno,name,line in st:
+ buf.append(' File "%s", line %d, in %s'%(filename,lineno,name))
+ if line:
+ buf.append(' %s'%line.strip())
+ if buf:log.error("\n".join(buf))
+def warn(*k,**kw):
+ global log
+ log.warn(*k,**kw)
+def info(*k,**kw):
+ global log
+ log.info(*k,**kw)
+def init_log():
+ global log
+ log=logging.getLogger('waflib')
+ log.handlers=[]
+ log.filters=[]
+ hdlr=logging.StreamHandler()
+ hdlr.setFormatter(formatter())
+ log.addHandler(hdlr)
+ log.addFilter(log_filter())
+ log.setLevel(logging.DEBUG)
+def make_logger(path,name):
+ logger=logging.getLogger(name)
+ hdlr=logging.FileHandler(path,'w')
+ formatter=logging.Formatter('%(message)s')
+ hdlr.setFormatter(formatter)
+ logger.addHandler(hdlr)
+ logger.setLevel(logging.DEBUG)
+ return logger
+def make_mem_logger(name,to_log,size=10000):
+ from logging.handlers import MemoryHandler
+ logger=logging.getLogger(name)
+ hdlr=MemoryHandler(size,target=to_log)
+ formatter=logging.Formatter('%(message)s')
+ hdlr.setFormatter(formatter)
+ logger.addHandler(hdlr)
+ logger.memhandler=hdlr
+ logger.setLevel(logging.DEBUG)
+ return logger
+def pprint(col,str,label='',sep='\n'):
+ sys.stderr.write("%s%s%s %s%s"%(colors(col),str,colors.NORMAL,label,sep))
--- /dev/null
+#! /usr/bin/env python
+# encoding: utf-8
+# WARNING! Do not edit! http://waf.googlecode.com/git/docs/wafbook/single.html#_obtaining_the_waf_file
+
+import os,re,sys,shutil
+from waflib import Utils,Errors
+exclude_regs='''
+**/*~
+**/#*#
+**/.#*
+**/%*%
+**/._*
+**/CVS
+**/CVS/**
+**/.cvsignore
+**/SCCS
+**/SCCS/**
+**/vssver.scc
+**/.svn
+**/.svn/**
+**/BitKeeper
+**/.git
+**/.git/**
+**/.gitignore
+**/.bzr
+**/.bzrignore
+**/.bzr/**
+**/.hg
+**/.hg/**
+**/_MTN
+**/_MTN/**
+**/.arch-ids
+**/{arch}
+**/_darcs
+**/_darcs/**
+**/.DS_Store'''
+def split_path(path):
+ return path.split('/')
+def split_path_cygwin(path):
+ if path.startswith('//'):
+ ret=path.split('/')[2:]
+ ret[0]='/'+ret[0]
+ return ret
+ return path.split('/')
+re_sp=re.compile('[/\\\\]')
+def split_path_win32(path):
+ if path.startswith('\\\\'):
+ ret=re.split(re_sp,path)[2:]
+ ret[0]='\\'+ret[0]
+ return ret
+ return re.split(re_sp,path)
+if sys.platform=='cygwin':
+ split_path=split_path_cygwin
+elif Utils.is_win32:
+ split_path=split_path_win32
+class Node(object):
+ __slots__=('name','sig','children','parent','cache_abspath','cache_isdir','cache_sig')
+ def __init__(self,name,parent):
+ self.name=name
+ self.parent=parent
+ if parent:
+ if name in parent.children:
+ raise Errors.WafError('node %s exists in the parent files %r already'%(name,parent))
+ parent.children[name]=self
+ def __setstate__(self,data):
+ self.name=data[0]
+ self.parent=data[1]
+ if data[2]is not None:
+ self.children=data[2]
+ if data[3]is not None:
+ self.sig=data[3]
+ def __getstate__(self):
+ return(self.name,self.parent,getattr(self,'children',None),getattr(self,'sig',None))
+ def __str__(self):
+ return self.name
+ def __repr__(self):
+ return self.abspath()
+ def __hash__(self):
+ return id(self)
+ def __eq__(self,node):
+ return id(self)==id(node)
+ def __copy__(self):
+ raise Errors.WafError('nodes are not supposed to be copied')
+ def read(self,flags='r',encoding='ISO8859-1'):
+ return Utils.readf(self.abspath(),flags,encoding)
+ def write(self,data,flags='w',encoding='ISO8859-1'):
+ Utils.writef(self.abspath(),data,flags,encoding)
+ def chmod(self,val):
+ os.chmod(self.abspath(),val)
+ def delete(self):
+ try:
+ if getattr(self,'children',None):
+ shutil.rmtree(self.abspath())
+ else:
+ os.unlink(self.abspath())
+ except OSError:
+ pass
+ self.evict()
+ def evict(self):
+ del self.parent.children[self.name]
+ def suffix(self):
+ k=max(0,self.name.rfind('.'))
+ return self.name[k:]
+ def height(self):
+ d=self
+ val=-1
+ while d:
+ d=d.parent
+ val+=1
+ return val
+ def listdir(self):
+ lst=Utils.listdir(self.abspath())
+ lst.sort()
+ return lst
+ def mkdir(self):
+ if getattr(self,'cache_isdir',None):
+ return
+ try:
+ self.parent.mkdir()
+ except OSError:
+ pass
+ if self.name:
+ try:
+ os.makedirs(self.abspath())
+ except OSError:
+ pass
+ if not os.path.isdir(self.abspath()):
+ raise Errors.WafError('Could not create the directory %s'%self.abspath())
+ try:
+ self.children
+ except AttributeError:
+ self.children={}
+ self.cache_isdir=True
+ def find_node(self,lst):
+ if isinstance(lst,str):
+ lst=[x for x in split_path(lst)if x and x!='.']
+ cur=self
+ for x in lst:
+ if x=='..':
+ cur=cur.parent or cur
+ continue
+ try:
+ ch=cur.children
+ except AttributeError:
+ cur.children={}
+ else:
+ try:
+ cur=cur.children[x]
+ continue
+ except KeyError:
+ pass
+ cur=self.__class__(x,cur)
+ try:
+ os.stat(cur.abspath())
+ except OSError:
+ cur.evict()
+ return None
+ ret=cur
+ try:
+ os.stat(ret.abspath())
+ except OSError:
+ ret.evict()
+ return None
+ try:
+ while not getattr(cur.parent,'cache_isdir',None):
+ cur=cur.parent
+ cur.cache_isdir=True
+ except AttributeError:
+ pass
+ return ret
+ def make_node(self,lst):
+ if isinstance(lst,str):
+ lst=[x for x in split_path(lst)if x and x!='.']
+ cur=self
+ for x in lst:
+ if x=='..':
+ cur=cur.parent or cur
+ continue
+ if getattr(cur,'children',{}):
+ if x in cur.children:
+ cur=cur.children[x]
+ continue
+ else:
+ cur.children={}
+ cur=self.__class__(x,cur)
+ return cur
+ def search_node(self,lst):
+ if isinstance(lst,str):
+ lst=[x for x in split_path(lst)if x and x!='.']
+ cur=self
+ for x in lst:
+ if x=='..':
+ cur=cur.parent or cur
+ else:
+ try:
+ cur=cur.children[x]
+ except(AttributeError,KeyError):
+ return None
+ return cur
+ def path_from(self,node):
+ c1=self
+ c2=node
+ c1h=c1.height()
+ c2h=c2.height()
+ lst=[]
+ up=0
+ while c1h>c2h:
+ lst.append(c1.name)
+ c1=c1.parent
+ c1h-=1
+ while c2h>c1h:
+ up+=1
+ c2=c2.parent
+ c2h-=1
+ while id(c1)!=id(c2):
+ lst.append(c1.name)
+ up+=1
+ c1=c1.parent
+ c2=c2.parent
+ for i in range(up):
+ lst.append('..')
+ lst.reverse()
+ return os.sep.join(lst)or'.'
+ def abspath(self):
+ try:
+ return self.cache_abspath
+ except AttributeError:
+ pass
+ if os.sep=='/':
+ if not self.parent:
+ val=os.sep
+ elif not self.parent.name:
+ val=os.sep+self.name
+ else:
+ val=self.parent.abspath()+os.sep+self.name
+ else:
+ if not self.parent:
+ val=''
+ elif not self.parent.name:
+ val=self.name+os.sep
+ else:
+ val=self.parent.abspath().rstrip(os.sep)+os.sep+self.name
+ self.cache_abspath=val
+ return val
+ def is_child_of(self,node):
+ p=self
+ diff=self.height()-node.height()
+ while diff>0:
+ diff-=1
+ p=p.parent
+ return id(p)==id(node)
+ def ant_iter(self,accept=None,maxdepth=25,pats=[],dir=False,src=True,remove=True):
+ dircont=self.listdir()
+ dircont.sort()
+ try:
+ lst=set(self.children.keys())
+ except AttributeError:
+ self.children={}
+ else:
+ if remove:
+ for x in lst-set(dircont):
+ self.children[x].evict()
+ for name in dircont:
+ npats=accept(name,pats)
+ if npats and npats[0]:
+ accepted=[]in npats[0]
+ node=self.make_node([name])
+ isdir=os.path.isdir(node.abspath())
+ if accepted:
+ if isdir:
+ if dir:
+ yield node
+ else:
+ if src:
+ yield node
+ if getattr(node,'cache_isdir',None)or isdir:
+ node.cache_isdir=True
+ if maxdepth:
+ for k in node.ant_iter(accept=accept,maxdepth=maxdepth-1,pats=npats,dir=dir,src=src,remove=remove):
+ yield k
+ raise StopIteration
+ def ant_glob(self,*k,**kw):
+ src=kw.get('src',True)
+ dir=kw.get('dir',False)
+ excl=kw.get('excl',exclude_regs)
+ incl=k and k[0]or kw.get('incl','**')
+ reflags=kw.get('ignorecase',0)and re.I
+ def to_pat(s):
+ lst=Utils.to_list(s)
+ ret=[]
+ for x in lst:
+ x=x.replace('\\','/').replace('//','/')
+ if x.endswith('/'):
+ x+='**'
+ lst2=x.split('/')
+ accu=[]
+ for k in lst2:
+ if k=='**':
+ accu.append(k)
+ else:
+ k=k.replace('.','[.]').replace('*','.*').replace('?','.').replace('+','\\+')
+ k='^%s$'%k
+ try:
+ accu.append(re.compile(k,flags=reflags))
+ except Exception ,e:
+ raise Errors.WafError("Invalid pattern: %s"%k,e)
+ ret.append(accu)
+ return ret
+ def filtre(name,nn):
+ ret=[]
+ for lst in nn:
+ if not lst:
+ pass
+ elif lst[0]=='**':
+ ret.append(lst)
+ if len(lst)>1:
+ if lst[1].match(name):
+ ret.append(lst[2:])
+ else:
+ ret.append([])
+ elif lst[0].match(name):
+ ret.append(lst[1:])
+ return ret
+ def accept(name,pats):
+ nacc=filtre(name,pats[0])
+ nrej=filtre(name,pats[1])
+ if[]in nrej:
+ nacc=[]
+ return[nacc,nrej]
+ ret=[x for x in self.ant_iter(accept=accept,pats=[to_pat(incl),to_pat(excl)],maxdepth=25,dir=dir,src=src,remove=kw.get('remove',True))]
+ if kw.get('flat',False):
+ return' '.join([x.path_from(self)for x in ret])
+ return ret
+ def is_src(self):
+ cur=self
+ x=id(self.ctx.srcnode)
+ y=id(self.ctx.bldnode)
+ while cur.parent:
+ if id(cur)==y:
+ return False
+ if id(cur)==x:
+ return True
+ cur=cur.parent
+ return False
+ def is_bld(self):
+ cur=self
+ y=id(self.ctx.bldnode)
+ while cur.parent:
+ if id(cur)==y:
+ return True
+ cur=cur.parent
+ return False
+ def get_src(self):
+ cur=self
+ x=id(self.ctx.srcnode)
+ y=id(self.ctx.bldnode)
+ lst=[]
+ while cur.parent:
+ if id(cur)==y:
+ lst.reverse()
+ return self.ctx.srcnode.make_node(lst)
+ if id(cur)==x:
+ return self
+ lst.append(cur.name)
+ cur=cur.parent
+ return self
+ def get_bld(self):
+ cur=self
+ x=id(self.ctx.srcnode)
+ y=id(self.ctx.bldnode)
+ lst=[]
+ while cur.parent:
+ if id(cur)==y:
+ return self
+ if id(cur)==x:
+ lst.reverse()
+ return self.ctx.bldnode.make_node(lst)
+ lst.append(cur.name)
+ cur=cur.parent
+ lst.reverse()
+ if lst and Utils.is_win32 and len(lst[0])==2 and lst[0].endswith(':'):
+ lst[0]=lst[0][0]
+ return self.ctx.bldnode.make_node(['__root__']+lst)
+ def find_resource(self,lst):
+ if isinstance(lst,str):
+ lst=[x for x in split_path(lst)if x and x!='.']
+ node=self.get_bld().search_node(lst)
+ if not node:
+ self=self.get_src()
+ node=self.find_node(lst)
+ if node:
+ if os.path.isdir(node.abspath()):
+ return None
+ return node
+ def find_or_declare(self,lst):
+ if isinstance(lst,str):
+ lst=[x for x in split_path(lst)if x and x!='.']
+ node=self.get_bld().search_node(lst)
+ if node:
+ if not os.path.isfile(node.abspath()):
+ node.sig=None
+ node.parent.mkdir()
+ return node
+ self=self.get_src()
+ node=self.find_node(lst)
+ if node:
+ if not os.path.isfile(node.abspath()):
+ node.sig=None
+ node.parent.mkdir()
+ return node
+ node=self.get_bld().make_node(lst)
+ node.parent.mkdir()
+ return node
+ def find_dir(self,lst):
+ if isinstance(lst,str):
+ lst=[x for x in split_path(lst)if x and x!='.']
+ node=self.find_node(lst)
+ try:
+ if not os.path.isdir(node.abspath()):
+ return None
+ except(OSError,AttributeError):
+ return None
+ return node
+ def change_ext(self,ext,ext_in=None):
+ name=self.name
+ if ext_in is None:
+ k=name.rfind('.')
+ if k>=0:
+ name=name[:k]+ext
+ else:
+ name=name+ext
+ else:
+ name=name[:-len(ext_in)]+ext
+ return self.parent.find_or_declare([name])
+ def nice_path(self,env=None):
+ return self.path_from(self.ctx.launch_node())
+ def bldpath(self):
+ return self.path_from(self.ctx.bldnode)
+ def srcpath(self):
+ return self.path_from(self.ctx.srcnode)
+ def relpath(self):
+ cur=self
+ x=id(self.ctx.bldnode)
+ while cur.parent:
+ if id(cur)==x:
+ return self.bldpath()
+ cur=cur.parent
+ return self.srcpath()
+ def bld_dir(self):
+ return self.parent.bldpath()
+ def bld_base(self):
+ s=os.path.splitext(self.name)[0]
+ return self.bld_dir()+os.sep+s
+ def get_bld_sig(self):
+ try:
+ return self.cache_sig
+ except AttributeError:
+ pass
+ if not self.is_bld()or self.ctx.bldnode is self.ctx.srcnode:
+ self.sig=Utils.h_file(self.abspath())
+ self.cache_sig=ret=self.sig
+ return ret
+ search=search_node
+pickle_lock=Utils.threading.Lock()
+class Nod3(Node):
+ pass
--- /dev/null
+#! /usr/bin/env python
+# encoding: utf-8
+# WARNING! Do not edit! http://waf.googlecode.com/git/docs/wafbook/single.html#_obtaining_the_waf_file
+
+import os,tempfile,optparse,sys,re
+from waflib import Logs,Utils,Context
+cmds='distclean configure build install clean uninstall check dist distcheck'.split()
+options={}
+commands=[]
+lockfile=os.environ.get('WAFLOCK','.lock-waf_%s_build'%sys.platform)
+try:cache_global=os.path.abspath(os.environ['WAFCACHE'])
+except KeyError:cache_global=''
+platform=Utils.unversioned_sys_platform()
+class opt_parser(optparse.OptionParser):
+ def __init__(self,ctx):
+ optparse.OptionParser.__init__(self,conflict_handler="resolve",version='waf %s (%s)'%(Context.WAFVERSION,Context.WAFREVISION))
+ self.formatter.width=Logs.get_term_cols()
+ p=self.add_option
+ self.ctx=ctx
+ jobs=ctx.jobs()
+ p('-j','--jobs',dest='jobs',default=jobs,type='int',help='amount of parallel jobs (%r)'%jobs)
+ p('-k','--keep',dest='keep',default=0,action='count',help='keep running happily even if errors are found')
+ p('-v','--verbose',dest='verbose',default=0,action='count',help='verbosity level -v -vv or -vvv [default: 0]')
+ p('--nocache',dest='nocache',default=False,action='store_true',help='ignore the WAFCACHE (if set)')
+ p('--zones',dest='zones',default='',action='store',help='debugging zones (task_gen, deps, tasks, etc)')
+ gr=optparse.OptionGroup(self,'configure options')
+ self.add_option_group(gr)
+ gr.add_option('-o','--out',action='store',default='',help='build dir for the project',dest='out')
+ gr.add_option('-t','--top',action='store',default='',help='src dir for the project',dest='top')
+ default_prefix=os.environ.get('PREFIX')
+ if not default_prefix:
+ if platform=='win32':
+ d=tempfile.gettempdir()
+ default_prefix=d[0].upper()+d[1:]
+ else:
+ default_prefix='/usr/local/'
+ gr.add_option('--prefix',dest='prefix',default=default_prefix,help='installation prefix [default: %r]'%default_prefix)
+ gr.add_option('--download',dest='download',default=False,action='store_true',help='try to download the tools if missing')
+ gr=optparse.OptionGroup(self,'build and install options')
+ self.add_option_group(gr)
+ gr.add_option('-p','--progress',dest='progress_bar',default=0,action='count',help='-p: progress bar; -pp: ide output')
+ gr.add_option('--targets',dest='targets',default='',action='store',help='task generators, e.g. "target1,target2"')
+ gr=optparse.OptionGroup(self,'step options')
+ self.add_option_group(gr)
+ gr.add_option('--files',dest='files',default='',action='store',help='files to process, by regexp, e.g. "*/main.c,*/test/main.o"')
+ default_destdir=os.environ.get('DESTDIR','')
+ gr=optparse.OptionGroup(self,'install/uninstall options')
+ self.add_option_group(gr)
+ gr.add_option('--destdir',help='installation root [default: %r]'%default_destdir,default=default_destdir,dest='destdir')
+ gr.add_option('-f','--force',dest='force',default=False,action='store_true',help='force file installation')
+ gr.add_option('--distcheck-args',help='arguments to pass to distcheck',default=None,action='store')
+ def get_usage(self):
+ cmds_str={}
+ for cls in Context.classes:
+ if not cls.cmd or cls.cmd=='options':
+ continue
+ s=cls.__doc__ or''
+ cmds_str[cls.cmd]=s
+ if Context.g_module:
+ for(k,v)in Context.g_module.__dict__.items():
+ if k in['options','init','shutdown']:
+ continue
+ if type(v)is type(Context.create_context):
+ if v.__doc__ and not k.startswith('_'):
+ cmds_str[k]=v.__doc__
+ just=0
+ for k in cmds_str:
+ just=max(just,len(k))
+ lst=[' %s: %s'%(k.ljust(just),v)for(k,v)in cmds_str.items()]
+ lst.sort()
+ ret='\n'.join(lst)
+ return'''waf [commands] [options]
+
+Main commands (example: ./waf build -j4)
+%s
+'''%ret
+class OptionsContext(Context.Context):
+ cmd='options'
+ fun='options'
+ def __init__(self,**kw):
+ super(OptionsContext,self).__init__(**kw)
+ self.parser=opt_parser(self)
+ self.option_groups={}
+ def jobs(self):
+ count=int(os.environ.get('JOBS',0))
+ if count<1:
+ if'NUMBER_OF_PROCESSORS'in os.environ:
+ count=int(os.environ.get('NUMBER_OF_PROCESSORS',1))
+ else:
+ if hasattr(os,'sysconf_names'):
+ if'SC_NPROCESSORS_ONLN'in os.sysconf_names:
+ count=int(os.sysconf('SC_NPROCESSORS_ONLN'))
+ elif'SC_NPROCESSORS_CONF'in os.sysconf_names:
+ count=int(os.sysconf('SC_NPROCESSORS_CONF'))
+ if not count and os.name not in('nt','java'):
+ try:
+ tmp=self.cmd_and_log(['sysctl','-n','hw.ncpu'],quiet=0)
+ except Exception:
+ pass
+ else:
+ if re.match('^[0-9]+$',tmp):
+ count=int(tmp)
+ if count<1:
+ count=1
+ elif count>1024:
+ count=1024
+ return count
+ def add_option(self,*k,**kw):
+ return self.parser.add_option(*k,**kw)
+ def add_option_group(self,*k,**kw):
+ try:
+ gr=self.option_groups[k[0]]
+ except KeyError:
+ gr=self.parser.add_option_group(*k,**kw)
+ self.option_groups[k[0]]=gr
+ return gr
+ def get_option_group(self,opt_str):
+ try:
+ return self.option_groups[opt_str]
+ except KeyError:
+ for group in self.parser.option_groups:
+ if group.title==opt_str:
+ return group
+ return None
+ def parse_args(self,_args=None):
+ global options,commands
+ (options,leftover_args)=self.parser.parse_args(args=_args)
+ commands=leftover_args
+ if options.destdir:
+ options.destdir=os.path.abspath(os.path.expanduser(options.destdir))
+ if options.verbose>=1:
+ self.load('errcheck')
+ def execute(self):
+ super(OptionsContext,self).execute()
+ self.parse_args()
--- /dev/null
+#! /usr/bin/env python
+# encoding: utf-8
+# WARNING! Do not edit! http://waf.googlecode.com/git/docs/wafbook/single.html#_obtaining_the_waf_file
+
+import random,atexit
+try:
+ from queue import Queue
+except ImportError:
+ from Queue import Queue
+from waflib import Utils,Task,Errors,Logs
+GAP=10
+class TaskConsumer(Utils.threading.Thread):
+ def __init__(self):
+ Utils.threading.Thread.__init__(self)
+ self.ready=Queue()
+ self.setDaemon(1)
+ self.start()
+ def run(self):
+ try:
+ self.loop()
+ except Exception:
+ pass
+ def loop(self):
+ while 1:
+ tsk=self.ready.get()
+ if not isinstance(tsk,Task.TaskBase):
+ tsk(self)
+ else:
+ tsk.process()
+pool=Queue()
+def get_pool():
+ try:
+ return pool.get(False)
+ except Exception:
+ return TaskConsumer()
+def put_pool(x):
+ pool.put(x)
+def _free_resources():
+ global pool
+ lst=[]
+ while pool.qsize():
+ lst.append(pool.get())
+ for x in lst:
+ x.ready.put(None)
+ for x in lst:
+ x.join()
+ pool=None
+atexit.register(_free_resources)
+class Parallel(object):
+ def __init__(self,bld,j=2):
+ self.numjobs=j
+ self.bld=bld
+ self.outstanding=[]
+ self.frozen=[]
+ self.out=Queue(0)
+ self.count=0
+ self.processed=1
+ self.stop=False
+ self.error=[]
+ self.biter=None
+ self.dirty=False
+ def get_next_task(self):
+ if not self.outstanding:
+ return None
+ return self.outstanding.pop(0)
+ def postpone(self,tsk):
+ if random.randint(0,1):
+ self.frozen.insert(0,tsk)
+ else:
+ self.frozen.append(tsk)
+ def refill_task_list(self):
+ while self.count>self.numjobs*GAP:
+ self.get_out()
+ while not self.outstanding:
+ if self.count:
+ self.get_out()
+ elif self.frozen:
+ try:
+ cond=self.deadlock==self.processed
+ except AttributeError:
+ pass
+ else:
+ if cond:
+ msg='check the build order for the tasks'
+ for tsk in self.frozen:
+ if not tsk.run_after:
+ msg='check the methods runnable_status'
+ break
+ lst=[]
+ for tsk in self.frozen:
+ lst.append('%s\t-> %r'%(repr(tsk),[id(x)for x in tsk.run_after]))
+ raise Errors.WafError('Deadlock detected: %s%s'%(msg,''.join(lst)))
+ self.deadlock=self.processed
+ if self.frozen:
+ self.outstanding+=self.frozen
+ self.frozen=[]
+ elif not self.count:
+ self.outstanding.extend(self.biter.next())
+ self.total=self.bld.total()
+ break
+ def add_more_tasks(self,tsk):
+ if getattr(tsk,'more_tasks',None):
+ self.outstanding+=tsk.more_tasks
+ self.total+=len(tsk.more_tasks)
+ def get_out(self):
+ tsk=self.out.get()
+ if not self.stop:
+ self.add_more_tasks(tsk)
+ self.count-=1
+ self.dirty=True
+ return tsk
+ def error_handler(self,tsk):
+ if not self.bld.keep:
+ self.stop=True
+ self.error.append(tsk)
+ def add_task(self,tsk):
+ try:
+ self.pool
+ except AttributeError:
+ self.init_task_pool()
+ self.ready.put(tsk)
+ def init_task_pool(self):
+ pool=self.pool=[get_pool()for i in range(self.numjobs)]
+ self.ready=Queue(0)
+ def setq(consumer):
+ consumer.ready=self.ready
+ for x in pool:
+ x.ready.put(setq)
+ return pool
+ def free_task_pool(self):
+ def setq(consumer):
+ consumer.ready=Queue(0)
+ self.out.put(self)
+ try:
+ pool=self.pool
+ except AttributeError:
+ pass
+ else:
+ for x in pool:
+ self.ready.put(setq)
+ for x in pool:
+ self.get_out()
+ for x in pool:
+ put_pool(x)
+ self.pool=[]
+ def start(self):
+ self.total=self.bld.total()
+ while not self.stop:
+ self.refill_task_list()
+ tsk=self.get_next_task()
+ if not tsk:
+ if self.count:
+ continue
+ else:
+ break
+ if tsk.hasrun:
+ self.processed+=1
+ continue
+ if self.stop:
+ break
+ try:
+ st=tsk.runnable_status()
+ except Exception:
+ self.processed+=1
+ tsk.err_msg=Utils.ex_stack()
+ if not self.stop and self.bld.keep:
+ tsk.hasrun=Task.SKIPPED
+ if self.bld.keep==1:
+ if Logs.verbose>1 or not self.error:
+ self.error.append(tsk)
+ self.stop=True
+ else:
+ if Logs.verbose>1:
+ self.error.append(tsk)
+ continue
+ tsk.hasrun=Task.EXCEPTION
+ self.error_handler(tsk)
+ continue
+ if st==Task.ASK_LATER:
+ self.postpone(tsk)
+ elif st==Task.SKIP_ME:
+ self.processed+=1
+ tsk.hasrun=Task.SKIPPED
+ self.add_more_tasks(tsk)
+ else:
+ tsk.position=(self.processed,self.total)
+ self.count+=1
+ tsk.master=self
+ self.processed+=1
+ if self.numjobs==1:
+ tsk.process()
+ else:
+ self.add_task(tsk)
+ while self.error and self.count:
+ self.get_out()
+ assert(self.count==0 or self.stop)
+ self.free_task_pool()
--- /dev/null
+#! /usr/bin/env python
+# encoding: utf-8
+# WARNING! Do not edit! http://waf.googlecode.com/git/docs/wafbook/single.html#_obtaining_the_waf_file
+
+import os,shlex,shutil,traceback,errno,sys,stat
+from waflib import Utils,Configure,Logs,Options,ConfigSet,Context,Errors,Build,Node
+build_dir_override=None
+no_climb_commands=['configure']
+default_cmd="build"
+def waf_entry_point(current_directory,version,wafdir):
+ Logs.init_log()
+ if Context.WAFVERSION!=version:
+ Logs.error('Waf script %r and library %r do not match (directory %r)'%(version,Context.WAFVERSION,wafdir))
+ sys.exit(1)
+ if'--version'in sys.argv:
+ Context.run_dir=current_directory
+ ctx=Context.create_context('options')
+ ctx.curdir=current_directory
+ ctx.parse_args()
+ sys.exit(0)
+ Context.waf_dir=wafdir
+ Context.launch_dir=current_directory
+ no_climb=os.environ.get('NOCLIMB',None)
+ if not no_climb:
+ for k in no_climb_commands:
+ if k in sys.argv:
+ no_climb=True
+ break
+ cur=current_directory
+ while cur:
+ lst=os.listdir(cur)
+ if Options.lockfile in lst:
+ env=ConfigSet.ConfigSet()
+ try:
+ env.load(os.path.join(cur,Options.lockfile))
+ ino=os.stat(cur)[stat.ST_INO]
+ except Exception:
+ pass
+ else:
+ for x in[env.run_dir,env.top_dir,env.out_dir]:
+ if Utils.is_win32:
+ if cur==x:
+ load=True
+ break
+ else:
+ try:
+ ino2=os.stat(x)[stat.ST_INO]
+ except OSError:
+ pass
+ else:
+ if ino==ino2:
+ load=True
+ break
+ else:
+ Logs.warn('invalid lock file in %s'%cur)
+ load=False
+ if load:
+ Context.run_dir=env.run_dir
+ Context.top_dir=env.top_dir
+ Context.out_dir=env.out_dir
+ break
+ if not Context.run_dir:
+ if Context.WSCRIPT_FILE in lst:
+ Context.run_dir=cur
+ next=os.path.dirname(cur)
+ if next==cur:
+ break
+ cur=next
+ if no_climb:
+ break
+ if not Context.run_dir:
+ if'-h'in sys.argv or'--help'in sys.argv:
+ Logs.warn('No wscript file found: the help message may be incomplete')
+ Context.run_dir=current_directory
+ ctx=Context.create_context('options')
+ ctx.curdir=current_directory
+ ctx.parse_args()
+ sys.exit(0)
+ Logs.error('Waf: Run from a directory containing a file named %r'%Context.WSCRIPT_FILE)
+ sys.exit(1)
+ try:
+ os.chdir(Context.run_dir)
+ except OSError:
+ Logs.error('Waf: The folder %r is unreadable'%Context.run_dir)
+ sys.exit(1)
+ try:
+ set_main_module(Context.run_dir+os.sep+Context.WSCRIPT_FILE)
+ except Errors.WafError ,e:
+ Logs.pprint('RED',e.verbose_msg)
+ Logs.error(str(e))
+ sys.exit(1)
+ except Exception ,e:
+ Logs.error('Waf: The wscript in %r is unreadable'%Context.run_dir,e)
+ traceback.print_exc(file=sys.stdout)
+ sys.exit(2)
+ try:
+ run_commands()
+ except Errors.WafError ,e:
+ if Logs.verbose>1:
+ Logs.pprint('RED',e.verbose_msg)
+ Logs.error(e.msg)
+ sys.exit(1)
+ except SystemExit:
+ raise
+ except Exception ,e:
+ traceback.print_exc(file=sys.stdout)
+ sys.exit(2)
+ except KeyboardInterrupt:
+ Logs.pprint('RED','Interrupted')
+ sys.exit(68)
+def set_main_module(file_path):
+ Context.g_module=Context.load_module(file_path)
+ Context.g_module.root_path=file_path
+ def set_def(obj):
+ name=obj.__name__
+ if not name in Context.g_module.__dict__:
+ setattr(Context.g_module,name,obj)
+ for k in[update,dist,distclean,distcheck,update]:
+ set_def(k)
+ if not'init'in Context.g_module.__dict__:
+ Context.g_module.init=Utils.nada
+ if not'shutdown'in Context.g_module.__dict__:
+ Context.g_module.shutdown=Utils.nada
+ if not'options'in Context.g_module.__dict__:
+ Context.g_module.options=Utils.nada
+def parse_options():
+ Context.create_context('options').execute()
+ if not Options.commands:
+ Options.commands=[default_cmd]
+ Options.commands=[x for x in Options.commands if x!='options']
+ Logs.verbose=Options.options.verbose
+ Logs.init_log()
+ if Options.options.zones:
+ Logs.zones=Options.options.zones.split(',')
+ if not Logs.verbose:
+ Logs.verbose=1
+ elif Logs.verbose>0:
+ Logs.zones=['runner']
+ if Logs.verbose>2:
+ Logs.zones=['*']
+def run_command(cmd_name):
+ ctx=Context.create_context(cmd_name)
+ ctx.log_timer=Utils.Timer()
+ ctx.options=Options.options
+ ctx.cmd=cmd_name
+ ctx.execute()
+ return ctx
+def run_commands():
+ parse_options()
+ run_command('init')
+ while Options.commands:
+ cmd_name=Options.commands.pop(0)
+ ctx=run_command(cmd_name)
+ Logs.info('%r finished successfully (%s)'%(cmd_name,str(ctx.log_timer)))
+ run_command('shutdown')
+def _can_distclean(name):
+ for k in'.o .moc .exe'.split():
+ if name.endswith(k):
+ return True
+ return False
+def distclean_dir(dirname):
+ for(root,dirs,files)in os.walk(dirname):
+ for f in files:
+ if _can_distclean(f):
+ fname=root+os.sep+f
+ try:
+ os.unlink(fname)
+ except OSError:
+ Logs.warn('Could not remove %r'%fname)
+ for x in[Context.DBFILE,'config.log']:
+ try:
+ os.unlink(x)
+ except OSError:
+ pass
+ try:
+ shutil.rmtree('c4che')
+ except OSError:
+ pass
+def distclean(ctx):
+ '''removes the build directory'''
+ lst=os.listdir('.')
+ for f in lst:
+ if f==Options.lockfile:
+ try:
+ proj=ConfigSet.ConfigSet(f)
+ except IOError:
+ Logs.warn('Could not read %r'%f)
+ continue
+ if proj['out_dir']!=proj['top_dir']:
+ try:
+ shutil.rmtree(proj['out_dir'])
+ except IOError:
+ pass
+ except OSError ,e:
+ if e.errno!=errno.ENOENT:
+ Logs.warn('project %r cannot be removed'%proj[Context.OUT])
+ else:
+ distclean_dir(proj['out_dir'])
+ for k in(proj['out_dir'],proj['top_dir'],proj['run_dir']):
+ try:
+ os.remove(os.path.join(k,Options.lockfile))
+ except OSError ,e:
+ if e.errno!=errno.ENOENT:
+ Logs.warn('file %r cannot be removed'%f)
+ if f.startswith('.waf')and not Options.commands:
+ shutil.rmtree(f,ignore_errors=True)
+class Dist(Context.Context):
+ '''creates an archive containing the project source code'''
+ cmd='dist'
+ fun='dist'
+ algo='tar.bz2'
+ ext_algo={}
+ def execute(self):
+ self.recurse([os.path.dirname(Context.g_module.root_path)])
+ self.archive()
+ def archive(self):
+ import tarfile
+ arch_name=self.get_arch_name()
+ try:
+ self.base_path
+ except AttributeError:
+ self.base_path=self.path
+ node=self.base_path.make_node(arch_name)
+ try:
+ node.delete()
+ except Exception:
+ pass
+ files=self.get_files()
+ if self.algo.startswith('tar.'):
+ tar=tarfile.open(arch_name,'w:'+self.algo.replace('tar.',''))
+ for x in files:
+ self.add_tar_file(x,tar)
+ tar.close()
+ elif self.algo=='zip':
+ import zipfile
+ zip=zipfile.ZipFile(arch_name,'w',compression=zipfile.ZIP_DEFLATED)
+ for x in files:
+ archive_name=self.get_base_name()+'/'+x.path_from(self.base_path)
+ zip.write(x.abspath(),archive_name,zipfile.ZIP_DEFLATED)
+ zip.close()
+ else:
+ self.fatal('Valid algo types are tar.bz2, tar.gz or zip')
+ try:
+ from hashlib import sha1 as sha
+ except ImportError:
+ from sha import sha
+ try:
+ digest=" (sha=%r)"%sha(node.read()).hexdigest()
+ except Exception:
+ digest=''
+ Logs.info('New archive created: %s%s'%(self.arch_name,digest))
+ def get_tar_path(self,node):
+ return node.abspath()
+ def add_tar_file(self,x,tar):
+ p=self.get_tar_path(x)
+ tinfo=tar.gettarinfo(name=p,arcname=self.get_tar_prefix()+'/'+x.path_from(self.base_path))
+ tinfo.uid=0
+ tinfo.gid=0
+ tinfo.uname='root'
+ tinfo.gname='root'
+ fu=None
+ try:
+ fu=open(p,'rb')
+ tar.addfile(tinfo,fileobj=fu)
+ finally:
+ if fu:
+ fu.close()
+ def get_tar_prefix(self):
+ try:
+ return self.tar_prefix
+ except AttributeError:
+ return self.get_base_name()
+ def get_arch_name(self):
+ try:
+ self.arch_name
+ except AttributeError:
+ self.arch_name=self.get_base_name()+'.'+self.ext_algo.get(self.algo,self.algo)
+ return self.arch_name
+ def get_base_name(self):
+ try:
+ self.base_name
+ except AttributeError:
+ appname=getattr(Context.g_module,Context.APPNAME,'noname')
+ version=getattr(Context.g_module,Context.VERSION,'1.0')
+ self.base_name=appname+'-'+version
+ return self.base_name
+ def get_excl(self):
+ try:
+ return self.excl
+ except AttributeError:
+ self.excl=Node.exclude_regs+' **/waf-1.7.* **/.waf-1.7* **/waf3-1.7.* **/.waf3-1.7* **/*~ **/*.rej **/*.orig **/*.pyc **/*.pyo **/*.bak **/*.swp **/.lock-w*'
+ nd=self.root.find_node(Context.out_dir)
+ if nd:
+ self.excl+=' '+nd.path_from(self.base_path)
+ return self.excl
+ def get_files(self):
+ try:
+ files=self.files
+ except AttributeError:
+ files=self.base_path.ant_glob('**/*',excl=self.get_excl())
+ return files
+def dist(ctx):
+ '''makes a tarball for redistributing the sources'''
+ pass
+class DistCheck(Dist):
+ fun='distcheck'
+ cmd='distcheck'
+ def execute(self):
+ self.recurse([os.path.dirname(Context.g_module.root_path)])
+ self.archive()
+ self.check()
+ def check(self):
+ import tempfile,tarfile
+ t=None
+ try:
+ t=tarfile.open(self.get_arch_name())
+ for x in t:
+ t.extract(x)
+ finally:
+ if t:
+ t.close()
+ cfg=[]
+ if Options.options.distcheck_args:
+ cfg=shlex.split(Options.options.distcheck_args)
+ else:
+ cfg=[x for x in sys.argv if x.startswith('-')]
+ instdir=tempfile.mkdtemp('.inst',self.get_base_name())
+ ret=Utils.subprocess.Popen([sys.argv[0],'configure','install','uninstall','--destdir='+instdir]+cfg,cwd=self.get_base_name()).wait()
+ if ret:
+ raise Errors.WafError('distcheck failed with code %i'%ret)
+ if os.path.exists(instdir):
+ raise Errors.WafError('distcheck succeeded, but files were left in %s'%instdir)
+ shutil.rmtree(self.get_base_name())
+def distcheck(ctx):
+ '''checks if the project compiles (tarball from 'dist')'''
+ pass
+def update(ctx):
+ '''updates the plugins from the *waflib/extras* directory'''
+ lst=Options.options.files.split(',')
+ if not lst:
+ lst=[x for x in Utils.listdir(Context.waf_dir+'/waflib/extras')if x.endswith('.py')]
+ for x in lst:
+ tool=x.replace('.py','')
+ try:
+ Configure.download_tool(tool,force=True,ctx=ctx)
+ except Errors.WafError:
+ Logs.error('Could not find the tool %s in the remote repository'%x)
+def autoconfigure(execute_method):
+ def execute(self):
+ if not Configure.autoconfig:
+ return execute_method(self)
+ env=ConfigSet.ConfigSet()
+ do_config=False
+ try:
+ env.load(os.path.join(Context.top_dir,Options.lockfile))
+ except Exception:
+ Logs.warn('Configuring the project')
+ do_config=True
+ else:
+ if env.run_dir!=Context.run_dir:
+ do_config=True
+ else:
+ h=0
+ for f in env['files']:
+ h=hash((h,Utils.readf(f,'rb')))
+ do_config=h!=env.hash
+ if do_config:
+ Options.commands.insert(0,self.cmd)
+ Options.commands.insert(0,'configure')
+ return
+ return execute_method(self)
+ return execute
+Build.BuildContext.execute=autoconfigure(Build.BuildContext.execute)
--- /dev/null
+#! /usr/bin/env python
+# encoding: utf-8
+# WARNING! Do not edit! http://waf.googlecode.com/git/docs/wafbook/single.html#_obtaining_the_waf_file
+
+import os,shutil,re,tempfile
+from waflib import Utils,Logs,Errors
+NOT_RUN=0
+MISSING=1
+CRASHED=2
+EXCEPTION=3
+SKIPPED=8
+SUCCESS=9
+ASK_LATER=-1
+SKIP_ME=-2
+RUN_ME=-3
+COMPILE_TEMPLATE_SHELL='''
+def f(tsk):
+ env = tsk.env
+ gen = tsk.generator
+ bld = gen.bld
+ wd = getattr(tsk, 'cwd', None)
+ p = env.get_flat
+ tsk.last_cmd = cmd = \'\'\' %s \'\'\' % s
+ return tsk.exec_command(cmd, cwd=wd, env=env.env or None)
+'''
+COMPILE_TEMPLATE_NOSHELL='''
+def f(tsk):
+ env = tsk.env
+ gen = tsk.generator
+ bld = gen.bld
+ wd = getattr(tsk, 'cwd', None)
+ def to_list(xx):
+ if isinstance(xx, str): return [xx]
+ return xx
+ tsk.last_cmd = lst = []
+ %s
+ lst = [x for x in lst if x]
+ return tsk.exec_command(lst, cwd=wd, env=env.env or None)
+'''
+def cache_outputs(cls):
+ m1=cls.run
+ def run(self):
+ bld=self.generator.bld
+ if bld.cache_global and not bld.nocache:
+ if self.can_retrieve_cache():
+ return 0
+ return m1(self)
+ cls.run=run
+ m2=cls.post_run
+ def post_run(self):
+ bld=self.generator.bld
+ ret=m2(self)
+ if bld.cache_global and not bld.nocache:
+ self.put_files_cache()
+ return ret
+ cls.post_run=post_run
+ return cls
+classes={}
+class store_task_type(type):
+ def __init__(cls,name,bases,dict):
+ super(store_task_type,cls).__init__(name,bases,dict)
+ name=cls.__name__
+ if name.endswith('_task'):
+ name=name.replace('_task','')
+ if name!='evil'and name!='TaskBase':
+ global classes
+ if getattr(cls,'run_str',None):
+ (f,dvars)=compile_fun(cls.run_str,cls.shell)
+ cls.hcode=cls.run_str
+ cls.run_str=None
+ cls.run=f
+ cls.vars=list(set(cls.vars+dvars))
+ cls.vars.sort()
+ elif getattr(cls,'run',None)and not'hcode'in cls.__dict__:
+ cls.hcode=Utils.h_fun(cls.run)
+ if not getattr(cls,'nocache',None):
+ cls=cache_outputs(cls)
+ getattr(cls,'register',classes)[name]=cls
+evil=store_task_type('evil',(object,),{})
+class TaskBase(evil):
+ color='GREEN'
+ ext_in=[]
+ ext_out=[]
+ before=[]
+ after=[]
+ hcode=''
+ def __init__(self,*k,**kw):
+ self.hasrun=NOT_RUN
+ try:
+ self.generator=kw['generator']
+ except KeyError:
+ self.generator=self
+ def __repr__(self):
+ return'\n\t{task %r: %s %s}'%(self.__class__.__name__,id(self),str(getattr(self,'fun','')))
+ def __str__(self):
+ if hasattr(self,'fun'):
+ return'executing: %s\n'%self.fun.__name__
+ return self.__class__.__name__+'\n'
+ def __hash__(self):
+ return id(self)
+ def exec_command(self,cmd,**kw):
+ bld=self.generator.bld
+ try:
+ if not kw.get('cwd',None):
+ kw['cwd']=bld.cwd
+ except AttributeError:
+ bld.cwd=kw['cwd']=bld.variant_dir
+ return bld.exec_command(cmd,**kw)
+ def runnable_status(self):
+ return RUN_ME
+ def process(self):
+ m=self.master
+ if m.stop:
+ m.out.put(self)
+ return
+ try:
+ del self.generator.bld.task_sigs[self.uid()]
+ except KeyError:
+ pass
+ try:
+ self.generator.bld.returned_tasks.append(self)
+ self.log_display(self.generator.bld)
+ ret=self.run()
+ except Exception:
+ self.err_msg=Utils.ex_stack()
+ self.hasrun=EXCEPTION
+ m.error_handler(self)
+ m.out.put(self)
+ return
+ if ret:
+ self.err_code=ret
+ self.hasrun=CRASHED
+ else:
+ try:
+ self.post_run()
+ except Errors.WafError:
+ pass
+ except Exception:
+ self.err_msg=Utils.ex_stack()
+ self.hasrun=EXCEPTION
+ else:
+ self.hasrun=SUCCESS
+ if self.hasrun!=SUCCESS:
+ m.error_handler(self)
+ m.out.put(self)
+ def run(self):
+ if hasattr(self,'fun'):
+ return self.fun(self)
+ return 0
+ def post_run(self):
+ pass
+ def log_display(self,bld):
+ bld.to_log(self.display())
+ def display(self):
+ col1=Logs.colors(self.color)
+ col2=Logs.colors.NORMAL
+ master=self.master
+ def cur():
+ tmp=-1
+ if hasattr(master,'ready'):
+ tmp-=master.ready.qsize()
+ return master.processed+tmp
+ if self.generator.bld.progress_bar==1:
+ return self.generator.bld.progress_line(cur(),master.total,col1,col2)
+ if self.generator.bld.progress_bar==2:
+ ela=str(self.generator.bld.timer)
+ try:
+ ins=','.join([n.name for n in self.inputs])
+ except AttributeError:
+ ins=''
+ try:
+ outs=','.join([n.name for n in self.outputs])
+ except AttributeError:
+ outs=''
+ return'|Total %s|Current %s|Inputs %s|Outputs %s|Time %s|\n'%(master.total,cur(),ins,outs,ela)
+ s=str(self)
+ if not s:
+ return None
+ total=master.total
+ n=len(str(total))
+ fs='[%%%dd/%%%dd] %%s%%s%%s'%(n,n)
+ return fs%(cur(),total,col1,s,col2)
+ def attr(self,att,default=None):
+ ret=getattr(self,att,self)
+ if ret is self:return getattr(self.__class__,att,default)
+ return ret
+ def hash_constraints(self):
+ cls=self.__class__
+ tup=(str(cls.before),str(cls.after),str(cls.ext_in),str(cls.ext_out),cls.__name__,cls.hcode)
+ h=hash(tup)
+ return h
+ def format_error(self):
+ msg=getattr(self,'last_cmd','')
+ name=getattr(self.generator,'name','')
+ if getattr(self,"err_msg",None):
+ return self.err_msg
+ elif not self.hasrun:
+ return'task in %r was not executed for some reason: %r'%(name,self)
+ elif self.hasrun==CRASHED:
+ try:
+ return' -> task in %r failed (exit status %r): %r\n%r'%(name,self.err_code,self,msg)
+ except AttributeError:
+ return' -> task in %r failed: %r\n%r'%(name,self,msg)
+ elif self.hasrun==MISSING:
+ return' -> missing files in %r: %r\n%r'%(name,self,msg)
+ else:
+ return'invalid status for task in %r: %r'%(name,self.hasrun)
+ def colon(self,var1,var2):
+ tmp=self.env[var1]
+ if isinstance(var2,str):
+ it=self.env[var2]
+ else:
+ it=var2
+ if isinstance(tmp,str):
+ return[tmp%x for x in it]
+ else:
+ if Logs.verbose and not tmp and it:
+ Logs.warn('Missing env variable %r for task %r (generator %r)'%(var1,self,self.generator))
+ lst=[]
+ for y in it:
+ lst.extend(tmp)
+ lst.append(y)
+ return lst
+class Task(TaskBase):
+ vars=[]
+ shell=False
+ def __init__(self,*k,**kw):
+ TaskBase.__init__(self,*k,**kw)
+ self.env=kw['env']
+ self.inputs=[]
+ self.outputs=[]
+ self.dep_nodes=[]
+ self.run_after=set([])
+ def __str__(self):
+ env=self.env
+ src_str=' '.join([a.nice_path()for a in self.inputs])
+ tgt_str=' '.join([a.nice_path()for a in self.outputs])
+ if self.outputs:sep=' -> '
+ else:sep=''
+ return'%s: %s%s%s\n'%(self.__class__.__name__.replace('_task',''),src_str,sep,tgt_str)
+ def __repr__(self):
+ try:
+ ins=",".join([x.name for x in self.inputs])
+ outs=",".join([x.name for x in self.outputs])
+ except AttributeError:
+ ins=",".join([str(x)for x in self.inputs])
+ outs=",".join([str(x)for x in self.outputs])
+ return"".join(['\n\t{task %r: '%id(self),self.__class__.__name__," ",ins," -> ",outs,'}'])
+ def uid(self):
+ try:
+ return self.uid_
+ except AttributeError:
+ m=Utils.md5()
+ up=m.update
+ up(self.__class__.__name__)
+ for x in self.inputs+self.outputs:
+ up(x.abspath())
+ self.uid_=m.digest()
+ return self.uid_
+ def set_inputs(self,inp):
+ if isinstance(inp,list):self.inputs+=inp
+ else:self.inputs.append(inp)
+ def set_outputs(self,out):
+ if isinstance(out,list):self.outputs+=out
+ else:self.outputs.append(out)
+ def set_run_after(self,task):
+ assert isinstance(task,TaskBase)
+ self.run_after.add(task)
+ def signature(self):
+ try:return self.cache_sig
+ except AttributeError:pass
+ self.m=Utils.md5()
+ self.m.update(self.hcode)
+ self.sig_explicit_deps()
+ self.sig_vars()
+ if self.scan:
+ try:
+ self.sig_implicit_deps()
+ except Errors.TaskRescan:
+ return self.signature()
+ ret=self.cache_sig=self.m.digest()
+ return ret
+ def runnable_status(self):
+ for t in self.run_after:
+ if not t.hasrun:
+ return ASK_LATER
+ bld=self.generator.bld
+ try:
+ new_sig=self.signature()
+ except Errors.TaskNotReady:
+ return ASK_LATER
+ key=self.uid()
+ try:
+ prev_sig=bld.task_sigs[key]
+ except KeyError:
+ Logs.debug("task: task %r must run as it was never run before or the task code changed"%self)
+ return RUN_ME
+ for node in self.outputs:
+ try:
+ if node.sig!=new_sig:
+ return RUN_ME
+ except AttributeError:
+ Logs.debug("task: task %r must run as the output nodes do not exist"%self)
+ return RUN_ME
+ if new_sig!=prev_sig:
+ return RUN_ME
+ return SKIP_ME
+ def post_run(self):
+ bld=self.generator.bld
+ sig=self.signature()
+ for node in self.outputs:
+ try:
+ os.stat(node.abspath())
+ except OSError:
+ self.hasrun=MISSING
+ self.err_msg='-> missing file: %r'%node.abspath()
+ raise Errors.WafError(self.err_msg)
+ node.sig=sig
+ bld.task_sigs[self.uid()]=self.cache_sig
+ def sig_explicit_deps(self):
+ bld=self.generator.bld
+ upd=self.m.update
+ for x in self.inputs+self.dep_nodes:
+ try:
+ upd(x.get_bld_sig())
+ except(AttributeError,TypeError):
+ raise Errors.WafError('Missing node signature for %r (required by %r)'%(x,self))
+ if bld.deps_man:
+ additional_deps=bld.deps_man
+ for x in self.inputs+self.outputs:
+ try:
+ d=additional_deps[id(x)]
+ except KeyError:
+ continue
+ for v in d:
+ if isinstance(v,bld.root.__class__):
+ try:
+ v=v.get_bld_sig()
+ except AttributeError:
+ raise Errors.WafError('Missing node signature for %r (required by %r)'%(v,self))
+ elif hasattr(v,'__call__'):
+ v=v()
+ upd(v)
+ return self.m.digest()
+ def sig_vars(self):
+ bld=self.generator.bld
+ env=self.env
+ upd=self.m.update
+ act_sig=bld.hash_env_vars(env,self.__class__.vars)
+ upd(act_sig)
+ dep_vars=getattr(self,'dep_vars',None)
+ if dep_vars:
+ upd(bld.hash_env_vars(env,dep_vars))
+ return self.m.digest()
+ scan=None
+ def sig_implicit_deps(self):
+ bld=self.generator.bld
+ key=self.uid()
+ prev=bld.task_sigs.get((key,'imp'),[])
+ if prev:
+ try:
+ if prev==self.compute_sig_implicit_deps():
+ return prev
+ except Exception:
+ for x in bld.node_deps.get(self.uid(),[]):
+ if x.is_child_of(bld.srcnode):
+ try:
+ os.stat(x.abspath())
+ except OSError:
+ try:
+ del x.parent.children[x.name]
+ except KeyError:
+ pass
+ del bld.task_sigs[(key,'imp')]
+ raise Errors.TaskRescan('rescan')
+ (nodes,names)=self.scan()
+ if Logs.verbose:
+ Logs.debug('deps: scanner for %s returned %s %s'%(str(self),str(nodes),str(names)))
+ bld.node_deps[key]=nodes
+ bld.raw_deps[key]=names
+ self.are_implicit_nodes_ready()
+ try:
+ bld.task_sigs[(key,'imp')]=sig=self.compute_sig_implicit_deps()
+ except Exception:
+ if Logs.verbose:
+ for k in bld.node_deps.get(self.uid(),[]):
+ try:
+ k.get_bld_sig()
+ except Exception:
+ Logs.warn('Missing signature for node %r (may cause rebuilds)'%k)
+ else:
+ return sig
+ def compute_sig_implicit_deps(self):
+ upd=self.m.update
+ bld=self.generator.bld
+ self.are_implicit_nodes_ready()
+ for k in bld.node_deps.get(self.uid(),[]):
+ upd(k.get_bld_sig())
+ return self.m.digest()
+ def are_implicit_nodes_ready(self):
+ bld=self.generator.bld
+ try:
+ cache=bld.dct_implicit_nodes
+ except AttributeError:
+ bld.dct_implicit_nodes=cache={}
+ try:
+ dct=cache[bld.cur]
+ except KeyError:
+ dct=cache[bld.cur]={}
+ for tsk in bld.cur_tasks:
+ for x in tsk.outputs:
+ dct[x]=tsk
+ modified=False
+ for x in bld.node_deps.get(self.uid(),[]):
+ if x in dct:
+ self.run_after.add(dct[x])
+ modified=True
+ if modified:
+ for tsk in self.run_after:
+ if not tsk.hasrun:
+ raise Errors.TaskNotReady('not ready')
+ def can_retrieve_cache(self):
+ if not getattr(self,'outputs',None):
+ return None
+ sig=self.signature()
+ ssig=Utils.to_hex(self.uid())+Utils.to_hex(sig)
+ dname=os.path.join(self.generator.bld.cache_global,ssig)
+ try:
+ t1=os.stat(dname).st_mtime
+ except OSError:
+ return None
+ for node in self.outputs:
+ orig=os.path.join(dname,node.name)
+ try:
+ shutil.copy2(orig,node.abspath())
+ os.utime(orig,None)
+ except(OSError,IOError):
+ Logs.debug('task: failed retrieving file')
+ return None
+ try:
+ t2=os.stat(dname).st_mtime
+ except OSError:
+ return None
+ if t1!=t2:
+ return None
+ for node in self.outputs:
+ node.sig=sig
+ if self.generator.bld.progress_bar<1:
+ self.generator.bld.to_log('restoring from cache %r\n'%node.abspath())
+ self.cached=True
+ return True
+ def put_files_cache(self):
+ if getattr(self,'cached',None):
+ return None
+ if not getattr(self,'outputs',None):
+ return None
+ sig=self.signature()
+ ssig=Utils.to_hex(self.uid())+Utils.to_hex(sig)
+ dname=os.path.join(self.generator.bld.cache_global,ssig)
+ tmpdir=tempfile.mkdtemp(prefix=self.generator.bld.cache_global+os.sep+'waf')
+ try:
+ shutil.rmtree(dname)
+ except Exception:
+ pass
+ try:
+ for node in self.outputs:
+ dest=os.path.join(tmpdir,node.name)
+ shutil.copy2(node.abspath(),dest)
+ except(OSError,IOError):
+ try:
+ shutil.rmtree(tmpdir)
+ except Exception:
+ pass
+ else:
+ try:
+ os.rename(tmpdir,dname)
+ except OSError:
+ try:
+ shutil.rmtree(tmpdir)
+ except Exception:
+ pass
+ else:
+ try:
+ os.chmod(dname,Utils.O755)
+ except Exception:
+ pass
+def is_before(t1,t2):
+ to_list=Utils.to_list
+ for k in to_list(t2.ext_in):
+ if k in to_list(t1.ext_out):
+ return 1
+ if t1.__class__.__name__ in to_list(t2.after):
+ return 1
+ if t2.__class__.__name__ in to_list(t1.before):
+ return 1
+ return 0
+def set_file_constraints(tasks):
+ ins=Utils.defaultdict(set)
+ outs=Utils.defaultdict(set)
+ for x in tasks:
+ for a in getattr(x,'inputs',[])+getattr(x,'dep_nodes',[]):
+ ins[id(a)].add(x)
+ for a in getattr(x,'outputs',[]):
+ outs[id(a)].add(x)
+ links=set(ins.keys()).intersection(outs.keys())
+ for k in links:
+ for a in ins[k]:
+ a.run_after.update(outs[k])
+def set_precedence_constraints(tasks):
+ cstr_groups=Utils.defaultdict(list)
+ for x in tasks:
+ h=x.hash_constraints()
+ cstr_groups[h].append(x)
+ keys=list(cstr_groups.keys())
+ maxi=len(keys)
+ for i in range(maxi):
+ t1=cstr_groups[keys[i]][0]
+ for j in range(i+1,maxi):
+ t2=cstr_groups[keys[j]][0]
+ if is_before(t1,t2):
+ a=i
+ b=j
+ elif is_before(t2,t1):
+ a=j
+ b=i
+ else:
+ continue
+ aval=set(cstr_groups[keys[a]])
+ for x in cstr_groups[keys[b]]:
+ x.run_after.update(aval)
+def funex(c):
+ dc={}
+ exec(c,dc)
+ return dc['f']
+reg_act=re.compile(r"(?P<backslash>\\)|(?P<dollar>\$\$)|(?P<subst>\$\{(?P<var>\w+)(?P<code>.*?)\})",re.M)
+def compile_fun_shell(line):
+ extr=[]
+ def repl(match):
+ g=match.group
+ if g('dollar'):return"$"
+ elif g('backslash'):return'\\\\'
+ elif g('subst'):extr.append((g('var'),g('code')));return"%s"
+ return None
+ line=reg_act.sub(repl,line)or line
+ parm=[]
+ dvars=[]
+ app=parm.append
+ for(var,meth)in extr:
+ if var=='SRC':
+ if meth:app('tsk.inputs%s'%meth)
+ else:app('" ".join([a.path_from(bld.bldnode) for a in tsk.inputs])')
+ elif var=='TGT':
+ if meth:app('tsk.outputs%s'%meth)
+ else:app('" ".join([a.path_from(bld.bldnode) for a in tsk.outputs])')
+ elif meth:
+ if meth.startswith(':'):
+ m=meth[1:]
+ if m=='SRC':
+ m='[a.path_from(bld.bldnode) for a in tsk.inputs]'
+ elif m=='TGT':
+ m='[a.path_from(bld.bldnode) for a in tsk.outputs]'
+ elif m[:3]not in('tsk','gen','bld'):
+ dvars.extend([var,meth[1:]])
+ m='%r'%m
+ app('" ".join(tsk.colon(%r, %s))'%(var,m))
+ else:
+ app('%s%s'%(var,meth))
+ else:
+ if not var in dvars:dvars.append(var)
+ app("p('%s')"%var)
+ if parm:parm="%% (%s) "%(',\n\t\t'.join(parm))
+ else:parm=''
+ c=COMPILE_TEMPLATE_SHELL%(line,parm)
+ Logs.debug('action: %s'%c.strip().splitlines())
+ return(funex(c),dvars)
+def compile_fun_noshell(line):
+ extr=[]
+ def repl(match):
+ g=match.group
+ if g('dollar'):return"$"
+ elif g('subst'):extr.append((g('var'),g('code')));return"<<|@|>>"
+ return None
+ line2=reg_act.sub(repl,line)
+ params=line2.split('<<|@|>>')
+ assert(extr)
+ buf=[]
+ dvars=[]
+ app=buf.append
+ for x in range(len(extr)):
+ params[x]=params[x].strip()
+ if params[x]:
+ app("lst.extend(%r)"%params[x].split())
+ (var,meth)=extr[x]
+ if var=='SRC':
+ if meth:app('lst.append(tsk.inputs%s)'%meth)
+ else:app("lst.extend([a.path_from(bld.bldnode) for a in tsk.inputs])")
+ elif var=='TGT':
+ if meth:app('lst.append(tsk.outputs%s)'%meth)
+ else:app("lst.extend([a.path_from(bld.bldnode) for a in tsk.outputs])")
+ elif meth:
+ if meth.startswith(':'):
+ m=meth[1:]
+ if m=='SRC':
+ m='[a.path_from(bld.bldnode) for a in tsk.inputs]'
+ elif m=='TGT':
+ m='[a.path_from(bld.bldnode) for a in tsk.outputs]'
+ elif m[:3]not in('tsk','gen','bld'):
+ dvars.extend([var,m])
+ m='%r'%m
+ app('lst.extend(tsk.colon(%r, %s))'%(var,m))
+ else:
+ app('lst.extend(gen.to_list(%s%s))'%(var,meth))
+ else:
+ app('lst.extend(to_list(env[%r]))'%var)
+ if not var in dvars:dvars.append(var)
+ if extr:
+ if params[-1]:
+ app("lst.extend(%r)"%params[-1].split())
+ fun=COMPILE_TEMPLATE_NOSHELL%"\n\t".join(buf)
+ Logs.debug('action: %s'%fun.strip().splitlines())
+ return(funex(fun),dvars)
+def compile_fun(line,shell=False):
+ if line.find('<')>0 or line.find('>')>0 or line.find('&&')>0:
+ shell=True
+ if shell:
+ return compile_fun_shell(line)
+ else:
+ return compile_fun_noshell(line)
+def task_factory(name,func=None,vars=None,color='GREEN',ext_in=[],ext_out=[],before=[],after=[],shell=False,scan=None):
+ params={'vars':vars or[],'color':color,'name':name,'ext_in':Utils.to_list(ext_in),'ext_out':Utils.to_list(ext_out),'before':Utils.to_list(before),'after':Utils.to_list(after),'shell':shell,'scan':scan,}
+ if isinstance(func,str):
+ params['run_str']=func
+ else:
+ params['run']=func
+ cls=type(Task)(name,(Task,),params)
+ global classes
+ classes[name]=cls
+ return cls
+def always_run(cls):
+ old=cls.runnable_status
+ def always(self):
+ ret=old(self)
+ if ret==SKIP_ME:
+ ret=RUN_ME
+ return ret
+ cls.runnable_status=always
+ return cls
+def update_outputs(cls):
+ old_post_run=cls.post_run
+ def post_run(self):
+ old_post_run(self)
+ for node in self.outputs:
+ node.sig=Utils.h_file(node.abspath())
+ self.generator.bld.task_sigs[node.abspath()]=self.uid()
+ cls.post_run=post_run
+ old_runnable_status=cls.runnable_status
+ def runnable_status(self):
+ status=old_runnable_status(self)
+ if status!=RUN_ME:
+ return status
+ try:
+ bld=self.generator.bld
+ prev_sig=bld.task_sigs[self.uid()]
+ if prev_sig==self.signature():
+ for x in self.outputs:
+ if not x.sig or bld.task_sigs[x.abspath()]!=self.uid():
+ return RUN_ME
+ return SKIP_ME
+ except KeyError:
+ pass
+ except IndexError:
+ pass
+ except AttributeError:
+ pass
+ return RUN_ME
+ cls.runnable_status=runnable_status
+ return cls
--- /dev/null
+#! /usr/bin/env python
+# encoding: utf-8
+# WARNING! Do not edit! http://waf.googlecode.com/git/docs/wafbook/single.html#_obtaining_the_waf_file
+
+import copy,re,os
+from waflib import Task,Utils,Logs,Errors,ConfigSet,Node
+feats=Utils.defaultdict(set)
+class task_gen(object):
+ mappings={}
+ prec=Utils.defaultdict(list)
+ def __init__(self,*k,**kw):
+ self.source=''
+ self.target=''
+ self.meths=[]
+ self.prec=Utils.defaultdict(list)
+ self.mappings={}
+ self.features=[]
+ self.tasks=[]
+ if not'bld'in kw:
+ self.env=ConfigSet.ConfigSet()
+ self.idx=0
+ self.path=None
+ else:
+ self.bld=kw['bld']
+ self.env=self.bld.env.derive()
+ self.path=self.bld.path
+ try:
+ self.idx=self.bld.idx[id(self.path)]=self.bld.idx.get(id(self.path),0)+1
+ except AttributeError:
+ self.bld.idx={}
+ self.idx=self.bld.idx[id(self.path)]=1
+ for key,val in kw.items():
+ setattr(self,key,val)
+ def __str__(self):
+ return"<task_gen %r declared in %s>"%(self.name,self.path.abspath())
+ def __repr__(self):
+ lst=[]
+ for x in self.__dict__.keys():
+ if x not in['env','bld','compiled_tasks','tasks']:
+ lst.append("%s=%s"%(x,repr(getattr(self,x))))
+ return"bld(%s) in %s"%(", ".join(lst),self.path.abspath())
+ def get_name(self):
+ try:
+ return self._name
+ except AttributeError:
+ if isinstance(self.target,list):
+ lst=[str(x)for x in self.target]
+ name=self._name=','.join(lst)
+ else:
+ name=self._name=str(self.target)
+ return name
+ def set_name(self,name):
+ self._name=name
+ name=property(get_name,set_name)
+ def to_list(self,val):
+ if isinstance(val,str):return val.split()
+ else:return val
+ def post(self):
+ if getattr(self,'posted',None):
+ return False
+ self.posted=True
+ keys=set(self.meths)
+ self.features=Utils.to_list(self.features)
+ for x in self.features+['*']:
+ st=feats[x]
+ if not st:
+ if not x in Task.classes:
+ Logs.warn('feature %r does not exist - bind at least one method to it'%x)
+ keys.update(list(st))
+ prec={}
+ prec_tbl=self.prec or task_gen.prec
+ for x in prec_tbl:
+ if x in keys:
+ prec[x]=prec_tbl[x]
+ tmp=[]
+ for a in keys:
+ for x in prec.values():
+ if a in x:break
+ else:
+ tmp.append(a)
+ tmp.sort()
+ out=[]
+ while tmp:
+ e=tmp.pop()
+ if e in keys:out.append(e)
+ try:
+ nlst=prec[e]
+ except KeyError:
+ pass
+ else:
+ del prec[e]
+ for x in nlst:
+ for y in prec:
+ if x in prec[y]:
+ break
+ else:
+ tmp.append(x)
+ if prec:
+ raise Errors.WafError('Cycle detected in the method execution %r'%prec)
+ out.reverse()
+ self.meths=out
+ Logs.debug('task_gen: posting %s %d'%(self,id(self)))
+ for x in out:
+ try:
+ v=getattr(self,x)
+ except AttributeError:
+ raise Errors.WafError('%r is not a valid task generator method'%x)
+ Logs.debug('task_gen: -> %s (%d)'%(x,id(self)))
+ v()
+ Logs.debug('task_gen: posted %s'%self.name)
+ return True
+ def get_hook(self,node):
+ name=node.name
+ for k in self.mappings:
+ if name.endswith(k):
+ return self.mappings[k]
+ for k in task_gen.mappings:
+ if name.endswith(k):
+ return task_gen.mappings[k]
+ raise Errors.WafError("File %r has no mapping in %r (did you forget to load a waf tool?)"%(node,task_gen.mappings.keys()))
+ def create_task(self,name,src=None,tgt=None):
+ task=Task.classes[name](env=self.env.derive(),generator=self)
+ if src:
+ task.set_inputs(src)
+ if tgt:
+ task.set_outputs(tgt)
+ self.tasks.append(task)
+ return task
+ def clone(self,env):
+ newobj=self.bld()
+ for x in self.__dict__:
+ if x in['env','bld']:
+ continue
+ elif x in['path','features']:
+ setattr(newobj,x,getattr(self,x))
+ else:
+ setattr(newobj,x,copy.copy(getattr(self,x)))
+ newobj.posted=False
+ if isinstance(env,str):
+ newobj.env=self.bld.all_envs[env].derive()
+ else:
+ newobj.env=env.derive()
+ return newobj
+def declare_chain(name='',rule=None,reentrant=None,color='BLUE',ext_in=[],ext_out=[],before=[],after=[],decider=None,scan=None,install_path=None,shell=False):
+ ext_in=Utils.to_list(ext_in)
+ ext_out=Utils.to_list(ext_out)
+ if not name:
+ name=rule
+ cls=Task.task_factory(name,rule,color=color,ext_in=ext_in,ext_out=ext_out,before=before,after=after,scan=scan,shell=shell)
+ def x_file(self,node):
+ ext=decider and decider(self,node)or cls.ext_out
+ if ext_in:
+ _ext_in=ext_in[0]
+ tsk=self.create_task(name,node)
+ cnt=0
+ keys=list(self.mappings.keys())+list(self.__class__.mappings.keys())
+ for x in ext:
+ k=node.change_ext(x,ext_in=_ext_in)
+ tsk.outputs.append(k)
+ if reentrant!=None:
+ if cnt<int(reentrant):
+ self.source.append(k)
+ else:
+ for y in keys:
+ if k.name.endswith(y):
+ self.source.append(k)
+ break
+ cnt+=1
+ if install_path:
+ self.bld.install_files(install_path,tsk.outputs)
+ return tsk
+ for x in cls.ext_in:
+ task_gen.mappings[x]=x_file
+ return x_file
+def taskgen_method(func):
+ setattr(task_gen,func.__name__,func)
+ return func
+def feature(*k):
+ def deco(func):
+ setattr(task_gen,func.__name__,func)
+ for name in k:
+ feats[name].update([func.__name__])
+ return func
+ return deco
+def before_method(*k):
+ def deco(func):
+ setattr(task_gen,func.__name__,func)
+ for fun_name in k:
+ if not func.__name__ in task_gen.prec[fun_name]:
+ task_gen.prec[fun_name].append(func.__name__)
+ return func
+ return deco
+before=before_method
+def after_method(*k):
+ def deco(func):
+ setattr(task_gen,func.__name__,func)
+ for fun_name in k:
+ if not fun_name in task_gen.prec[func.__name__]:
+ task_gen.prec[func.__name__].append(fun_name)
+ return func
+ return deco
+after=after_method
+def extension(*k):
+ def deco(func):
+ setattr(task_gen,func.__name__,func)
+ for x in k:
+ task_gen.mappings[x]=func
+ return func
+ return deco
+@taskgen_method
+def to_nodes(self,lst,path=None):
+ tmp=[]
+ path=path or self.path
+ find=path.find_resource
+ if isinstance(lst,self.path.__class__):
+ lst=[lst]
+ for x in Utils.to_list(lst):
+ if isinstance(x,str):
+ node=find(x)
+ else:
+ node=x
+ if not node:
+ raise Errors.WafError("source not found: %r in %r"%(x,self))
+ tmp.append(node)
+ return tmp
+@feature('*')
+def process_source(self):
+ self.source=self.to_nodes(getattr(self,'source',[]))
+ for node in self.source:
+ self.get_hook(node)(self,node)
+@feature('*')
+@before_method('process_source')
+def process_rule(self):
+ if not getattr(self,'rule',None):
+ return
+ name=str(getattr(self,'name',None)or self.target or getattr(self.rule,'__name__',self.rule))
+ try:
+ cache=self.bld.cache_rule_attr
+ except AttributeError:
+ cache=self.bld.cache_rule_attr={}
+ cls=None
+ if getattr(self,'cache_rule','True'):
+ try:
+ cls=cache[(name,self.rule)]
+ except KeyError:
+ pass
+ if not cls:
+ cls=Task.task_factory(name,self.rule,getattr(self,'vars',[]),shell=getattr(self,'shell',True),color=getattr(self,'color','BLUE'),scan=getattr(self,'scan',None))
+ if getattr(self,'scan',None):
+ cls.scan=self.scan
+ elif getattr(self,'deps',None):
+ def scan(self):
+ nodes=[]
+ for x in self.generator.to_list(getattr(self.generator,'deps',None)):
+ node=self.generator.path.find_resource(x)
+ if not node:
+ self.generator.bld.fatal('Could not find %r (was it declared?)'%x)
+ nodes.append(node)
+ return[nodes,[]]
+ cls.scan=scan
+ if getattr(self,'update_outputs',None):
+ Task.update_outputs(cls)
+ if getattr(self,'always',None):
+ Task.always_run(cls)
+ for x in['after','before','ext_in','ext_out']:
+ setattr(cls,x,getattr(self,x,[]))
+ if getattr(self,'cache_rule','True'):
+ cache[(name,self.rule)]=cls
+ tsk=self.create_task(name)
+ if getattr(self,'target',None):
+ if isinstance(self.target,str):
+ self.target=self.target.split()
+ if not isinstance(self.target,list):
+ self.target=[self.target]
+ for x in self.target:
+ if isinstance(x,str):
+ tsk.outputs.append(self.path.find_or_declare(x))
+ else:
+ x.parent.mkdir()
+ tsk.outputs.append(x)
+ if getattr(self,'install_path',None):
+ self.bld.install_files(self.install_path,tsk.outputs)
+ if getattr(self,'source',None):
+ tsk.inputs=self.to_nodes(self.source)
+ self.source=[]
+ if getattr(self,'cwd',None):
+ tsk.cwd=self.cwd
+@feature('seq')
+def sequence_order(self):
+ if self.meths and self.meths[-1]!='sequence_order':
+ self.meths.append('sequence_order')
+ return
+ if getattr(self,'seq_start',None):
+ return
+ if getattr(self.bld,'prev',None):
+ self.bld.prev.post()
+ for x in self.bld.prev.tasks:
+ for y in self.tasks:
+ y.set_run_after(x)
+ self.bld.prev=self
+re_m4=re.compile('@(\w+)@',re.M)
+class subst_pc(Task.Task):
+ def run(self):
+ if getattr(self.generator,'is_copy',None):
+ self.outputs[0].write(self.inputs[0].read('rb'),'wb')
+ if getattr(self.generator,'chmod',None):
+ os.chmod(self.outputs[0].abspath(),self.generator.chmod)
+ return
+ code=self.inputs[0].read(encoding=getattr(self.generator,'encoding','ISO8859-1'))
+ if getattr(self.generator,'subst_fun',None):
+ code=self.generator.subst_fun(self,code)
+ if code:
+ self.outputs[0].write(code,encoding=getattr(self.generator,'encoding','ISO8859-1'))
+ return
+ code=code.replace('%','%%')
+ lst=[]
+ def repl(match):
+ g=match.group
+ if g(1):
+ lst.append(g(1))
+ return"%%(%s)s"%g(1)
+ return''
+ code=re_m4.sub(repl,code)
+ try:
+ d=self.generator.dct
+ except AttributeError:
+ d={}
+ for x in lst:
+ tmp=getattr(self.generator,x,'')or self.env.get_flat(x)or self.env.get_flat(x.upper())
+ d[x]=str(tmp)
+ code=code%d
+ self.outputs[0].write(code,encoding=getattr(self.generator,'encoding','ISO8859-1'))
+ self.generator.bld.raw_deps[self.uid()]=self.dep_vars=lst
+ try:delattr(self,'cache_sig')
+ except AttributeError:pass
+ if getattr(self.generator,'chmod',None):
+ os.chmod(self.outputs[0].abspath(),self.generator.chmod)
+ def sig_vars(self):
+ bld=self.generator.bld
+ env=self.env
+ upd=self.m.update
+ if getattr(self.generator,'subst_fun',None):
+ upd(Utils.h_fun(self.generator.subst_fun))
+ vars=self.generator.bld.raw_deps.get(self.uid(),[])
+ act_sig=bld.hash_env_vars(env,vars)
+ upd(act_sig)
+ lst=[getattr(self.generator,x,'')for x in vars]
+ upd(Utils.h_list(lst))
+ return self.m.digest()
+@extension('.pc.in')
+def add_pcfile(self,node):
+ tsk=self.create_task('subst_pc',node,node.change_ext('.pc','.pc.in'))
+ self.bld.install_files(getattr(self,'install_path','${LIBDIR}/pkgconfig/'),tsk.outputs)
+class subst(subst_pc):
+ pass
+@feature('subst')
+@before_method('process_source','process_rule')
+def process_subst(self):
+ src=Utils.to_list(getattr(self,'source',[]))
+ if isinstance(src,Node.Node):
+ src=[src]
+ tgt=Utils.to_list(getattr(self,'target',[]))
+ if isinstance(tgt,Node.Node):
+ tgt=[tgt]
+ if len(src)!=len(tgt):
+ raise Errors.WafError('invalid number of source/target for %r'%self)
+ for x,y in zip(src,tgt):
+ if not x or not y:
+ raise Errors.WafError('null source or target for %r'%self)
+ a,b=None,None
+ if isinstance(x,str)and isinstance(y,str)and x==y:
+ a=self.path.find_node(x)
+ b=self.path.get_bld().make_node(y)
+ if not os.path.isfile(b.abspath()):
+ b.sig=None
+ b.parent.mkdir()
+ else:
+ if isinstance(x,str):
+ a=self.path.find_resource(x)
+ elif isinstance(x,Node.Node):
+ a=x
+ if isinstance(y,str):
+ b=self.path.find_or_declare(y)
+ elif isinstance(y,Node.Node):
+ b=y
+ if not a:
+ raise Errors.WafError('cound not find %r for %r'%(x,self))
+ has_constraints=False
+ tsk=self.create_task('subst',a,b)
+ for k in('after','before','ext_in','ext_out'):
+ val=getattr(self,k,None)
+ if val:
+ has_constraints=True
+ setattr(tsk,k,val)
+ if not has_constraints and b.name.endswith('.h'):
+ tsk.before=[k for k in('c','cxx')if k in Task.classes]
+ inst_to=getattr(self,'install_path',None)
+ if inst_to:
+ self.bld.install_files(inst_to,b,chmod=getattr(self,'chmod',Utils.O644))
+ self.source=[]
--- /dev/null
+#! /usr/bin/env python
+# encoding: utf-8
+# WARNING! Do not edit! http://waf.googlecode.com/git/docs/wafbook/single.html#_obtaining_the_waf_file
+
--- /dev/null
+#! /usr/bin/env python
+# encoding: utf-8
+# WARNING! Do not edit! http://waf.googlecode.com/git/docs/wafbook/single.html#_obtaining_the_waf_file
+
+from waflib.Configure import conf
+@conf
+def find_ar(conf):
+ conf.load('ar')
+def configure(conf):
+ conf.find_program('ar',var='AR')
+ conf.env.ARFLAGS='rcs'
--- /dev/null
+#! /usr/bin/env python
+# encoding: utf-8
+# WARNING! Do not edit! http://waf.googlecode.com/git/docs/wafbook/single.html#_obtaining_the_waf_file
+
+import os,sys
+from waflib import Task,Utils
+import waflib.Task
+from waflib.Tools.ccroot import link_task,stlink_task
+from waflib.TaskGen import extension,feature
+class asm(Task.Task):
+ color='BLUE'
+ run_str='${AS} ${ASFLAGS} ${ASMPATH_ST:INCPATHS} ${AS_SRC_F}${SRC} ${AS_TGT_F}${TGT}'
+@extension('.s','.S','.asm','.ASM','.spp','.SPP')
+def asm_hook(self,node):
+ return self.create_compiled_task('asm',node)
+class asmprogram(link_task):
+ run_str='${ASLINK} ${ASLINKFLAGS} ${ASLNK_TGT_F}${TGT} ${ASLNK_SRC_F}${SRC}'
+ ext_out=['.bin']
+ inst_to='${BINDIR}'
+class asmshlib(asmprogram):
+ inst_to='${LIBDIR}'
+class asmstlib(stlink_task):
+ pass
+def configure(conf):
+ conf.env['ASMPATH_ST']='-I%s'
--- /dev/null
+#! /usr/bin/env python
+# encoding: utf-8
+# WARNING! Do not edit! http://waf.googlecode.com/git/docs/wafbook/single.html#_obtaining_the_waf_file
+
+from waflib import Task
+from waflib.TaskGen import extension
+class bison(Task.Task):
+ color='BLUE'
+ run_str='${BISON} ${BISONFLAGS} ${SRC[0].abspath()} -o ${TGT[0].name}'
+ ext_out=['.h']
+@extension('.y','.yc','.yy')
+def big_bison(self,node):
+ has_h='-d'in self.env['BISONFLAGS']
+ outs=[]
+ if node.name.endswith('.yc'):
+ outs.append(node.change_ext('.tab.cc'))
+ if has_h:
+ outs.append(node.change_ext('.tab.hh'))
+ else:
+ outs.append(node.change_ext('.tab.c'))
+ if has_h:
+ outs.append(node.change_ext('.tab.h'))
+ tsk=self.create_task('bison',node,outs)
+ tsk.cwd=node.parent.get_bld().abspath()
+ self.source.append(outs[0])
+def configure(conf):
+ conf.find_program('bison',var='BISON')
+ conf.env.BISONFLAGS=['-d']
--- /dev/null
+#! /usr/bin/env python
+# encoding: utf-8
+# WARNING! Do not edit! http://waf.googlecode.com/git/docs/wafbook/single.html#_obtaining_the_waf_file
+
+from waflib import TaskGen,Task,Utils
+from waflib.Tools import c_preproc
+from waflib.Tools.ccroot import link_task,stlink_task
+@TaskGen.extension('.c')
+def c_hook(self,node):
+ return self.create_compiled_task('c',node)
+class c(Task.Task):
+ run_str='${CC} ${ARCH_ST:ARCH} ${CFLAGS} ${CPPFLAGS} ${FRAMEWORKPATH_ST:FRAMEWORKPATH} ${CPPPATH_ST:INCPATHS} ${DEFINES_ST:DEFINES} ${CC_SRC_F}${SRC} ${CC_TGT_F}${TGT}'
+ vars=['CCDEPS']
+ ext_in=['.h']
+ scan=c_preproc.scan
+class cprogram(link_task):
+ run_str='${LINK_CC} ${LINKFLAGS} ${CCLNK_SRC_F}${SRC} ${CCLNK_TGT_F}${TGT[0].abspath()} ${RPATH_ST:RPATH} ${FRAMEWORKPATH_ST:FRAMEWORKPATH} ${FRAMEWORK_ST:FRAMEWORK} ${ARCH_ST:ARCH} ${STLIB_MARKER} ${STLIBPATH_ST:STLIBPATH} ${STLIB_ST:STLIB} ${SHLIB_MARKER} ${LIBPATH_ST:LIBPATH} ${LIB_ST:LIB}'
+ ext_out=['.bin']
+ vars=['LINKDEPS']
+ inst_to='${BINDIR}'
+class cshlib(cprogram):
+ inst_to='${LIBDIR}'
+class cstlib(stlink_task):
+ pass
--- /dev/null
+#! /usr/bin/env python
+# encoding: utf-8
+# WARNING! Do not edit! http://waf.googlecode.com/git/docs/wafbook/single.html#_obtaining_the_waf_file
+
+import os,sys,re
+from waflib import Utils,Build
+from waflib.Configure import conf
+def get_extensions(lst):
+ ret=[]
+ for x in Utils.to_list(lst):
+ try:
+ if not isinstance(x,str):
+ x=x.name
+ ret.append(x[x.rfind('.')+1:])
+ except Exception:
+ pass
+ return ret
+def sniff_features(**kw):
+ exts=get_extensions(kw['source'])
+ type=kw['_type']
+ feats=[]
+ if'cxx'in exts or'cpp'in exts or'c++'in exts or'cc'in exts or'C'in exts:
+ feats.append('cxx')
+ if'c'in exts or'vala'in exts:
+ feats.append('c')
+ if'd'in exts:
+ feats.append('d')
+ if'java'in exts:
+ feats.append('java')
+ if'java'in exts:
+ return'java'
+ if type in['program','shlib','stlib']:
+ for x in feats:
+ if x in['cxx','d','c']:
+ feats.append(x+type)
+ return feats
+def set_features(kw,_type):
+ kw['_type']=_type
+ kw['features']=Utils.to_list(kw.get('features',[]))+Utils.to_list(sniff_features(**kw))
+@conf
+def program(bld,*k,**kw):
+ set_features(kw,'program')
+ return bld(*k,**kw)
+@conf
+def shlib(bld,*k,**kw):
+ set_features(kw,'shlib')
+ return bld(*k,**kw)
+@conf
+def stlib(bld,*k,**kw):
+ set_features(kw,'stlib')
+ return bld(*k,**kw)
+@conf
+def objects(bld,*k,**kw):
+ set_features(kw,'objects')
+ return bld(*k,**kw)
--- /dev/null
+#! /usr/bin/env python
+# encoding: utf-8
+# WARNING! Do not edit! http://waf.googlecode.com/git/docs/wafbook/single.html#_obtaining_the_waf_file
+
+import os,re,shlex,sys
+from waflib import Build,Utils,Task,Options,Logs,Errors,ConfigSet,Runner
+from waflib.TaskGen import after_method,feature
+from waflib.Configure import conf
+WAF_CONFIG_H='config.h'
+DEFKEYS='define_key'
+INCKEYS='include_key'
+cfg_ver={'atleast-version':'>=','exact-version':'==','max-version':'<=',}
+SNIP_FUNCTION='''
+int main(int argc, char **argv) {
+ void *p;
+ (void)argc; (void)argv;
+ p=(void*)(%s);
+ return 0;
+}
+'''
+SNIP_TYPE='''
+int main(int argc, char **argv) {
+ (void)argc; (void)argv;
+ if ((%(type_name)s *) 0) return 0;
+ if (sizeof (%(type_name)s)) return 0;
+ return 1;
+}
+'''
+SNIP_EMPTY_PROGRAM='''
+int main(int argc, char **argv) {
+ (void)argc; (void)argv;
+ return 0;
+}
+'''
+SNIP_FIELD='''
+int main(int argc, char **argv) {
+ char *off;
+ (void)argc; (void)argv;
+ off = (char*) &((%(type_name)s*)0)->%(field_name)s;
+ return (size_t) off < sizeof(%(type_name)s);
+}
+'''
+MACRO_TO_DESTOS={'__linux__':'linux','__GNU__':'gnu','__FreeBSD__':'freebsd','__NetBSD__':'netbsd','__OpenBSD__':'openbsd','__sun':'sunos','__hpux':'hpux','__sgi':'irix','_AIX':'aix','__CYGWIN__':'cygwin','__MSYS__':'msys','_UWIN':'uwin','_WIN64':'win32','_WIN32':'win32','__ENVIRONMENT_MAC_OS_X_VERSION_MIN_REQUIRED__':'darwin','__ENVIRONMENT_IPHONE_OS_VERSION_MIN_REQUIRED__':'darwin','__QNX__':'qnx','__native_client__':'nacl'}
+MACRO_TO_DEST_CPU={'__x86_64__':'x86_64','__amd64__':'x86_64','__i386__':'x86','__ia64__':'ia','__mips__':'mips','__sparc__':'sparc','__alpha__':'alpha','__aarch64__':'aarch64','__thumb__':'thumb','__arm__':'arm','__hppa__':'hppa','__powerpc__':'powerpc','__ppc__':'powerpc','__convex__':'convex','__m68k__':'m68k','__s390x__':'s390x','__s390__':'s390','__sh__':'sh',}
+@conf
+def parse_flags(self,line,uselib_store,env=None,force_static=False):
+ assert(isinstance(line,str))
+ env=env or self.env
+ app=env.append_value
+ appu=env.append_unique
+ lex=shlex.shlex(line,posix=False)
+ lex.whitespace_split=True
+ lex.commenters=''
+ lst=list(lex)
+ uselib=uselib_store
+ while lst:
+ x=lst.pop(0)
+ st=x[:2]
+ ot=x[2:]
+ if st=='-I'or st=='/I':
+ if not ot:ot=lst.pop(0)
+ appu('INCLUDES_'+uselib,[ot])
+ elif st=='-include':
+ tmp=[x,lst.pop(0)]
+ app('CFLAGS',tmp)
+ app('CXXFLAGS',tmp)
+ elif st=='-D'or(env.CXX_NAME=='msvc'and st=='/D'):
+ if not ot:ot=lst.pop(0)
+ app('DEFINES_'+uselib,[ot])
+ elif st=='-l':
+ if not ot:ot=lst.pop(0)
+ prefix=force_static and'STLIB_'or'LIB_'
+ appu(prefix+uselib,[ot])
+ elif st=='-L':
+ if not ot:ot=lst.pop(0)
+ appu('LIBPATH_'+uselib,[ot])
+ elif x.startswith('/LIBPATH:'):
+ appu('LIBPATH_'+uselib,[x.replace('/LIBPATH:','')])
+ elif x=='-pthread'or x.startswith('+')or x.startswith('-std'):
+ app('CFLAGS_'+uselib,[x])
+ app('CXXFLAGS_'+uselib,[x])
+ app('LINKFLAGS_'+uselib,[x])
+ elif x=='-framework':
+ appu('FRAMEWORK_'+uselib,[lst.pop(0)])
+ elif x.startswith('-F'):
+ appu('FRAMEWORKPATH_'+uselib,[x[2:]])
+ elif x.startswith('-Wl'):
+ app('LINKFLAGS_'+uselib,[x])
+ elif x.startswith('-m')or x.startswith('-f')or x.startswith('-dynamic'):
+ app('CFLAGS_'+uselib,[x])
+ app('CXXFLAGS_'+uselib,[x])
+ elif x.startswith('-bundle'):
+ app('LINKFLAGS_'+uselib,[x])
+ elif x.startswith('-undefined'):
+ arg=lst.pop(0)
+ app('LINKFLAGS_'+uselib,[x,arg])
+ elif x.startswith('-arch')or x.startswith('-isysroot'):
+ tmp=[x,lst.pop(0)]
+ app('CFLAGS_'+uselib,tmp)
+ app('CXXFLAGS_'+uselib,tmp)
+ app('LINKFLAGS_'+uselib,tmp)
+ elif x.endswith('.a')or x.endswith('.so')or x.endswith('.dylib')or x.endswith('.lib'):
+ appu('LINKFLAGS_'+uselib,[x])
+@conf
+def ret_msg(self,f,kw):
+ if isinstance(f,str):
+ return f
+ return f(kw)
+@conf
+def validate_cfg(self,kw):
+ if not'path'in kw:
+ if not self.env.PKGCONFIG:
+ self.find_program('pkg-config',var='PKGCONFIG')
+ kw['path']=self.env.PKGCONFIG
+ if'atleast_pkgconfig_version'in kw:
+ if not'msg'in kw:
+ kw['msg']='Checking for pkg-config version >= %r'%kw['atleast_pkgconfig_version']
+ return
+ if not'okmsg'in kw:
+ kw['okmsg']='yes'
+ if not'errmsg'in kw:
+ kw['errmsg']='not found'
+ if'modversion'in kw:
+ if not'msg'in kw:
+ kw['msg']='Checking for %r version'%kw['modversion']
+ return
+ for x in cfg_ver.keys():
+ y=x.replace('-','_')
+ if y in kw:
+ if not'package'in kw:
+ raise ValueError('%s requires a package'%x)
+ if not'msg'in kw:
+ kw['msg']='Checking for %r %s %s'%(kw['package'],cfg_ver[x],kw[y])
+ return
+ if not'msg'in kw:
+ kw['msg']='Checking for %r'%(kw['package']or kw['path'])
+@conf
+def exec_cfg(self,kw):
+ def define_it():
+ self.define(self.have_define(kw.get('uselib_store',kw['package'])),1,0)
+ if'atleast_pkgconfig_version'in kw:
+ cmd=[kw['path'],'--atleast-pkgconfig-version=%s'%kw['atleast_pkgconfig_version']]
+ self.cmd_and_log(cmd)
+ if not'okmsg'in kw:
+ kw['okmsg']='yes'
+ return
+ for x in cfg_ver:
+ y=x.replace('-','_')
+ if y in kw:
+ self.cmd_and_log([kw['path'],'--%s=%s'%(x,kw[y]),kw['package']])
+ if not'okmsg'in kw:
+ kw['okmsg']='yes'
+ define_it()
+ break
+ if'modversion'in kw:
+ version=self.cmd_and_log([kw['path'],'--modversion',kw['modversion']]).strip()
+ self.define('%s_VERSION'%Utils.quote_define_name(kw.get('uselib_store',kw['modversion'])),version)
+ return version
+ lst=[kw['path']]
+ defi=kw.get('define_variable',None)
+ if not defi:
+ defi=self.env.PKG_CONFIG_DEFINES or{}
+ for key,val in defi.items():
+ lst.append('--define-variable=%s=%s'%(key,val))
+ if'variables'in kw:
+ env=kw.get('env',self.env)
+ uselib=kw.get('uselib_store',kw['package'].upper())
+ vars=Utils.to_list(kw['variables'])
+ for v in vars:
+ val=self.cmd_and_log(lst+['--variable='+v]).strip()
+ var='%s_%s'%(uselib,v)
+ env[var]=val
+ if not'okmsg'in kw:
+ kw['okmsg']='yes'
+ return
+ static=False
+ if'args'in kw:
+ args=Utils.to_list(kw['args'])
+ if'--static'in args or'--static-libs'in args:
+ static=True
+ lst+=args
+ lst.extend(Utils.to_list(kw['package']))
+ ret=self.cmd_and_log(lst)
+ if not'okmsg'in kw:
+ kw['okmsg']='yes'
+ define_it()
+ self.parse_flags(ret,kw.get('uselib_store',kw['package'].upper()),kw.get('env',self.env),force_static=static)
+ return ret
+@conf
+def check_cfg(self,*k,**kw):
+ if k:
+ lst=k[0].split()
+ kw['package']=lst[0]
+ kw['args']=' '.join(lst[1:])
+ self.validate_cfg(kw)
+ if'msg'in kw:
+ self.start_msg(kw['msg'])
+ ret=None
+ try:
+ ret=self.exec_cfg(kw)
+ except self.errors.WafError:
+ if'errmsg'in kw:
+ self.end_msg(kw['errmsg'],'YELLOW')
+ if Logs.verbose>1:
+ raise
+ else:
+ self.fatal('The configuration failed')
+ else:
+ kw['success']=ret
+ if'okmsg'in kw:
+ self.end_msg(self.ret_msg(kw['okmsg'],kw))
+ return ret
+@conf
+def validate_c(self,kw):
+ if not'env'in kw:
+ kw['env']=self.env.derive()
+ env=kw['env']
+ if not'compiler'in kw and not'features'in kw:
+ kw['compiler']='c'
+ if env['CXX_NAME']and Task.classes.get('cxx',None):
+ kw['compiler']='cxx'
+ if not self.env['CXX']:
+ self.fatal('a c++ compiler is required')
+ else:
+ if not self.env['CC']:
+ self.fatal('a c compiler is required')
+ if not'compile_mode'in kw:
+ kw['compile_mode']='c'
+ if'cxx'in Utils.to_list(kw.get('features',[]))or kw.get('compiler','')=='cxx':
+ kw['compile_mode']='cxx'
+ if not'type'in kw:
+ kw['type']='cprogram'
+ if not'features'in kw:
+ kw['features']=[kw['compile_mode'],kw['type']]
+ else:
+ kw['features']=Utils.to_list(kw['features'])
+ if not'compile_filename'in kw:
+ kw['compile_filename']='test.c'+((kw['compile_mode']=='cxx')and'pp'or'')
+ def to_header(dct):
+ if'header_name'in dct:
+ dct=Utils.to_list(dct['header_name'])
+ return''.join(['#include <%s>\n'%x for x in dct])
+ return''
+ if'framework_name'in kw:
+ fwkname=kw['framework_name']
+ if not'uselib_store'in kw:
+ kw['uselib_store']=fwkname.upper()
+ if not kw.get('no_header',False):
+ if not'header_name'in kw:
+ kw['header_name']=[]
+ fwk='%s/%s.h'%(fwkname,fwkname)
+ if kw.get('remove_dot_h',None):
+ fwk=fwk[:-2]
+ kw['header_name']=Utils.to_list(kw['header_name'])+[fwk]
+ kw['msg']='Checking for framework %s'%fwkname
+ kw['framework']=fwkname
+ if'function_name'in kw:
+ fu=kw['function_name']
+ if not'msg'in kw:
+ kw['msg']='Checking for function %s'%fu
+ kw['code']=to_header(kw)+SNIP_FUNCTION%fu
+ if not'uselib_store'in kw:
+ kw['uselib_store']=fu.upper()
+ if not'define_name'in kw:
+ kw['define_name']=self.have_define(fu)
+ elif'type_name'in kw:
+ tu=kw['type_name']
+ if not'header_name'in kw:
+ kw['header_name']='stdint.h'
+ if'field_name'in kw:
+ field=kw['field_name']
+ kw['code']=to_header(kw)+SNIP_FIELD%{'type_name':tu,'field_name':field}
+ if not'msg'in kw:
+ kw['msg']='Checking for field %s in %s'%(field,tu)
+ if not'define_name'in kw:
+ kw['define_name']=self.have_define((tu+'_'+field).upper())
+ else:
+ kw['code']=to_header(kw)+SNIP_TYPE%{'type_name':tu}
+ if not'msg'in kw:
+ kw['msg']='Checking for type %s'%tu
+ if not'define_name'in kw:
+ kw['define_name']=self.have_define(tu.upper())
+ elif'header_name'in kw:
+ if not'msg'in kw:
+ kw['msg']='Checking for header %s'%kw['header_name']
+ l=Utils.to_list(kw['header_name'])
+ assert len(l)>0,'list of headers in header_name is empty'
+ kw['code']=to_header(kw)+SNIP_EMPTY_PROGRAM
+ if not'uselib_store'in kw:
+ kw['uselib_store']=l[0].upper()
+ if not'define_name'in kw:
+ kw['define_name']=self.have_define(l[0])
+ if'lib'in kw:
+ if not'msg'in kw:
+ kw['msg']='Checking for library %s'%kw['lib']
+ if not'uselib_store'in kw:
+ kw['uselib_store']=kw['lib'].upper()
+ if'stlib'in kw:
+ if not'msg'in kw:
+ kw['msg']='Checking for static library %s'%kw['stlib']
+ if not'uselib_store'in kw:
+ kw['uselib_store']=kw['stlib'].upper()
+ if'fragment'in kw:
+ kw['code']=kw['fragment']
+ if not'msg'in kw:
+ kw['msg']='Checking for code snippet'
+ if not'errmsg'in kw:
+ kw['errmsg']='no'
+ for(flagsname,flagstype)in[('cxxflags','compiler'),('cflags','compiler'),('linkflags','linker')]:
+ if flagsname in kw:
+ if not'msg'in kw:
+ kw['msg']='Checking for %s flags %s'%(flagstype,kw[flagsname])
+ if not'errmsg'in kw:
+ kw['errmsg']='no'
+ if not'execute'in kw:
+ kw['execute']=False
+ if kw['execute']:
+ kw['features'].append('test_exec')
+ if not'errmsg'in kw:
+ kw['errmsg']='not found'
+ if not'okmsg'in kw:
+ kw['okmsg']='yes'
+ if not'code'in kw:
+ kw['code']=SNIP_EMPTY_PROGRAM
+ if self.env[INCKEYS]:
+ kw['code']='\n'.join(['#include <%s>'%x for x in self.env[INCKEYS]])+'\n'+kw['code']
+ if not kw.get('success'):kw['success']=None
+ if'define_name'in kw:
+ self.undefine(kw['define_name'])
+ assert'msg'in kw,'invalid parameters, read http://freehackers.org/~tnagy/wafbook/single.html#config_helpers_c'
+@conf
+def post_check(self,*k,**kw):
+ is_success=0
+ if kw['execute']:
+ if kw['success']is not None:
+ if kw.get('define_ret',False):
+ is_success=kw['success']
+ else:
+ is_success=(kw['success']==0)
+ else:
+ is_success=(kw['success']==0)
+ if'define_name'in kw:
+ if'header_name'in kw or'function_name'in kw or'type_name'in kw or'fragment'in kw:
+ if kw['execute']and kw.get('define_ret',None)and isinstance(is_success,str):
+ self.define(kw['define_name'],is_success,quote=kw.get('quote',1))
+ else:
+ self.define_cond(kw['define_name'],is_success)
+ else:
+ self.define_cond(kw['define_name'],is_success)
+ if'header_name'in kw:
+ if kw.get('auto_add_header_name',False):
+ self.env.append_value(INCKEYS,Utils.to_list(kw['header_name']))
+ if is_success and'uselib_store'in kw:
+ from waflib.Tools import ccroot
+ _vars=set([])
+ for x in kw['features']:
+ if x in ccroot.USELIB_VARS:
+ _vars|=ccroot.USELIB_VARS[x]
+ for k in _vars:
+ lk=k.lower()
+ if k=='INCLUDES':lk='includes'
+ if k=='DEFINES':lk='defines'
+ if lk in kw:
+ val=kw[lk]
+ if isinstance(val,str):
+ val=val.rstrip(os.path.sep)
+ self.env.append_unique(k+'_'+kw['uselib_store'],val)
+ return is_success
+@conf
+def check(self,*k,**kw):
+ self.validate_c(kw)
+ self.start_msg(kw['msg'])
+ ret=None
+ try:
+ ret=self.run_c_code(*k,**kw)
+ except self.errors.ConfigurationError:
+ self.end_msg(kw['errmsg'],'YELLOW')
+ if Logs.verbose>1:
+ raise
+ else:
+ self.fatal('The configuration failed')
+ else:
+ kw['success']=ret
+ ret=self.post_check(*k,**kw)
+ if not ret:
+ self.end_msg(kw['errmsg'],'YELLOW')
+ self.fatal('The configuration failed %r'%ret)
+ else:
+ self.end_msg(self.ret_msg(kw['okmsg'],kw))
+ return ret
+class test_exec(Task.Task):
+ color='PINK'
+ def run(self):
+ if getattr(self.generator,'rpath',None):
+ if getattr(self.generator,'define_ret',False):
+ self.generator.bld.retval=self.generator.bld.cmd_and_log([self.inputs[0].abspath()])
+ else:
+ self.generator.bld.retval=self.generator.bld.exec_command([self.inputs[0].abspath()])
+ else:
+ env=self.env.env or{}
+ env.update(dict(os.environ))
+ for var in('LD_LIBRARY_PATH','DYLD_LIBRARY_PATH','PATH'):
+ env[var]=self.inputs[0].parent.abspath()+os.path.pathsep+env.get(var,'')
+ if getattr(self.generator,'define_ret',False):
+ self.generator.bld.retval=self.generator.bld.cmd_and_log([self.inputs[0].abspath()],env=env)
+ else:
+ self.generator.bld.retval=self.generator.bld.exec_command([self.inputs[0].abspath()],env=env)
+@feature('test_exec')
+@after_method('apply_link')
+def test_exec_fun(self):
+ self.create_task('test_exec',self.link_task.outputs[0])
+CACHE_RESULTS=1
+COMPILE_ERRORS=2
+@conf
+def run_c_code(self,*k,**kw):
+ lst=[str(v)for(p,v)in kw.items()if p!='env']
+ h=Utils.h_list(lst)
+ dir=self.bldnode.abspath()+os.sep+(not Utils.is_win32 and'.'or'')+'conf_check_'+Utils.to_hex(h)
+ try:
+ os.makedirs(dir)
+ except OSError:
+ pass
+ try:
+ os.stat(dir)
+ except OSError:
+ self.fatal('cannot use the configuration test folder %r'%dir)
+ cachemode=getattr(Options.options,'confcache',None)
+ if cachemode==CACHE_RESULTS:
+ try:
+ proj=ConfigSet.ConfigSet(os.path.join(dir,'cache_run_c_code'))
+ except OSError:
+ pass
+ else:
+ ret=proj['cache_run_c_code']
+ if isinstance(ret,str)and ret.startswith('Test does not build'):
+ self.fatal(ret)
+ return ret
+ bdir=os.path.join(dir,'testbuild')
+ if not os.path.exists(bdir):
+ os.makedirs(bdir)
+ self.test_bld=bld=Build.BuildContext(top_dir=dir,out_dir=bdir)
+ bld.init_dirs()
+ bld.progress_bar=0
+ bld.targets='*'
+ if kw['compile_filename']:
+ node=bld.srcnode.make_node(kw['compile_filename'])
+ node.write(kw['code'])
+ bld.logger=self.logger
+ bld.all_envs.update(self.all_envs)
+ bld.env=kw['env']
+ o=bld(features=kw['features'],source=kw['compile_filename'],target='testprog')
+ for k,v in kw.items():
+ setattr(o,k,v)
+ self.to_log("==>\n%s\n<=="%kw['code'])
+ bld.targets='*'
+ ret=-1
+ try:
+ try:
+ bld.compile()
+ except Errors.WafError:
+ ret='Test does not build: %s'%Utils.ex_stack()
+ self.fatal(ret)
+ else:
+ ret=getattr(bld,'retval',0)
+ finally:
+ proj=ConfigSet.ConfigSet()
+ proj['cache_run_c_code']=ret
+ proj.store(os.path.join(dir,'cache_run_c_code'))
+ return ret
+@conf
+def check_cxx(self,*k,**kw):
+ kw['compiler']='cxx'
+ return self.check(*k,**kw)
+@conf
+def check_cc(self,*k,**kw):
+ kw['compiler']='c'
+ return self.check(*k,**kw)
+@conf
+def define(self,key,val,quote=True):
+ assert key and isinstance(key,str)
+ if val is True:
+ val=1
+ elif val in(False,None):
+ val=0
+ if isinstance(val,int)or isinstance(val,float):
+ s='%s=%s'
+ else:
+ s=quote and'%s="%s"'or'%s=%s'
+ app=s%(key,str(val))
+ ban=key+'='
+ lst=self.env['DEFINES']
+ for x in lst:
+ if x.startswith(ban):
+ lst[lst.index(x)]=app
+ break
+ else:
+ self.env.append_value('DEFINES',app)
+ self.env.append_unique(DEFKEYS,key)
+@conf
+def undefine(self,key):
+ assert key and isinstance(key,str)
+ ban=key+'='
+ lst=[x for x in self.env['DEFINES']if not x.startswith(ban)]
+ self.env['DEFINES']=lst
+ self.env.append_unique(DEFKEYS,key)
+@conf
+def define_cond(self,key,val):
+ assert key and isinstance(key,str)
+ if val:
+ self.define(key,1)
+ else:
+ self.undefine(key)
+@conf
+def is_defined(self,key):
+ assert key and isinstance(key,str)
+ ban=key+'='
+ for x in self.env['DEFINES']:
+ if x.startswith(ban):
+ return True
+ return False
+@conf
+def get_define(self,key):
+ assert key and isinstance(key,str)
+ ban=key+'='
+ for x in self.env['DEFINES']:
+ if x.startswith(ban):
+ return x[len(ban):]
+ return None
+@conf
+def have_define(self,key):
+ return(self.env.HAVE_PAT or'HAVE_%s')%Utils.quote_define_name(key)
+@conf
+def write_config_header(self,configfile='',guard='',top=False,env=None,defines=True,headers=False,remove=True,define_prefix=''):
+ if env:
+ Logs.warn('Cannot pass env to write_config_header')
+ if not configfile:configfile=WAF_CONFIG_H
+ waf_guard=guard or'W_%s_WAF'%Utils.quote_define_name(configfile)
+ node=top and self.bldnode or self.path.get_bld()
+ node=node.make_node(configfile)
+ node.parent.mkdir()
+ lst=['/* WARNING! All changes made to this file will be lost! */\n']
+ lst.append('#ifndef %s\n#define %s\n'%(waf_guard,waf_guard))
+ lst.append(self.get_config_header(defines,headers,define_prefix=define_prefix))
+ lst.append('\n#endif /* %s */\n'%waf_guard)
+ node.write('\n'.join(lst))
+ self.env.append_unique(Build.CFG_FILES,[node.abspath()])
+ if remove:
+ for key in self.env[DEFKEYS]:
+ self.undefine(key)
+ self.env[DEFKEYS]=[]
+@conf
+def get_config_header(self,defines=True,headers=False,define_prefix=''):
+ lst=[]
+ if headers:
+ for x in self.env[INCKEYS]:
+ lst.append('#include <%s>'%x)
+ if defines:
+ for x in self.env[DEFKEYS]:
+ if self.is_defined(x):
+ val=self.get_define(x)
+ lst.append('#define %s %s'%(define_prefix+x,val))
+ else:
+ lst.append('/* #undef %s */'%(define_prefix+x))
+ return"\n".join(lst)
+@conf
+def cc_add_flags(conf):
+ conf.add_os_flags('CPPFLAGS','CFLAGS')
+ conf.add_os_flags('CFLAGS')
+@conf
+def cxx_add_flags(conf):
+ conf.add_os_flags('CPPFLAGS','CXXFLAGS')
+ conf.add_os_flags('CXXFLAGS')
+@conf
+def link_add_flags(conf):
+ conf.add_os_flags('LINKFLAGS')
+ conf.add_os_flags('LDFLAGS','LINKFLAGS')
+@conf
+def cc_load_tools(conf):
+ if not conf.env.DEST_OS:
+ conf.env.DEST_OS=Utils.unversioned_sys_platform()
+ conf.load('c')
+@conf
+def cxx_load_tools(conf):
+ if not conf.env.DEST_OS:
+ conf.env.DEST_OS=Utils.unversioned_sys_platform()
+ conf.load('cxx')
+@conf
+def get_cc_version(conf,cc,gcc=False,icc=False):
+ cmd=cc+['-dM','-E','-']
+ env=conf.env.env or None
+ try:
+ p=Utils.subprocess.Popen(cmd,stdin=Utils.subprocess.PIPE,stdout=Utils.subprocess.PIPE,stderr=Utils.subprocess.PIPE,env=env)
+ p.stdin.write('\n')
+ out=p.communicate()[0]
+ except Exception:
+ conf.fatal('Could not determine the compiler version %r'%cmd)
+ if not isinstance(out,str):
+ out=out.decode(sys.stdout.encoding or'iso8859-1')
+ if gcc:
+ if out.find('__INTEL_COMPILER')>=0:
+ conf.fatal('The intel compiler pretends to be gcc')
+ if out.find('__GNUC__')<0:
+ conf.fatal('Could not determine the compiler type')
+ if icc and out.find('__INTEL_COMPILER')<0:
+ conf.fatal('Not icc/icpc')
+ k={}
+ if icc or gcc:
+ out=out.splitlines()
+ for line in out:
+ lst=shlex.split(line)
+ if len(lst)>2:
+ key=lst[1]
+ val=lst[2]
+ k[key]=val
+ def isD(var):
+ return var in k
+ def isT(var):
+ return var in k and k[var]!='0'
+ if not conf.env.DEST_OS:
+ conf.env.DEST_OS=''
+ for i in MACRO_TO_DESTOS:
+ if isD(i):
+ conf.env.DEST_OS=MACRO_TO_DESTOS[i]
+ break
+ else:
+ if isD('__APPLE__')and isD('__MACH__'):
+ conf.env.DEST_OS='darwin'
+ elif isD('__unix__'):
+ conf.env.DEST_OS='generic'
+ if isD('__ELF__'):
+ conf.env.DEST_BINFMT='elf'
+ elif isD('__WINNT__')or isD('__CYGWIN__'):
+ conf.env.DEST_BINFMT='pe'
+ conf.env.LIBDIR=conf.env['PREFIX']+'/bin'
+ elif isD('__APPLE__'):
+ conf.env.DEST_BINFMT='mac-o'
+ if not conf.env.DEST_BINFMT:
+ conf.env.DEST_BINFMT=Utils.destos_to_binfmt(conf.env.DEST_OS)
+ for i in MACRO_TO_DEST_CPU:
+ if isD(i):
+ conf.env.DEST_CPU=MACRO_TO_DEST_CPU[i]
+ break
+ Logs.debug('ccroot: dest platform: '+' '.join([conf.env[x]or'?'for x in('DEST_OS','DEST_BINFMT','DEST_CPU')]))
+ if icc:
+ ver=k['__INTEL_COMPILER']
+ conf.env['CC_VERSION']=(ver[:-2],ver[-2],ver[-1])
+ else:
+ if isD('__clang__'):
+ conf.env['CC_VERSION']=(k['__clang_major__'],k['__clang_minor__'],k['__clang_patchlevel__'])
+ else:
+ conf.env['CC_VERSION']=(k['__GNUC__'],k['__GNUC_MINOR__'],k['__GNUC_PATCHLEVEL__'])
+ return k
+@conf
+def get_xlc_version(conf,cc):
+ cmd=cc+['-qversion']
+ try:
+ out,err=conf.cmd_and_log(cmd,output=0)
+ except Errors.WafError:
+ conf.fatal('Could not find xlc %r'%cmd)
+ for v in(r"IBM XL C/C\+\+.* V(?P<major>\d*)\.(?P<minor>\d*)",):
+ version_re=re.compile(v,re.I).search
+ match=version_re(out or err)
+ if match:
+ k=match.groupdict()
+ conf.env['CC_VERSION']=(k['major'],k['minor'])
+ break
+ else:
+ conf.fatal('Could not determine the XLC version.')
+@conf
+def add_as_needed(self):
+ if self.env.DEST_BINFMT=='elf'and'gcc'in(self.env.CXX_NAME,self.env.CC_NAME):
+ self.env.append_unique('LINKFLAGS','--as-needed')
+class cfgtask(Task.TaskBase):
+ def display(self):
+ return''
+ def runnable_status(self):
+ return Task.RUN_ME
+ def uid(self):
+ return Utils.SIG_NIL
+ def run(self):
+ conf=self.conf
+ bld=Build.BuildContext(top_dir=conf.srcnode.abspath(),out_dir=conf.bldnode.abspath())
+ bld.env=conf.env
+ bld.init_dirs()
+ bld.in_msg=1
+ bld.logger=self.logger
+ try:
+ bld.check(**self.args)
+ except Exception:
+ return 1
+@conf
+def multicheck(self,*k,**kw):
+ self.start_msg(kw.get('msg','Executing %d configuration tests'%len(k)))
+ class par(object):
+ def __init__(self):
+ self.keep=False
+ self.cache_global=Options.cache_global
+ self.nocache=Options.options.nocache
+ self.returned_tasks=[]
+ self.task_sigs={}
+ def total(self):
+ return len(tasks)
+ def to_log(self,*k,**kw):
+ return
+ bld=par()
+ tasks=[]
+ for dct in k:
+ x=cfgtask(bld=bld)
+ tasks.append(x)
+ x.args=dct
+ x.bld=bld
+ x.conf=self
+ x.args=dct
+ x.logger=Logs.make_mem_logger(str(id(x)),self.logger)
+ def it():
+ yield tasks
+ while 1:
+ yield[]
+ p=Runner.Parallel(bld,Options.options.jobs)
+ p.biter=it()
+ p.start()
+ for x in tasks:
+ x.logger.memhandler.flush()
+ for x in tasks:
+ if x.hasrun!=Task.SUCCESS:
+ self.end_msg(kw.get('errmsg','no'),color='YELLOW')
+ self.fatal(kw.get('fatalmsg',None)or'One of the tests has failed, see the config.log for more information')
+ self.end_msg('ok')
--- /dev/null
+#! /usr/bin/env python
+# encoding: utf-8
+# WARNING! Do not edit! http://waf.googlecode.com/git/docs/wafbook/single.html#_obtaining_the_waf_file
+
+import os,shutil,sys,platform
+from waflib import TaskGen,Task,Build,Options,Utils,Errors
+from waflib.TaskGen import taskgen_method,feature,after_method,before_method
+app_info='''
+<?xml version="1.0" encoding="UTF-8"?>
+<!DOCTYPE plist SYSTEM "file://localhost/System/Library/DTDs/PropertyList.dtd">
+<plist version="0.9">
+<dict>
+ <key>CFBundlePackageType</key>
+ <string>APPL</string>
+ <key>CFBundleGetInfoString</key>
+ <string>Created by Waf</string>
+ <key>CFBundleSignature</key>
+ <string>????</string>
+ <key>NOTE</key>
+ <string>THIS IS A GENERATED FILE, DO NOT MODIFY</string>
+ <key>CFBundleExecutable</key>
+ <string>%s</string>
+</dict>
+</plist>
+'''
+@feature('c','cxx')
+def set_macosx_deployment_target(self):
+ if self.env['MACOSX_DEPLOYMENT_TARGET']:
+ os.environ['MACOSX_DEPLOYMENT_TARGET']=self.env['MACOSX_DEPLOYMENT_TARGET']
+ elif'MACOSX_DEPLOYMENT_TARGET'not in os.environ:
+ if Utils.unversioned_sys_platform()=='darwin':
+ os.environ['MACOSX_DEPLOYMENT_TARGET']='.'.join(platform.mac_ver()[0].split('.')[:2])
+@taskgen_method
+def create_bundle_dirs(self,name,out):
+ bld=self.bld
+ dir=out.parent.find_or_declare(name)
+ dir.mkdir()
+ macos=dir.find_or_declare(['Contents','MacOS'])
+ macos.mkdir()
+ return dir
+def bundle_name_for_output(out):
+ name=out.name
+ k=name.rfind('.')
+ if k>=0:
+ name=name[:k]+'.app'
+ else:
+ name=name+'.app'
+ return name
+@feature('cprogram','cxxprogram')
+@after_method('apply_link')
+def create_task_macapp(self):
+ if self.env['MACAPP']or getattr(self,'mac_app',False):
+ out=self.link_task.outputs[0]
+ name=bundle_name_for_output(out)
+ dir=self.create_bundle_dirs(name,out)
+ n1=dir.find_or_declare(['Contents','MacOS',out.name])
+ self.apptask=self.create_task('macapp',self.link_task.outputs,n1)
+ inst_to=getattr(self,'install_path','/Applications')+'/%s/Contents/MacOS/'%name
+ self.bld.install_files(inst_to,n1,chmod=Utils.O755)
+ if getattr(self,'mac_resources',None):
+ res_dir=n1.parent.parent.make_node('Resources')
+ inst_to=getattr(self,'install_path','/Applications')+'/%s/Resources'%name
+ for x in self.to_list(self.mac_resources):
+ node=self.path.find_node(x)
+ if not node:
+ raise Errors.WafError('Missing mac_resource %r in %r'%(x,self))
+ parent=node.parent
+ if os.path.isdir(node.abspath()):
+ nodes=node.ant_glob('**')
+ else:
+ nodes=[node]
+ for node in nodes:
+ rel=node.path_from(parent)
+ tsk=self.create_task('macapp',node,res_dir.make_node(rel))
+ self.bld.install_as(inst_to+'/%s'%rel,node)
+ if getattr(self.bld,'is_install',None):
+ self.install_task.hasrun=Task.SKIP_ME
+@feature('cprogram','cxxprogram')
+@after_method('apply_link')
+def create_task_macplist(self):
+ if self.env['MACAPP']or getattr(self,'mac_app',False):
+ out=self.link_task.outputs[0]
+ name=bundle_name_for_output(out)
+ dir=self.create_bundle_dirs(name,out)
+ n1=dir.find_or_declare(['Contents','Info.plist'])
+ self.plisttask=plisttask=self.create_task('macplist',[],n1)
+ if getattr(self,'mac_plist',False):
+ node=self.path.find_resource(self.mac_plist)
+ if node:
+ plisttask.inputs.append(node)
+ else:
+ plisttask.code=self.mac_plist
+ else:
+ plisttask.code=app_info%self.link_task.outputs[0].name
+ inst_to=getattr(self,'install_path','/Applications')+'/%s/Contents/'%name
+ self.bld.install_files(inst_to,n1)
+@feature('cshlib','cxxshlib')
+@before_method('apply_link','propagate_uselib_vars')
+def apply_bundle(self):
+ if self.env['MACBUNDLE']or getattr(self,'mac_bundle',False):
+ self.env['LINKFLAGS_cshlib']=self.env['LINKFLAGS_cxxshlib']=[]
+ self.env['cshlib_PATTERN']=self.env['cxxshlib_PATTERN']=self.env['macbundle_PATTERN']
+ use=self.use=self.to_list(getattr(self,'use',[]))
+ if not'MACBUNDLE'in use:
+ use.append('MACBUNDLE')
+app_dirs=['Contents','Contents/MacOS','Contents/Resources']
+class macapp(Task.Task):
+ color='PINK'
+ def run(self):
+ self.outputs[0].parent.mkdir()
+ shutil.copy2(self.inputs[0].srcpath(),self.outputs[0].abspath())
+class macplist(Task.Task):
+ color='PINK'
+ ext_in=['.bin']
+ def run(self):
+ if getattr(self,'code',None):
+ txt=self.code
+ else:
+ txt=self.inputs[0].read()
+ self.outputs[0].write(txt)
--- /dev/null
+#! /usr/bin/env python
+# encoding: utf-8
+# WARNING! Do not edit! http://waf.googlecode.com/git/docs/wafbook/single.html#_obtaining_the_waf_file
+
+import re,string,traceback
+from waflib import Logs,Utils,Errors
+from waflib.Logs import debug,error
+class PreprocError(Errors.WafError):
+ pass
+POPFILE='-'
+recursion_limit=150
+go_absolute=False
+standard_includes=['/usr/include']
+if Utils.is_win32:
+ standard_includes=[]
+use_trigraphs=0
+strict_quotes=0
+g_optrans={'not':'!','and':'&&','bitand':'&','and_eq':'&=','or':'||','bitor':'|','or_eq':'|=','xor':'^','xor_eq':'^=','compl':'~',}
+re_lines=re.compile('^[ \t]*(#|%:)[ \t]*(ifdef|ifndef|if|else|elif|endif|include|import|define|undef|pragma)[ \t]*(.*)\r*$',re.IGNORECASE|re.MULTILINE)
+re_mac=re.compile("^[a-zA-Z_]\w*")
+re_fun=re.compile('^[a-zA-Z_][a-zA-Z0-9_]*[(]')
+re_pragma_once=re.compile('^\s*once\s*',re.IGNORECASE)
+re_nl=re.compile('\\\\\r*\n',re.MULTILINE)
+re_cpp=re.compile(r"""(/\*[^*]*\*+([^/*][^*]*\*+)*/)|//[^\n]*|("(\\.|[^"\\])*"|'(\\.|[^'\\])*'|.[^/"'\\]*)""",re.MULTILINE)
+trig_def=[('??'+a,b)for a,b in zip("=-/!'()<>",r'#~\|^[]{}')]
+chr_esc={'0':0,'a':7,'b':8,'t':9,'n':10,'f':11,'v':12,'r':13,'\\':92,"'":39}
+NUM='i'
+OP='O'
+IDENT='T'
+STR='s'
+CHAR='c'
+tok_types=[NUM,STR,IDENT,OP]
+exp_types=[r"""0[xX](?P<hex>[a-fA-F0-9]+)(?P<qual1>[uUlL]*)|L*?'(?P<char>(\\.|[^\\'])+)'|(?P<n1>\d+)[Ee](?P<exp0>[+-]*?\d+)(?P<float0>[fFlL]*)|(?P<n2>\d*\.\d+)([Ee](?P<exp1>[+-]*?\d+))?(?P<float1>[fFlL]*)|(?P<n4>\d+\.\d*)([Ee](?P<exp2>[+-]*?\d+))?(?P<float2>[fFlL]*)|(?P<oct>0*)(?P<n0>\d+)(?P<qual2>[uUlL]*)""",r'L?"([^"\\]|\\.)*"',r'[a-zA-Z_]\w*',r'%:%:|<<=|>>=|\.\.\.|<<|<%|<:|<=|>>|>=|\+\+|\+=|--|->|-=|\*=|/=|%:|%=|%>|==|&&|&=|\|\||\|=|\^=|:>|!=|##|[\(\)\{\}\[\]<>\?\|\^\*\+&=:!#;,%/\-\?\~\.]',]
+re_clexer=re.compile('|'.join(["(?P<%s>%s)"%(name,part)for name,part in zip(tok_types,exp_types)]),re.M)
+accepted='a'
+ignored='i'
+undefined='u'
+skipped='s'
+def repl(m):
+ s=m.group(1)
+ if s:
+ return' '
+ return m.group(3)or''
+def filter_comments(filename):
+ code=Utils.readf(filename)
+ if use_trigraphs:
+ for(a,b)in trig_def:code=code.split(a).join(b)
+ code=re_nl.sub('',code)
+ code=re_cpp.sub(repl,code)
+ return[(m.group(2),m.group(3))for m in re.finditer(re_lines,code)]
+prec={}
+ops=['* / %','+ -','<< >>','< <= >= >','== !=','& | ^','&& ||',',']
+for x in range(len(ops)):
+ syms=ops[x]
+ for u in syms.split():
+ prec[u]=x
+def trimquotes(s):
+ if not s:return''
+ s=s.rstrip()
+ if s[0]=="'"and s[-1]=="'":return s[1:-1]
+ return s
+def reduce_nums(val_1,val_2,val_op):
+ try:a=0+val_1
+ except TypeError:a=int(val_1)
+ try:b=0+val_2
+ except TypeError:b=int(val_2)
+ d=val_op
+ if d=='%':c=a%b
+ elif d=='+':c=a+b
+ elif d=='-':c=a-b
+ elif d=='*':c=a*b
+ elif d=='/':c=a/b
+ elif d=='^':c=a^b
+ elif d=='|':c=a|b
+ elif d=='||':c=int(a or b)
+ elif d=='&':c=a&b
+ elif d=='&&':c=int(a and b)
+ elif d=='==':c=int(a==b)
+ elif d=='!=':c=int(a!=b)
+ elif d=='<=':c=int(a<=b)
+ elif d=='<':c=int(a<b)
+ elif d=='>':c=int(a>b)
+ elif d=='>=':c=int(a>=b)
+ elif d=='^':c=int(a^b)
+ elif d=='<<':c=a<<b
+ elif d=='>>':c=a>>b
+ else:c=0
+ return c
+def get_num(lst):
+ if not lst:raise PreprocError("empty list for get_num")
+ (p,v)=lst[0]
+ if p==OP:
+ if v=='(':
+ count_par=1
+ i=1
+ while i<len(lst):
+ (p,v)=lst[i]
+ if p==OP:
+ if v==')':
+ count_par-=1
+ if count_par==0:
+ break
+ elif v=='(':
+ count_par+=1
+ i+=1
+ else:
+ raise PreprocError("rparen expected %r"%lst)
+ (num,_)=get_term(lst[1:i])
+ return(num,lst[i+1:])
+ elif v=='+':
+ return get_num(lst[1:])
+ elif v=='-':
+ num,lst=get_num(lst[1:])
+ return(reduce_nums('-1',num,'*'),lst)
+ elif v=='!':
+ num,lst=get_num(lst[1:])
+ return(int(not int(num)),lst)
+ elif v=='~':
+ num,lst=get_num(lst[1:])
+ return(~int(num),lst)
+ else:
+ raise PreprocError("Invalid op token %r for get_num"%lst)
+ elif p==NUM:
+ return v,lst[1:]
+ elif p==IDENT:
+ return 0,lst[1:]
+ else:
+ raise PreprocError("Invalid token %r for get_num"%lst)
+def get_term(lst):
+ if not lst:raise PreprocError("empty list for get_term")
+ num,lst=get_num(lst)
+ if not lst:
+ return(num,[])
+ (p,v)=lst[0]
+ if p==OP:
+ if v==',':
+ return get_term(lst[1:])
+ elif v=='?':
+ count_par=0
+ i=1
+ while i<len(lst):
+ (p,v)=lst[i]
+ if p==OP:
+ if v==')':
+ count_par-=1
+ elif v=='(':
+ count_par+=1
+ elif v==':':
+ if count_par==0:
+ break
+ i+=1
+ else:
+ raise PreprocError("rparen expected %r"%lst)
+ if int(num):
+ return get_term(lst[1:i])
+ else:
+ return get_term(lst[i+1:])
+ else:
+ num2,lst=get_num(lst[1:])
+ if not lst:
+ num2=reduce_nums(num,num2,v)
+ return get_term([(NUM,num2)]+lst)
+ p2,v2=lst[0]
+ if p2!=OP:
+ raise PreprocError("op expected %r"%lst)
+ if prec[v2]>=prec[v]:
+ num2=reduce_nums(num,num2,v)
+ return get_term([(NUM,num2)]+lst)
+ else:
+ num3,lst=get_num(lst[1:])
+ num3=reduce_nums(num2,num3,v2)
+ return get_term([(NUM,num),(p,v),(NUM,num3)]+lst)
+ raise PreprocError("cannot reduce %r"%lst)
+def reduce_eval(lst):
+ num,lst=get_term(lst)
+ return(NUM,num)
+def stringize(lst):
+ lst=[str(v2)for(p2,v2)in lst]
+ return"".join(lst)
+def paste_tokens(t1,t2):
+ p1=None
+ if t1[0]==OP and t2[0]==OP:
+ p1=OP
+ elif t1[0]==IDENT and(t2[0]==IDENT or t2[0]==NUM):
+ p1=IDENT
+ elif t1[0]==NUM and t2[0]==NUM:
+ p1=NUM
+ if not p1:
+ raise PreprocError('tokens do not make a valid paste %r and %r'%(t1,t2))
+ return(p1,t1[1]+t2[1])
+def reduce_tokens(lst,defs,ban=[]):
+ i=0
+ while i<len(lst):
+ (p,v)=lst[i]
+ if p==IDENT and v=="defined":
+ del lst[i]
+ if i<len(lst):
+ (p2,v2)=lst[i]
+ if p2==IDENT:
+ if v2 in defs:
+ lst[i]=(NUM,1)
+ else:
+ lst[i]=(NUM,0)
+ elif p2==OP and v2=='(':
+ del lst[i]
+ (p2,v2)=lst[i]
+ del lst[i]
+ if v2 in defs:
+ lst[i]=(NUM,1)
+ else:
+ lst[i]=(NUM,0)
+ else:
+ raise PreprocError("Invalid define expression %r"%lst)
+ elif p==IDENT and v in defs:
+ if isinstance(defs[v],str):
+ a,b=extract_macro(defs[v])
+ defs[v]=b
+ macro_def=defs[v]
+ to_add=macro_def[1]
+ if isinstance(macro_def[0],list):
+ del lst[i]
+ accu=to_add[:]
+ reduce_tokens(accu,defs,ban+[v])
+ for x in range(len(accu)):
+ lst.insert(i,accu[x])
+ i+=1
+ else:
+ args=[]
+ del lst[i]
+ if i>=len(lst):
+ raise PreprocError("expected '(' after %r (got nothing)"%v)
+ (p2,v2)=lst[i]
+ if p2!=OP or v2!='(':
+ raise PreprocError("expected '(' after %r"%v)
+ del lst[i]
+ one_param=[]
+ count_paren=0
+ while i<len(lst):
+ p2,v2=lst[i]
+ del lst[i]
+ if p2==OP and count_paren==0:
+ if v2=='(':
+ one_param.append((p2,v2))
+ count_paren+=1
+ elif v2==')':
+ if one_param:args.append(one_param)
+ break
+ elif v2==',':
+ if not one_param:raise PreprocError("empty param in funcall %s"%p)
+ args.append(one_param)
+ one_param=[]
+ else:
+ one_param.append((p2,v2))
+ else:
+ one_param.append((p2,v2))
+ if v2=='(':count_paren+=1
+ elif v2==')':count_paren-=1
+ else:
+ raise PreprocError('malformed macro')
+ accu=[]
+ arg_table=macro_def[0]
+ j=0
+ while j<len(to_add):
+ (p2,v2)=to_add[j]
+ if p2==OP and v2=='#':
+ if j+1<len(to_add)and to_add[j+1][0]==IDENT and to_add[j+1][1]in arg_table:
+ toks=args[arg_table[to_add[j+1][1]]]
+ accu.append((STR,stringize(toks)))
+ j+=1
+ else:
+ accu.append((p2,v2))
+ elif p2==OP and v2=='##':
+ if accu and j+1<len(to_add):
+ t1=accu[-1]
+ if to_add[j+1][0]==IDENT and to_add[j+1][1]in arg_table:
+ toks=args[arg_table[to_add[j+1][1]]]
+ if toks:
+ accu[-1]=paste_tokens(t1,toks[0])
+ accu.extend(toks[1:])
+ else:
+ accu.append((p2,v2))
+ accu.extend(toks)
+ elif to_add[j+1][0]==IDENT and to_add[j+1][1]=='__VA_ARGS__':
+ va_toks=[]
+ st=len(macro_def[0])
+ pt=len(args)
+ for x in args[pt-st+1:]:
+ va_toks.extend(x)
+ va_toks.append((OP,','))
+ if va_toks:va_toks.pop()
+ if len(accu)>1:
+ (p3,v3)=accu[-1]
+ (p4,v4)=accu[-2]
+ if v3=='##':
+ accu.pop()
+ if v4==','and pt<st:
+ accu.pop()
+ accu+=va_toks
+ else:
+ accu[-1]=paste_tokens(t1,to_add[j+1])
+ j+=1
+ else:
+ accu.append((p2,v2))
+ elif p2==IDENT and v2 in arg_table:
+ toks=args[arg_table[v2]]
+ reduce_tokens(toks,defs,ban+[v])
+ accu.extend(toks)
+ else:
+ accu.append((p2,v2))
+ j+=1
+ reduce_tokens(accu,defs,ban+[v])
+ for x in range(len(accu)-1,-1,-1):
+ lst.insert(i,accu[x])
+ i+=1
+def eval_macro(lst,defs):
+ reduce_tokens(lst,defs,[])
+ if not lst:raise PreprocError("missing tokens to evaluate")
+ (p,v)=reduce_eval(lst)
+ return int(v)!=0
+def extract_macro(txt):
+ t=tokenize(txt)
+ if re_fun.search(txt):
+ p,name=t[0]
+ p,v=t[1]
+ if p!=OP:raise PreprocError("expected open parenthesis")
+ i=1
+ pindex=0
+ params={}
+ prev='('
+ while 1:
+ i+=1
+ p,v=t[i]
+ if prev=='(':
+ if p==IDENT:
+ params[v]=pindex
+ pindex+=1
+ prev=p
+ elif p==OP and v==')':
+ break
+ else:
+ raise PreprocError("unexpected token (3)")
+ elif prev==IDENT:
+ if p==OP and v==',':
+ prev=v
+ elif p==OP and v==')':
+ break
+ else:
+ raise PreprocError("comma or ... expected")
+ elif prev==',':
+ if p==IDENT:
+ params[v]=pindex
+ pindex+=1
+ prev=p
+ elif p==OP and v=='...':
+ raise PreprocError("not implemented (1)")
+ else:
+ raise PreprocError("comma or ... expected (2)")
+ elif prev=='...':
+ raise PreprocError("not implemented (2)")
+ else:
+ raise PreprocError("unexpected else")
+ return(name,[params,t[i+1:]])
+ else:
+ (p,v)=t[0]
+ return(v,[[],t[1:]])
+re_include=re.compile('^\s*(<(?P<a>.*)>|"(?P<b>.*)")')
+def extract_include(txt,defs):
+ m=re_include.search(txt)
+ if m:
+ if m.group('a'):return'<',m.group('a')
+ if m.group('b'):return'"',m.group('b')
+ toks=tokenize(txt)
+ reduce_tokens(toks,defs,['waf_include'])
+ if not toks:
+ raise PreprocError("could not parse include %s"%txt)
+ if len(toks)==1:
+ if toks[0][0]==STR:
+ return'"',toks[0][1]
+ else:
+ if toks[0][1]=='<'and toks[-1][1]=='>':
+ return stringize(toks).lstrip('<').rstrip('>')
+ raise PreprocError("could not parse include %s."%txt)
+def parse_char(txt):
+ if not txt:raise PreprocError("attempted to parse a null char")
+ if txt[0]!='\\':
+ return ord(txt)
+ c=txt[1]
+ if c=='x':
+ if len(txt)==4 and txt[3]in string.hexdigits:return int(txt[2:],16)
+ return int(txt[2:],16)
+ elif c.isdigit():
+ if c=='0'and len(txt)==2:return 0
+ for i in 3,2,1:
+ if len(txt)>i and txt[1:1+i].isdigit():
+ return(1+i,int(txt[1:1+i],8))
+ else:
+ try:return chr_esc[c]
+ except KeyError:raise PreprocError("could not parse char literal '%s'"%txt)
+def tokenize(s):
+ return tokenize_private(s)[:]
+@Utils.run_once
+def tokenize_private(s):
+ ret=[]
+ for match in re_clexer.finditer(s):
+ m=match.group
+ for name in tok_types:
+ v=m(name)
+ if v:
+ if name==IDENT:
+ try:v=g_optrans[v];name=OP
+ except KeyError:
+ if v.lower()=="true":
+ v=1
+ name=NUM
+ elif v.lower()=="false":
+ v=0
+ name=NUM
+ elif name==NUM:
+ if m('oct'):v=int(v,8)
+ elif m('hex'):v=int(m('hex'),16)
+ elif m('n0'):v=m('n0')
+ else:
+ v=m('char')
+ if v:v=parse_char(v)
+ else:v=m('n2')or m('n4')
+ elif name==OP:
+ if v=='%:':v='#'
+ elif v=='%:%:':v='##'
+ elif name==STR:
+ v=v[1:-1]
+ ret.append((name,v))
+ break
+ return ret
+@Utils.run_once
+def define_name(line):
+ return re_mac.match(line).group(0)
+class c_parser(object):
+ def __init__(self,nodepaths=None,defines=None):
+ self.lines=[]
+ if defines is None:
+ self.defs={}
+ else:
+ self.defs=dict(defines)
+ self.state=[]
+ self.count_files=0
+ self.currentnode_stack=[]
+ self.nodepaths=nodepaths or[]
+ self.nodes=[]
+ self.names=[]
+ self.curfile=''
+ self.ban_includes=set([])
+ def cached_find_resource(self,node,filename):
+ try:
+ nd=node.ctx.cache_nd
+ except AttributeError:
+ nd=node.ctx.cache_nd={}
+ tup=(node,filename)
+ try:
+ return nd[tup]
+ except KeyError:
+ ret=node.find_resource(filename)
+ if ret:
+ if getattr(ret,'children',None):
+ ret=None
+ elif ret.is_child_of(node.ctx.bldnode):
+ tmp=node.ctx.srcnode.search_node(ret.path_from(node.ctx.bldnode))
+ if tmp and getattr(tmp,'children',None):
+ ret=None
+ nd[tup]=ret
+ return ret
+ def tryfind(self,filename):
+ self.curfile=filename
+ found=self.cached_find_resource(self.currentnode_stack[-1],filename)
+ for n in self.nodepaths:
+ if found:
+ break
+ found=self.cached_find_resource(n,filename)
+ if found:
+ self.nodes.append(found)
+ if filename[-4:]!='.moc':
+ self.addlines(found)
+ else:
+ if not filename in self.names:
+ self.names.append(filename)
+ return found
+ def addlines(self,node):
+ self.currentnode_stack.append(node.parent)
+ filepath=node.abspath()
+ self.count_files+=1
+ if self.count_files>recursion_limit:
+ raise PreprocError("recursion limit exceeded")
+ pc=self.parse_cache
+ debug('preproc: reading file %r',filepath)
+ try:
+ lns=pc[filepath]
+ except KeyError:
+ pass
+ else:
+ self.lines.extend(lns)
+ return
+ try:
+ lines=filter_comments(filepath)
+ lines.append((POPFILE,''))
+ lines.reverse()
+ pc[filepath]=lines
+ self.lines.extend(lines)
+ except IOError:
+ raise PreprocError("could not read the file %s"%filepath)
+ except Exception:
+ if Logs.verbose>0:
+ error("parsing %s failed"%filepath)
+ traceback.print_exc()
+ def start(self,node,env):
+ debug('preproc: scanning %s (in %s)',node.name,node.parent.name)
+ bld=node.ctx
+ try:
+ self.parse_cache=bld.parse_cache
+ except AttributeError:
+ bld.parse_cache={}
+ self.parse_cache=bld.parse_cache
+ self.addlines(node)
+ if env['DEFINES']:
+ try:
+ lst=['%s %s'%(x[0],trimquotes('='.join(x[1:])))for x in[y.split('=')for y in env['DEFINES']]]
+ lst.reverse()
+ self.lines.extend([('define',x)for x in lst])
+ except AttributeError:
+ pass
+ while self.lines:
+ (token,line)=self.lines.pop()
+ if token==POPFILE:
+ self.count_files-=1
+ self.currentnode_stack.pop()
+ continue
+ try:
+ ve=Logs.verbose
+ if ve:debug('preproc: line is %s - %s state is %s',token,line,self.state)
+ state=self.state
+ if token[:2]=='if':
+ state.append(undefined)
+ elif token=='endif':
+ state.pop()
+ if token[0]!='e':
+ if skipped in self.state or ignored in self.state:
+ continue
+ if token=='if':
+ ret=eval_macro(tokenize(line),self.defs)
+ if ret:state[-1]=accepted
+ else:state[-1]=ignored
+ elif token=='ifdef':
+ m=re_mac.match(line)
+ if m and m.group(0)in self.defs:state[-1]=accepted
+ else:state[-1]=ignored
+ elif token=='ifndef':
+ m=re_mac.match(line)
+ if m and m.group(0)in self.defs:state[-1]=ignored
+ else:state[-1]=accepted
+ elif token=='include'or token=='import':
+ (kind,inc)=extract_include(line,self.defs)
+ if inc in self.ban_includes:
+ continue
+ if token=='import':self.ban_includes.add(inc)
+ if ve:debug('preproc: include found %s (%s) ',inc,kind)
+ if kind=='"'or not strict_quotes:
+ self.tryfind(inc)
+ elif token=='elif':
+ if state[-1]==accepted:
+ state[-1]=skipped
+ elif state[-1]==ignored:
+ if eval_macro(tokenize(line),self.defs):
+ state[-1]=accepted
+ elif token=='else':
+ if state[-1]==accepted:state[-1]=skipped
+ elif state[-1]==ignored:state[-1]=accepted
+ elif token=='define':
+ try:
+ self.defs[define_name(line)]=line
+ except Exception:
+ raise PreprocError("Invalid define line %s"%line)
+ elif token=='undef':
+ m=re_mac.match(line)
+ if m and m.group(0)in self.defs:
+ self.defs.__delitem__(m.group(0))
+ elif token=='pragma':
+ if re_pragma_once.match(line.lower()):
+ self.ban_includes.add(self.curfile)
+ except Exception ,e:
+ if Logs.verbose:
+ debug('preproc: line parsing failed (%s): %s %s',e,line,Utils.ex_stack())
+def scan(task):
+ global go_absolute
+ try:
+ incn=task.generator.includes_nodes
+ except AttributeError:
+ raise Errors.WafError('%r is missing a feature such as "c", "cxx" or "includes": '%task.generator)
+ if go_absolute:
+ nodepaths=incn+[task.generator.bld.root.find_dir(x)for x in standard_includes]
+ else:
+ nodepaths=[x for x in incn if x.is_child_of(x.ctx.srcnode)or x.is_child_of(x.ctx.bldnode)]
+ tmp=c_parser(nodepaths)
+ tmp.start(task.inputs[0],task.env)
+ if Logs.verbose:
+ debug('deps: deps for %r: %r; unresolved %r'%(task.inputs,tmp.nodes,tmp.names))
+ return(tmp.nodes,tmp.names)
--- /dev/null
+#! /usr/bin/env python
+# encoding: utf-8
+# WARNING! Do not edit! http://waf.googlecode.com/git/docs/wafbook/single.html#_obtaining_the_waf_file
+
+from waflib import Task
+from waflib.Configure import conf
+from waflib.TaskGen import feature,before_method,after_method
+import sys
+LIB_CODE='''
+#ifdef _MSC_VER
+#define testEXPORT __declspec(dllexport)
+#else
+#define testEXPORT
+#endif
+testEXPORT int lib_func(void) { return 9; }
+'''
+MAIN_CODE='''
+#ifdef _MSC_VER
+#define testEXPORT __declspec(dllimport)
+#else
+#define testEXPORT
+#endif
+testEXPORT int lib_func(void);
+int main(int argc, char **argv) {
+ (void)argc; (void)argv;
+ return !(lib_func() == 9);
+}
+'''
+@feature('link_lib_test')
+@before_method('process_source')
+def link_lib_test_fun(self):
+ def write_test_file(task):
+ task.outputs[0].write(task.generator.code)
+ rpath=[]
+ if getattr(self,'add_rpath',False):
+ rpath=[self.bld.path.get_bld().abspath()]
+ mode=self.mode
+ m='%s %s'%(mode,mode)
+ ex=self.test_exec and'test_exec'or''
+ bld=self.bld
+ bld(rule=write_test_file,target='test.'+mode,code=LIB_CODE)
+ bld(rule=write_test_file,target='main.'+mode,code=MAIN_CODE)
+ bld(features='%sshlib'%m,source='test.'+mode,target='test')
+ bld(features='%sprogram %s'%(m,ex),source='main.'+mode,target='app',use='test',rpath=rpath)
+@conf
+def check_library(self,mode=None,test_exec=True):
+ if not mode:
+ mode='c'
+ if self.env.CXX:
+ mode='cxx'
+ self.check(compile_filename=[],features='link_lib_test',msg='Checking for libraries',mode=mode,test_exec=test_exec,)
+INLINE_CODE='''
+typedef int foo_t;
+static %s foo_t static_foo () {return 0; }
+%s foo_t foo () {
+ return 0;
+}
+'''
+INLINE_VALUES=['inline','__inline__','__inline']
+@conf
+def check_inline(self,**kw):
+ self.start_msg('Checking for inline')
+ if not'define_name'in kw:
+ kw['define_name']='INLINE_MACRO'
+ if not'features'in kw:
+ if self.env.CXX:
+ kw['features']=['cxx']
+ else:
+ kw['features']=['c']
+ for x in INLINE_VALUES:
+ kw['fragment']=INLINE_CODE%(x,x)
+ try:
+ self.check(**kw)
+ except self.errors.ConfigurationError:
+ continue
+ else:
+ self.end_msg(x)
+ if x!='inline':
+ self.define('inline',x,quote=False)
+ return x
+ self.fatal('could not use inline functions')
+LARGE_FRAGMENT='''#include <unistd.h>
+int main(int argc, char **argv) {
+ (void)argc; (void)argv;
+ return !(sizeof(off_t) >= 8);
+}
+'''
+@conf
+def check_large_file(self,**kw):
+ if not'define_name'in kw:
+ kw['define_name']='HAVE_LARGEFILE'
+ if not'execute'in kw:
+ kw['execute']=True
+ if not'features'in kw:
+ if self.env.CXX:
+ kw['features']=['cxx','cxxprogram']
+ else:
+ kw['features']=['c','cprogram']
+ kw['fragment']=LARGE_FRAGMENT
+ kw['msg']='Checking for large file support'
+ ret=True
+ try:
+ if self.env.DEST_BINFMT!='pe':
+ ret=self.check(**kw)
+ except self.errors.ConfigurationError:
+ pass
+ else:
+ if ret:
+ return True
+ kw['msg']='Checking for -D_FILE_OFFSET_BITS=64'
+ kw['defines']=['_FILE_OFFSET_BITS=64']
+ try:
+ ret=self.check(**kw)
+ except self.errors.ConfigurationError:
+ pass
+ else:
+ self.define('_FILE_OFFSET_BITS',64)
+ return ret
+ self.fatal('There is no support for large files')
+ENDIAN_FRAGMENT='''
+short int ascii_mm[] = { 0x4249, 0x4765, 0x6E44, 0x6961, 0x6E53, 0x7953, 0 };
+short int ascii_ii[] = { 0x694C, 0x5454, 0x656C, 0x6E45, 0x6944, 0x6E61, 0 };
+int use_ascii (int i) {
+ return ascii_mm[i] + ascii_ii[i];
+}
+short int ebcdic_ii[] = { 0x89D3, 0xE3E3, 0x8593, 0x95C5, 0x89C4, 0x9581, 0 };
+short int ebcdic_mm[] = { 0xC2C9, 0xC785, 0x95C4, 0x8981, 0x95E2, 0xA8E2, 0 };
+int use_ebcdic (int i) {
+ return ebcdic_mm[i] + ebcdic_ii[i];
+}
+extern int foo;
+'''
+class grep_for_endianness(Task.Task):
+ color='PINK'
+ def run(self):
+ txt=self.inputs[0].read(flags='rb').decode('iso8859-1')
+ if txt.find('LiTTleEnDian')>-1:
+ self.generator.tmp.append('little')
+ elif txt.find('BIGenDianSyS')>-1:
+ self.generator.tmp.append('big')
+ else:
+ return-1
+@feature('grep_for_endianness')
+@after_method('process_source')
+def grep_for_endianness_fun(self):
+ self.create_task('grep_for_endianness',self.compiled_tasks[0].outputs[0])
+@conf
+def check_endianness(self):
+ tmp=[]
+ def check_msg(self):
+ return tmp[0]
+ self.check(fragment=ENDIAN_FRAGMENT,features='c grep_for_endianness',msg="Checking for endianness",define='ENDIANNESS',tmp=tmp,okmsg=check_msg)
+ return tmp[0]
--- /dev/null
+#! /usr/bin/env python
+# encoding: utf-8
+# WARNING! Do not edit! http://waf.googlecode.com/git/docs/wafbook/single.html#_obtaining_the_waf_file
+
+import os
+from waflib import Task,Utils,Node,Errors
+from waflib.TaskGen import after_method,before_method,feature,taskgen_method,extension
+from waflib.Tools import c_aliases,c_preproc,c_config,c_osx,c_tests
+from waflib.Configure import conf
+SYSTEM_LIB_PATHS=['/usr/lib64','/usr/lib','/usr/local/lib64','/usr/local/lib']
+USELIB_VARS=Utils.defaultdict(set)
+USELIB_VARS['c']=set(['INCLUDES','FRAMEWORKPATH','DEFINES','CPPFLAGS','CCDEPS','CFLAGS','ARCH'])
+USELIB_VARS['cxx']=set(['INCLUDES','FRAMEWORKPATH','DEFINES','CPPFLAGS','CXXDEPS','CXXFLAGS','ARCH'])
+USELIB_VARS['d']=set(['INCLUDES','DFLAGS'])
+USELIB_VARS['includes']=set(['INCLUDES','FRAMEWORKPATH','ARCH'])
+USELIB_VARS['cprogram']=USELIB_VARS['cxxprogram']=set(['LIB','STLIB','LIBPATH','STLIBPATH','LINKFLAGS','RPATH','LINKDEPS','FRAMEWORK','FRAMEWORKPATH','ARCH'])
+USELIB_VARS['cshlib']=USELIB_VARS['cxxshlib']=set(['LIB','STLIB','LIBPATH','STLIBPATH','LINKFLAGS','RPATH','LINKDEPS','FRAMEWORK','FRAMEWORKPATH','ARCH'])
+USELIB_VARS['cstlib']=USELIB_VARS['cxxstlib']=set(['ARFLAGS','LINKDEPS'])
+USELIB_VARS['dprogram']=set(['LIB','STLIB','LIBPATH','STLIBPATH','LINKFLAGS','RPATH','LINKDEPS'])
+USELIB_VARS['dshlib']=set(['LIB','STLIB','LIBPATH','STLIBPATH','LINKFLAGS','RPATH','LINKDEPS'])
+USELIB_VARS['dstlib']=set(['ARFLAGS','LINKDEPS'])
+USELIB_VARS['asm']=set(['ASFLAGS'])
+@taskgen_method
+def create_compiled_task(self,name,node):
+ out='%s.%d.o'%(node.name,self.idx)
+ task=self.create_task(name,node,node.parent.find_or_declare(out))
+ try:
+ self.compiled_tasks.append(task)
+ except AttributeError:
+ self.compiled_tasks=[task]
+ return task
+@taskgen_method
+def to_incnodes(self,inlst):
+ lst=[]
+ seen=set([])
+ for x in self.to_list(inlst):
+ if x in seen or not x:
+ continue
+ seen.add(x)
+ if isinstance(x,Node.Node):
+ lst.append(x)
+ else:
+ if os.path.isabs(x):
+ lst.append(self.bld.root.make_node(x)or x)
+ else:
+ if x[0]=='#':
+ p=self.bld.bldnode.make_node(x[1:])
+ v=self.bld.srcnode.make_node(x[1:])
+ else:
+ p=self.path.get_bld().make_node(x)
+ v=self.path.make_node(x)
+ if p.is_child_of(self.bld.bldnode):
+ p.mkdir()
+ lst.append(p)
+ lst.append(v)
+ return lst
+@feature('c','cxx','d','asm','fc','includes')
+@after_method('propagate_uselib_vars','process_source')
+def apply_incpaths(self):
+ lst=self.to_incnodes(self.to_list(getattr(self,'includes',[]))+self.env['INCLUDES'])
+ self.includes_nodes=lst
+ self.env['INCPATHS']=[x.abspath()for x in lst]
+class link_task(Task.Task):
+ color='YELLOW'
+ inst_to=None
+ chmod=Utils.O755
+ def add_target(self,target):
+ if isinstance(target,str):
+ pattern=self.env[self.__class__.__name__+'_PATTERN']
+ if not pattern:
+ pattern='%s'
+ folder,name=os.path.split(target)
+ if self.__class__.__name__.find('shlib')>0:
+ if self.env.DEST_BINFMT=='pe'and getattr(self.generator,'vnum',None):
+ name=name+'-'+self.generator.vnum.split('.')[0]
+ tmp=folder+os.sep+pattern%name
+ target=self.generator.path.find_or_declare(tmp)
+ self.set_outputs(target)
+class stlink_task(link_task):
+ run_str='${AR} ${ARFLAGS} ${AR_TGT_F}${TGT} ${AR_SRC_F}${SRC}'
+def rm_tgt(cls):
+ old=cls.run
+ def wrap(self):
+ try:os.remove(self.outputs[0].abspath())
+ except OSError:pass
+ return old(self)
+ setattr(cls,'run',wrap)
+rm_tgt(stlink_task)
+@feature('c','cxx','d','fc','asm')
+@after_method('process_source')
+def apply_link(self):
+ for x in self.features:
+ if x=='cprogram'and'cxx'in self.features:
+ x='cxxprogram'
+ elif x=='cshlib'and'cxx'in self.features:
+ x='cxxshlib'
+ if x in Task.classes:
+ if issubclass(Task.classes[x],link_task):
+ link=x
+ break
+ else:
+ return
+ objs=[t.outputs[0]for t in getattr(self,'compiled_tasks',[])]
+ self.link_task=self.create_task(link,objs)
+ self.link_task.add_target(self.target)
+ try:
+ inst_to=self.install_path
+ except AttributeError:
+ inst_to=self.link_task.__class__.inst_to
+ if inst_to:
+ self.install_task=self.bld.install_files(inst_to,self.link_task.outputs[:],env=self.env,chmod=self.link_task.chmod)
+@taskgen_method
+def use_rec(self,name,**kw):
+ if name in self.tmp_use_not or name in self.tmp_use_seen:
+ return
+ try:
+ y=self.bld.get_tgen_by_name(name)
+ except Errors.WafError:
+ self.uselib.append(name)
+ self.tmp_use_not.add(name)
+ return
+ self.tmp_use_seen.append(name)
+ y.post()
+ y.tmp_use_objects=objects=kw.get('objects',True)
+ y.tmp_use_stlib=stlib=kw.get('stlib',True)
+ try:
+ link_task=y.link_task
+ except AttributeError:
+ y.tmp_use_var=''
+ else:
+ objects=False
+ if not isinstance(link_task,stlink_task):
+ stlib=False
+ y.tmp_use_var='LIB'
+ else:
+ y.tmp_use_var='STLIB'
+ p=self.tmp_use_prec
+ for x in self.to_list(getattr(y,'use',[])):
+ try:
+ p[x].append(name)
+ except KeyError:
+ p[x]=[name]
+ self.use_rec(x,objects=objects,stlib=stlib)
+@feature('c','cxx','d','use','fc')
+@before_method('apply_incpaths','propagate_uselib_vars')
+@after_method('apply_link','process_source')
+def process_use(self):
+ use_not=self.tmp_use_not=set([])
+ self.tmp_use_seen=[]
+ use_prec=self.tmp_use_prec={}
+ self.uselib=self.to_list(getattr(self,'uselib',[]))
+ self.includes=self.to_list(getattr(self,'includes',[]))
+ names=self.to_list(getattr(self,'use',[]))
+ for x in names:
+ self.use_rec(x)
+ for x in use_not:
+ if x in use_prec:
+ del use_prec[x]
+ out=[]
+ tmp=[]
+ for x in self.tmp_use_seen:
+ for k in use_prec.values():
+ if x in k:
+ break
+ else:
+ tmp.append(x)
+ while tmp:
+ e=tmp.pop()
+ out.append(e)
+ try:
+ nlst=use_prec[e]
+ except KeyError:
+ pass
+ else:
+ del use_prec[e]
+ for x in nlst:
+ for y in use_prec:
+ if x in use_prec[y]:
+ break
+ else:
+ tmp.append(x)
+ if use_prec:
+ raise Errors.WafError('Cycle detected in the use processing %r'%use_prec)
+ out.reverse()
+ link_task=getattr(self,'link_task',None)
+ for x in out:
+ y=self.bld.get_tgen_by_name(x)
+ var=y.tmp_use_var
+ if var and link_task:
+ if var=='LIB'or y.tmp_use_stlib:
+ self.env.append_value(var,[y.target[y.target.rfind(os.sep)+1:]])
+ self.link_task.dep_nodes.extend(y.link_task.outputs)
+ tmp_path=y.link_task.outputs[0].parent.path_from(self.bld.bldnode)
+ self.env.append_value(var+'PATH',[tmp_path])
+ else:
+ if y.tmp_use_objects:
+ self.add_objects_from_tgen(y)
+ if getattr(y,'export_includes',None):
+ self.includes.extend(y.to_incnodes(y.export_includes))
+ for x in names:
+ try:
+ y=self.bld.get_tgen_by_name(x)
+ except Exception:
+ if not self.env['STLIB_'+x]and not x in self.uselib:
+ self.uselib.append(x)
+ else:
+ for k in self.to_list(getattr(y,'uselib',[])):
+ if not self.env['STLIB_'+k]and not k in self.uselib:
+ self.uselib.append(k)
+@taskgen_method
+def accept_node_to_link(self,node):
+ return not node.name.endswith('.pdb')
+@taskgen_method
+def add_objects_from_tgen(self,tg):
+ try:
+ link_task=self.link_task
+ except AttributeError:
+ pass
+ else:
+ for tsk in getattr(tg,'compiled_tasks',[]):
+ for x in tsk.outputs:
+ if self.accept_node_to_link(x):
+ link_task.inputs.append(x)
+@taskgen_method
+def get_uselib_vars(self):
+ _vars=set([])
+ for x in self.features:
+ if x in USELIB_VARS:
+ _vars|=USELIB_VARS[x]
+ return _vars
+@feature('c','cxx','d','fc','javac','cs','uselib','asm')
+@after_method('process_use')
+def propagate_uselib_vars(self):
+ _vars=self.get_uselib_vars()
+ env=self.env
+ for x in _vars:
+ y=x.lower()
+ env.append_unique(x,self.to_list(getattr(self,y,[])))
+ for x in self.features:
+ for var in _vars:
+ compvar='%s_%s'%(var,x)
+ env.append_value(var,env[compvar])
+ for x in self.to_list(getattr(self,'uselib',[])):
+ for v in _vars:
+ env.append_value(v,env[v+'_'+x])
+@feature('cshlib','cxxshlib','fcshlib')
+@after_method('apply_link')
+def apply_implib(self):
+ if not self.env.DEST_BINFMT=='pe':
+ return
+ dll=self.link_task.outputs[0]
+ if isinstance(self.target,Node.Node):
+ name=self.target.name
+ else:
+ name=os.path.split(self.target)[1]
+ implib=self.env['implib_PATTERN']%name
+ implib=dll.parent.find_or_declare(implib)
+ self.env.append_value('LINKFLAGS',self.env['IMPLIB_ST']%implib.bldpath())
+ self.link_task.outputs.append(implib)
+ if getattr(self,'defs',None)and self.env.DEST_BINFMT=='pe':
+ node=self.path.find_resource(self.defs)
+ if not node:
+ raise Errors.WafError('invalid def file %r'%self.defs)
+ if'msvc'in(self.env.CC_NAME,self.env.CXX_NAME):
+ self.env.append_value('LINKFLAGS','/def:%s'%node.path_from(self.bld.bldnode))
+ self.link_task.dep_nodes.append(node)
+ else:
+ self.link_task.inputs.append(node)
+ try:
+ inst_to=self.install_path
+ except AttributeError:
+ inst_to=self.link_task.__class__.inst_to
+ if not inst_to:
+ return
+ self.implib_install_task=self.bld.install_as('${LIBDIR}/%s'%implib.name,implib,self.env)
+@feature('cshlib','cxxshlib','dshlib','fcshlib','vnum')
+@after_method('apply_link','propagate_uselib_vars')
+def apply_vnum(self):
+ if not getattr(self,'vnum','')or os.name!='posix'or self.env.DEST_BINFMT not in('elf','mac-o'):
+ return
+ link=self.link_task
+ nums=self.vnum.split('.')
+ node=link.outputs[0]
+ libname=node.name
+ if libname.endswith('.dylib'):
+ name3=libname.replace('.dylib','.%s.dylib'%self.vnum)
+ name2=libname.replace('.dylib','.%s.dylib'%nums[0])
+ else:
+ name3=libname+'.'+self.vnum
+ name2=libname+'.'+nums[0]
+ if self.env.SONAME_ST:
+ v=self.env.SONAME_ST%name2
+ self.env.append_value('LINKFLAGS',v.split())
+ self.create_task('vnum',node,[node.parent.find_or_declare(name2),node.parent.find_or_declare(name3)])
+ if getattr(self,'install_task',None):
+ self.install_task.hasrun=Task.SKIP_ME
+ bld=self.bld
+ path=self.install_task.dest
+ t1=bld.install_as(path+os.sep+name3,node,env=self.env,chmod=self.link_task.chmod)
+ t2=bld.symlink_as(path+os.sep+name2,name3)
+ t3=bld.symlink_as(path+os.sep+libname,name3)
+ self.vnum_install_task=(t1,t2,t3)
+ if'-dynamiclib'in self.env['LINKFLAGS']:
+ try:
+ inst_to=self.install_path
+ except AttributeError:
+ inst_to=self.link_task.__class__.inst_to
+ if inst_to:
+ p=Utils.subst_vars(inst_to,self.env)
+ path=os.path.join(p,self.link_task.outputs[0].name)
+ self.env.append_value('LINKFLAGS',['-install_name',path])
+class vnum(Task.Task):
+ color='CYAN'
+ quient=True
+ ext_in=['.bin']
+ def run(self):
+ for x in self.outputs:
+ path=x.abspath()
+ try:
+ os.remove(path)
+ except OSError:
+ pass
+ try:
+ os.symlink(self.inputs[0].name,path)
+ except OSError:
+ return 1
+class fake_shlib(link_task):
+ def runnable_status(self):
+ for t in self.run_after:
+ if not t.hasrun:
+ return Task.ASK_LATER
+ for x in self.outputs:
+ x.sig=Utils.h_file(x.abspath())
+ return Task.SKIP_ME
+class fake_stlib(stlink_task):
+ def runnable_status(self):
+ for t in self.run_after:
+ if not t.hasrun:
+ return Task.ASK_LATER
+ for x in self.outputs:
+ x.sig=Utils.h_file(x.abspath())
+ return Task.SKIP_ME
+@conf
+def read_shlib(self,name,paths=[]):
+ return self(name=name,features='fake_lib',lib_paths=paths,lib_type='shlib')
+@conf
+def read_stlib(self,name,paths=[]):
+ return self(name=name,features='fake_lib',lib_paths=paths,lib_type='stlib')
+lib_patterns={'shlib':['lib%s.so','%s.so','lib%s.dylib','lib%s.dll','%s.dll'],'stlib':['lib%s.a','%s.a','lib%s.dll','%s.dll','lib%s.lib','%s.lib'],}
+@feature('fake_lib')
+def process_lib(self):
+ node=None
+ names=[x%self.name for x in lib_patterns[self.lib_type]]
+ for x in self.lib_paths+[self.path]+SYSTEM_LIB_PATHS:
+ if not isinstance(x,Node.Node):
+ x=self.bld.root.find_node(x)or self.path.find_node(x)
+ if not x:
+ continue
+ for y in names:
+ node=x.find_node(y)
+ if node:
+ node.sig=Utils.h_file(node.abspath())
+ break
+ else:
+ continue
+ break
+ else:
+ raise Errors.WafError('could not find library %r'%self.name)
+ self.link_task=self.create_task('fake_%s'%self.lib_type,[],[node])
+ self.target=self.name
+class fake_o(Task.Task):
+ def runnable_status(self):
+ return Task.SKIP_ME
+@extension('.o','.obj')
+def add_those_o_files(self,node):
+ tsk=self.create_task('fake_o',[],node)
+ try:
+ self.compiled_tasks.append(tsk)
+ except AttributeError:
+ self.compiled_tasks=[tsk]
+@feature('fake_obj')
+@before_method('process_source')
+def process_objs(self):
+ for node in self.to_nodes(self.source):
+ self.add_those_o_files(node)
+ self.source=[]
+@conf
+def read_object(self,obj):
+ if not isinstance(obj,self.path.__class__):
+ obj=self.path.find_resource(obj)
+ return self(features='fake_obj',source=obj,name=obj.name)
--- /dev/null
+#! /usr/bin/env python
+# encoding: utf-8
+# WARNING! Do not edit! http://waf.googlecode.com/git/docs/wafbook/single.html#_obtaining_the_waf_file
+
+import os,sys,imp,types
+from waflib.Tools import ccroot
+from waflib import Utils,Configure
+from waflib.Logs import debug
+c_compiler={'win32':['msvc','gcc'],'cygwin':['gcc'],'darwin':['gcc'],'aix':['xlc','gcc'],'linux':['gcc','icc'],'sunos':['suncc','gcc'],'irix':['gcc','irixcc'],'hpux':['gcc'],'gnu':['gcc'],'java':['gcc','msvc','icc'],'default':['gcc'],}
+def configure(conf):
+ try:test_for_compiler=conf.options.check_c_compiler
+ except AttributeError:conf.fatal("Add options(opt): opt.load('compiler_c')")
+ for compiler in test_for_compiler.split():
+ conf.env.stash()
+ conf.start_msg('Checking for %r (c compiler)'%compiler)
+ try:
+ conf.load(compiler)
+ except conf.errors.ConfigurationError ,e:
+ conf.env.revert()
+ conf.end_msg(False)
+ debug('compiler_c: %r'%e)
+ else:
+ if conf.env['CC']:
+ conf.end_msg(conf.env.get_flat('CC'))
+ conf.env['COMPILER_CC']=compiler
+ break
+ conf.end_msg(False)
+ else:
+ conf.fatal('could not configure a c compiler!')
+def options(opt):
+ opt.load_special_tools('c_*.py',ban=['c_dumbpreproc.py'])
+ global c_compiler
+ build_platform=Utils.unversioned_sys_platform()
+ possible_compiler_list=c_compiler[build_platform in c_compiler and build_platform or'default']
+ test_for_compiler=' '.join(possible_compiler_list)
+ cc_compiler_opts=opt.add_option_group("C Compiler Options")
+ cc_compiler_opts.add_option('--check-c-compiler',default="%s"%test_for_compiler,help='On this platform (%s) the following C-Compiler will be checked by default: "%s"'%(build_platform,test_for_compiler),dest="check_c_compiler")
+ for x in test_for_compiler.split():
+ opt.load('%s'%x)
--- /dev/null
+#! /usr/bin/env python
+# encoding: utf-8
+# WARNING! Do not edit! http://waf.googlecode.com/git/docs/wafbook/single.html#_obtaining_the_waf_file
+
+import os,sys,imp,types
+from waflib.Tools import ccroot
+from waflib import Utils,Configure
+from waflib.Logs import debug
+cxx_compiler={'win32':['msvc','g++'],'cygwin':['g++'],'darwin':['g++'],'aix':['xlc++','g++'],'linux':['g++','icpc'],'sunos':['sunc++','g++'],'irix':['g++'],'hpux':['g++'],'gnu':['g++'],'java':['g++','msvc','icpc'],'default':['g++']}
+def configure(conf):
+ try:test_for_compiler=conf.options.check_cxx_compiler
+ except AttributeError:conf.fatal("Add options(opt): opt.load('compiler_cxx')")
+ for compiler in test_for_compiler.split():
+ conf.env.stash()
+ conf.start_msg('Checking for %r (c++ compiler)'%compiler)
+ try:
+ conf.load(compiler)
+ except conf.errors.ConfigurationError ,e:
+ conf.env.revert()
+ conf.end_msg(False)
+ debug('compiler_cxx: %r'%e)
+ else:
+ if conf.env['CXX']:
+ conf.end_msg(conf.env.get_flat('CXX'))
+ conf.env['COMPILER_CXX']=compiler
+ break
+ conf.end_msg(False)
+ else:
+ conf.fatal('could not configure a c++ compiler!')
+def options(opt):
+ opt.load_special_tools('cxx_*.py')
+ global cxx_compiler
+ build_platform=Utils.unversioned_sys_platform()
+ possible_compiler_list=cxx_compiler[build_platform in cxx_compiler and build_platform or'default']
+ test_for_compiler=' '.join(possible_compiler_list)
+ cxx_compiler_opts=opt.add_option_group('C++ Compiler Options')
+ cxx_compiler_opts.add_option('--check-cxx-compiler',default="%s"%test_for_compiler,help='On this platform (%s) the following C++ Compiler will be checked by default: "%s"'%(build_platform,test_for_compiler),dest="check_cxx_compiler")
+ for x in test_for_compiler.split():
+ opt.load('%s'%x)
--- /dev/null
+#! /usr/bin/env python
+# encoding: utf-8
+# WARNING! Do not edit! http://waf.googlecode.com/git/docs/wafbook/single.html#_obtaining_the_waf_file
+
+import os,sys,imp,types
+from waflib import Utils,Configure,Options,Logs
+def configure(conf):
+ for compiler in conf.options.dcheck.split(','):
+ conf.env.stash()
+ conf.start_msg('Checking for %r (d compiler)'%compiler)
+ try:
+ conf.load(compiler)
+ except conf.errors.ConfigurationError ,e:
+ conf.env.revert()
+ conf.end_msg(False)
+ Logs.debug('compiler_d: %r'%e)
+ else:
+ if conf.env.D:
+ conf.end_msg(conf.env.get_flat('D'))
+ conf.env['COMPILER_D']=compiler
+ break
+ conf.end_msg(False)
+ else:
+ conf.fatal('no suitable d compiler was found')
+def options(opt):
+ d_compiler_opts=opt.add_option_group('D Compiler Options')
+ d_compiler_opts.add_option('--check-d-compiler',default='gdc,dmd,ldc2',action='store',help='check for the compiler [Default:gdc,dmd,ldc2]',dest='dcheck')
+ for d_compiler in['gdc','dmd','ldc2']:
+ opt.load('%s'%d_compiler)
--- /dev/null
+#! /usr/bin/env python
+# encoding: utf-8
+# WARNING! Do not edit! http://waf.googlecode.com/git/docs/wafbook/single.html#_obtaining_the_waf_file
+
+import os,sys,imp,types
+from waflib import Utils,Configure,Options,Logs,Errors
+from waflib.Tools import fc
+fc_compiler={'win32':['gfortran','ifort'],'darwin':['gfortran','g95','ifort'],'linux':['gfortran','g95','ifort'],'java':['gfortran','g95','ifort'],'default':['gfortran'],'aix':['gfortran']}
+def __list_possible_compiler(platform):
+ try:
+ return fc_compiler[platform]
+ except KeyError:
+ return fc_compiler["default"]
+def configure(conf):
+ try:test_for_compiler=conf.options.check_fc
+ except AttributeError:conf.fatal("Add options(opt): opt.load('compiler_fc')")
+ for compiler in test_for_compiler.split():
+ conf.env.stash()
+ conf.start_msg('Checking for %r (fortran compiler)'%compiler)
+ try:
+ conf.load(compiler)
+ except conf.errors.ConfigurationError ,e:
+ conf.env.revert()
+ conf.end_msg(False)
+ Logs.debug('compiler_fortran: %r'%e)
+ else:
+ if conf.env['FC']:
+ conf.end_msg(conf.env.get_flat('FC'))
+ conf.env.COMPILER_FORTRAN=compiler
+ break
+ conf.end_msg(False)
+ else:
+ conf.fatal('could not configure a fortran compiler!')
+def options(opt):
+ opt.load_special_tools('fc_*.py')
+ build_platform=Utils.unversioned_sys_platform()
+ detected_platform=Options.platform
+ possible_compiler_list=__list_possible_compiler(detected_platform)
+ test_for_compiler=' '.join(possible_compiler_list)
+ fortran_compiler_opts=opt.add_option_group("Fortran Compiler Options")
+ fortran_compiler_opts.add_option('--check-fortran-compiler',default="%s"%test_for_compiler,help='On this platform (%s) the following Fortran Compiler will be checked by default: "%s"'%(detected_platform,test_for_compiler),dest="check_fc")
+ for compiler in test_for_compiler.split():
+ opt.load('%s'%compiler)
--- /dev/null
+#! /usr/bin/env python
+# encoding: utf-8
+# WARNING! Do not edit! http://waf.googlecode.com/git/docs/wafbook/single.html#_obtaining_the_waf_file
+
+from waflib import Utils,Task,Options,Logs,Errors
+from waflib.TaskGen import before_method,after_method,feature
+from waflib.Tools import ccroot
+from waflib.Configure import conf
+import os,tempfile
+ccroot.USELIB_VARS['cs']=set(['CSFLAGS','ASSEMBLIES','RESOURCES'])
+ccroot.lib_patterns['csshlib']=['%s']
+@feature('cs')
+@before_method('process_source')
+def apply_cs(self):
+ cs_nodes=[]
+ no_nodes=[]
+ for x in self.to_nodes(self.source):
+ if x.name.endswith('.cs'):
+ cs_nodes.append(x)
+ else:
+ no_nodes.append(x)
+ self.source=no_nodes
+ bintype=getattr(self,'bintype',self.gen.endswith('.dll')and'library'or'exe')
+ self.cs_task=tsk=self.create_task('mcs',cs_nodes,self.path.find_or_declare(self.gen))
+ tsk.env.CSTYPE='/target:%s'%bintype
+ tsk.env.OUT='/out:%s'%tsk.outputs[0].abspath()
+ self.env.append_value('CSFLAGS','/platform:%s'%getattr(self,'platform','anycpu'))
+ inst_to=getattr(self,'install_path',bintype=='exe'and'${BINDIR}'or'${LIBDIR}')
+ if inst_to:
+ mod=getattr(self,'chmod',bintype=='exe'and Utils.O755 or Utils.O644)
+ self.install_task=self.bld.install_files(inst_to,self.cs_task.outputs[:],env=self.env,chmod=mod)
+@feature('cs')
+@after_method('apply_cs')
+def use_cs(self):
+ names=self.to_list(getattr(self,'use',[]))
+ get=self.bld.get_tgen_by_name
+ for x in names:
+ try:
+ y=get(x)
+ except Errors.WafError:
+ self.env.append_value('CSFLAGS','/reference:%s'%x)
+ continue
+ y.post()
+ tsk=getattr(y,'cs_task',None)or getattr(y,'link_task',None)
+ if not tsk:
+ self.bld.fatal('cs task has no link task for use %r'%self)
+ self.cs_task.dep_nodes.extend(tsk.outputs)
+ self.cs_task.set_run_after(tsk)
+ self.env.append_value('CSFLAGS','/reference:%s'%tsk.outputs[0].abspath())
+@feature('cs')
+@after_method('apply_cs','use_cs')
+def debug_cs(self):
+ csdebug=getattr(self,'csdebug',self.env.CSDEBUG)
+ if not csdebug:
+ return
+ node=self.cs_task.outputs[0]
+ if self.env.CS_NAME=='mono':
+ out=node.parent.find_or_declare(node.name+'.mdb')
+ else:
+ out=node.change_ext('.pdb')
+ self.cs_task.outputs.append(out)
+ try:
+ self.install_task.source.append(out)
+ except AttributeError:
+ pass
+ if csdebug=='pdbonly':
+ val=['/debug+','/debug:pdbonly']
+ elif csdebug=='full':
+ val=['/debug+','/debug:full']
+ else:
+ val=['/debug-']
+ self.env.append_value('CSFLAGS',val)
+class mcs(Task.Task):
+ color='YELLOW'
+ run_str='${MCS} ${CSTYPE} ${CSFLAGS} ${ASS_ST:ASSEMBLIES} ${RES_ST:RESOURCES} ${OUT} ${SRC}'
+ def exec_command(self,cmd,**kw):
+ bld=self.generator.bld
+ try:
+ if not kw.get('cwd',None):
+ kw['cwd']=bld.cwd
+ except AttributeError:
+ bld.cwd=kw['cwd']=bld.variant_dir
+ try:
+ tmp=None
+ if isinstance(cmd,list)and len(' '.join(cmd))>=8192:
+ program=cmd[0]
+ cmd=[self.quote_response_command(x)for x in cmd]
+ (fd,tmp)=tempfile.mkstemp()
+ os.write(fd,'\r\n'.join(i.replace('\\','\\\\')for i in cmd[1:]))
+ os.close(fd)
+ cmd=[program,'@'+tmp]
+ ret=self.generator.bld.exec_command(cmd,**kw)
+ finally:
+ if tmp:
+ try:
+ os.remove(tmp)
+ except OSError:
+ pass
+ return ret
+ def quote_response_command(self,flag):
+ if flag.lower()=='/noconfig':
+ return''
+ if flag.find(' ')>-1:
+ for x in('/r:','/reference:','/resource:','/lib:','/out:'):
+ if flag.startswith(x):
+ flag='%s"%s"'%(x,flag[len(x):])
+ break
+ else:
+ flag='"%s"'%flag
+ return flag
+def configure(conf):
+ csc=getattr(Options.options,'cscbinary',None)
+ if csc:
+ conf.env.MCS=csc
+ conf.find_program(['csc','mcs','gmcs'],var='MCS')
+ conf.env.ASS_ST='/r:%s'
+ conf.env.RES_ST='/resource:%s'
+ conf.env.CS_NAME='csc'
+ if str(conf.env.MCS).lower().find('mcs')>-1:
+ conf.env.CS_NAME='mono'
+def options(opt):
+ opt.add_option('--with-csc-binary',type='string',dest='cscbinary')
+class fake_csshlib(Task.Task):
+ color='YELLOW'
+ inst_to=None
+ def runnable_status(self):
+ for x in self.outputs:
+ x.sig=Utils.h_file(x.abspath())
+ return Task.SKIP_ME
+@conf
+def read_csshlib(self,name,paths=[]):
+ return self(name=name,features='fake_lib',lib_paths=paths,lib_type='csshlib')
--- /dev/null
+#! /usr/bin/env python
+# encoding: utf-8
+# WARNING! Do not edit! http://waf.googlecode.com/git/docs/wafbook/single.html#_obtaining_the_waf_file
+
+from waflib import TaskGen,Task,Utils
+from waflib.Tools import c_preproc
+from waflib.Tools.ccroot import link_task,stlink_task
+@TaskGen.extension('.cpp','.cc','.cxx','.C','.c++')
+def cxx_hook(self,node):
+ return self.create_compiled_task('cxx',node)
+if not'.c'in TaskGen.task_gen.mappings:
+ TaskGen.task_gen.mappings['.c']=TaskGen.task_gen.mappings['.cpp']
+class cxx(Task.Task):
+ run_str='${CXX} ${ARCH_ST:ARCH} ${CXXFLAGS} ${CPPFLAGS} ${FRAMEWORKPATH_ST:FRAMEWORKPATH} ${CPPPATH_ST:INCPATHS} ${DEFINES_ST:DEFINES} ${CXX_SRC_F}${SRC} ${CXX_TGT_F}${TGT}'
+ vars=['CXXDEPS']
+ ext_in=['.h']
+ scan=c_preproc.scan
+class cxxprogram(link_task):
+ run_str='${LINK_CXX} ${LINKFLAGS} ${CXXLNK_SRC_F}${SRC} ${CXXLNK_TGT_F}${TGT[0].abspath()} ${RPATH_ST:RPATH} ${FRAMEWORKPATH_ST:FRAMEWORKPATH} ${FRAMEWORK_ST:FRAMEWORK} ${ARCH_ST:ARCH} ${STLIB_MARKER} ${STLIBPATH_ST:STLIBPATH} ${STLIB_ST:STLIB} ${SHLIB_MARKER} ${LIBPATH_ST:LIBPATH} ${LIB_ST:LIB}'
+ vars=['LINKDEPS']
+ ext_out=['.bin']
+ inst_to='${BINDIR}'
+class cxxshlib(cxxprogram):
+ inst_to='${LIBDIR}'
+class cxxstlib(stlink_task):
+ pass
--- /dev/null
+#! /usr/bin/env python
+# encoding: utf-8
+# WARNING! Do not edit! http://waf.googlecode.com/git/docs/wafbook/single.html#_obtaining_the_waf_file
+
+from waflib import Utils,Task,Errors
+from waflib.TaskGen import taskgen_method,feature,extension
+from waflib.Tools import d_scan,d_config
+from waflib.Tools.ccroot import link_task,stlink_task
+class d(Task.Task):
+ color='GREEN'
+ run_str='${D} ${DFLAGS} ${DINC_ST:INCPATHS} ${D_SRC_F:SRC} ${D_TGT_F:TGT}'
+ scan=d_scan.scan
+class d_with_header(d):
+ run_str='${D} ${DFLAGS} ${DINC_ST:INCPATHS} ${D_HDR_F:tgt.outputs[1].bldpath()} ${D_SRC_F:SRC} ${D_TGT_F:tgt.outputs[0].bldpath()}'
+class d_header(Task.Task):
+ color='BLUE'
+ run_str='${D} ${D_HEADER} ${SRC}'
+class dprogram(link_task):
+ run_str='${D_LINKER} ${LINKFLAGS} ${DLNK_SRC_F}${SRC} ${DLNK_TGT_F:TGT} ${RPATH_ST:RPATH} ${DSTLIB_MARKER} ${DSTLIBPATH_ST:STLIBPATH} ${DSTLIB_ST:STLIB} ${DSHLIB_MARKER} ${DLIBPATH_ST:LIBPATH} ${DSHLIB_ST:LIB}'
+ inst_to='${BINDIR}'
+class dshlib(dprogram):
+ inst_to='${LIBDIR}'
+class dstlib(stlink_task):
+ pass
+@extension('.d','.di','.D')
+def d_hook(self,node):
+ ext=Utils.destos_to_binfmt(self.env.DEST_OS)=='pe'and'obj'or'o'
+ out='%s.%d.%s'%(node.name,self.idx,ext)
+ def create_compiled_task(self,name,node):
+ task=self.create_task(name,node,node.parent.find_or_declare(out))
+ try:
+ self.compiled_tasks.append(task)
+ except AttributeError:
+ self.compiled_tasks=[task]
+ return task
+ if getattr(self,'generate_headers',None):
+ tsk=create_compiled_task(self,'d_with_header',node)
+ tsk.outputs.append(node.change_ext(self.env['DHEADER_ext']))
+ else:
+ tsk=create_compiled_task(self,'d',node)
+ return tsk
+@taskgen_method
+def generate_header(self,filename):
+ try:
+ self.header_lst.append([filename,self.install_path])
+ except AttributeError:
+ self.header_lst=[[filename,self.install_path]]
+@feature('d')
+def process_header(self):
+ for i in getattr(self,'header_lst',[]):
+ node=self.path.find_resource(i[0])
+ if not node:
+ raise Errors.WafError('file %r not found on d obj'%i[0])
+ self.create_task('d_header',node,node.change_ext('.di'))
--- /dev/null
+#! /usr/bin/env python
+# encoding: utf-8
+# WARNING! Do not edit! http://waf.googlecode.com/git/docs/wafbook/single.html#_obtaining_the_waf_file
+
+from waflib import Utils
+from waflib.Configure import conf
+@conf
+def d_platform_flags(self):
+ v=self.env
+ if not v.DEST_OS:
+ v.DEST_OS=Utils.unversioned_sys_platform()
+ binfmt=Utils.destos_to_binfmt(self.env.DEST_OS)
+ if binfmt=='pe':
+ v['dprogram_PATTERN']='%s.exe'
+ v['dshlib_PATTERN']='lib%s.dll'
+ v['dstlib_PATTERN']='lib%s.a'
+ elif binfmt=='mac-o':
+ v['dprogram_PATTERN']='%s'
+ v['dshlib_PATTERN']='lib%s.dylib'
+ v['dstlib_PATTERN']='lib%s.a'
+ else:
+ v['dprogram_PATTERN']='%s'
+ v['dshlib_PATTERN']='lib%s.so'
+ v['dstlib_PATTERN']='lib%s.a'
+DLIB='''
+version(D_Version2) {
+ import std.stdio;
+ int main() {
+ writefln("phobos2");
+ return 0;
+ }
+} else {
+ version(Tango) {
+ import tango.stdc.stdio;
+ int main() {
+ printf("tango");
+ return 0;
+ }
+ } else {
+ import std.stdio;
+ int main() {
+ writefln("phobos1");
+ return 0;
+ }
+ }
+}
+'''
+@conf
+def check_dlibrary(self,execute=True):
+ ret=self.check_cc(features='d dprogram',fragment=DLIB,compile_filename='test.d',execute=execute,define_ret=True)
+ if execute:
+ self.env.DLIBRARY=ret.strip()
--- /dev/null
+#! /usr/bin/env python
+# encoding: utf-8
+# WARNING! Do not edit! http://waf.googlecode.com/git/docs/wafbook/single.html#_obtaining_the_waf_file
+
+import re
+from waflib import Utils,Logs
+def filter_comments(filename):
+ txt=Utils.readf(filename)
+ i=0
+ buf=[]
+ max=len(txt)
+ begin=0
+ while i<max:
+ c=txt[i]
+ if c=='"'or c=="'":
+ buf.append(txt[begin:i])
+ delim=c
+ i+=1
+ while i<max:
+ c=txt[i]
+ if c==delim:break
+ elif c=='\\':
+ i+=1
+ i+=1
+ i+=1
+ begin=i
+ elif c=='/':
+ buf.append(txt[begin:i])
+ i+=1
+ if i==max:break
+ c=txt[i]
+ if c=='+':
+ i+=1
+ nesting=1
+ c=None
+ while i<max:
+ prev=c
+ c=txt[i]
+ if prev=='/'and c=='+':
+ nesting+=1
+ c=None
+ elif prev=='+'and c=='/':
+ nesting-=1
+ if nesting==0:break
+ c=None
+ i+=1
+ elif c=='*':
+ i+=1
+ c=None
+ while i<max:
+ prev=c
+ c=txt[i]
+ if prev=='*'and c=='/':break
+ i+=1
+ elif c=='/':
+ i+=1
+ while i<max and txt[i]!='\n':
+ i+=1
+ else:
+ begin=i-1
+ continue
+ i+=1
+ begin=i
+ buf.append(' ')
+ else:
+ i+=1
+ buf.append(txt[begin:])
+ return buf
+class d_parser(object):
+ def __init__(self,env,incpaths):
+ self.allnames=[]
+ self.re_module=re.compile("module\s+([^;]+)")
+ self.re_import=re.compile("import\s+([^;]+)")
+ self.re_import_bindings=re.compile("([^:]+):(.*)")
+ self.re_import_alias=re.compile("[^=]+=(.+)")
+ self.env=env
+ self.nodes=[]
+ self.names=[]
+ self.incpaths=incpaths
+ def tryfind(self,filename):
+ found=0
+ for n in self.incpaths:
+ found=n.find_resource(filename.replace('.','/')+'.d')
+ if found:
+ self.nodes.append(found)
+ self.waiting.append(found)
+ break
+ if not found:
+ if not filename in self.names:
+ self.names.append(filename)
+ def get_strings(self,code):
+ self.module=''
+ lst=[]
+ mod_name=self.re_module.search(code)
+ if mod_name:
+ self.module=re.sub('\s+','',mod_name.group(1))
+ import_iterator=self.re_import.finditer(code)
+ if import_iterator:
+ for import_match in import_iterator:
+ import_match_str=re.sub('\s+','',import_match.group(1))
+ bindings_match=self.re_import_bindings.match(import_match_str)
+ if bindings_match:
+ import_match_str=bindings_match.group(1)
+ matches=import_match_str.split(',')
+ for match in matches:
+ alias_match=self.re_import_alias.match(match)
+ if alias_match:
+ match=alias_match.group(1)
+ lst.append(match)
+ return lst
+ def start(self,node):
+ self.waiting=[node]
+ while self.waiting:
+ nd=self.waiting.pop(0)
+ self.iter(nd)
+ def iter(self,node):
+ path=node.abspath()
+ code="".join(filter_comments(path))
+ names=self.get_strings(code)
+ for x in names:
+ if x in self.allnames:continue
+ self.allnames.append(x)
+ self.tryfind(x)
+def scan(self):
+ env=self.env
+ gruik=d_parser(env,self.generator.includes_nodes)
+ node=self.inputs[0]
+ gruik.start(node)
+ nodes=gruik.nodes
+ names=gruik.names
+ if Logs.verbose:
+ Logs.debug('deps: deps for %s: %r; unresolved %r'%(str(node),nodes,names))
+ return(nodes,names)
--- /dev/null
+#! /usr/bin/env python
+# encoding: utf-8
+# WARNING! Do not edit! http://waf.googlecode.com/git/docs/wafbook/single.html#_obtaining_the_waf_file
+
+from waflib import Task,Errors
+from waflib.TaskGen import taskgen_method,before_method
+@taskgen_method
+def add_dbus_file(self,filename,prefix,mode):
+ if not hasattr(self,'dbus_lst'):
+ self.dbus_lst=[]
+ if not'process_dbus'in self.meths:
+ self.meths.append('process_dbus')
+ self.dbus_lst.append([filename,prefix,mode])
+@before_method('apply_core')
+def process_dbus(self):
+ for filename,prefix,mode in getattr(self,'dbus_lst',[]):
+ node=self.path.find_resource(filename)
+ if not node:
+ raise Errors.WafError('file not found '+filename)
+ tsk=self.create_task('dbus_binding_tool',node,node.change_ext('.h'))
+ tsk.env.DBUS_BINDING_TOOL_PREFIX=prefix
+ tsk.env.DBUS_BINDING_TOOL_MODE=mode
+class dbus_binding_tool(Task.Task):
+ color='BLUE'
+ ext_out=['.h']
+ run_str='${DBUS_BINDING_TOOL} --prefix=${DBUS_BINDING_TOOL_PREFIX} --mode=${DBUS_BINDING_TOOL_MODE} --output=${TGT} ${SRC}'
+ shell=True
+def configure(conf):
+ dbus_binding_tool=conf.find_program('dbus-binding-tool',var='DBUS_BINDING_TOOL')
--- /dev/null
+#! /usr/bin/env python
+# encoding: utf-8
+# WARNING! Do not edit! http://waf.googlecode.com/git/docs/wafbook/single.html#_obtaining_the_waf_file
+
+import sys
+from waflib.Tools import ar,d
+from waflib.Configure import conf
+@conf
+def find_dmd(conf):
+ conf.find_program(['dmd','dmd2','ldc'],var='D')
+ out=conf.cmd_and_log([conf.env.D,'--help'])
+ if out.find("D Compiler v")==-1:
+ out=conf.cmd_and_log([conf.env.D,'-version'])
+ if out.find("based on DMD v1.")==-1:
+ conf.fatal("detected compiler is not dmd/ldc")
+@conf
+def common_flags_ldc(conf):
+ v=conf.env
+ v['DFLAGS']=['-d-version=Posix']
+ v['LINKFLAGS']=[]
+ v['DFLAGS_dshlib']=['-relocation-model=pic']
+@conf
+def common_flags_dmd(conf):
+ v=conf.env
+ v['D_SRC_F']=['-c']
+ v['D_TGT_F']='-of%s'
+ v['D_LINKER']=v['D']
+ v['DLNK_SRC_F']=''
+ v['DLNK_TGT_F']='-of%s'
+ v['DINC_ST']='-I%s'
+ v['DSHLIB_MARKER']=v['DSTLIB_MARKER']=''
+ v['DSTLIB_ST']=v['DSHLIB_ST']='-L-l%s'
+ v['DSTLIBPATH_ST']=v['DLIBPATH_ST']='-L-L%s'
+ v['LINKFLAGS_dprogram']=['-quiet']
+ v['DFLAGS_dshlib']=['-fPIC']
+ v['LINKFLAGS_dshlib']=['-L-shared']
+ v['DHEADER_ext']='.di'
+ v.DFLAGS_d_with_header=['-H','-Hf']
+ v['D_HDR_F']='%s'
+def configure(conf):
+ conf.find_dmd()
+ if sys.platform=='win32':
+ out=conf.cmd_and_log([conf.env.D,'--help'])
+ if out.find("D Compiler v2.")>-1:
+ conf.fatal('dmd2 on Windows is not supported, use gdc or ldc2 instead')
+ conf.load('ar')
+ conf.load('d')
+ conf.common_flags_dmd()
+ conf.d_platform_flags()
+ if str(conf.env.D).find('ldc')>-1:
+ conf.common_flags_ldc()
--- /dev/null
+#! /usr/bin/env python
+# encoding: utf-8
+# WARNING! Do not edit! http://waf.googlecode.com/git/docs/wafbook/single.html#_obtaining_the_waf_file
+
+typos={'feature':'features','sources':'source','targets':'target','include':'includes','export_include':'export_includes','define':'defines','importpath':'includes','installpath':'install_path','iscopy':'is_copy',}
+meths_typos=['__call__','program','shlib','stlib','objects']
+from waflib import Logs,Build,Node,Task,TaskGen,ConfigSet,Errors,Utils
+import waflib.Tools.ccroot
+def check_same_targets(self):
+ mp=Utils.defaultdict(list)
+ uids={}
+ def check_task(tsk):
+ if not isinstance(tsk,Task.Task):
+ return
+ for node in tsk.outputs:
+ mp[node].append(tsk)
+ try:
+ uids[tsk.uid()].append(tsk)
+ except KeyError:
+ uids[tsk.uid()]=[tsk]
+ for g in self.groups:
+ for tg in g:
+ try:
+ for tsk in tg.tasks:
+ check_task(tsk)
+ except AttributeError:
+ check_task(tg)
+ dupe=False
+ for(k,v)in mp.items():
+ if len(v)>1:
+ dupe=True
+ msg='* Node %r is created more than once%s. The task generators are:'%(k,Logs.verbose==1 and" (full message on 'waf -v -v')"or"")
+ Logs.error(msg)
+ for x in v:
+ if Logs.verbose>1:
+ Logs.error(' %d. %r'%(1+v.index(x),x.generator))
+ else:
+ Logs.error(' %d. %r in %r'%(1+v.index(x),x.generator.name,getattr(x.generator,'path',None)))
+ if not dupe:
+ for(k,v)in uids.items():
+ if len(v)>1:
+ Logs.error('* Several tasks use the same identifier. Please check the information on\n http://docs.waf.googlecode.com/git/apidocs_16/Task.html#waflib.Task.Task.uid')
+ for tsk in v:
+ Logs.error(' - object %r (%r) defined in %r'%(tsk.__class__.__name__,tsk,tsk.generator))
+def check_invalid_constraints(self):
+ feat=set([])
+ for x in list(TaskGen.feats.values()):
+ feat.union(set(x))
+ for(x,y)in TaskGen.task_gen.prec.items():
+ feat.add(x)
+ feat.union(set(y))
+ ext=set([])
+ for x in TaskGen.task_gen.mappings.values():
+ ext.add(x.__name__)
+ invalid=ext&feat
+ if invalid:
+ Logs.error('The methods %r have invalid annotations: @extension <-> @feature/@before_method/@after_method'%list(invalid))
+ for cls in list(Task.classes.values()):
+ for x in('before','after'):
+ for y in Utils.to_list(getattr(cls,x,[])):
+ if not Task.classes.get(y,None):
+ Logs.error('Erroneous order constraint %r=%r on task class %r'%(x,y,cls.__name__))
+ if getattr(cls,'rule',None):
+ Logs.error('Erroneous attribute "rule" on task class %r (rename to "run_str")'%cls.__name__)
+def replace(m):
+ oldcall=getattr(Build.BuildContext,m)
+ def call(self,*k,**kw):
+ ret=oldcall(self,*k,**kw)
+ for x in typos:
+ if x in kw:
+ if x=='iscopy'and'subst'in getattr(self,'features',''):
+ continue
+ err=True
+ Logs.error('Fix the typo %r -> %r on %r'%(x,typos[x],ret))
+ return ret
+ setattr(Build.BuildContext,m,call)
+def enhance_lib():
+ for m in meths_typos:
+ replace(m)
+ def ant_glob(self,*k,**kw):
+ if k:
+ lst=Utils.to_list(k[0])
+ for pat in lst:
+ if'..'in pat.split('/'):
+ Logs.error("In ant_glob pattern %r: '..' means 'two dots', not 'parent directory'"%k[0])
+ if kw.get('remove',True):
+ try:
+ if self.is_child_of(self.ctx.bldnode)and not kw.get('quiet',False):
+ Logs.error('Using ant_glob on the build folder (%r) is dangerous (quiet=True to disable this warning)'%self)
+ except AttributeError:
+ pass
+ return self.old_ant_glob(*k,**kw)
+ Node.Node.old_ant_glob=Node.Node.ant_glob
+ Node.Node.ant_glob=ant_glob
+ old=Task.is_before
+ def is_before(t1,t2):
+ ret=old(t1,t2)
+ if ret and old(t2,t1):
+ Logs.error('Contradictory order constraints in classes %r %r'%(t1,t2))
+ return ret
+ Task.is_before=is_before
+ def check_err_features(self):
+ lst=self.to_list(self.features)
+ if'shlib'in lst:
+ Logs.error('feature shlib -> cshlib, dshlib or cxxshlib')
+ for x in('c','cxx','d','fc'):
+ if not x in lst and lst and lst[0]in[x+y for y in('program','shlib','stlib')]:
+ Logs.error('%r features is probably missing %r'%(self,x))
+ TaskGen.feature('*')(check_err_features)
+ def check_err_order(self):
+ if not hasattr(self,'rule')and not'subst'in Utils.to_list(self.features):
+ for x in('before','after','ext_in','ext_out'):
+ if hasattr(self,x):
+ Logs.warn('Erroneous order constraint %r on non-rule based task generator %r'%(x,self))
+ else:
+ for x in('before','after'):
+ for y in self.to_list(getattr(self,x,[])):
+ if not Task.classes.get(y,None):
+ Logs.error('Erroneous order constraint %s=%r on %r (no such class)'%(x,y,self))
+ TaskGen.feature('*')(check_err_order)
+ def check_compile(self):
+ check_invalid_constraints(self)
+ try:
+ ret=self.orig_compile()
+ finally:
+ check_same_targets(self)
+ return ret
+ Build.BuildContext.orig_compile=Build.BuildContext.compile
+ Build.BuildContext.compile=check_compile
+ def use_rec(self,name,**kw):
+ try:
+ y=self.bld.get_tgen_by_name(name)
+ except Errors.WafError:
+ pass
+ else:
+ idx=self.bld.get_group_idx(self)
+ odx=self.bld.get_group_idx(y)
+ if odx>idx:
+ msg="Invalid 'use' across build groups:"
+ if Logs.verbose>1:
+ msg+='\n target %r\n uses:\n %r'%(self,y)
+ else:
+ msg+=" %r uses %r (try 'waf -v -v' for the full error)"%(self.name,name)
+ raise Errors.WafError(msg)
+ self.orig_use_rec(name,**kw)
+ TaskGen.task_gen.orig_use_rec=TaskGen.task_gen.use_rec
+ TaskGen.task_gen.use_rec=use_rec
+ def getattri(self,name,default=None):
+ if name=='append'or name=='add':
+ raise Errors.WafError('env.append and env.add do not exist: use env.append_value/env.append_unique')
+ elif name=='prepend':
+ raise Errors.WafError('env.prepend does not exist: use env.prepend_value')
+ if name in self.__slots__:
+ return object.__getattr__(self,name,default)
+ else:
+ return self[name]
+ ConfigSet.ConfigSet.__getattr__=getattri
+def options(opt):
+ enhance_lib()
+def configure(conf):
+ pass
--- /dev/null
+#! /usr/bin/env python
+# encoding: utf-8
+# WARNING! Do not edit! http://waf.googlecode.com/git/docs/wafbook/single.html#_obtaining_the_waf_file
+
+import re
+from waflib import Utils,Task,TaskGen,Logs
+from waflib.Tools import ccroot,fc_config,fc_scan
+from waflib.TaskGen import feature,before_method,after_method,extension
+from waflib.Configure import conf
+ccroot.USELIB_VARS['fc']=set(['FCFLAGS','DEFINES','INCLUDES'])
+ccroot.USELIB_VARS['fcprogram_test']=ccroot.USELIB_VARS['fcprogram']=set(['LIB','STLIB','LIBPATH','STLIBPATH','LINKFLAGS','RPATH','LINKDEPS'])
+ccroot.USELIB_VARS['fcshlib']=set(['LIB','STLIB','LIBPATH','STLIBPATH','LINKFLAGS','RPATH','LINKDEPS'])
+ccroot.USELIB_VARS['fcstlib']=set(['ARFLAGS','LINKDEPS'])
+@feature('fcprogram','fcshlib','fcstlib','fcprogram_test')
+def dummy(self):
+ pass
+@extension('.f','.f90','.F','.F90','.for','.FOR')
+def fc_hook(self,node):
+ return self.create_compiled_task('fc',node)
+@conf
+def modfile(conf,name):
+ return{'lower':name.lower()+'.mod','lower.MOD':name.upper()+'.MOD','UPPER.mod':name.upper()+'.mod','UPPER':name.upper()+'.MOD'}[conf.env.FC_MOD_CAPITALIZATION or'lower']
+def get_fortran_tasks(tsk):
+ bld=tsk.generator.bld
+ tasks=bld.get_tasks_group(bld.get_group_idx(tsk.generator))
+ return[x for x in tasks if isinstance(x,fc)and not getattr(x,'nomod',None)and not getattr(x,'mod_fortran_done',None)]
+class fc(Task.Task):
+ color='GREEN'
+ run_str='${FC} ${FCFLAGS} ${FCINCPATH_ST:INCPATHS} ${FCDEFINES_ST:DEFINES} ${_FCMODOUTFLAGS} ${FC_TGT_F}${TGT[0].abspath()} ${FC_SRC_F}${SRC[0].abspath()}'
+ vars=["FORTRANMODPATHFLAG"]
+ def scan(self):
+ tmp=fc_scan.fortran_parser(self.generator.includes_nodes)
+ tmp.task=self
+ tmp.start(self.inputs[0])
+ if Logs.verbose:
+ Logs.debug('deps: deps for %r: %r; unresolved %r'%(self.inputs,tmp.nodes,tmp.names))
+ return(tmp.nodes,tmp.names)
+ def runnable_status(self):
+ if getattr(self,'mod_fortran_done',None):
+ return super(fc,self).runnable_status()
+ bld=self.generator.bld
+ lst=get_fortran_tasks(self)
+ for tsk in lst:
+ tsk.mod_fortran_done=True
+ for tsk in lst:
+ ret=tsk.runnable_status()
+ if ret==Task.ASK_LATER:
+ for x in lst:
+ x.mod_fortran_done=None
+ return Task.ASK_LATER
+ ins=Utils.defaultdict(set)
+ outs=Utils.defaultdict(set)
+ for tsk in lst:
+ key=tsk.uid()
+ for x in bld.raw_deps[key]:
+ if x.startswith('MOD@'):
+ name=bld.modfile(x.replace('MOD@',''))
+ node=bld.srcnode.find_or_declare(name)
+ tsk.set_outputs(node)
+ outs[id(node)].add(tsk)
+ for tsk in lst:
+ key=tsk.uid()
+ for x in bld.raw_deps[key]:
+ if x.startswith('USE@'):
+ name=bld.modfile(x.replace('USE@',''))
+ node=bld.srcnode.find_resource(name)
+ if node and node not in tsk.outputs:
+ if not node in bld.node_deps[key]:
+ bld.node_deps[key].append(node)
+ ins[id(node)].add(tsk)
+ for k in ins.keys():
+ for a in ins[k]:
+ a.run_after.update(outs[k])
+ tmp=[]
+ for t in outs[k]:
+ tmp.extend(t.outputs)
+ a.dep_nodes.extend(tmp)
+ a.dep_nodes.sort(key=lambda x:x.abspath())
+ for tsk in lst:
+ try:
+ delattr(tsk,'cache_sig')
+ except AttributeError:
+ pass
+ return super(fc,self).runnable_status()
+class fcprogram(ccroot.link_task):
+ color='YELLOW'
+ run_str='${FC} ${LINKFLAGS} ${FCLNK_SRC_F}${SRC} ${FCLNK_TGT_F}${TGT[0].abspath()} ${RPATH_ST:RPATH} ${FCSTLIB_MARKER} ${FCSTLIBPATH_ST:STLIBPATH} ${FCSTLIB_ST:STLIB} ${FCSHLIB_MARKER} ${FCLIBPATH_ST:LIBPATH} ${FCLIB_ST:LIB}'
+ inst_to='${BINDIR}'
+class fcshlib(fcprogram):
+ inst_to='${LIBDIR}'
+class fcprogram_test(fcprogram):
+ def can_retrieve_cache(self):
+ return False
+ def runnable_status(self):
+ ret=super(fcprogram_test,self).runnable_status()
+ if ret==Task.SKIP_ME:
+ ret=Task.RUN_ME
+ return ret
+ def exec_command(self,cmd,**kw):
+ bld=self.generator.bld
+ kw['shell']=isinstance(cmd,str)
+ kw['stdout']=kw['stderr']=Utils.subprocess.PIPE
+ kw['cwd']=bld.variant_dir
+ bld.out=bld.err=''
+ bld.to_log('command: %s\n'%cmd)
+ kw['output']=0
+ try:
+ (bld.out,bld.err)=bld.cmd_and_log(cmd,**kw)
+ except Exception ,e:
+ return-1
+ if bld.out:
+ bld.to_log("out: %s\n"%bld.out)
+ if bld.err:
+ bld.to_log("err: %s\n"%bld.err)
+class fcstlib(ccroot.stlink_task):
+ pass
--- /dev/null
+#! /usr/bin/env python
+# encoding: utf-8
+# WARNING! Do not edit! http://waf.googlecode.com/git/docs/wafbook/single.html#_obtaining_the_waf_file
+
+import re,shutil,os,sys,string,shlex
+from waflib.Configure import conf
+from waflib.TaskGen import feature,after_method,before_method
+from waflib import Build,Utils
+FC_FRAGMENT=' program main\n end program main\n'
+FC_FRAGMENT2=' PROGRAM MAIN\n END\n'
+@conf
+def fc_flags(conf):
+ v=conf.env
+ v['FC_SRC_F']=[]
+ v['FC_TGT_F']=['-c','-o']
+ v['FCINCPATH_ST']='-I%s'
+ v['FCDEFINES_ST']='-D%s'
+ if not v['LINK_FC']:v['LINK_FC']=v['FC']
+ v['FCLNK_SRC_F']=[]
+ v['FCLNK_TGT_F']=['-o']
+ v['FCFLAGS_fcshlib']=['-fpic']
+ v['LINKFLAGS_fcshlib']=['-shared']
+ v['fcshlib_PATTERN']='lib%s.so'
+ v['fcstlib_PATTERN']='lib%s.a'
+ v['FCLIB_ST']='-l%s'
+ v['FCLIBPATH_ST']='-L%s'
+ v['FCSTLIB_ST']='-l%s'
+ v['FCSTLIBPATH_ST']='-L%s'
+ v['FCSTLIB_MARKER']='-Wl,-Bstatic'
+ v['FCSHLIB_MARKER']='-Wl,-Bdynamic'
+ v['SONAME_ST']='-Wl,-h,%s'
+@conf
+def fc_add_flags(conf):
+ conf.add_os_flags('FCFLAGS')
+ conf.add_os_flags('LDFLAGS','LINKFLAGS')
+@conf
+def check_fortran(self,*k,**kw):
+ self.check_cc(fragment=FC_FRAGMENT,compile_filename='test.f',features='fc fcprogram',msg='Compiling a simple fortran app')
+@conf
+def check_fc(self,*k,**kw):
+ kw['compiler']='fc'
+ if not'compile_mode'in kw:
+ kw['compile_mode']='fc'
+ if not'type'in kw:
+ kw['type']='fcprogram'
+ if not'compile_filename'in kw:
+ kw['compile_filename']='test.f90'
+ if not'code'in kw:
+ kw['code']=FC_FRAGMENT
+ return self.check(*k,**kw)
+@conf
+def fortran_modifier_darwin(conf):
+ v=conf.env
+ v['FCFLAGS_fcshlib']=['-fPIC','-compatibility_version','1','-current_version','1']
+ v['LINKFLAGS_fcshlib']=['-dynamiclib']
+ v['fcshlib_PATTERN']='lib%s.dylib'
+ v['FRAMEWORKPATH_ST']='-F%s'
+ v['FRAMEWORK_ST']='-framework %s'
+ v['LINKFLAGS_fcstlib']=[]
+ v['FCSHLIB_MARKER']=''
+ v['FCSTLIB_MARKER']=''
+ v['SONAME_ST']=''
+@conf
+def fortran_modifier_win32(conf):
+ v=conf.env
+ v['fcprogram_PATTERN']=v['fcprogram_test_PATTERN']='%s.exe'
+ v['fcshlib_PATTERN']='%s.dll'
+ v['implib_PATTERN']='lib%s.dll.a'
+ v['IMPLIB_ST']='-Wl,--out-implib,%s'
+ v['FCFLAGS_fcshlib']=[]
+ v.append_value('FCFLAGS_fcshlib',['-DDLL_EXPORT'])
+ v.append_value('LINKFLAGS',['-Wl,--enable-auto-import'])
+@conf
+def fortran_modifier_cygwin(conf):
+ fortran_modifier_win32(conf)
+ v=conf.env
+ v['fcshlib_PATTERN']='cyg%s.dll'
+ v.append_value('LINKFLAGS_fcshlib',['-Wl,--enable-auto-image-base'])
+ v['FCFLAGS_fcshlib']=[]
+@conf
+def check_fortran_dummy_main(self,*k,**kw):
+ if not self.env.CC:
+ self.fatal('A c compiler is required for check_fortran_dummy_main')
+ lst=['MAIN__','__MAIN','_MAIN','MAIN_','MAIN']
+ lst.extend([m.lower()for m in lst])
+ lst.append('')
+ self.start_msg('Detecting whether we need a dummy main')
+ for main in lst:
+ kw['fortran_main']=main
+ try:
+ self.check_cc(fragment='int %s() { return 0; }\n'%(main or'test'),features='c fcprogram',mandatory=True)
+ if not main:
+ self.env.FC_MAIN=-1
+ self.end_msg('no')
+ else:
+ self.env.FC_MAIN=main
+ self.end_msg('yes %s'%main)
+ break
+ except self.errors.ConfigurationError:
+ pass
+ else:
+ self.end_msg('not found')
+ self.fatal('could not detect whether fortran requires a dummy main, see the config.log')
+GCC_DRIVER_LINE=re.compile('^Driving:')
+POSIX_STATIC_EXT=re.compile('\S+\.a')
+POSIX_LIB_FLAGS=re.compile('-l\S+')
+@conf
+def is_link_verbose(self,txt):
+ assert isinstance(txt,str)
+ for line in txt.splitlines():
+ if not GCC_DRIVER_LINE.search(line):
+ if POSIX_STATIC_EXT.search(line)or POSIX_LIB_FLAGS.search(line):
+ return True
+ return False
+@conf
+def check_fortran_verbose_flag(self,*k,**kw):
+ self.start_msg('fortran link verbose flag')
+ for x in['-v','--verbose','-verbose','-V']:
+ try:
+ self.check_cc(features='fc fcprogram_test',fragment=FC_FRAGMENT2,compile_filename='test.f',linkflags=[x],mandatory=True)
+ except self.errors.ConfigurationError:
+ pass
+ else:
+ if self.is_link_verbose(self.test_bld.err)or self.is_link_verbose(self.test_bld.out):
+ self.end_msg(x)
+ break
+ else:
+ self.end_msg('failure')
+ self.fatal('Could not obtain the fortran link verbose flag (see config.log)')
+ self.env.FC_VERBOSE_FLAG=x
+ return x
+LINKFLAGS_IGNORED=[r'-lang*',r'-lcrt[a-zA-Z0-9\.]*\.o',r'-lc$',r'-lSystem',r'-libmil',r'-LIST:*',r'-LNO:*']
+if os.name=='nt':
+ LINKFLAGS_IGNORED.extend([r'-lfrt*',r'-luser32',r'-lkernel32',r'-ladvapi32',r'-lmsvcrt',r'-lshell32',r'-lmingw',r'-lmoldname'])
+else:
+ LINKFLAGS_IGNORED.append(r'-lgcc*')
+RLINKFLAGS_IGNORED=[re.compile(f)for f in LINKFLAGS_IGNORED]
+def _match_ignore(line):
+ for i in RLINKFLAGS_IGNORED:
+ if i.match(line):
+ return True
+ return False
+def parse_fortran_link(lines):
+ final_flags=[]
+ for line in lines:
+ if not GCC_DRIVER_LINE.match(line):
+ _parse_flink_line(line,final_flags)
+ return final_flags
+SPACE_OPTS=re.compile('^-[LRuYz]$')
+NOSPACE_OPTS=re.compile('^-[RL]')
+def _parse_flink_line(line,final_flags):
+ lexer=shlex.shlex(line,posix=True)
+ lexer.whitespace_split=True
+ t=lexer.get_token()
+ tmp_flags=[]
+ while t:
+ def parse(token):
+ if _match_ignore(token):
+ pass
+ elif token.startswith('-lkernel32')and sys.platform=='cygwin':
+ tmp_flags.append(token)
+ elif SPACE_OPTS.match(token):
+ t=lexer.get_token()
+ if t.startswith('P,'):
+ t=t[2:]
+ for opt in t.split(os.pathsep):
+ tmp_flags.append('-L%s'%opt)
+ elif NOSPACE_OPTS.match(token):
+ tmp_flags.append(token)
+ elif POSIX_LIB_FLAGS.match(token):
+ tmp_flags.append(token)
+ else:
+ pass
+ t=lexer.get_token()
+ return t
+ t=parse(t)
+ final_flags.extend(tmp_flags)
+ return final_flags
+@conf
+def check_fortran_clib(self,autoadd=True,*k,**kw):
+ if not self.env.FC_VERBOSE_FLAG:
+ self.fatal('env.FC_VERBOSE_FLAG is not set: execute check_fortran_verbose_flag?')
+ self.start_msg('Getting fortran runtime link flags')
+ try:
+ self.check_cc(fragment=FC_FRAGMENT2,compile_filename='test.f',features='fc fcprogram_test',linkflags=[self.env.FC_VERBOSE_FLAG])
+ except Exception:
+ self.end_msg(False)
+ if kw.get('mandatory',True):
+ conf.fatal('Could not find the c library flags')
+ else:
+ out=self.test_bld.err
+ flags=parse_fortran_link(out.splitlines())
+ self.end_msg('ok (%s)'%' '.join(flags))
+ self.env.LINKFLAGS_CLIB=flags
+ return flags
+ return[]
+def getoutput(conf,cmd,stdin=False):
+ if stdin:
+ stdin=Utils.subprocess.PIPE
+ else:
+ stdin=None
+ env=conf.env.env or None
+ try:
+ p=Utils.subprocess.Popen(cmd,stdin=stdin,stdout=Utils.subprocess.PIPE,stderr=Utils.subprocess.PIPE,env=env)
+ if stdin:
+ p.stdin.write('\n')
+ out,err=p.communicate()
+ except Exception:
+ conf.fatal('could not determine the compiler version %r'%cmd)
+ if not isinstance(out,str):
+ out=out.decode(sys.stdout.encoding or'iso8859-1')
+ if not isinstance(err,str):
+ err=err.decode(sys.stdout.encoding or'iso8859-1')
+ return(out,err)
+ROUTINES_CODE="""\
+ subroutine foobar()
+ return
+ end
+ subroutine foo_bar()
+ return
+ end
+"""
+MAIN_CODE="""
+void %(dummy_func_nounder)s(void);
+void %(dummy_func_under)s(void);
+int %(main_func_name)s() {
+ %(dummy_func_nounder)s();
+ %(dummy_func_under)s();
+ return 0;
+}
+"""
+@feature('link_main_routines_func')
+@before_method('process_source')
+def link_main_routines_tg_method(self):
+ def write_test_file(task):
+ task.outputs[0].write(task.generator.code)
+ bld=self.bld
+ bld(rule=write_test_file,target='main.c',code=MAIN_CODE%self.__dict__)
+ bld(rule=write_test_file,target='test.f',code=ROUTINES_CODE)
+ bld(features='fc fcstlib',source='test.f',target='test')
+ bld(features='c fcprogram',source='main.c',target='app',use='test')
+def mangling_schemes():
+ for u in['_','']:
+ for du in['','_']:
+ for c in["lower","upper"]:
+ yield(u,du,c)
+def mangle_name(u,du,c,name):
+ return getattr(name,c)()+u+(name.find('_')!=-1 and du or'')
+@conf
+def check_fortran_mangling(self,*k,**kw):
+ if not self.env.CC:
+ self.fatal('A c compiler is required for link_main_routines')
+ if not self.env.FC:
+ self.fatal('A fortran compiler is required for link_main_routines')
+ if not self.env.FC_MAIN:
+ self.fatal('Checking for mangling requires self.env.FC_MAIN (execute "check_fortran_dummy_main" first?)')
+ self.start_msg('Getting fortran mangling scheme')
+ for(u,du,c)in mangling_schemes():
+ try:
+ self.check_cc(compile_filename=[],features='link_main_routines_func',msg='nomsg',errmsg='nomsg',mandatory=True,dummy_func_nounder=mangle_name(u,du,c,"foobar"),dummy_func_under=mangle_name(u,du,c,"foo_bar"),main_func_name=self.env.FC_MAIN)
+ except self.errors.ConfigurationError:
+ pass
+ else:
+ self.end_msg("ok ('%s', '%s', '%s-case')"%(u,du,c))
+ self.env.FORTRAN_MANGLING=(u,du,c)
+ break
+ else:
+ self.end_msg(False)
+ self.fatal('mangler not found')
+ return(u,du,c)
+@feature('pyext')
+@before_method('propagate_uselib_vars','apply_link')
+def set_lib_pat(self):
+ self.env['fcshlib_PATTERN']=self.env['pyext_PATTERN']
+@conf
+def detect_openmp(self):
+ for x in['-fopenmp','-openmp','-mp','-xopenmp','-omp','-qsmp=omp']:
+ try:
+ self.check_fc(msg='Checking for OpenMP flag %s'%x,fragment='program main\n call omp_get_num_threads()\nend program main',fcflags=x,linkflags=x,uselib_store='OPENMP')
+ except self.errors.ConfigurationError:
+ pass
+ else:
+ break
+ else:
+ self.fatal('Could not find OpenMP')
--- /dev/null
+#! /usr/bin/env python
+# encoding: utf-8
+# WARNING! Do not edit! http://waf.googlecode.com/git/docs/wafbook/single.html#_obtaining_the_waf_file
+
+import re
+from waflib import Utils,Task,TaskGen,Logs
+from waflib.TaskGen import feature,before_method,after_method,extension
+from waflib.Configure import conf
+INC_REGEX="""(?:^|['">]\s*;)\s*INCLUDE\s+(?:\w+_)?[<"'](.+?)(?=["'>])"""
+USE_REGEX="""(?:^|;)\s*USE(?:\s+|(?:(?:\s*,\s*(?:NON_)?INTRINSIC)?\s*::))\s*(\w+)"""
+MOD_REGEX="""(?:^|;)\s*MODULE(?!\s*PROCEDURE)(?:\s+|(?:(?:\s*,\s*(?:NON_)?INTRINSIC)?\s*::))\s*(\w+)"""
+re_inc=re.compile(INC_REGEX,re.I)
+re_use=re.compile(USE_REGEX,re.I)
+re_mod=re.compile(MOD_REGEX,re.I)
+class fortran_parser(object):
+ def __init__(self,incpaths):
+ self.seen=[]
+ self.nodes=[]
+ self.names=[]
+ self.incpaths=incpaths
+ def find_deps(self,node):
+ txt=node.read()
+ incs=[]
+ uses=[]
+ mods=[]
+ for line in txt.splitlines():
+ m=re_inc.search(line)
+ if m:
+ incs.append(m.group(1))
+ m=re_use.search(line)
+ if m:
+ uses.append(m.group(1))
+ m=re_mod.search(line)
+ if m:
+ mods.append(m.group(1))
+ return(incs,uses,mods)
+ def start(self,node):
+ self.waiting=[node]
+ while self.waiting:
+ nd=self.waiting.pop(0)
+ self.iter(nd)
+ def iter(self,node):
+ path=node.abspath()
+ incs,uses,mods=self.find_deps(node)
+ for x in incs:
+ if x in self.seen:
+ continue
+ self.seen.append(x)
+ self.tryfind_header(x)
+ for x in uses:
+ name="USE@%s"%x
+ if not name in self.names:
+ self.names.append(name)
+ for x in mods:
+ name="MOD@%s"%x
+ if not name in self.names:
+ self.names.append(name)
+ def tryfind_header(self,filename):
+ found=None
+ for n in self.incpaths:
+ found=n.find_resource(filename)
+ if found:
+ self.nodes.append(found)
+ self.waiting.append(found)
+ break
+ if not found:
+ if not filename in self.names:
+ self.names.append(filename)
--- /dev/null
+#! /usr/bin/env python
+# encoding: utf-8
+# WARNING! Do not edit! http://waf.googlecode.com/git/docs/wafbook/single.html#_obtaining_the_waf_file
+
+import waflib.TaskGen,os,re
+def decide_ext(self,node):
+ if'cxx'in self.features:
+ return['.lex.cc']
+ return['.lex.c']
+def flexfun(tsk):
+ env=tsk.env
+ bld=tsk.generator.bld
+ wd=bld.variant_dir
+ def to_list(xx):
+ if isinstance(xx,str):return[xx]
+ return xx
+ tsk.last_cmd=lst=[]
+ lst.extend(to_list(env['FLEX']))
+ lst.extend(to_list(env['FLEXFLAGS']))
+ inputs=[a.path_from(bld.bldnode)for a in tsk.inputs]
+ if env.FLEX_MSYS:
+ inputs=[x.replace(os.sep,'/')for x in inputs]
+ lst.extend(inputs)
+ lst=[x for x in lst if x]
+ txt=bld.cmd_and_log(lst,cwd=wd,env=env.env or None,quiet=0)
+ tsk.outputs[0].write(txt.replace('\r\n','\n').replace('\r','\n'))
+waflib.TaskGen.declare_chain(name='flex',rule=flexfun,ext_in='.l',decider=decide_ext,)
+def configure(conf):
+ conf.find_program('flex',var='FLEX')
+ conf.env.FLEXFLAGS=['-t']
+ if re.search(r"\\msys\\[0-9.]+\\bin\\flex.exe$",conf.env.FLEX):
+ conf.env.FLEX_MSYS=True
--- /dev/null
+#! /usr/bin/env python
+# encoding: utf-8
+# WARNING! Do not edit! http://waf.googlecode.com/git/docs/wafbook/single.html#_obtaining_the_waf_file
+
+import re
+from waflib import Utils
+from waflib.Tools import fc,fc_config,fc_scan,ar
+from waflib.Configure import conf
+@conf
+def find_g95(conf):
+ fc=conf.find_program('g95',var='FC')
+ fc=conf.cmd_to_list(fc)
+ conf.get_g95_version(fc)
+ conf.env.FC_NAME='G95'
+@conf
+def g95_flags(conf):
+ v=conf.env
+ v['FCFLAGS_fcshlib']=['-fPIC']
+ v['FORTRANMODFLAG']=['-fmod=','']
+ v['FCFLAGS_DEBUG']=['-Werror']
+@conf
+def g95_modifier_win32(conf):
+ fc_config.fortran_modifier_win32(conf)
+@conf
+def g95_modifier_cygwin(conf):
+ fc_config.fortran_modifier_cygwin(conf)
+@conf
+def g95_modifier_darwin(conf):
+ fc_config.fortran_modifier_darwin(conf)
+@conf
+def g95_modifier_platform(conf):
+ dest_os=conf.env['DEST_OS']or Utils.unversioned_sys_platform()
+ g95_modifier_func=getattr(conf,'g95_modifier_'+dest_os,None)
+ if g95_modifier_func:
+ g95_modifier_func()
+@conf
+def get_g95_version(conf,fc):
+ version_re=re.compile(r"g95\s*(?P<major>\d*)\.(?P<minor>\d*)").search
+ cmd=fc+['--version']
+ out,err=fc_config.getoutput(conf,cmd,stdin=False)
+ if out:
+ match=version_re(out)
+ else:
+ match=version_re(err)
+ if not match:
+ conf.fatal('cannot determine g95 version')
+ k=match.groupdict()
+ conf.env['FC_VERSION']=(k['major'],k['minor'])
+def configure(conf):
+ conf.find_g95()
+ conf.find_ar()
+ conf.fc_flags()
+ conf.fc_add_flags()
+ conf.g95_flags()
+ conf.g95_modifier_platform()
--- /dev/null
+#! /usr/bin/env python
+# encoding: utf-8
+# WARNING! Do not edit! http://waf.googlecode.com/git/docs/wafbook/single.html#_obtaining_the_waf_file
+
+import waflib.Tools.asm
+from waflib.Tools import ar
+def configure(conf):
+ conf.find_program(['gas','gcc'],var='AS')
+ conf.env.AS_TGT_F=['-c','-o']
+ conf.env.ASLNK_TGT_F=['-o']
+ conf.find_ar()
+ conf.load('asm')
--- /dev/null
+#! /usr/bin/env python
+# encoding: utf-8
+# WARNING! Do not edit! http://waf.googlecode.com/git/docs/wafbook/single.html#_obtaining_the_waf_file
+
+import os,sys
+from waflib import Configure,Options,Utils
+from waflib.Tools import ccroot,ar
+from waflib.Configure import conf
+@conf
+def find_gcc(conf):
+ cc=conf.find_program(['gcc','cc'],var='CC')
+ cc=conf.cmd_to_list(cc)
+ conf.get_cc_version(cc,gcc=True)
+ conf.env.CC_NAME='gcc'
+ conf.env.CC=cc
+@conf
+def gcc_common_flags(conf):
+ v=conf.env
+ v['CC_SRC_F']=[]
+ v['CC_TGT_F']=['-c','-o']
+ if not v['LINK_CC']:v['LINK_CC']=v['CC']
+ v['CCLNK_SRC_F']=[]
+ v['CCLNK_TGT_F']=['-o']
+ v['CPPPATH_ST']='-I%s'
+ v['DEFINES_ST']='-D%s'
+ v['LIB_ST']='-l%s'
+ v['LIBPATH_ST']='-L%s'
+ v['STLIB_ST']='-l%s'
+ v['STLIBPATH_ST']='-L%s'
+ v['RPATH_ST']='-Wl,-rpath,%s'
+ v['SONAME_ST']='-Wl,-h,%s'
+ v['SHLIB_MARKER']='-Wl,-Bdynamic'
+ v['STLIB_MARKER']='-Wl,-Bstatic'
+ v['cprogram_PATTERN']='%s'
+ v['CFLAGS_cshlib']=['-fPIC']
+ v['LINKFLAGS_cshlib']=['-shared']
+ v['cshlib_PATTERN']='lib%s.so'
+ v['LINKFLAGS_cstlib']=['-Wl,-Bstatic']
+ v['cstlib_PATTERN']='lib%s.a'
+ v['LINKFLAGS_MACBUNDLE']=['-bundle','-undefined','dynamic_lookup']
+ v['CFLAGS_MACBUNDLE']=['-fPIC']
+ v['macbundle_PATTERN']='%s.bundle'
+@conf
+def gcc_modifier_win32(conf):
+ v=conf.env
+ v['cprogram_PATTERN']='%s.exe'
+ v['cshlib_PATTERN']='%s.dll'
+ v['implib_PATTERN']='lib%s.dll.a'
+ v['IMPLIB_ST']='-Wl,--out-implib,%s'
+ v['CFLAGS_cshlib']=[]
+ v.append_value('LINKFLAGS',['-Wl,--enable-auto-import'])
+@conf
+def gcc_modifier_cygwin(conf):
+ gcc_modifier_win32(conf)
+ v=conf.env
+ v['cshlib_PATTERN']='cyg%s.dll'
+ v.append_value('LINKFLAGS_cshlib',['-Wl,--enable-auto-image-base'])
+ v['CFLAGS_cshlib']=[]
+@conf
+def gcc_modifier_darwin(conf):
+ v=conf.env
+ v['CFLAGS_cshlib']=['-fPIC','-compatibility_version','1','-current_version','1']
+ v['LINKFLAGS_cshlib']=['-dynamiclib']
+ v['cshlib_PATTERN']='lib%s.dylib'
+ v['FRAMEWORKPATH_ST']='-F%s'
+ v['FRAMEWORK_ST']=['-framework']
+ v['ARCH_ST']=['-arch']
+ v['LINKFLAGS_cstlib']=[]
+ v['SHLIB_MARKER']=[]
+ v['STLIB_MARKER']=[]
+ v['SONAME_ST']=[]
+@conf
+def gcc_modifier_aix(conf):
+ v=conf.env
+ v['LINKFLAGS_cprogram']=['-Wl,-brtl']
+ v['LINKFLAGS_cshlib']=['-shared','-Wl,-brtl,-bexpfull']
+ v['SHLIB_MARKER']=[]
+@conf
+def gcc_modifier_hpux(conf):
+ v=conf.env
+ v['SHLIB_MARKER']=[]
+ v['STLIB_MARKER']='-Bstatic'
+ v['CFLAGS_cshlib']=['-fPIC','-DPIC']
+ v['cshlib_PATTERN']='lib%s.sl'
+@conf
+def gcc_modifier_platform(conf):
+ gcc_modifier_func=getattr(conf,'gcc_modifier_'+conf.env.DEST_OS,None)
+ if gcc_modifier_func:
+ gcc_modifier_func()
+def configure(conf):
+ conf.find_gcc()
+ conf.find_ar()
+ conf.gcc_common_flags()
+ conf.gcc_modifier_platform()
+ conf.cc_load_tools()
+ conf.cc_add_flags()
+ conf.link_add_flags()
--- /dev/null
+#! /usr/bin/env python
+# encoding: utf-8
+# WARNING! Do not edit! http://waf.googlecode.com/git/docs/wafbook/single.html#_obtaining_the_waf_file
+
+import sys
+from waflib.Tools import ar,d
+from waflib.Configure import conf
+@conf
+def find_gdc(conf):
+ conf.find_program('gdc',var='D')
+ out=conf.cmd_and_log([conf.env.D,'--version'])
+ if out.find("gdc ")==-1:
+ conf.fatal("detected compiler is not gdc")
+@conf
+def common_flags_gdc(conf):
+ v=conf.env
+ v['DFLAGS']=[]
+ v['D_SRC_F']=['-c']
+ v['D_TGT_F']='-o%s'
+ v['D_LINKER']=v['D']
+ v['DLNK_SRC_F']=''
+ v['DLNK_TGT_F']='-o%s'
+ v['DINC_ST']='-I%s'
+ v['DSHLIB_MARKER']=v['DSTLIB_MARKER']=''
+ v['DSTLIB_ST']=v['DSHLIB_ST']='-l%s'
+ v['DSTLIBPATH_ST']=v['DLIBPATH_ST']='-L%s'
+ v['LINKFLAGS_dshlib']=['-shared']
+ v['DHEADER_ext']='.di'
+ v.DFLAGS_d_with_header='-fintfc'
+ v['D_HDR_F']='-fintfc-file=%s'
+def configure(conf):
+ conf.find_gdc()
+ conf.load('ar')
+ conf.load('d')
+ conf.common_flags_gdc()
+ conf.d_platform_flags()
--- /dev/null
+#! /usr/bin/env python
+# encoding: utf-8
+# WARNING! Do not edit! http://waf.googlecode.com/git/docs/wafbook/single.html#_obtaining_the_waf_file
+
+import re
+from waflib import Utils
+from waflib.Tools import fc,fc_config,fc_scan,ar
+from waflib.Configure import conf
+@conf
+def find_gfortran(conf):
+ fc=conf.find_program(['gfortran','g77'],var='FC')
+ fc=conf.cmd_to_list(fc)
+ conf.get_gfortran_version(fc)
+ conf.env.FC_NAME='GFORTRAN'
+@conf
+def gfortran_flags(conf):
+ v=conf.env
+ v['FCFLAGS_fcshlib']=['-fPIC']
+ v['FORTRANMODFLAG']=['-J','']
+ v['FCFLAGS_DEBUG']=['-Werror']
+@conf
+def gfortran_modifier_win32(conf):
+ fc_config.fortran_modifier_win32(conf)
+@conf
+def gfortran_modifier_cygwin(conf):
+ fc_config.fortran_modifier_cygwin(conf)
+@conf
+def gfortran_modifier_darwin(conf):
+ fc_config.fortran_modifier_darwin(conf)
+@conf
+def gfortran_modifier_platform(conf):
+ dest_os=conf.env['DEST_OS']or Utils.unversioned_sys_platform()
+ gfortran_modifier_func=getattr(conf,'gfortran_modifier_'+dest_os,None)
+ if gfortran_modifier_func:
+ gfortran_modifier_func()
+@conf
+def get_gfortran_version(conf,fc):
+ version_re=re.compile(r"GNU\s*Fortran",re.I).search
+ cmd=fc+['--version']
+ out,err=fc_config.getoutput(conf,cmd,stdin=False)
+ if out:match=version_re(out)
+ else:match=version_re(err)
+ if not match:
+ conf.fatal('Could not determine the compiler type')
+ cmd=fc+['-dM','-E','-']
+ out,err=fc_config.getoutput(conf,cmd,stdin=True)
+ if out.find('__GNUC__')<0:
+ conf.fatal('Could not determine the compiler type')
+ k={}
+ out=out.split('\n')
+ import shlex
+ for line in out:
+ lst=shlex.split(line)
+ if len(lst)>2:
+ key=lst[1]
+ val=lst[2]
+ k[key]=val
+ def isD(var):
+ return var in k
+ def isT(var):
+ return var in k and k[var]!='0'
+ conf.env['FC_VERSION']=(k['__GNUC__'],k['__GNUC_MINOR__'],k['__GNUC_PATCHLEVEL__'])
+def configure(conf):
+ conf.find_gfortran()
+ conf.find_ar()
+ conf.fc_flags()
+ conf.fc_add_flags()
+ conf.gfortran_flags()
+ conf.gfortran_modifier_platform()
--- /dev/null
+#! /usr/bin/env python
+# encoding: utf-8
+# WARNING! Do not edit! http://waf.googlecode.com/git/docs/wafbook/single.html#_obtaining_the_waf_file
+
+import os
+from waflib import Task,Utils,Options,Errors,Logs
+from waflib.TaskGen import taskgen_method,before_method,after_method,feature
+@taskgen_method
+def add_marshal_file(self,filename,prefix):
+ if not hasattr(self,'marshal_list'):
+ self.marshal_list=[]
+ self.meths.append('process_marshal')
+ self.marshal_list.append((filename,prefix))
+@before_method('process_source')
+def process_marshal(self):
+ for f,prefix in getattr(self,'marshal_list',[]):
+ node=self.path.find_resource(f)
+ if not node:
+ raise Errors.WafError('file not found %r'%f)
+ h_node=node.change_ext('.h')
+ c_node=node.change_ext('.c')
+ task=self.create_task('glib_genmarshal',node,[h_node,c_node])
+ task.env.GLIB_GENMARSHAL_PREFIX=prefix
+ self.source=self.to_nodes(getattr(self,'source',[]))
+ self.source.append(c_node)
+class glib_genmarshal(Task.Task):
+ def run(self):
+ bld=self.inputs[0].__class__.ctx
+ get=self.env.get_flat
+ cmd1="%s %s --prefix=%s --header > %s"%(get('GLIB_GENMARSHAL'),self.inputs[0].srcpath(),get('GLIB_GENMARSHAL_PREFIX'),self.outputs[0].abspath())
+ ret=bld.exec_command(cmd1)
+ if ret:return ret
+ c='''#include "%s"\n'''%self.outputs[0].name
+ self.outputs[1].write(c)
+ cmd2="%s %s --prefix=%s --body >> %s"%(get('GLIB_GENMARSHAL'),self.inputs[0].srcpath(),get('GLIB_GENMARSHAL_PREFIX'),self.outputs[1].abspath())
+ return bld.exec_command(cmd2)
+ vars=['GLIB_GENMARSHAL_PREFIX','GLIB_GENMARSHAL']
+ color='BLUE'
+ ext_out=['.h']
+@taskgen_method
+def add_enums_from_template(self,source='',target='',template='',comments=''):
+ if not hasattr(self,'enums_list'):
+ self.enums_list=[]
+ self.meths.append('process_enums')
+ self.enums_list.append({'source':source,'target':target,'template':template,'file-head':'','file-prod':'','file-tail':'','enum-prod':'','value-head':'','value-prod':'','value-tail':'','comments':comments})
+@taskgen_method
+def add_enums(self,source='',target='',file_head='',file_prod='',file_tail='',enum_prod='',value_head='',value_prod='',value_tail='',comments=''):
+ if not hasattr(self,'enums_list'):
+ self.enums_list=[]
+ self.meths.append('process_enums')
+ self.enums_list.append({'source':source,'template':'','target':target,'file-head':file_head,'file-prod':file_prod,'file-tail':file_tail,'enum-prod':enum_prod,'value-head':value_head,'value-prod':value_prod,'value-tail':value_tail,'comments':comments})
+@before_method('process_source')
+def process_enums(self):
+ for enum in getattr(self,'enums_list',[]):
+ task=self.create_task('glib_mkenums')
+ env=task.env
+ inputs=[]
+ source_list=self.to_list(enum['source'])
+ if not source_list:
+ raise Errors.WafError('missing source '+str(enum))
+ source_list=[self.path.find_resource(k)for k in source_list]
+ inputs+=source_list
+ env['GLIB_MKENUMS_SOURCE']=[k.abspath()for k in source_list]
+ if not enum['target']:
+ raise Errors.WafError('missing target '+str(enum))
+ tgt_node=self.path.find_or_declare(enum['target'])
+ if tgt_node.name.endswith('.c'):
+ self.source.append(tgt_node)
+ env['GLIB_MKENUMS_TARGET']=tgt_node.abspath()
+ options=[]
+ if enum['template']:
+ template_node=self.path.find_resource(enum['template'])
+ options.append('--template %s'%(template_node.abspath()))
+ inputs.append(template_node)
+ params={'file-head':'--fhead','file-prod':'--fprod','file-tail':'--ftail','enum-prod':'--eprod','value-head':'--vhead','value-prod':'--vprod','value-tail':'--vtail','comments':'--comments'}
+ for param,option in params.items():
+ if enum[param]:
+ options.append('%s %r'%(option,enum[param]))
+ env['GLIB_MKENUMS_OPTIONS']=' '.join(options)
+ task.set_inputs(inputs)
+ task.set_outputs(tgt_node)
+class glib_mkenums(Task.Task):
+ run_str='${GLIB_MKENUMS} ${GLIB_MKENUMS_OPTIONS} ${GLIB_MKENUMS_SOURCE} > ${GLIB_MKENUMS_TARGET}'
+ color='PINK'
+ ext_out=['.h']
+@taskgen_method
+def add_settings_schemas(self,filename_list):
+ if not hasattr(self,'settings_schema_files'):
+ self.settings_schema_files=[]
+ if not isinstance(filename_list,list):
+ filename_list=[filename_list]
+ self.settings_schema_files.extend(filename_list)
+@taskgen_method
+def add_settings_enums(self,namespace,filename_list):
+ if hasattr(self,'settings_enum_namespace'):
+ raise Errors.WafError("Tried to add gsettings enums to '%s' more than once"%self.name)
+ self.settings_enum_namespace=namespace
+ if type(filename_list)!='list':
+ filename_list=[filename_list]
+ self.settings_enum_files=filename_list
+def r_change_ext(self,ext):
+ name=self.name
+ k=name.rfind('.')
+ if k>=0:
+ name=name[:k]+ext
+ else:
+ name=name+ext
+ return self.parent.find_or_declare([name])
+@feature('glib2')
+def process_settings(self):
+ enums_tgt_node=[]
+ install_files=[]
+ settings_schema_files=getattr(self,'settings_schema_files',[])
+ if settings_schema_files and not self.env['GLIB_COMPILE_SCHEMAS']:
+ raise Errors.WafError("Unable to process GSettings schemas - glib-compile-schemas was not found during configure")
+ if hasattr(self,'settings_enum_files'):
+ enums_task=self.create_task('glib_mkenums')
+ source_list=self.settings_enum_files
+ source_list=[self.path.find_resource(k)for k in source_list]
+ enums_task.set_inputs(source_list)
+ enums_task.env['GLIB_MKENUMS_SOURCE']=[k.abspath()for k in source_list]
+ target=self.settings_enum_namespace+'.enums.xml'
+ tgt_node=self.path.find_or_declare(target)
+ enums_task.set_outputs(tgt_node)
+ enums_task.env['GLIB_MKENUMS_TARGET']=tgt_node.abspath()
+ enums_tgt_node=[tgt_node]
+ install_files.append(tgt_node)
+ options='--comments "<!-- @comment@ -->" --fhead "<schemalist>" --vhead " <@type@ id=\\"%s.@EnumName@\\">" --vprod " <value nick=\\"@valuenick@\\" value=\\"@valuenum@\\"/>" --vtail " </@type@>" --ftail "</schemalist>" '%(self.settings_enum_namespace)
+ enums_task.env['GLIB_MKENUMS_OPTIONS']=options
+ for schema in settings_schema_files:
+ schema_task=self.create_task('glib_validate_schema')
+ schema_node=self.path.find_resource(schema)
+ if not schema_node:
+ raise Errors.WafError("Cannot find the schema file '%s'"%schema)
+ install_files.append(schema_node)
+ source_list=enums_tgt_node+[schema_node]
+ schema_task.set_inputs(source_list)
+ schema_task.env['GLIB_COMPILE_SCHEMAS_OPTIONS']=[("--schema-file="+k.abspath())for k in source_list]
+ target_node=r_change_ext(schema_node,'.xml.valid')
+ schema_task.set_outputs(target_node)
+ schema_task.env['GLIB_VALIDATE_SCHEMA_OUTPUT']=target_node.abspath()
+ def compile_schemas_callback(bld):
+ if not bld.is_install:return
+ Logs.pprint('YELLOW','Updating GSettings schema cache')
+ command=Utils.subst_vars("${GLIB_COMPILE_SCHEMAS} ${GSETTINGSSCHEMADIR}",bld.env)
+ ret=self.bld.exec_command(command)
+ if self.bld.is_install:
+ if not self.env['GSETTINGSSCHEMADIR']:
+ raise Errors.WafError('GSETTINGSSCHEMADIR not defined (should have been set up automatically during configure)')
+ if install_files:
+ self.bld.install_files(self.env['GSETTINGSSCHEMADIR'],install_files)
+ if not hasattr(self.bld,'_compile_schemas_registered'):
+ self.bld.add_post_fun(compile_schemas_callback)
+ self.bld._compile_schemas_registered=True
+class glib_validate_schema(Task.Task):
+ run_str='rm -f ${GLIB_VALIDATE_SCHEMA_OUTPUT} && ${GLIB_COMPILE_SCHEMAS} --dry-run ${GLIB_COMPILE_SCHEMAS_OPTIONS} && touch ${GLIB_VALIDATE_SCHEMA_OUTPUT}'
+ color='PINK'
+def configure(conf):
+ conf.find_program('glib-genmarshal',var='GLIB_GENMARSHAL')
+ conf.find_perl_program('glib-mkenums',var='GLIB_MKENUMS')
+ conf.find_program('glib-compile-schemas',var='GLIB_COMPILE_SCHEMAS',mandatory=False)
+ def getstr(varname):
+ return getattr(Options.options,varname,getattr(conf.env,varname,''))
+ gsettingsschemadir=getstr('GSETTINGSSCHEMADIR')
+ if not gsettingsschemadir:
+ datadir=getstr('DATADIR')
+ if not datadir:
+ prefix=conf.env['PREFIX']
+ datadir=os.path.join(prefix,'share')
+ gsettingsschemadir=os.path.join(datadir,'glib-2.0','schemas')
+ conf.env['GSETTINGSSCHEMADIR']=gsettingsschemadir
+def options(opt):
+ opt.add_option('--gsettingsschemadir',help='GSettings schema location [Default: ${datadir}/glib-2.0/schemas]',default='',dest='GSETTINGSSCHEMADIR')
--- /dev/null
+#! /usr/bin/env python
+# encoding: utf-8
+# WARNING! Do not edit! http://waf.googlecode.com/git/docs/wafbook/single.html#_obtaining_the_waf_file
+
+import os
+from waflib import Utils,Options,Context
+_options=[x.split(', ')for x in'''
+bindir, user executables, ${EXEC_PREFIX}/bin
+sbindir, system admin executables, ${EXEC_PREFIX}/sbin
+libexecdir, program executables, ${EXEC_PREFIX}/libexec
+sysconfdir, read-only single-machine data, ${PREFIX}/etc
+sharedstatedir, modifiable architecture-independent data, ${PREFIX}/com
+localstatedir, modifiable single-machine data, ${PREFIX}/var
+libdir, object code libraries, ${EXEC_PREFIX}/lib
+includedir, C header files, ${PREFIX}/include
+oldincludedir, C header files for non-gcc, /usr/include
+datarootdir, read-only arch.-independent data root, ${PREFIX}/share
+datadir, read-only architecture-independent data, ${DATAROOTDIR}
+infodir, info documentation, ${DATAROOTDIR}/info
+localedir, locale-dependent data, ${DATAROOTDIR}/locale
+mandir, man documentation, ${DATAROOTDIR}/man
+docdir, documentation root, ${DATAROOTDIR}/doc/${PACKAGE}
+htmldir, html documentation, ${DOCDIR}
+dvidir, dvi documentation, ${DOCDIR}
+pdfdir, pdf documentation, ${DOCDIR}
+psdir, ps documentation, ${DOCDIR}
+'''.split('\n')if x]
+def configure(conf):
+ def get_param(varname,default):
+ return getattr(Options.options,varname,'')or default
+ env=conf.env
+ env.LIBDIR=env.BINDIR=[]
+ env.EXEC_PREFIX=get_param('EXEC_PREFIX',env.PREFIX)
+ env.PACKAGE=getattr(Context.g_module,'APPNAME',None)or env.PACKAGE
+ complete=False
+ iter=0
+ while not complete and iter<len(_options)+1:
+ iter+=1
+ complete=True
+ for name,help,default in _options:
+ name=name.upper()
+ if not env[name]:
+ try:
+ env[name]=Utils.subst_vars(get_param(name,default).replace('/',os.sep),env)
+ except TypeError:
+ complete=False
+ if not complete:
+ lst=[name for name,_,_ in _options if not env[name.upper()]]
+ raise conf.errors.WafError('Variable substitution failure %r'%lst)
+def options(opt):
+ inst_dir=opt.add_option_group('Installation directories','By default, "waf install" will put the files in\
+ "/usr/local/bin", "/usr/local/lib" etc. An installation prefix other\
+ than "/usr/local" can be given using "--prefix", for example "--prefix=$HOME"')
+ for k in('--prefix','--destdir'):
+ option=opt.parser.get_option(k)
+ if option:
+ opt.parser.remove_option(k)
+ inst_dir.add_option(option)
+ inst_dir.add_option('--exec-prefix',help='installation prefix [Default: ${PREFIX}]',default='',dest='EXEC_PREFIX')
+ dirs_options=opt.add_option_group('Pre-defined installation directories','')
+ for name,help,default in _options:
+ option_name='--'+name
+ str_default=default
+ str_help='%s [Default: %s]'%(help,str_default)
+ dirs_options.add_option(option_name,help=str_help,default='',dest=name.upper())
--- /dev/null
+#! /usr/bin/env python
+# encoding: utf-8
+# WARNING! Do not edit! http://waf.googlecode.com/git/docs/wafbook/single.html#_obtaining_the_waf_file
+
+import os,sys
+from waflib import Configure,Options,Utils
+from waflib.Tools import ccroot,ar
+from waflib.Configure import conf
+@conf
+def find_gxx(conf):
+ cxx=conf.find_program(['g++','c++'],var='CXX')
+ cxx=conf.cmd_to_list(cxx)
+ conf.get_cc_version(cxx,gcc=True)
+ conf.env.CXX_NAME='gcc'
+ conf.env.CXX=cxx
+@conf
+def gxx_common_flags(conf):
+ v=conf.env
+ v['CXX_SRC_F']=[]
+ v['CXX_TGT_F']=['-c','-o']
+ if not v['LINK_CXX']:v['LINK_CXX']=v['CXX']
+ v['CXXLNK_SRC_F']=[]
+ v['CXXLNK_TGT_F']=['-o']
+ v['CPPPATH_ST']='-I%s'
+ v['DEFINES_ST']='-D%s'
+ v['LIB_ST']='-l%s'
+ v['LIBPATH_ST']='-L%s'
+ v['STLIB_ST']='-l%s'
+ v['STLIBPATH_ST']='-L%s'
+ v['RPATH_ST']='-Wl,-rpath,%s'
+ v['SONAME_ST']='-Wl,-h,%s'
+ v['SHLIB_MARKER']='-Wl,-Bdynamic'
+ v['STLIB_MARKER']='-Wl,-Bstatic'
+ v['cxxprogram_PATTERN']='%s'
+ v['CXXFLAGS_cxxshlib']=['-fPIC']
+ v['LINKFLAGS_cxxshlib']=['-shared']
+ v['cxxshlib_PATTERN']='lib%s.so'
+ v['LINKFLAGS_cxxstlib']=['-Wl,-Bstatic']
+ v['cxxstlib_PATTERN']='lib%s.a'
+ v['LINKFLAGS_MACBUNDLE']=['-bundle','-undefined','dynamic_lookup']
+ v['CXXFLAGS_MACBUNDLE']=['-fPIC']
+ v['macbundle_PATTERN']='%s.bundle'
+@conf
+def gxx_modifier_win32(conf):
+ v=conf.env
+ v['cxxprogram_PATTERN']='%s.exe'
+ v['cxxshlib_PATTERN']='%s.dll'
+ v['implib_PATTERN']='lib%s.dll.a'
+ v['IMPLIB_ST']='-Wl,--out-implib,%s'
+ v['CXXFLAGS_cxxshlib']=[]
+ v.append_value('LINKFLAGS',['-Wl,--enable-auto-import'])
+@conf
+def gxx_modifier_cygwin(conf):
+ gxx_modifier_win32(conf)
+ v=conf.env
+ v['cxxshlib_PATTERN']='cyg%s.dll'
+ v.append_value('LINKFLAGS_cxxshlib',['-Wl,--enable-auto-image-base'])
+ v['CXXFLAGS_cxxshlib']=[]
+@conf
+def gxx_modifier_darwin(conf):
+ v=conf.env
+ v['CXXFLAGS_cxxshlib']=['-fPIC','-compatibility_version','1','-current_version','1']
+ v['LINKFLAGS_cxxshlib']=['-dynamiclib']
+ v['cxxshlib_PATTERN']='lib%s.dylib'
+ v['FRAMEWORKPATH_ST']='-F%s'
+ v['FRAMEWORK_ST']=['-framework']
+ v['ARCH_ST']=['-arch']
+ v['LINKFLAGS_cxxstlib']=[]
+ v['SHLIB_MARKER']=[]
+ v['STLIB_MARKER']=[]
+ v['SONAME_ST']=[]
+@conf
+def gxx_modifier_aix(conf):
+ v=conf.env
+ v['LINKFLAGS_cxxprogram']=['-Wl,-brtl']
+ v['LINKFLAGS_cxxshlib']=['-shared','-Wl,-brtl,-bexpfull']
+ v['SHLIB_MARKER']=[]
+@conf
+def gxx_modifier_hpux(conf):
+ v=conf.env
+ v['SHLIB_MARKER']=[]
+ v['STLIB_MARKER']='-Bstatic'
+ v['CFLAGS_cxxshlib']=['-fPIC','-DPIC']
+ v['cxxshlib_PATTERN']='lib%s.sl'
+@conf
+def gxx_modifier_platform(conf):
+ gxx_modifier_func=getattr(conf,'gxx_modifier_'+conf.env.DEST_OS,None)
+ if gxx_modifier_func:
+ gxx_modifier_func()
+def configure(conf):
+ conf.find_gxx()
+ conf.find_ar()
+ conf.gxx_common_flags()
+ conf.gxx_modifier_platform()
+ conf.cxx_load_tools()
+ conf.cxx_add_flags()
+ conf.link_add_flags()
--- /dev/null
+#! /usr/bin/env python
+# encoding: utf-8
+# WARNING! Do not edit! http://waf.googlecode.com/git/docs/wafbook/single.html#_obtaining_the_waf_file
+
+import os,sys
+from waflib.Tools import ccroot,ar,gcc
+from waflib.Configure import conf
+@conf
+def find_icc(conf):
+ if sys.platform=='cygwin':
+ conf.fatal('The Intel compiler does not work on Cygwin')
+ v=conf.env
+ cc=None
+ if v['CC']:cc=v['CC']
+ elif'CC'in conf.environ:cc=conf.environ['CC']
+ if not cc:cc=conf.find_program('icc',var='CC')
+ if not cc:cc=conf.find_program('ICL',var='CC')
+ if not cc:conf.fatal('Intel C Compiler (icc) was not found')
+ cc=conf.cmd_to_list(cc)
+ conf.get_cc_version(cc,icc=True)
+ v['CC']=cc
+ v['CC_NAME']='icc'
+def configure(conf):
+ conf.find_icc()
+ conf.find_ar()
+ conf.gcc_common_flags()
+ conf.gcc_modifier_platform()
+ conf.cc_load_tools()
+ conf.cc_add_flags()
+ conf.link_add_flags()
--- /dev/null
+#! /usr/bin/env python
+# encoding: utf-8
+# WARNING! Do not edit! http://waf.googlecode.com/git/docs/wafbook/single.html#_obtaining_the_waf_file
+
+import os,sys
+from waflib.Tools import ccroot,ar,gxx
+from waflib.Configure import conf
+@conf
+def find_icpc(conf):
+ if sys.platform=='cygwin':
+ conf.fatal('The Intel compiler does not work on Cygwin')
+ v=conf.env
+ cxx=None
+ if v['CXX']:cxx=v['CXX']
+ elif'CXX'in conf.environ:cxx=conf.environ['CXX']
+ if not cxx:cxx=conf.find_program('icpc',var='CXX')
+ if not cxx:conf.fatal('Intel C++ Compiler (icpc) was not found')
+ cxx=conf.cmd_to_list(cxx)
+ conf.get_cc_version(cxx,icc=True)
+ v['CXX']=cxx
+ v['CXX_NAME']='icc'
+def configure(conf):
+ conf.find_icpc()
+ conf.find_ar()
+ conf.gxx_common_flags()
+ conf.gxx_modifier_platform()
+ conf.cxx_load_tools()
+ conf.cxx_add_flags()
+ conf.link_add_flags()
--- /dev/null
+#! /usr/bin/env python
+# encoding: utf-8
+# WARNING! Do not edit! http://waf.googlecode.com/git/docs/wafbook/single.html#_obtaining_the_waf_file
+
+import re
+from waflib import Utils
+from waflib.Tools import fc,fc_config,fc_scan,ar
+from waflib.Configure import conf
+@conf
+def find_ifort(conf):
+ fc=conf.find_program('ifort',var='FC')
+ fc=conf.cmd_to_list(fc)
+ conf.get_ifort_version(fc)
+ conf.env.FC_NAME='IFORT'
+@conf
+def ifort_modifier_cygwin(conf):
+ raise NotImplementedError("Ifort on cygwin not yet implemented")
+@conf
+def ifort_modifier_win32(conf):
+ fc_config.fortran_modifier_win32(conf)
+@conf
+def ifort_modifier_darwin(conf):
+ fc_config.fortran_modifier_darwin(conf)
+@conf
+def ifort_modifier_platform(conf):
+ dest_os=conf.env['DEST_OS']or Utils.unversioned_sys_platform()
+ ifort_modifier_func=getattr(conf,'ifort_modifier_'+dest_os,None)
+ if ifort_modifier_func:
+ ifort_modifier_func()
+@conf
+def get_ifort_version(conf,fc):
+ version_re=re.compile(r"ifort\s*\(IFORT\)\s*(?P<major>\d*)\.(?P<minor>\d*)",re.I).search
+ cmd=fc+['--version']
+ out,err=fc_config.getoutput(conf,cmd,stdin=False)
+ if out:
+ match=version_re(out)
+ else:
+ match=version_re(err)
+ if not match:
+ conf.fatal('cannot determine ifort version.')
+ k=match.groupdict()
+ conf.env['FC_VERSION']=(k['major'],k['minor'])
+def configure(conf):
+ conf.find_ifort()
+ conf.find_program('xiar',var='AR')
+ conf.env.ARFLAGS='rcs'
+ conf.fc_flags()
+ conf.fc_add_flags()
+ conf.ifort_modifier_platform()
--- /dev/null
+#! /usr/bin/env python
+# encoding: utf-8
+# WARNING! Do not edit! http://waf.googlecode.com/git/docs/wafbook/single.html#_obtaining_the_waf_file
+
+import os,re
+from waflib import Configure,TaskGen,Task,Utils,Runner,Options,Build,Logs
+import waflib.Tools.ccroot
+from waflib.TaskGen import feature,before_method
+from waflib.Logs import error
+@before_method('process_source')
+@feature('intltool_in')
+def apply_intltool_in_f(self):
+ try:self.meths.remove('process_source')
+ except ValueError:pass
+ if not self.env.LOCALEDIR:
+ self.env.LOCALEDIR=self.env.PREFIX+'/share/locale'
+ for i in self.to_list(self.source):
+ node=self.path.find_resource(i)
+ podir=getattr(self,'podir','po')
+ podirnode=self.path.find_dir(podir)
+ if not podirnode:
+ error("could not find the podir %r"%podir)
+ continue
+ cache=getattr(self,'intlcache','.intlcache')
+ self.env['INTLCACHE']=os.path.join(self.path.bldpath(),podir,cache)
+ self.env['INTLPODIR']=podirnode.bldpath()
+ self.env['INTLFLAGS']=getattr(self,'flags',['-q','-u','-c'])
+ task=self.create_task('intltool',node,node.change_ext(''))
+ inst=getattr(self,'install_path','${LOCALEDIR}')
+ if inst:
+ self.bld.install_files(inst,task.outputs)
+@feature('intltool_po')
+def apply_intltool_po(self):
+ try:self.meths.remove('process_source')
+ except ValueError:pass
+ if not self.env.LOCALEDIR:
+ self.env.LOCALEDIR=self.env.PREFIX+'/share/locale'
+ appname=getattr(self,'appname','set_your_app_name')
+ podir=getattr(self,'podir','')
+ inst=getattr(self,'install_path','${LOCALEDIR}')
+ linguas=self.path.find_node(os.path.join(podir,'LINGUAS'))
+ if linguas:
+ file=open(linguas.abspath())
+ langs=[]
+ for line in file.readlines():
+ if not line.startswith('#'):
+ langs+=line.split()
+ file.close()
+ re_linguas=re.compile('[-a-zA-Z_@.]+')
+ for lang in langs:
+ if re_linguas.match(lang):
+ node=self.path.find_resource(os.path.join(podir,re_linguas.match(lang).group()+'.po'))
+ task=self.create_task('po',node,node.change_ext('.mo'))
+ if inst:
+ filename=task.outputs[0].name
+ (langname,ext)=os.path.splitext(filename)
+ inst_file=inst+os.sep+langname+os.sep+'LC_MESSAGES'+os.sep+appname+'.mo'
+ self.bld.install_as(inst_file,task.outputs[0],chmod=getattr(self,'chmod',Utils.O644),env=task.env)
+ else:
+ Logs.pprint('RED',"Error no LINGUAS file found in po directory")
+class po(Task.Task):
+ run_str='${MSGFMT} -o ${TGT} ${SRC}'
+ color='BLUE'
+class intltool(Task.Task):
+ run_str='${INTLTOOL} ${INTLFLAGS} ${INTLCACHE} ${INTLPODIR} ${SRC} ${TGT}'
+ color='BLUE'
+def configure(conf):
+ conf.find_program('msgfmt',var='MSGFMT')
+ conf.find_perl_program('intltool-merge',var='INTLTOOL')
+ prefix=conf.env.PREFIX
+ datadir=conf.env.DATADIR
+ if not datadir:
+ datadir=os.path.join(prefix,'share')
+ conf.define('LOCALEDIR',os.path.join(datadir,'locale').replace('\\','\\\\'))
+ conf.define('DATADIR',datadir.replace('\\','\\\\'))
+ if conf.env.CC or conf.env.CXX:
+ conf.check(header_name='locale.h')
--- /dev/null
+#! /usr/bin/env python
+# encoding: utf-8
+# WARNING! Do not edit! http://waf.googlecode.com/git/docs/wafbook/single.html#_obtaining_the_waf_file
+
+import os
+from waflib import Utils
+from waflib.Tools import ccroot,ar
+from waflib.Configure import conf
+@conf
+def find_irixcc(conf):
+ v=conf.env
+ cc=None
+ if v['CC']:cc=v['CC']
+ elif'CC'in conf.environ:cc=conf.environ['CC']
+ if not cc:cc=conf.find_program('cc',var='CC')
+ if not cc:conf.fatal('irixcc was not found')
+ cc=conf.cmd_to_list(cc)
+ try:
+ conf.cmd_and_log(cc+['-version'])
+ except Exception:
+ conf.fatal('%r -version could not be executed'%cc)
+ v['CC']=cc
+ v['CC_NAME']='irix'
+@conf
+def irixcc_common_flags(conf):
+ v=conf.env
+ v['CC_SRC_F']=''
+ v['CC_TGT_F']=['-c','-o']
+ v['CPPPATH_ST']='-I%s'
+ v['DEFINES_ST']='-D%s'
+ if not v['LINK_CC']:v['LINK_CC']=v['CC']
+ v['CCLNK_SRC_F']=''
+ v['CCLNK_TGT_F']=['-o']
+ v['LIB_ST']='-l%s'
+ v['LIBPATH_ST']='-L%s'
+ v['STLIB_ST']='-l%s'
+ v['STLIBPATH_ST']='-L%s'
+ v['cprogram_PATTERN']='%s'
+ v['cshlib_PATTERN']='lib%s.so'
+ v['cstlib_PATTERN']='lib%s.a'
+def configure(conf):
+ conf.find_irixcc()
+ conf.find_cpp()
+ conf.find_ar()
+ conf.irixcc_common_flags()
+ conf.cc_load_tools()
+ conf.cc_add_flags()
+ conf.link_add_flags()
--- /dev/null
+#! /usr/bin/env python
+# encoding: utf-8
+# WARNING! Do not edit! http://waf.googlecode.com/git/docs/wafbook/single.html#_obtaining_the_waf_file
+
+import os,re,tempfile,shutil
+from waflib import TaskGen,Task,Utils,Options,Build,Errors,Node,Logs
+from waflib.Configure import conf
+from waflib.TaskGen import feature,before_method,after_method
+from waflib.Tools import ccroot
+ccroot.USELIB_VARS['javac']=set(['CLASSPATH','JAVACFLAGS'])
+SOURCE_RE='**/*.java'
+JAR_RE='**/*'
+class_check_source='''
+public class Test {
+ public static void main(String[] argv) {
+ Class lib;
+ if (argv.length < 1) {
+ System.err.println("Missing argument");
+ System.exit(77);
+ }
+ try {
+ lib = Class.forName(argv[0]);
+ } catch (ClassNotFoundException e) {
+ System.err.println("ClassNotFoundException");
+ System.exit(1);
+ }
+ lib = null;
+ System.exit(0);
+ }
+}
+'''
+@feature('javac')
+@before_method('process_source')
+def apply_java(self):
+ Utils.def_attrs(self,jarname='',classpath='',sourcepath='.',srcdir='.',jar_mf_attributes={},jar_mf_classpath=[])
+ nodes_lst=[]
+ outdir=getattr(self,'outdir',None)
+ if outdir:
+ if not isinstance(outdir,Node.Node):
+ outdir=self.path.get_bld().make_node(self.outdir)
+ else:
+ outdir=self.path.get_bld()
+ outdir.mkdir()
+ self.outdir=outdir
+ self.env['OUTDIR']=outdir.abspath()
+ self.javac_task=tsk=self.create_task('javac')
+ tmp=[]
+ srcdir=getattr(self,'srcdir','')
+ if isinstance(srcdir,Node.Node):
+ srcdir=[srcdir]
+ for x in Utils.to_list(srcdir):
+ if isinstance(x,Node.Node):
+ y=x
+ else:
+ y=self.path.find_dir(x)
+ if not y:
+ self.bld.fatal('Could not find the folder %s from %s'%(x,self.path))
+ tmp.append(y)
+ tsk.srcdir=tmp
+ if getattr(self,'compat',None):
+ tsk.env.append_value('JAVACFLAGS',['-source',self.compat])
+ if hasattr(self,'sourcepath'):
+ fold=[isinstance(x,Node.Node)and x or self.path.find_dir(x)for x in self.to_list(self.sourcepath)]
+ names=os.pathsep.join([x.srcpath()for x in fold])
+ else:
+ names=[x.srcpath()for x in tsk.srcdir]
+ if names:
+ tsk.env.append_value('JAVACFLAGS',['-sourcepath',names])
+@feature('javac')
+@after_method('apply_java')
+def use_javac_files(self):
+ lst=[]
+ self.uselib=self.to_list(getattr(self,'uselib',[]))
+ names=self.to_list(getattr(self,'use',[]))
+ get=self.bld.get_tgen_by_name
+ for x in names:
+ try:
+ y=get(x)
+ except Exception:
+ self.uselib.append(x)
+ else:
+ y.post()
+ lst.append(y.jar_task.outputs[0].abspath())
+ self.javac_task.set_run_after(y.jar_task)
+ if lst:
+ self.env.append_value('CLASSPATH',lst)
+@feature('javac')
+@after_method('apply_java','propagate_uselib_vars','use_javac_files')
+def set_classpath(self):
+ self.env.append_value('CLASSPATH',getattr(self,'classpath',[]))
+ for x in self.tasks:
+ x.env.CLASSPATH=os.pathsep.join(self.env.CLASSPATH)+os.pathsep
+@feature('jar')
+@after_method('apply_java','use_javac_files')
+@before_method('process_source')
+def jar_files(self):
+ destfile=getattr(self,'destfile','test.jar')
+ jaropts=getattr(self,'jaropts',[])
+ manifest=getattr(self,'manifest',None)
+ basedir=getattr(self,'basedir',None)
+ if basedir:
+ if not isinstance(self.basedir,Node.Node):
+ basedir=self.path.get_bld().make_node(basedir)
+ else:
+ basedir=self.path.get_bld()
+ if not basedir:
+ self.bld.fatal('Could not find the basedir %r for %r'%(self.basedir,self))
+ self.jar_task=tsk=self.create_task('jar_create')
+ if manifest:
+ jarcreate=getattr(self,'jarcreate','cfm')
+ node=self.path.find_node(manifest)
+ tsk.dep_nodes.append(node)
+ jaropts.insert(0,node.abspath())
+ else:
+ jarcreate=getattr(self,'jarcreate','cf')
+ if not isinstance(destfile,Node.Node):
+ destfile=self.path.find_or_declare(destfile)
+ if not destfile:
+ self.bld.fatal('invalid destfile %r for %r'%(destfile,self))
+ tsk.set_outputs(destfile)
+ tsk.basedir=basedir
+ jaropts.append('-C')
+ jaropts.append(basedir.bldpath())
+ jaropts.append('.')
+ tsk.env['JAROPTS']=jaropts
+ tsk.env['JARCREATE']=jarcreate
+ if getattr(self,'javac_task',None):
+ tsk.set_run_after(self.javac_task)
+@feature('jar')
+@after_method('jar_files')
+def use_jar_files(self):
+ lst=[]
+ self.uselib=self.to_list(getattr(self,'uselib',[]))
+ names=self.to_list(getattr(self,'use',[]))
+ get=self.bld.get_tgen_by_name
+ for x in names:
+ try:
+ y=get(x)
+ except Exception:
+ self.uselib.append(x)
+ else:
+ y.post()
+ self.jar_task.run_after.update(y.tasks)
+class jar_create(Task.Task):
+ color='GREEN'
+ run_str='${JAR} ${JARCREATE} ${TGT} ${JAROPTS}'
+ def runnable_status(self):
+ for t in self.run_after:
+ if not t.hasrun:
+ return Task.ASK_LATER
+ if not self.inputs:
+ global JAR_RE
+ try:
+ self.inputs=[x for x in self.basedir.ant_glob(JAR_RE,remove=False)if id(x)!=id(self.outputs[0])]
+ except Exception:
+ raise Errors.WafError('Could not find the basedir %r for %r'%(self.basedir,self))
+ return super(jar_create,self).runnable_status()
+class javac(Task.Task):
+ color='BLUE'
+ nocache=True
+ vars=['CLASSPATH','JAVACFLAGS','JAVAC','OUTDIR']
+ def runnable_status(self):
+ for t in self.run_after:
+ if not t.hasrun:
+ return Task.ASK_LATER
+ if not self.inputs:
+ global SOURCE_RE
+ self.inputs=[]
+ for x in self.srcdir:
+ self.inputs.extend(x.ant_glob(SOURCE_RE,remove=False))
+ return super(javac,self).runnable_status()
+ def run(self):
+ env=self.env
+ gen=self.generator
+ bld=gen.bld
+ wd=bld.bldnode.abspath()
+ def to_list(xx):
+ if isinstance(xx,str):return[xx]
+ return xx
+ cmd=[]
+ cmd.extend(to_list(env['JAVAC']))
+ cmd.extend(['-classpath'])
+ cmd.extend(to_list(env['CLASSPATH']))
+ cmd.extend(['-d'])
+ cmd.extend(to_list(env['OUTDIR']))
+ cmd.extend(to_list(env['JAVACFLAGS']))
+ files=[a.path_from(bld.bldnode)for a in self.inputs]
+ tmp=None
+ try:
+ if len(str(files))+len(str(cmd))>8192:
+ (fd,tmp)=tempfile.mkstemp(dir=bld.bldnode.abspath())
+ try:
+ os.write(fd,'\n'.join(files))
+ finally:
+ if tmp:
+ os.close(fd)
+ if Logs.verbose:
+ Logs.debug('runner: %r'%(cmd+files))
+ cmd.append('@'+tmp)
+ else:
+ cmd+=files
+ ret=self.exec_command(cmd,cwd=wd,env=env.env or None)
+ finally:
+ if tmp:
+ os.unlink(tmp)
+ return ret
+ def post_run(self):
+ for n in self.generator.outdir.ant_glob('**/*.class'):
+ n.sig=Utils.h_file(n.abspath())
+ self.generator.bld.task_sigs[self.uid()]=self.cache_sig
+@feature('javadoc')
+@after_method('process_rule')
+def create_javadoc(self):
+ tsk=self.create_task('javadoc')
+ tsk.classpath=getattr(self,'classpath',[])
+ self.javadoc_package=Utils.to_list(self.javadoc_package)
+ if not isinstance(self.javadoc_output,Node.Node):
+ self.javadoc_output=self.bld.path.find_or_declare(self.javadoc_output)
+class javadoc(Task.Task):
+ color='BLUE'
+ def __str__(self):
+ return'%s: %s -> %s\n'%(self.__class__.__name__,self.generator.srcdir,self.generator.javadoc_output)
+ def run(self):
+ env=self.env
+ bld=self.generator.bld
+ wd=bld.bldnode.abspath()
+ srcpath=self.generator.path.abspath()+os.sep+self.generator.srcdir
+ srcpath+=os.pathsep
+ srcpath+=self.generator.path.get_bld().abspath()+os.sep+self.generator.srcdir
+ classpath=env.CLASSPATH
+ classpath+=os.pathsep
+ classpath+=os.pathsep.join(self.classpath)
+ classpath="".join(classpath)
+ self.last_cmd=lst=[]
+ lst.extend(Utils.to_list(env['JAVADOC']))
+ lst.extend(['-d',self.generator.javadoc_output.abspath()])
+ lst.extend(['-sourcepath',srcpath])
+ lst.extend(['-classpath',classpath])
+ lst.extend(['-subpackages'])
+ lst.extend(self.generator.javadoc_package)
+ lst=[x for x in lst if x]
+ self.generator.bld.cmd_and_log(lst,cwd=wd,env=env.env or None,quiet=0)
+ def post_run(self):
+ nodes=self.generator.javadoc_output.ant_glob('**')
+ for x in nodes:
+ x.sig=Utils.h_file(x.abspath())
+ self.generator.bld.task_sigs[self.uid()]=self.cache_sig
+def configure(self):
+ java_path=self.environ['PATH'].split(os.pathsep)
+ v=self.env
+ if'JAVA_HOME'in self.environ:
+ java_path=[os.path.join(self.environ['JAVA_HOME'],'bin')]+java_path
+ self.env['JAVA_HOME']=[self.environ['JAVA_HOME']]
+ for x in'javac java jar javadoc'.split():
+ self.find_program(x,var=x.upper(),path_list=java_path)
+ self.env[x.upper()]=self.cmd_to_list(self.env[x.upper()])
+ if'CLASSPATH'in self.environ:
+ v['CLASSPATH']=self.environ['CLASSPATH']
+ if not v['JAR']:self.fatal('jar is required for making java packages')
+ if not v['JAVAC']:self.fatal('javac is required for compiling java classes')
+ v['JARCREATE']='cf'
+ v['JAVACFLAGS']=[]
+@conf
+def check_java_class(self,classname,with_classpath=None):
+ javatestdir='.waf-javatest'
+ classpath=javatestdir
+ if self.env['CLASSPATH']:
+ classpath+=os.pathsep+self.env['CLASSPATH']
+ if isinstance(with_classpath,str):
+ classpath+=os.pathsep+with_classpath
+ shutil.rmtree(javatestdir,True)
+ os.mkdir(javatestdir)
+ java_file=open(os.path.join(javatestdir,'Test.java'),'w')
+ java_file.write(class_check_source)
+ java_file.close()
+ self.exec_command(self.env['JAVAC']+[os.path.join(javatestdir,'Test.java')],shell=False)
+ cmd=self.env['JAVA']+['-cp',classpath,'Test',classname]
+ self.to_log("%s\n"%str(cmd))
+ found=self.exec_command(cmd,shell=False)
+ self.msg('Checking for java class %s'%classname,not found)
+ shutil.rmtree(javatestdir,True)
+ return found
+@conf
+def check_jni_headers(conf):
+ if not conf.env.CC_NAME and not conf.env.CXX_NAME:
+ conf.fatal('load a compiler first (gcc, g++, ..)')
+ if not conf.env.JAVA_HOME:
+ conf.fatal('set JAVA_HOME in the system environment')
+ javaHome=conf.env['JAVA_HOME'][0]
+ dir=conf.root.find_dir(conf.env.JAVA_HOME[0]+'/include')
+ if dir is None:
+ dir=conf.root.find_dir(conf.env.JAVA_HOME[0]+'/../Headers')
+ if dir is None:
+ conf.fatal('JAVA_HOME does not seem to be set properly')
+ f=dir.ant_glob('**/(jni|jni_md).h')
+ incDirs=[x.parent.abspath()for x in f]
+ dir=conf.root.find_dir(conf.env.JAVA_HOME[0])
+ f=dir.ant_glob('**/*jvm.(so|dll|dylib)')
+ libDirs=[x.parent.abspath()for x in f]or[javaHome]
+ f=dir.ant_glob('**/*jvm.(lib)')
+ if f:
+ libDirs=[[x,y.parent.abspath()]for x in libDirs for y in f]
+ for d in libDirs:
+ try:
+ conf.check(header_name='jni.h',define_name='HAVE_JNI_H',lib='jvm',libpath=d,includes=incDirs,uselib_store='JAVA',uselib='JAVA')
+ except Exception:
+ pass
+ else:
+ break
+ else:
+ conf.fatal('could not find lib jvm in %r (see config.log)'%libDirs)
--- /dev/null
+#! /usr/bin/env python
+# encoding: utf-8
+# WARNING! Do not edit! http://waf.googlecode.com/git/docs/wafbook/single.html#_obtaining_the_waf_file
+
+import os,sys,re
+from waflib import Options,TaskGen,Task,Utils
+from waflib.TaskGen import feature,after_method
+@feature('msgfmt')
+def apply_msgfmt(self):
+ for lang in self.to_list(self.langs):
+ node=self.path.find_resource(lang+'.po')
+ task=self.create_task('msgfmt',node,node.change_ext('.mo'))
+ langname=lang.split('/')
+ langname=langname[-1]
+ inst=getattr(self,'install_path','${KDE4_LOCALE_INSTALL_DIR}')
+ self.bld.install_as(inst+os.sep+langname+os.sep+'LC_MESSAGES'+os.sep+getattr(self,'appname','set_your_appname')+'.mo',task.outputs[0],chmod=getattr(self,'chmod',Utils.O644))
+class msgfmt(Task.Task):
+ color='BLUE'
+ run_str='${MSGFMT} ${SRC} -o ${TGT}'
+def configure(self):
+ kdeconfig=self.find_program('kde4-config')
+ prefix=self.cmd_and_log('%s --prefix'%kdeconfig).strip()
+ fname='%s/share/apps/cmake/modules/KDELibsDependencies.cmake'%prefix
+ try:os.stat(fname)
+ except OSError:
+ fname='%s/share/kde4/apps/cmake/modules/KDELibsDependencies.cmake'%prefix
+ try:os.stat(fname)
+ except OSError:self.fatal('could not open %s'%fname)
+ try:
+ txt=Utils.readf(fname)
+ except(OSError,IOError):
+ self.fatal('could not read %s'%fname)
+ txt=txt.replace('\\\n','\n')
+ fu=re.compile('#(.*)\n')
+ txt=fu.sub('',txt)
+ setregexp=re.compile('([sS][eE][tT]\s*\()\s*([^\s]+)\s+\"([^"]+)\"\)')
+ found=setregexp.findall(txt)
+ for(_,key,val)in found:
+ self.env[key]=val
+ self.env['LIB_KDECORE']=['kdecore']
+ self.env['LIB_KDEUI']=['kdeui']
+ self.env['LIB_KIO']=['kio']
+ self.env['LIB_KHTML']=['khtml']
+ self.env['LIB_KPARTS']=['kparts']
+ self.env['LIBPATH_KDECORE']=[os.path.join(self.env.KDE4_LIB_INSTALL_DIR,'kde4','devel'),self.env.KDE4_LIB_INSTALL_DIR]
+ self.env['INCLUDES_KDECORE']=[self.env['KDE4_INCLUDE_INSTALL_DIR']]
+ self.env.append_value('INCLUDES_KDECORE',[self.env['KDE4_INCLUDE_INSTALL_DIR']+os.sep+'KDE'])
+ self.find_program('msgfmt',var='MSGFMT')
--- /dev/null
+#! /usr/bin/env python
+# encoding: utf-8
+# WARNING! Do not edit! http://waf.googlecode.com/git/docs/wafbook/single.html#_obtaining_the_waf_file
+
+import sys
+from waflib.Tools import ar,d
+from waflib.Configure import conf
+@conf
+def find_ldc2(conf):
+ conf.find_program(['ldc2'],var='D')
+ out=conf.cmd_and_log([conf.env.D,'-version'])
+ if out.find("based on DMD v2.")==-1:
+ conf.fatal("detected compiler is not ldc2")
+@conf
+def common_flags_ldc2(conf):
+ v=conf.env
+ v['D_SRC_F']=['-c']
+ v['D_TGT_F']='-of%s'
+ v['D_LINKER']=v['D']
+ v['DLNK_SRC_F']=''
+ v['DLNK_TGT_F']='-of%s'
+ v['DINC_ST']='-I%s'
+ v['DSHLIB_MARKER']=v['DSTLIB_MARKER']=''
+ v['DSTLIB_ST']=v['DSHLIB_ST']='-L-l%s'
+ v['DSTLIBPATH_ST']=v['DLIBPATH_ST']='-L-L%s'
+ v['LINKFLAGS_dshlib']=['-L-shared']
+ v['DHEADER_ext']='.di'
+ v['DFLAGS_d_with_header']=['-H','-Hf']
+ v['D_HDR_F']='%s'
+ v['LINKFLAGS']=[]
+ v['DFLAGS_dshlib']=['-relocation-model=pic']
+def configure(conf):
+ conf.find_ldc2()
+ conf.load('ar')
+ conf.load('d')
+ conf.common_flags_ldc2()
+ conf.d_platform_flags()
--- /dev/null
+#! /usr/bin/env python
+# encoding: utf-8
+# WARNING! Do not edit! http://waf.googlecode.com/git/docs/wafbook/single.html#_obtaining_the_waf_file
+
+from waflib.TaskGen import extension
+from waflib import Task,Utils
+@extension('.lua')
+def add_lua(self,node):
+ tsk=self.create_task('luac',node,node.change_ext('.luac'))
+ inst_to=getattr(self,'install_path',self.env.LUADIR and'${LUADIR}'or None)
+ if inst_to:
+ self.bld.install_files(inst_to,tsk.outputs)
+ return tsk
+class luac(Task.Task):
+ run_str='${LUAC} -s -o ${TGT} ${SRC}'
+ color='PINK'
+def configure(conf):
+ conf.find_program('luac',var='LUAC')
--- /dev/null
+#! /usr/bin/env python
+# encoding: utf-8
+# WARNING! Do not edit! http://waf.googlecode.com/git/docs/wafbook/single.html#_obtaining_the_waf_file
+
+import os,sys,re,tempfile
+from waflib import Utils,Task,Logs,Options
+from waflib.Logs import debug,warn
+from waflib.TaskGen import after_method,feature
+from waflib.Configure import conf
+from waflib.Tools import ccroot,c,cxx,ar,winres
+g_msvc_systemlibs='''
+aclui activeds ad1 adptif adsiid advapi32 asycfilt authz bhsupp bits bufferoverflowu cabinet
+cap certadm certidl ciuuid clusapi comctl32 comdlg32 comsupp comsuppd comsuppw comsuppwd comsvcs
+credui crypt32 cryptnet cryptui d3d8thk daouuid dbgeng dbghelp dciman32 ddao35 ddao35d
+ddao35u ddao35ud delayimp dhcpcsvc dhcpsapi dlcapi dnsapi dsprop dsuiext dtchelp
+faultrep fcachdll fci fdi framedyd framedyn gdi32 gdiplus glauxglu32 gpedit gpmuuid
+gtrts32w gtrtst32hlink htmlhelp httpapi icm32 icmui imagehlp imm32 iphlpapi iprop
+kernel32 ksguid ksproxy ksuser libcmt libcmtd libcpmt libcpmtd loadperf lz32 mapi
+mapi32 mgmtapi minidump mmc mobsync mpr mprapi mqoa mqrt msacm32 mscms mscoree
+msdasc msimg32 msrating mstask msvcmrt msvcurt msvcurtd mswsock msxml2 mtx mtxdm
+netapi32 nmapinmsupp npptools ntdsapi ntdsbcli ntmsapi ntquery odbc32 odbcbcp
+odbccp32 oldnames ole32 oleacc oleaut32 oledb oledlgolepro32 opends60 opengl32
+osptk parser pdh penter pgobootrun pgort powrprof psapi ptrustm ptrustmd ptrustu
+ptrustud qosname rasapi32 rasdlg rassapi resutils riched20 rpcndr rpcns4 rpcrt4 rtm
+rtutils runtmchk scarddlg scrnsave scrnsavw secur32 sensapi setupapi sfc shell32
+shfolder shlwapi sisbkup snmpapi sporder srclient sti strsafe svcguid tapi32 thunk32
+traffic unicows url urlmon user32 userenv usp10 uuid uxtheme vcomp vcompd vdmdbg
+version vfw32 wbemuuid webpost wiaguid wininet winmm winscard winspool winstrm
+wintrust wldap32 wmiutils wow32 ws2_32 wsnmp32 wsock32 wst wtsapi32 xaswitch xolehlp
+'''.split()
+all_msvc_platforms=[('x64','amd64'),('x86','x86'),('ia64','ia64'),('x86_amd64','amd64'),('x86_ia64','ia64')]
+all_wince_platforms=[('armv4','arm'),('armv4i','arm'),('mipsii','mips'),('mipsii_fp','mips'),('mipsiv','mips'),('mipsiv_fp','mips'),('sh4','sh'),('x86','cex86')]
+all_icl_platforms=[('intel64','amd64'),('em64t','amd64'),('ia32','x86'),('Itanium','ia64')]
+def options(opt):
+ opt.add_option('--msvc_version',type='string',help='msvc version, eg: "msvc 10.0,msvc 9.0"',default='')
+ opt.add_option('--msvc_targets',type='string',help='msvc targets, eg: "x64,arm"',default='')
+def setup_msvc(conf,versions,arch=False):
+ platforms=getattr(Options.options,'msvc_targets','').split(',')
+ if platforms==['']:
+ platforms=Utils.to_list(conf.env['MSVC_TARGETS'])or[i for i,j in all_msvc_platforms+all_icl_platforms+all_wince_platforms]
+ desired_versions=getattr(Options.options,'msvc_version','').split(',')
+ if desired_versions==['']:
+ desired_versions=conf.env['MSVC_VERSIONS']or[v for v,_ in versions][::-1]
+ versiondict=dict(versions)
+ for version in desired_versions:
+ try:
+ targets=dict(versiondict[version])
+ for target in platforms:
+ try:
+ arch,(p1,p2,p3)=targets[target]
+ compiler,revision=version.rsplit(' ',1)
+ if arch:
+ return compiler,revision,p1,p2,p3,arch
+ else:
+ return compiler,revision,p1,p2,p3
+ except KeyError:continue
+ except KeyError:continue
+ conf.fatal('msvc: Impossible to find a valid architecture for building (in setup_msvc)')
+@conf
+def get_msvc_version(conf,compiler,version,target,vcvars):
+ debug('msvc: get_msvc_version: %r %r %r',compiler,version,target)
+ batfile=conf.bldnode.make_node('waf-print-msvc.bat')
+ batfile.write("""@echo off
+set INCLUDE=
+set LIB=
+call "%s" %s
+echo PATH=%%PATH%%
+echo INCLUDE=%%INCLUDE%%
+echo LIB=%%LIB%%
+"""%(vcvars,target))
+ sout=conf.cmd_and_log(['cmd','/E:on','/V:on','/C',batfile.abspath()])
+ lines=sout.splitlines()
+ if not lines[0]:
+ lines.pop(0)
+ if version=='11.0':
+ if lines[0].startswith('Error'):
+ conf.fatal('msvc: Could not find a valid architecture for building (get_msvc_version_1)')
+ else:
+ for x in('Setting environment','Setting SDK environment','Intel(R) C++ Compiler','Intel Parallel Studio','Intel(R) Parallel Studio','Intel(R) Composer','Intel Corporation. All rights reserved.'):
+ if lines[0].find(x)>-1:
+ lines.pop(0)
+ break
+ else:
+ debug('msvc: get_msvc_version: %r %r %r -> not found',compiler,version,target)
+ conf.fatal('msvc: Could not find a valid architecture for building (get_msvc_version_2)')
+ MSVC_PATH=MSVC_INCDIR=MSVC_LIBDIR=None
+ for line in lines:
+ if line.startswith('PATH='):
+ path=line[5:]
+ MSVC_PATH=path.split(';')
+ elif line.startswith('INCLUDE='):
+ MSVC_INCDIR=[i for i in line[8:].split(';')if i]
+ elif line.startswith('LIB='):
+ MSVC_LIBDIR=[i for i in line[4:].split(';')if i]
+ if None in(MSVC_PATH,MSVC_INCDIR,MSVC_LIBDIR):
+ conf.fatal('msvc: Could not find a valid architecture for building (get_msvc_version_3)')
+ env=dict(os.environ)
+ env.update(PATH=path)
+ compiler_name,linker_name,lib_name=_get_prog_names(conf,compiler)
+ cxx=conf.find_program(compiler_name,path_list=MSVC_PATH)
+ cxx=conf.cmd_to_list(cxx)
+ if'CL'in env:
+ del(env['CL'])
+ try:
+ try:
+ conf.cmd_and_log(cxx+['/help'],env=env)
+ except Exception ,e:
+ debug('msvc: get_msvc_version: %r %r %r -> failure'%(compiler,version,target))
+ debug(str(e))
+ conf.fatal('msvc: cannot run the compiler (in get_msvc_version)')
+ else:
+ debug('msvc: get_msvc_version: %r %r %r -> OK',compiler,version,target)
+ finally:
+ conf.env[compiler_name]=''
+ return(MSVC_PATH,MSVC_INCDIR,MSVC_LIBDIR)
+@conf
+def gather_wsdk_versions(conf,versions):
+ version_pattern=re.compile('^v..?.?\...?.?')
+ try:
+ all_versions=Utils.winreg.OpenKey(Utils.winreg.HKEY_LOCAL_MACHINE,'SOFTWARE\\Wow6432node\\Microsoft\\Microsoft SDKs\\Windows')
+ except WindowsError:
+ try:
+ all_versions=Utils.winreg.OpenKey(Utils.winreg.HKEY_LOCAL_MACHINE,'SOFTWARE\\Microsoft\\Microsoft SDKs\\Windows')
+ except WindowsError:
+ return
+ index=0
+ while 1:
+ try:
+ version=Utils.winreg.EnumKey(all_versions,index)
+ except WindowsError:
+ break
+ index=index+1
+ if not version_pattern.match(version):
+ continue
+ try:
+ msvc_version=Utils.winreg.OpenKey(all_versions,version)
+ path,type=Utils.winreg.QueryValueEx(msvc_version,'InstallationFolder')
+ except WindowsError:
+ continue
+ if os.path.isfile(os.path.join(path,'bin','SetEnv.cmd')):
+ targets=[]
+ for target,arch in all_msvc_platforms:
+ try:
+ targets.append((target,(arch,conf.get_msvc_version('wsdk',version,'/'+target,os.path.join(path,'bin','SetEnv.cmd')))))
+ except conf.errors.ConfigurationError:
+ pass
+ versions.append(('wsdk '+version[1:],targets))
+def gather_wince_supported_platforms():
+ supported_wince_platforms=[]
+ try:
+ ce_sdk=Utils.winreg.OpenKey(Utils.winreg.HKEY_LOCAL_MACHINE,'SOFTWARE\\Wow6432node\\Microsoft\\Windows CE Tools\\SDKs')
+ except WindowsError:
+ try:
+ ce_sdk=Utils.winreg.OpenKey(Utils.winreg.HKEY_LOCAL_MACHINE,'SOFTWARE\\Microsoft\\Windows CE Tools\\SDKs')
+ except WindowsError:
+ ce_sdk=''
+ if not ce_sdk:
+ return supported_wince_platforms
+ ce_index=0
+ while 1:
+ try:
+ sdk_device=Utils.winreg.EnumKey(ce_sdk,ce_index)
+ except WindowsError:
+ break
+ ce_index=ce_index+1
+ sdk=Utils.winreg.OpenKey(ce_sdk,sdk_device)
+ try:
+ path,type=Utils.winreg.QueryValueEx(sdk,'SDKRootDir')
+ except WindowsError:
+ try:
+ path,type=Utils.winreg.QueryValueEx(sdk,'SDKInformation')
+ path,xml=os.path.split(path)
+ except WindowsError:
+ continue
+ path=str(path)
+ path,device=os.path.split(path)
+ if not device:
+ path,device=os.path.split(path)
+ for arch,compiler in all_wince_platforms:
+ platforms=[]
+ if os.path.isdir(os.path.join(path,device,'Lib',arch)):
+ platforms.append((arch,compiler,os.path.join(path,device,'Include',arch),os.path.join(path,device,'Lib',arch)))
+ if platforms:
+ supported_wince_platforms.append((device,platforms))
+ return supported_wince_platforms
+def gather_msvc_detected_versions():
+ version_pattern=re.compile('^(\d\d?\.\d\d?)(Exp)?$')
+ detected_versions=[]
+ for vcver,vcvar in[('VCExpress','Exp'),('VisualStudio','')]:
+ try:
+ prefix='SOFTWARE\\Wow6432node\\Microsoft\\'+vcver
+ all_versions=Utils.winreg.OpenKey(Utils.winreg.HKEY_LOCAL_MACHINE,prefix)
+ except WindowsError:
+ try:
+ prefix='SOFTWARE\\Microsoft\\'+vcver
+ all_versions=Utils.winreg.OpenKey(Utils.winreg.HKEY_LOCAL_MACHINE,prefix)
+ except WindowsError:
+ continue
+ index=0
+ while 1:
+ try:
+ version=Utils.winreg.EnumKey(all_versions,index)
+ except WindowsError:
+ break
+ index=index+1
+ match=version_pattern.match(version)
+ if not match:
+ continue
+ else:
+ versionnumber=float(match.group(1))
+ detected_versions.append((versionnumber,version+vcvar,prefix+"\\"+version))
+ def fun(tup):
+ return tup[0]
+ detected_versions.sort(key=fun)
+ return detected_versions
+@conf
+def gather_msvc_targets(conf,versions,version,vc_path):
+ targets=[]
+ if os.path.isfile(os.path.join(vc_path,'vcvarsall.bat')):
+ for target,realtarget in all_msvc_platforms[::-1]:
+ try:
+ targets.append((target,(realtarget,conf.get_msvc_version('msvc',version,target,os.path.join(vc_path,'vcvarsall.bat')))))
+ except conf.errors.ConfigurationError:
+ pass
+ elif os.path.isfile(os.path.join(vc_path,'Common7','Tools','vsvars32.bat')):
+ try:
+ targets.append(('x86',('x86',conf.get_msvc_version('msvc',version,'x86',os.path.join(vc_path,'Common7','Tools','vsvars32.bat')))))
+ except conf.errors.ConfigurationError:
+ pass
+ elif os.path.isfile(os.path.join(vc_path,'Bin','vcvars32.bat')):
+ try:
+ targets.append(('x86',('x86',conf.get_msvc_version('msvc',version,'',os.path.join(vc_path,'Bin','vcvars32.bat')))))
+ except conf.errors.ConfigurationError:
+ pass
+ versions.append(('msvc '+version,targets))
+@conf
+def gather_wince_targets(conf,versions,version,vc_path,vsvars,supported_platforms):
+ for device,platforms in supported_platforms:
+ cetargets=[]
+ for platform,compiler,include,lib in platforms:
+ winCEpath=os.path.join(vc_path,'ce')
+ if not os.path.isdir(winCEpath):
+ continue
+ try:
+ common_bindirs,_1,_2=conf.get_msvc_version('msvc',version,'x86',vsvars)
+ except conf.errors.ConfigurationError:
+ continue
+ if os.path.isdir(os.path.join(winCEpath,'lib',platform)):
+ bindirs=[os.path.join(winCEpath,'bin',compiler),os.path.join(winCEpath,'bin','x86_'+compiler)]+common_bindirs
+ incdirs=[os.path.join(winCEpath,'include'),os.path.join(winCEpath,'atlmfc','include'),include]
+ libdirs=[os.path.join(winCEpath,'lib',platform),os.path.join(winCEpath,'atlmfc','lib',platform),lib]
+ cetargets.append((platform,(platform,(bindirs,incdirs,libdirs))))
+ if cetargets:
+ versions.append((device+' '+version,cetargets))
+@conf
+def gather_msvc_versions(conf,versions):
+ vc_paths=[]
+ for(v,version,reg)in gather_msvc_detected_versions():
+ try:
+ try:
+ msvc_version=Utils.winreg.OpenKey(Utils.winreg.HKEY_LOCAL_MACHINE,reg+"\\Setup\\VC")
+ except WindowsError:
+ msvc_version=Utils.winreg.OpenKey(Utils.winreg.HKEY_LOCAL_MACHINE,reg+"\\Setup\\Microsoft Visual C++")
+ path,type=Utils.winreg.QueryValueEx(msvc_version,'ProductDir')
+ vc_paths.append((version,os.path.abspath(str(path))))
+ except WindowsError:
+ continue
+ wince_supported_platforms=gather_wince_supported_platforms()
+ for version,vc_path in vc_paths:
+ vs_path=os.path.dirname(vc_path)
+ vsvars=os.path.join(vs_path,'Common7','Tools','vsvars32.bat')
+ if wince_supported_platforms and os.path.isfile(vsvars):
+ conf.gather_wince_targets(versions,version,vc_path,vsvars,wince_supported_platforms)
+ for version,vc_path in vc_paths:
+ vs_path=os.path.dirname(vc_path)
+ conf.gather_msvc_targets(versions,version,vc_path)
+@conf
+def gather_icl_versions(conf,versions):
+ version_pattern=re.compile('^...?.?\....?.?')
+ try:
+ all_versions=Utils.winreg.OpenKey(Utils.winreg.HKEY_LOCAL_MACHINE,'SOFTWARE\\Wow6432node\\Intel\\Compilers\\C++')
+ except WindowsError:
+ try:
+ all_versions=Utils.winreg.OpenKey(Utils.winreg.HKEY_LOCAL_MACHINE,'SOFTWARE\\Intel\\Compilers\\C++')
+ except WindowsError:
+ return
+ index=0
+ while 1:
+ try:
+ version=Utils.winreg.EnumKey(all_versions,index)
+ except WindowsError:
+ break
+ index=index+1
+ if not version_pattern.match(version):
+ continue
+ targets=[]
+ for target,arch in all_icl_platforms:
+ try:
+ if target=='intel64':targetDir='EM64T_NATIVE'
+ else:targetDir=target
+ Utils.winreg.OpenKey(all_versions,version+'\\'+targetDir)
+ icl_version=Utils.winreg.OpenKey(all_versions,version)
+ path,type=Utils.winreg.QueryValueEx(icl_version,'ProductDir')
+ batch_file=os.path.join(path,'bin','iclvars.bat')
+ if os.path.isfile(batch_file):
+ try:
+ targets.append((target,(arch,conf.get_msvc_version('intel',version,target,batch_file))))
+ except conf.errors.ConfigurationError:
+ pass
+ except WindowsError:
+ pass
+ for target,arch in all_icl_platforms:
+ try:
+ icl_version=Utils.winreg.OpenKey(all_versions,version+'\\'+target)
+ path,type=Utils.winreg.QueryValueEx(icl_version,'ProductDir')
+ batch_file=os.path.join(path,'bin','iclvars.bat')
+ if os.path.isfile(batch_file):
+ try:
+ targets.append((target,(arch,conf.get_msvc_version('intel',version,target,batch_file))))
+ except conf.errors.ConfigurationError:
+ pass
+ except WindowsError:
+ continue
+ major=version[0:2]
+ versions.append(('intel '+major,targets))
+@conf
+def gather_intel_composer_versions(conf,versions):
+ version_pattern=re.compile('^...?.?\...?.?.?')
+ try:
+ all_versions=Utils.winreg.OpenKey(Utils.winreg.HKEY_LOCAL_MACHINE,'SOFTWARE\\Wow6432node\\Intel\\Suites')
+ except WindowsError:
+ try:
+ all_versions=Utils.winreg.OpenKey(Utils.winreg.HKEY_LOCAL_MACHINE,'SOFTWARE\\Intel\\Suites')
+ except WindowsError:
+ return
+ index=0
+ while 1:
+ try:
+ version=Utils.winreg.EnumKey(all_versions,index)
+ except WindowsError:
+ break
+ index=index+1
+ if not version_pattern.match(version):
+ continue
+ targets=[]
+ for target,arch in all_icl_platforms:
+ try:
+ if target=='intel64':targetDir='EM64T_NATIVE'
+ else:targetDir=target
+ try:
+ defaults=Utils.winreg.OpenKey(all_versions,version+'\\Defaults\\C++\\'+targetDir)
+ except WindowsError:
+ if targetDir=='EM64T_NATIVE':
+ defaults=Utils.winreg.OpenKey(all_versions,version+'\\Defaults\\C++\\EM64T')
+ else:
+ raise WindowsError
+ uid,type=Utils.winreg.QueryValueEx(defaults,'SubKey')
+ Utils.winreg.OpenKey(all_versions,version+'\\'+uid+'\\C++\\'+targetDir)
+ icl_version=Utils.winreg.OpenKey(all_versions,version+'\\'+uid+'\\C++')
+ path,type=Utils.winreg.QueryValueEx(icl_version,'ProductDir')
+ batch_file=os.path.join(path,'bin','iclvars.bat')
+ if os.path.isfile(batch_file):
+ try:
+ targets.append((target,(arch,conf.get_msvc_version('intel',version,target,batch_file))))
+ except conf.errors.ConfigurationError ,e:
+ pass
+ compilervars_warning_attr='_compilervars_warning_key'
+ if version[0:2]=='13'and getattr(conf,compilervars_warning_attr,True):
+ setattr(conf,compilervars_warning_attr,False)
+ patch_url='http://software.intel.com/en-us/forums/topic/328487'
+ compilervars_arch=os.path.join(path,'bin','compilervars_arch.bat')
+ vs_express_path=os.environ['VS110COMNTOOLS']+r'..\IDE\VSWinExpress.exe'
+ dev_env_path=os.environ['VS110COMNTOOLS']+r'..\IDE\devenv.exe'
+ if(r'if exist "%VS110COMNTOOLS%..\IDE\VSWinExpress.exe"'in Utils.readf(compilervars_arch)and not os.path.exists(vs_express_path)and not os.path.exists(dev_env_path)):
+ Logs.warn(('The Intel compilervar_arch.bat only checks for one Visual Studio SKU ''(VSWinExpress.exe) but it does not seem to be installed at %r. ''The intel command line set up will fail to configure unless the file %r''is patched. See: %s')%(vs_express_path,compilervars_arch,patch_url))
+ except WindowsError:
+ pass
+ major=version[0:2]
+ versions.append(('intel '+major,targets))
+@conf
+def get_msvc_versions(conf):
+ if not conf.env['MSVC_INSTALLED_VERSIONS']:
+ lst=[]
+ conf.gather_icl_versions(lst)
+ conf.gather_intel_composer_versions(lst)
+ conf.gather_wsdk_versions(lst)
+ conf.gather_msvc_versions(lst)
+ conf.env['MSVC_INSTALLED_VERSIONS']=lst
+ return conf.env['MSVC_INSTALLED_VERSIONS']
+@conf
+def print_all_msvc_detected(conf):
+ for version,targets in conf.env['MSVC_INSTALLED_VERSIONS']:
+ Logs.info(version)
+ for target,l in targets:
+ Logs.info("\t"+target)
+@conf
+def detect_msvc(conf,arch=False):
+ versions=get_msvc_versions(conf)
+ return setup_msvc(conf,versions,arch)
+@conf
+def find_lt_names_msvc(self,libname,is_static=False):
+ lt_names=['lib%s.la'%libname,'%s.la'%libname,]
+ for path in self.env['LIBPATH']:
+ for la in lt_names:
+ laf=os.path.join(path,la)
+ dll=None
+ if os.path.exists(laf):
+ ltdict=Utils.read_la_file(laf)
+ lt_libdir=None
+ if ltdict.get('libdir',''):
+ lt_libdir=ltdict['libdir']
+ if not is_static and ltdict.get('library_names',''):
+ dllnames=ltdict['library_names'].split()
+ dll=dllnames[0].lower()
+ dll=re.sub('\.dll$','',dll)
+ return(lt_libdir,dll,False)
+ elif ltdict.get('old_library',''):
+ olib=ltdict['old_library']
+ if os.path.exists(os.path.join(path,olib)):
+ return(path,olib,True)
+ elif lt_libdir!=''and os.path.exists(os.path.join(lt_libdir,olib)):
+ return(lt_libdir,olib,True)
+ else:
+ return(None,olib,True)
+ else:
+ raise self.errors.WafError('invalid libtool object file: %s'%laf)
+ return(None,None,None)
+@conf
+def libname_msvc(self,libname,is_static=False):
+ lib=libname.lower()
+ lib=re.sub('\.lib$','',lib)
+ if lib in g_msvc_systemlibs:
+ return lib
+ lib=re.sub('^lib','',lib)
+ if lib=='m':
+ return None
+ (lt_path,lt_libname,lt_static)=self.find_lt_names_msvc(lib,is_static)
+ if lt_path!=None and lt_libname!=None:
+ if lt_static==True:
+ return os.path.join(lt_path,lt_libname)
+ if lt_path!=None:
+ _libpaths=[lt_path]+self.env['LIBPATH']
+ else:
+ _libpaths=self.env['LIBPATH']
+ static_libs=['lib%ss.lib'%lib,'lib%s.lib'%lib,'%ss.lib'%lib,'%s.lib'%lib,]
+ dynamic_libs=['lib%s.dll.lib'%lib,'lib%s.dll.a'%lib,'%s.dll.lib'%lib,'%s.dll.a'%lib,'lib%s_d.lib'%lib,'%s_d.lib'%lib,'%s.lib'%lib,]
+ libnames=static_libs
+ if not is_static:
+ libnames=dynamic_libs+static_libs
+ for path in _libpaths:
+ for libn in libnames:
+ if os.path.exists(os.path.join(path,libn)):
+ debug('msvc: lib found: %s'%os.path.join(path,libn))
+ return re.sub('\.lib$','',libn)
+ self.fatal("The library %r could not be found"%libname)
+ return re.sub('\.lib$','',libname)
+@conf
+def check_lib_msvc(self,libname,is_static=False,uselib_store=None):
+ libn=self.libname_msvc(libname,is_static)
+ if not uselib_store:
+ uselib_store=libname.upper()
+ if False and is_static:
+ self.env['STLIB_'+uselib_store]=[libn]
+ else:
+ self.env['LIB_'+uselib_store]=[libn]
+@conf
+def check_libs_msvc(self,libnames,is_static=False):
+ for libname in Utils.to_list(libnames):
+ self.check_lib_msvc(libname,is_static)
+def configure(conf):
+ conf.autodetect(True)
+ conf.find_msvc()
+ conf.msvc_common_flags()
+ conf.cc_load_tools()
+ conf.cxx_load_tools()
+ conf.cc_add_flags()
+ conf.cxx_add_flags()
+ conf.link_add_flags()
+ conf.visual_studio_add_flags()
+@conf
+def no_autodetect(conf):
+ conf.env.NO_MSVC_DETECT=1
+ configure(conf)
+@conf
+def autodetect(conf,arch=False):
+ v=conf.env
+ if v.NO_MSVC_DETECT:
+ return
+ if arch:
+ compiler,version,path,includes,libdirs,arch=conf.detect_msvc(True)
+ v['DEST_CPU']=arch
+ else:
+ compiler,version,path,includes,libdirs=conf.detect_msvc()
+ v['PATH']=path
+ v['INCLUDES']=includes
+ v['LIBPATH']=libdirs
+ v['MSVC_COMPILER']=compiler
+ try:
+ v['MSVC_VERSION']=float(version)
+ except Exception:
+ v['MSVC_VERSION']=float(version[:-3])
+def _get_prog_names(conf,compiler):
+ if compiler=='intel':
+ compiler_name='ICL'
+ linker_name='XILINK'
+ lib_name='XILIB'
+ else:
+ compiler_name='CL'
+ linker_name='LINK'
+ lib_name='LIB'
+ return compiler_name,linker_name,lib_name
+@conf
+def find_msvc(conf):
+ if sys.platform=='cygwin':
+ conf.fatal('MSVC module does not work under cygwin Python!')
+ v=conf.env
+ path=v['PATH']
+ compiler=v['MSVC_COMPILER']
+ version=v['MSVC_VERSION']
+ compiler_name,linker_name,lib_name=_get_prog_names(conf,compiler)
+ v.MSVC_MANIFEST=(compiler=='msvc'and version>=8)or(compiler=='wsdk'and version>=6)or(compiler=='intel'and version>=11)
+ cxx=None
+ if v['CXX']:cxx=v['CXX']
+ elif'CXX'in conf.environ:cxx=conf.environ['CXX']
+ cxx=conf.find_program(compiler_name,var='CXX',path_list=path)
+ cxx=conf.cmd_to_list(cxx)
+ env=dict(conf.environ)
+ if path:env.update(PATH=';'.join(path))
+ if not conf.cmd_and_log(cxx+['/nologo','/help'],env=env):
+ conf.fatal('the msvc compiler could not be identified')
+ v['CC']=v['CXX']=cxx
+ v['CC_NAME']=v['CXX_NAME']='msvc'
+ if not v['LINK_CXX']:
+ link=conf.find_program(linker_name,path_list=path)
+ if link:v['LINK_CXX']=link
+ else:conf.fatal('%s was not found (linker)'%linker_name)
+ v['LINK']=link
+ if not v['LINK_CC']:
+ v['LINK_CC']=v['LINK_CXX']
+ if not v['AR']:
+ stliblink=conf.find_program(lib_name,path_list=path,var='AR')
+ if not stliblink:return
+ v['ARFLAGS']=['/NOLOGO']
+ if v.MSVC_MANIFEST:
+ conf.find_program('MT',path_list=path,var='MT')
+ v['MTFLAGS']=['/NOLOGO']
+ conf.load('winres')
+ if not conf.env['WINRC']:
+ warn('Resource compiler not found. Compiling resource file is disabled')
+@conf
+def visual_studio_add_flags(self):
+ v=self.env
+ try:v.prepend_value('INCLUDES',[x for x in self.environ['INCLUDE'].split(';')if x])
+ except Exception:pass
+ try:v.prepend_value('LIBPATH',[x for x in self.environ['LIB'].split(';')if x])
+ except Exception:pass
+@conf
+def msvc_common_flags(conf):
+ v=conf.env
+ v['DEST_BINFMT']='pe'
+ v.append_value('CFLAGS',['/nologo'])
+ v.append_value('CXXFLAGS',['/nologo'])
+ v['DEFINES_ST']='/D%s'
+ v['CC_SRC_F']=''
+ v['CC_TGT_F']=['/c','/Fo']
+ if v['MSVC_VERSION']>=8:
+ v['CC_TGT_F']=['/FC']+v['CC_TGT_F']
+ v['CXX_SRC_F']=''
+ v['CXX_TGT_F']=['/c','/Fo']
+ if v['MSVC_VERSION']>=8:
+ v['CXX_TGT_F']=['/FC']+v['CXX_TGT_F']
+ v['CPPPATH_ST']='/I%s'
+ v['AR_TGT_F']=v['CCLNK_TGT_F']=v['CXXLNK_TGT_F']='/OUT:'
+ v['CFLAGS_CONSOLE']=v['CXXFLAGS_CONSOLE']=['/SUBSYSTEM:CONSOLE']
+ v['CFLAGS_NATIVE']=v['CXXFLAGS_NATIVE']=['/SUBSYSTEM:NATIVE']
+ v['CFLAGS_POSIX']=v['CXXFLAGS_POSIX']=['/SUBSYSTEM:POSIX']
+ v['CFLAGS_WINDOWS']=v['CXXFLAGS_WINDOWS']=['/SUBSYSTEM:WINDOWS']
+ v['CFLAGS_WINDOWSCE']=v['CXXFLAGS_WINDOWSCE']=['/SUBSYSTEM:WINDOWSCE']
+ v['CFLAGS_CRT_MULTITHREADED']=v['CXXFLAGS_CRT_MULTITHREADED']=['/MT']
+ v['CFLAGS_CRT_MULTITHREADED_DLL']=v['CXXFLAGS_CRT_MULTITHREADED_DLL']=['/MD']
+ v['CFLAGS_CRT_MULTITHREADED_DBG']=v['CXXFLAGS_CRT_MULTITHREADED_DBG']=['/MTd']
+ v['CFLAGS_CRT_MULTITHREADED_DLL_DBG']=v['CXXFLAGS_CRT_MULTITHREADED_DLL_DBG']=['/MDd']
+ v['LIB_ST']='%s.lib'
+ v['LIBPATH_ST']='/LIBPATH:%s'
+ v['STLIB_ST']='%s.lib'
+ v['STLIBPATH_ST']='/LIBPATH:%s'
+ v.append_value('LINKFLAGS',['/NOLOGO'])
+ if v['MSVC_MANIFEST']:
+ v.append_value('LINKFLAGS',['/MANIFEST'])
+ v['CFLAGS_cshlib']=[]
+ v['CXXFLAGS_cxxshlib']=[]
+ v['LINKFLAGS_cshlib']=v['LINKFLAGS_cxxshlib']=['/DLL']
+ v['cshlib_PATTERN']=v['cxxshlib_PATTERN']='%s.dll'
+ v['implib_PATTERN']='%s.lib'
+ v['IMPLIB_ST']='/IMPLIB:%s'
+ v['LINKFLAGS_cstlib']=[]
+ v['cstlib_PATTERN']=v['cxxstlib_PATTERN']='%s.lib'
+ v['cprogram_PATTERN']=v['cxxprogram_PATTERN']='%s.exe'
+@after_method('apply_link')
+@feature('c','cxx')
+def apply_flags_msvc(self):
+ if self.env.CC_NAME!='msvc'or not getattr(self,'link_task',None):
+ return
+ is_static=isinstance(self.link_task,ccroot.stlink_task)
+ subsystem=getattr(self,'subsystem','')
+ if subsystem:
+ subsystem='/subsystem:%s'%subsystem
+ flags=is_static and'ARFLAGS'or'LINKFLAGS'
+ self.env.append_value(flags,subsystem)
+ if not is_static:
+ for f in self.env.LINKFLAGS:
+ d=f.lower()
+ if d[1:]=='debug':
+ pdbnode=self.link_task.outputs[0].change_ext('.pdb')
+ self.link_task.outputs.append(pdbnode)
+ try:
+ self.install_task.source.append(pdbnode)
+ except AttributeError:
+ pass
+ break
+@feature('cprogram','cshlib','cxxprogram','cxxshlib')
+@after_method('apply_link')
+def apply_manifest(self):
+ if self.env.CC_NAME=='msvc'and self.env.MSVC_MANIFEST and getattr(self,'link_task',None):
+ out_node=self.link_task.outputs[0]
+ man_node=out_node.parent.find_or_declare(out_node.name+'.manifest')
+ self.link_task.outputs.append(man_node)
+ self.link_task.do_manifest=True
+def exec_mf(self):
+ env=self.env
+ mtool=env['MT']
+ if not mtool:
+ return 0
+ self.do_manifest=False
+ outfile=self.outputs[0].abspath()
+ manifest=None
+ for out_node in self.outputs:
+ if out_node.name.endswith('.manifest'):
+ manifest=out_node.abspath()
+ break
+ if manifest is None:
+ return 0
+ mode=''
+ if'cprogram'in self.generator.features or'cxxprogram'in self.generator.features:
+ mode='1'
+ elif'cshlib'in self.generator.features or'cxxshlib'in self.generator.features:
+ mode='2'
+ debug('msvc: embedding manifest in mode %r'%mode)
+ lst=[]
+ lst.append(env['MT'])
+ lst.extend(Utils.to_list(env['MTFLAGS']))
+ lst.extend(['-manifest',manifest])
+ lst.append('-outputresource:%s;%s'%(outfile,mode))
+ lst=[lst]
+ return self.exec_command(*lst)
+def quote_response_command(self,flag):
+ if flag.find(' ')>-1:
+ for x in('/LIBPATH:','/IMPLIB:','/OUT:','/I'):
+ if flag.startswith(x):
+ flag='%s"%s"'%(x,flag[len(x):])
+ break
+ else:
+ flag='"%s"'%flag
+ return flag
+def exec_response_command(self,cmd,**kw):
+ try:
+ tmp=None
+ if sys.platform.startswith('win')and isinstance(cmd,list)and len(' '.join(cmd))>=8192:
+ program=cmd[0]
+ cmd=[self.quote_response_command(x)for x in cmd]
+ (fd,tmp)=tempfile.mkstemp()
+ os.write(fd,'\r\n'.join(i.replace('\\','\\\\')for i in cmd[1:]))
+ os.close(fd)
+ cmd=[program,'@'+tmp]
+ ret=self.generator.bld.exec_command(cmd,**kw)
+ finally:
+ if tmp:
+ try:
+ os.remove(tmp)
+ except OSError:
+ pass
+ return ret
+def exec_command_msvc(self,*k,**kw):
+ assert self.env['CC_NAME']=='msvc'
+ if isinstance(k[0],list):
+ lst=[]
+ carry=''
+ for a in k[0]:
+ if a=='/Fo'or a=='/doc'or a[-1]==':':
+ carry=a
+ else:
+ lst.append(carry+a)
+ carry=''
+ k=[lst]
+ if self.env['PATH']:
+ env=dict(self.env.env or os.environ)
+ env.update(PATH=';'.join(self.env['PATH']))
+ kw['env']=env
+ bld=self.generator.bld
+ try:
+ if not kw.get('cwd',None):
+ kw['cwd']=bld.cwd
+ except AttributeError:
+ bld.cwd=kw['cwd']=bld.variant_dir
+ ret=self.exec_response_command(k[0],**kw)
+ if not ret and getattr(self,'do_manifest',None):
+ ret=self.exec_mf()
+ return ret
+def wrap_class(class_name):
+ cls=Task.classes.get(class_name,None)
+ if not cls:
+ return None
+ derived_class=type(class_name,(cls,),{})
+ def exec_command(self,*k,**kw):
+ if self.env['CC_NAME']=='msvc':
+ return self.exec_command_msvc(*k,**kw)
+ else:
+ return super(derived_class,self).exec_command(*k,**kw)
+ derived_class.exec_command=exec_command
+ derived_class.exec_response_command=exec_response_command
+ derived_class.quote_response_command=quote_response_command
+ derived_class.exec_command_msvc=exec_command_msvc
+ derived_class.exec_mf=exec_mf
+ return derived_class
+for k in'c cxx cprogram cxxprogram cshlib cxxshlib cstlib cxxstlib'.split():
+ wrap_class(k)
--- /dev/null
+#! /usr/bin/env python
+# encoding: utf-8
+# WARNING! Do not edit! http://waf.googlecode.com/git/docs/wafbook/single.html#_obtaining_the_waf_file
+
+import waflib.Tools.asm
+from waflib.TaskGen import feature
+@feature('asm')
+def apply_nasm_vars(self):
+ self.env.append_value('ASFLAGS',self.to_list(getattr(self,'nasm_flags',[])))
+def configure(conf):
+ nasm=conf.find_program(['nasm','yasm'],var='AS')
+ conf.env.AS_TGT_F=['-o']
+ conf.env.ASLNK_TGT_F=['-o']
+ conf.load('asm')
--- /dev/null
+#! /usr/bin/env python
+# encoding: utf-8
+# WARNING! Do not edit! http://waf.googlecode.com/git/docs/wafbook/single.html#_obtaining_the_waf_file
+
+import os
+from waflib import Task,Options,Utils
+from waflib.Configure import conf
+from waflib.TaskGen import extension,feature,before_method
+@before_method('apply_incpaths','apply_link','propagate_uselib_vars')
+@feature('perlext')
+def init_perlext(self):
+ self.uselib=self.to_list(getattr(self,'uselib',[]))
+ if not'PERLEXT'in self.uselib:self.uselib.append('PERLEXT')
+ self.env['cshlib_PATTERN']=self.env['cxxshlib_PATTERN']=self.env['perlext_PATTERN']
+@extension('.xs')
+def xsubpp_file(self,node):
+ outnode=node.change_ext('.c')
+ self.create_task('xsubpp',node,outnode)
+ self.source.append(outnode)
+class xsubpp(Task.Task):
+ run_str='${PERL} ${XSUBPP} -noprototypes -typemap ${EXTUTILS_TYPEMAP} ${SRC} > ${TGT}'
+ color='BLUE'
+ ext_out=['.h']
+@conf
+def check_perl_version(self,minver=None):
+ res=True
+ if minver:
+ cver='.'.join(map(str,minver))
+ else:
+ cver=''
+ self.start_msg('Checking for minimum perl version %s'%cver)
+ perl=getattr(Options.options,'perlbinary',None)
+ if not perl:
+ perl=self.find_program('perl',var='PERL')
+ if not perl:
+ self.end_msg("Perl not found",color="YELLOW")
+ return False
+ self.env['PERL']=perl
+ version=self.cmd_and_log([perl,"-e",'printf \"%vd\", $^V'])
+ if not version:
+ res=False
+ version="Unknown"
+ elif not minver is None:
+ ver=tuple(map(int,version.split(".")))
+ if ver<minver:
+ res=False
+ self.end_msg(version,color=res and"GREEN"or"YELLOW")
+ return res
+@conf
+def check_perl_module(self,module):
+ cmd=[self.env['PERL'],'-e','use %s'%module]
+ self.start_msg('perl module %s'%module)
+ try:
+ r=self.cmd_and_log(cmd)
+ except Exception:
+ self.end_msg(False)
+ return None
+ self.end_msg(r or True)
+ return r
+@conf
+def check_perl_ext_devel(self):
+ env=self.env
+ perl=env.PERL
+ if not perl:
+ self.fatal('find perl first')
+ def read_out(cmd):
+ return Utils.to_list(self.cmd_and_log(perl+cmd))
+ env['LINKFLAGS_PERLEXT']=read_out(" -MConfig -e'print $Config{lddlflags}'")
+ env['INCLUDES_PERLEXT']=read_out(" -MConfig -e'print \"$Config{archlib}/CORE\"'")
+ env['CFLAGS_PERLEXT']=read_out(" -MConfig -e'print \"$Config{ccflags} $Config{cccdlflags}\"'")
+ env['XSUBPP']=read_out(" -MConfig -e'print \"$Config{privlib}/ExtUtils/xsubpp$Config{exe_ext}\"'")
+ env['EXTUTILS_TYPEMAP']=read_out(" -MConfig -e'print \"$Config{privlib}/ExtUtils/typemap\"'")
+ if not getattr(Options.options,'perlarchdir',None):
+ env['ARCHDIR_PERL']=self.cmd_and_log(perl+" -MConfig -e'print $Config{sitearch}'")
+ else:
+ env['ARCHDIR_PERL']=getattr(Options.options,'perlarchdir')
+ env['perlext_PATTERN']='%s.'+self.cmd_and_log(perl+" -MConfig -e'print $Config{dlext}'")
+def options(opt):
+ opt.add_option('--with-perl-binary',type='string',dest='perlbinary',help='Specify alternate perl binary',default=None)
+ opt.add_option('--with-perl-archdir',type='string',dest='perlarchdir',help='Specify directory where to install arch specific files',default=None)
--- /dev/null
+#! /usr/bin/env python
+# encoding: utf-8
+# WARNING! Do not edit! http://waf.googlecode.com/git/docs/wafbook/single.html#_obtaining_the_waf_file
+
+import os,sys
+from waflib import Utils,Options,Errors,Logs
+from waflib.TaskGen import extension,before_method,after_method,feature
+from waflib.Configure import conf
+FRAG='''
+#include <Python.h>
+#ifdef __cplusplus
+extern "C" {
+#endif
+ void Py_Initialize(void);
+ void Py_Finalize(void);
+#ifdef __cplusplus
+}
+#endif
+int main(int argc, char **argv)
+{
+ (void)argc; (void)argv;
+ Py_Initialize();
+ Py_Finalize();
+ return 0;
+}
+'''
+INST='''
+import sys, py_compile
+py_compile.compile(sys.argv[1], sys.argv[2], sys.argv[3])
+'''
+DISTUTILS_IMP=['from distutils.sysconfig import get_config_var, get_python_lib']
+@extension('.py')
+def process_py(self,node):
+ try:
+ if not self.bld.is_install:
+ return
+ except AttributeError:
+ return
+ try:
+ if not self.install_path:
+ return
+ except AttributeError:
+ self.install_path='${PYTHONDIR}'
+ def inst_py(ctx):
+ install_from=getattr(self,'install_from',None)
+ if install_from:
+ install_from=self.path.find_dir(install_from)
+ install_pyfile(self,node,install_from)
+ self.bld.add_post_fun(inst_py)
+def install_pyfile(self,node,install_from=None):
+ from_node=install_from or node.parent
+ tsk=self.bld.install_as(self.install_path+'/'+node.path_from(from_node),node,postpone=False)
+ path=tsk.get_install_path()
+ if self.bld.is_install<0:
+ Logs.info("+ removing byte compiled python files")
+ for x in'co':
+ try:
+ os.remove(path+x)
+ except OSError:
+ pass
+ if self.bld.is_install>0:
+ try:
+ st1=os.stat(path)
+ except OSError:
+ Logs.error('The python file is missing, this should not happen')
+ for x in['c','o']:
+ do_inst=self.env['PY'+x.upper()]
+ try:
+ st2=os.stat(path+x)
+ except OSError:
+ pass
+ else:
+ if st1.st_mtime<=st2.st_mtime:
+ do_inst=False
+ if do_inst:
+ lst=(x=='o')and[self.env['PYFLAGS_OPT']]or[]
+ (a,b,c)=(path,path+x,tsk.get_install_path(destdir=False)+x)
+ argv=self.env['PYTHON']+lst+['-c',INST,a,b,c]
+ Logs.info('+ byte compiling %r'%(path+x))
+ env=self.env.env or None
+ ret=Utils.subprocess.Popen(argv,env=env).wait()
+ if ret:
+ raise Errors.WafError('py%s compilation failed %r'%(x,path))
+@feature('py')
+def feature_py(self):
+ pass
+@feature('pyext')
+@before_method('propagate_uselib_vars','apply_link')
+@after_method('apply_bundle')
+def init_pyext(self):
+ self.uselib=self.to_list(getattr(self,'uselib',[]))
+ if not'PYEXT'in self.uselib:
+ self.uselib.append('PYEXT')
+ self.env.cshlib_PATTERN=self.env.cxxshlib_PATTERN=self.env.macbundle_PATTERN=self.env.pyext_PATTERN
+ self.env.fcshlib_PATTERN=self.env.dshlib_PATTERN=self.env.pyext_PATTERN
+ try:
+ if not self.install_path:
+ return
+ except AttributeError:
+ self.install_path='${PYTHONARCHDIR}'
+@feature('pyext')
+@before_method('apply_link','apply_bundle')
+def set_bundle(self):
+ if Utils.unversioned_sys_platform()=='darwin':
+ self.mac_bundle=True
+@before_method('propagate_uselib_vars')
+@feature('pyembed')
+def init_pyembed(self):
+ self.uselib=self.to_list(getattr(self,'uselib',[]))
+ if not'PYEMBED'in self.uselib:
+ self.uselib.append('PYEMBED')
+@conf
+def get_python_variables(self,variables,imports=None):
+ if not imports:
+ try:
+ imports=self.python_imports
+ except AttributeError:
+ imports=DISTUTILS_IMP
+ program=list(imports)
+ program.append('')
+ for v in variables:
+ program.append("print(repr(%s))"%v)
+ os_env=dict(os.environ)
+ try:
+ del os_env['MACOSX_DEPLOYMENT_TARGET']
+ except KeyError:
+ pass
+ try:
+ out=self.cmd_and_log(self.env.PYTHON+['-c','\n'.join(program)],env=os_env)
+ except Errors.WafError:
+ self.fatal('The distutils module is unusable: install "python-devel"?')
+ self.to_log(out)
+ return_values=[]
+ for s in out.split('\n'):
+ s=s.strip()
+ if not s:
+ continue
+ if s=='None':
+ return_values.append(None)
+ elif(s[0]=="'"and s[-1]=="'")or(s[0]=='"'and s[-1]=='"'):
+ return_values.append(eval(s))
+ elif s[0].isdigit():
+ return_values.append(int(s))
+ else:break
+ return return_values
+@conf
+def check_python_headers(conf):
+ env=conf.env
+ if not env['CC_NAME']and not env['CXX_NAME']:
+ conf.fatal('load a compiler first (gcc, g++, ..)')
+ if not env['PYTHON_VERSION']:
+ conf.check_python_version()
+ pybin=conf.env.PYTHON
+ if not pybin:
+ conf.fatal('Could not find the python executable')
+ v='prefix SO LDFLAGS LIBDIR LIBPL INCLUDEPY Py_ENABLE_SHARED MACOSX_DEPLOYMENT_TARGET LDSHARED CFLAGS'.split()
+ try:
+ lst=conf.get_python_variables(["get_config_var('%s') or ''"%x for x in v])
+ except RuntimeError:
+ conf.fatal("Python development headers not found (-v for details).")
+ vals=['%s = %r'%(x,y)for(x,y)in zip(v,lst)]
+ conf.to_log("Configuration returned from %r:\n%r\n"%(pybin,'\n'.join(vals)))
+ dct=dict(zip(v,lst))
+ x='MACOSX_DEPLOYMENT_TARGET'
+ if dct[x]:
+ conf.env[x]=conf.environ[x]=dct[x]
+ env['pyext_PATTERN']='%s'+dct['SO']
+ all_flags=dct['LDFLAGS']+' '+dct['CFLAGS']
+ conf.parse_flags(all_flags,'PYEMBED')
+ all_flags=dct['LDFLAGS']+' '+dct['LDSHARED']+' '+dct['CFLAGS']
+ conf.parse_flags(all_flags,'PYEXT')
+ result=None
+ for name in('python'+env['PYTHON_VERSION'],'python'+env['PYTHON_VERSION'].replace('.','')):
+ if not result and env['LIBPATH_PYEMBED']:
+ path=env['LIBPATH_PYEMBED']
+ conf.to_log("\n\n# Trying default LIBPATH_PYEMBED: %r\n"%path)
+ result=conf.check(lib=name,uselib='PYEMBED',libpath=path,mandatory=False,msg='Checking for library %s in LIBPATH_PYEMBED'%name)
+ if not result and dct['LIBDIR']:
+ path=[dct['LIBDIR']]
+ conf.to_log("\n\n# try again with -L$python_LIBDIR: %r\n"%path)
+ result=conf.check(lib=name,uselib='PYEMBED',libpath=path,mandatory=False,msg='Checking for library %s in LIBDIR'%name)
+ if not result and dct['LIBPL']:
+ path=[dct['LIBPL']]
+ conf.to_log("\n\n# try again with -L$python_LIBPL (some systems don't install the python library in $prefix/lib)\n")
+ result=conf.check(lib=name,uselib='PYEMBED',libpath=path,mandatory=False,msg='Checking for library %s in python_LIBPL'%name)
+ if not result:
+ path=[os.path.join(dct['prefix'],"libs")]
+ conf.to_log("\n\n# try again with -L$prefix/libs, and pythonXY name rather than pythonX.Y (win32)\n")
+ result=conf.check(lib=name,uselib='PYEMBED',libpath=path,mandatory=False,msg='Checking for library %s in $prefix/libs'%name)
+ if result:
+ break
+ if result:
+ env['LIBPATH_PYEMBED']=path
+ env.append_value('LIB_PYEMBED',[name])
+ else:
+ conf.to_log("\n\n### LIB NOT FOUND\n")
+ if(Utils.is_win32 or sys.platform.startswith('os2')or dct['Py_ENABLE_SHARED']):
+ env['LIBPATH_PYEXT']=env['LIBPATH_PYEMBED']
+ env['LIB_PYEXT']=env['LIB_PYEMBED']
+ num='.'.join(env['PYTHON_VERSION'].split('.')[:2])
+ conf.find_program([''.join(pybin)+'-config','python%s-config'%num,'python-config-%s'%num,'python%sm-config'%num],var='PYTHON_CONFIG',mandatory=False)
+ includes=[]
+ if conf.env.PYTHON_CONFIG:
+ for incstr in conf.cmd_and_log([conf.env.PYTHON_CONFIG,'--includes']).strip().split():
+ if(incstr.startswith('-I')or incstr.startswith('/I')):
+ incstr=incstr[2:]
+ if incstr not in includes:
+ includes.append(incstr)
+ conf.to_log("Include path for Python extensions (found via python-config --includes): %r\n"%(includes,))
+ env['INCLUDES_PYEXT']=includes
+ env['INCLUDES_PYEMBED']=includes
+ else:
+ conf.to_log("Include path for Python extensions ""(found via distutils module): %r\n"%(dct['INCLUDEPY'],))
+ env['INCLUDES_PYEXT']=[dct['INCLUDEPY']]
+ env['INCLUDES_PYEMBED']=[dct['INCLUDEPY']]
+ if env['CC_NAME']=='gcc':
+ env.append_value('CFLAGS_PYEMBED',['-fno-strict-aliasing'])
+ env.append_value('CFLAGS_PYEXT',['-fno-strict-aliasing'])
+ if env['CXX_NAME']=='gcc':
+ env.append_value('CXXFLAGS_PYEMBED',['-fno-strict-aliasing'])
+ env.append_value('CXXFLAGS_PYEXT',['-fno-strict-aliasing'])
+ if env.CC_NAME=="msvc":
+ from distutils.msvccompiler import MSVCCompiler
+ dist_compiler=MSVCCompiler()
+ dist_compiler.initialize()
+ env.append_value('CFLAGS_PYEXT',dist_compiler.compile_options)
+ env.append_value('CXXFLAGS_PYEXT',dist_compiler.compile_options)
+ env.append_value('LINKFLAGS_PYEXT',dist_compiler.ldflags_shared)
+ try:
+ conf.check(header_name='Python.h',define_name='HAVE_PYTHON_H',uselib='PYEMBED',fragment=FRAG,errmsg=':-(')
+ except conf.errors.ConfigurationError:
+ xx=conf.env.CXX_NAME and'cxx'or'c'
+ conf.check_cfg(msg='Asking python-config for the flags (pyembed)',path=conf.env.PYTHON_CONFIG,package='',uselib_store='PYEMBED',args=['--cflags','--libs','--ldflags'])
+ conf.check(header_name='Python.h',define_name='HAVE_PYTHON_H',msg='Getting pyembed flags from python-config',fragment=FRAG,errmsg='Could not build a python embedded interpreter',features='%s %sprogram pyembed'%(xx,xx))
+ conf.check_cfg(msg='Asking python-config for the flags (pyext)',path=conf.env.PYTHON_CONFIG,package='',uselib_store='PYEXT',args=['--cflags','--libs','--ldflags'])
+ conf.check(header_name='Python.h',define_name='HAVE_PYTHON_H',msg='Getting pyext flags from python-config',features='%s %sshlib pyext'%(xx,xx),fragment=FRAG,errmsg='Could not build python extensions')
+@conf
+def check_python_version(conf,minver=None):
+ assert minver is None or isinstance(minver,tuple)
+ pybin=conf.env['PYTHON']
+ if not pybin:
+ conf.fatal('could not find the python executable')
+ cmd=pybin+['-c','import sys\nfor x in sys.version_info: print(str(x))']
+ Logs.debug('python: Running python command %r'%cmd)
+ lines=conf.cmd_and_log(cmd).split()
+ assert len(lines)==5,"found %i lines, expected 5: %r"%(len(lines),lines)
+ pyver_tuple=(int(lines[0]),int(lines[1]),int(lines[2]),lines[3],int(lines[4]))
+ result=(minver is None)or(pyver_tuple>=minver)
+ if result:
+ pyver='.'.join([str(x)for x in pyver_tuple[:2]])
+ conf.env['PYTHON_VERSION']=pyver
+ if'PYTHONDIR'in conf.environ:
+ pydir=conf.environ['PYTHONDIR']
+ else:
+ if Utils.is_win32:
+ (python_LIBDEST,pydir)=conf.get_python_variables(["get_config_var('LIBDEST') or ''","get_python_lib(standard_lib=0, prefix=%r) or ''"%conf.env['PREFIX']])
+ else:
+ python_LIBDEST=None
+ (pydir,)=conf.get_python_variables(["get_python_lib(standard_lib=0, prefix=%r) or ''"%conf.env['PREFIX']])
+ if python_LIBDEST is None:
+ if conf.env['LIBDIR']:
+ python_LIBDEST=os.path.join(conf.env['LIBDIR'],"python"+pyver)
+ else:
+ python_LIBDEST=os.path.join(conf.env['PREFIX'],"lib","python"+pyver)
+ if'PYTHONARCHDIR'in conf.environ:
+ pyarchdir=conf.environ['PYTHONARCHDIR']
+ else:
+ (pyarchdir,)=conf.get_python_variables(["get_python_lib(plat_specific=1, standard_lib=0, prefix=%r) or ''"%conf.env['PREFIX']])
+ if not pyarchdir:
+ pyarchdir=pydir
+ if hasattr(conf,'define'):
+ conf.define('PYTHONDIR',pydir)
+ conf.define('PYTHONARCHDIR',pyarchdir)
+ conf.env['PYTHONDIR']=pydir
+ conf.env['PYTHONARCHDIR']=pyarchdir
+ pyver_full='.'.join(map(str,pyver_tuple[:3]))
+ if minver is None:
+ conf.msg('Checking for python version',pyver_full)
+ else:
+ minver_str='.'.join(map(str,minver))
+ conf.msg('Checking for python version',pyver_tuple,">= %s"%(minver_str,)and'GREEN'or'YELLOW')
+ if not result:
+ conf.fatal('The python version is too old, expecting %r'%(minver,))
+PYTHON_MODULE_TEMPLATE='''
+import %s as current_module
+version = getattr(current_module, '__version__', None)
+if version is not None:
+ print(str(version))
+else:
+ print('unknown version')
+'''
+@conf
+def check_python_module(conf,module_name,condition=''):
+ msg='Python module %s'%module_name
+ if condition:
+ msg='%s (%s)'%(msg,condition)
+ conf.start_msg(msg)
+ try:
+ ret=conf.cmd_and_log(conf.env['PYTHON']+['-c',PYTHON_MODULE_TEMPLATE%module_name])
+ except Exception:
+ conf.end_msg(False)
+ conf.fatal('Could not find the python module %r'%module_name)
+ ret=ret.strip()
+ if condition:
+ conf.end_msg(ret)
+ if ret=='unknown version':
+ conf.fatal('Could not check the %s version'%module_name)
+ from distutils.version import LooseVersion
+ def num(*k):
+ if isinstance(k[0],int):
+ return LooseVersion('.'.join([str(x)for x in k]))
+ else:
+ return LooseVersion(k[0])
+ d={'num':num,'ver':LooseVersion(ret)}
+ ev=eval(condition,{},d)
+ if not ev:
+ conf.fatal('The %s version does not satisfy the requirements'%module_name)
+ else:
+ if ret=='unknown version':
+ conf.end_msg(True)
+ else:
+ conf.end_msg(ret)
+def configure(conf):
+ try:
+ conf.find_program('python',var='PYTHON')
+ except conf.errors.ConfigurationError:
+ Logs.warn("could not find a python executable, setting to sys.executable '%s'"%sys.executable)
+ conf.env.PYTHON=sys.executable
+ if conf.env.PYTHON!=sys.executable:
+ Logs.warn("python executable %r differs from system %r"%(conf.env.PYTHON,sys.executable))
+ conf.env.PYTHON=conf.cmd_to_list(conf.env.PYTHON)
+ v=conf.env
+ v['PYCMD']='"import sys, py_compile;py_compile.compile(sys.argv[1], sys.argv[2])"'
+ v['PYFLAGS']=''
+ v['PYFLAGS_OPT']='-O'
+ v['PYC']=getattr(Options.options,'pyc',1)
+ v['PYO']=getattr(Options.options,'pyo',1)
+def options(opt):
+ opt.add_option('--nopyc',action='store_false',default=1,help='Do not install bytecode compiled .pyc files (configuration) [Default:install]',dest='pyc')
+ opt.add_option('--nopyo',action='store_false',default=1,help='Do not install optimised compiled .pyo files (configuration) [Default:install]',dest='pyo')
--- /dev/null
+#! /usr/bin/env python
+# encoding: utf-8
+# WARNING! Do not edit! http://waf.googlecode.com/git/docs/wafbook/single.html#_obtaining_the_waf_file
+
+try:
+ from xml.sax import make_parser
+ from xml.sax.handler import ContentHandler
+except ImportError:
+ has_xml=False
+ ContentHandler=object
+else:
+ has_xml=True
+import os,sys
+from waflib.Tools import c_preproc,cxx
+from waflib import Task,Utils,Options,Errors
+from waflib.TaskGen import feature,after_method,extension
+from waflib.Configure import conf
+from waflib import Logs
+MOC_H=['.h','.hpp','.hxx','.hh']
+EXT_RCC=['.qrc']
+EXT_UI=['.ui']
+EXT_QT4=['.cpp','.cc','.cxx','.C']
+QT4_LIBS="QtCore QtGui QtUiTools QtNetwork QtOpenGL QtSql QtSvg QtTest QtXml QtXmlPatterns QtWebKit Qt3Support QtHelp QtScript QtDeclarative"
+class qxx(cxx.cxx):
+ def __init__(self,*k,**kw):
+ Task.Task.__init__(self,*k,**kw)
+ self.moc_done=0
+ def scan(self):
+ (nodes,names)=c_preproc.scan(self)
+ for x in nodes:
+ if x.name.endswith('.moc'):
+ nodes.remove(x)
+ names.append(x.path_from(self.inputs[0].parent.get_bld()))
+ return(nodes,names)
+ def runnable_status(self):
+ if self.moc_done:
+ return Task.Task.runnable_status(self)
+ else:
+ for t in self.run_after:
+ if not t.hasrun:
+ return Task.ASK_LATER
+ self.add_moc_tasks()
+ return Task.Task.runnable_status(self)
+ def add_moc_tasks(self):
+ node=self.inputs[0]
+ bld=self.generator.bld
+ try:
+ self.signature()
+ except KeyError:
+ pass
+ else:
+ delattr(self,'cache_sig')
+ moctasks=[]
+ mocfiles=[]
+ try:
+ tmp_lst=bld.raw_deps[self.uid()]
+ bld.raw_deps[self.uid()]=[]
+ except KeyError:
+ tmp_lst=[]
+ for d in tmp_lst:
+ if not d.endswith('.moc'):
+ continue
+ if d in mocfiles:
+ Logs.error("paranoia owns")
+ continue
+ mocfiles.append(d)
+ h_node=None
+ try:ext=Options.options.qt_header_ext.split()
+ except AttributeError:pass
+ if not ext:ext=MOC_H
+ base2=d[:-4]
+ for x in[node.parent]+self.generator.includes_nodes:
+ for e in ext:
+ h_node=x.find_node(base2+e)
+ if h_node:
+ break
+ if h_node:
+ m_node=h_node.change_ext('.moc')
+ break
+ else:
+ for k in EXT_QT4:
+ if base2.endswith(k):
+ for x in[node.parent]+self.generator.includes_nodes:
+ h_node=x.find_node(base2)
+ if h_node:
+ break
+ if h_node:
+ m_node=h_node.change_ext(k+'.moc')
+ break
+ if not h_node:
+ raise Errors.WafError('no header found for %r which is a moc file'%d)
+ bld.node_deps[(self.inputs[0].parent.abspath(),m_node.name)]=h_node
+ task=Task.classes['moc'](env=self.env,generator=self.generator)
+ task.set_inputs(h_node)
+ task.set_outputs(m_node)
+ gen=bld.producer
+ gen.outstanding.insert(0,task)
+ gen.total+=1
+ moctasks.append(task)
+ tmp_lst=bld.raw_deps[self.uid()]=mocfiles
+ lst=bld.node_deps.get(self.uid(),())
+ for d in lst:
+ name=d.name
+ if name.endswith('.moc'):
+ task=Task.classes['moc'](env=self.env,generator=self.generator)
+ task.set_inputs(bld.node_deps[(self.inputs[0].parent.abspath(),name)])
+ task.set_outputs(d)
+ gen=bld.producer
+ gen.outstanding.insert(0,task)
+ gen.total+=1
+ moctasks.append(task)
+ self.run_after.update(set(moctasks))
+ self.moc_done=1
+ run=Task.classes['cxx'].__dict__['run']
+class trans_update(Task.Task):
+ run_str='${QT_LUPDATE} ${SRC} -ts ${TGT}'
+ color='BLUE'
+Task.update_outputs(trans_update)
+class XMLHandler(ContentHandler):
+ def __init__(self):
+ self.buf=[]
+ self.files=[]
+ def startElement(self,name,attrs):
+ if name=='file':
+ self.buf=[]
+ def endElement(self,name):
+ if name=='file':
+ self.files.append(str(''.join(self.buf)))
+ def characters(self,cars):
+ self.buf.append(cars)
+@extension(*EXT_RCC)
+def create_rcc_task(self,node):
+ rcnode=node.change_ext('_rc.cpp')
+ rcctask=self.create_task('rcc',node,rcnode)
+ cpptask=self.create_task('cxx',rcnode,rcnode.change_ext('.o'))
+ try:
+ self.compiled_tasks.append(cpptask)
+ except AttributeError:
+ self.compiled_tasks=[cpptask]
+ return cpptask
+@extension(*EXT_UI)
+def create_uic_task(self,node):
+ uictask=self.create_task('ui4',node)
+ uictask.outputs=[self.path.find_or_declare(self.env['ui_PATTERN']%node.name[:-3])]
+@extension('.ts')
+def add_lang(self,node):
+ self.lang=self.to_list(getattr(self,'lang',[]))+[node]
+@feature('qt4')
+@after_method('apply_link')
+def apply_qt4(self):
+ if getattr(self,'lang',None):
+ qmtasks=[]
+ for x in self.to_list(self.lang):
+ if isinstance(x,str):
+ x=self.path.find_resource(x+'.ts')
+ qmtasks.append(self.create_task('ts2qm',x,x.change_ext('.qm')))
+ if getattr(self,'update',None)and Options.options.trans_qt4:
+ cxxnodes=[a.inputs[0]for a in self.compiled_tasks]+[a.inputs[0]for a in self.tasks if getattr(a,'inputs',None)and a.inputs[0].name.endswith('.ui')]
+ for x in qmtasks:
+ self.create_task('trans_update',cxxnodes,x.inputs)
+ if getattr(self,'langname',None):
+ qmnodes=[x.outputs[0]for x in qmtasks]
+ rcnode=self.langname
+ if isinstance(rcnode,str):
+ rcnode=self.path.find_or_declare(rcnode+'.qrc')
+ t=self.create_task('qm2rcc',qmnodes,rcnode)
+ k=create_rcc_task(self,t.outputs[0])
+ self.link_task.inputs.append(k.outputs[0])
+ lst=[]
+ for flag in self.to_list(self.env['CXXFLAGS']):
+ if len(flag)<2:continue
+ f=flag[0:2]
+ if f in['-D','-I','/D','/I']:
+ if(f[0]=='/'):
+ lst.append('-'+flag[1:])
+ else:
+ lst.append(flag)
+ self.env['MOC_FLAGS']=lst
+@extension(*EXT_QT4)
+def cxx_hook(self,node):
+ return self.create_compiled_task('qxx',node)
+class rcc(Task.Task):
+ color='BLUE'
+ run_str='${QT_RCC} -name ${SRC[0].name} ${SRC[0].abspath()} ${RCC_ST} -o ${TGT}'
+ ext_out=['.h']
+ def scan(self):
+ node=self.inputs[0]
+ if not has_xml:
+ Logs.error('no xml support was found, the rcc dependencies will be incomplete!')
+ return([],[])
+ parser=make_parser()
+ curHandler=XMLHandler()
+ parser.setContentHandler(curHandler)
+ fi=open(self.inputs[0].abspath(),'r')
+ try:
+ parser.parse(fi)
+ finally:
+ fi.close()
+ nodes=[]
+ names=[]
+ root=self.inputs[0].parent
+ for x in curHandler.files:
+ nd=root.find_resource(x)
+ if nd:nodes.append(nd)
+ else:names.append(x)
+ return(nodes,names)
+class moc(Task.Task):
+ color='BLUE'
+ run_str='${QT_MOC} ${MOC_FLAGS} ${MOCCPPPATH_ST:INCPATHS} ${MOCDEFINES_ST:DEFINES} ${SRC} ${MOC_ST} ${TGT}'
+class ui4(Task.Task):
+ color='BLUE'
+ run_str='${QT_UIC} ${SRC} -o ${TGT}'
+ ext_out=['.h']
+class ts2qm(Task.Task):
+ color='BLUE'
+ run_str='${QT_LRELEASE} ${QT_LRELEASE_FLAGS} ${SRC} -qm ${TGT}'
+class qm2rcc(Task.Task):
+ color='BLUE'
+ after='ts2qm'
+ def run(self):
+ txt='\n'.join(['<file>%s</file>'%k.path_from(self.outputs[0].parent)for k in self.inputs])
+ code='<!DOCTYPE RCC><RCC version="1.0">\n<qresource>\n%s\n</qresource>\n</RCC>'%txt
+ self.outputs[0].write(code)
+def configure(self):
+ self.find_qt4_binaries()
+ self.set_qt4_libs_to_check()
+ self.find_qt4_libraries()
+ self.add_qt4_rpath()
+ self.simplify_qt4_libs()
+@conf
+def find_qt4_binaries(self):
+ env=self.env
+ opt=Options.options
+ qtdir=getattr(opt,'qtdir','')
+ qtbin=getattr(opt,'qtbin','')
+ paths=[]
+ if qtdir:
+ qtbin=os.path.join(qtdir,'bin')
+ if not qtdir:
+ qtdir=os.environ.get('QT4_ROOT','')
+ qtbin=os.environ.get('QT4_BIN',None)or os.path.join(qtdir,'bin')
+ if qtbin:
+ paths=[qtbin]
+ if not qtdir:
+ paths=os.environ.get('PATH','').split(os.pathsep)
+ paths.append('/usr/share/qt4/bin/')
+ try:
+ lst=Utils.listdir('/usr/local/Trolltech/')
+ except OSError:
+ pass
+ else:
+ if lst:
+ lst.sort()
+ lst.reverse()
+ qtdir='/usr/local/Trolltech/%s/'%lst[0]
+ qtbin=os.path.join(qtdir,'bin')
+ paths.append(qtbin)
+ cand=None
+ prev_ver=['4','0','0']
+ for qmk in['qmake-qt4','qmake4','qmake']:
+ try:
+ qmake=self.find_program(qmk,path_list=paths)
+ except self.errors.ConfigurationError:
+ pass
+ else:
+ try:
+ version=self.cmd_and_log([qmake,'-query','QT_VERSION']).strip()
+ except self.errors.WafError:
+ pass
+ else:
+ if version:
+ new_ver=version.split('.')
+ if new_ver>prev_ver:
+ cand=qmake
+ prev_ver=new_ver
+ if cand:
+ self.env.QMAKE=cand
+ else:
+ self.fatal('Could not find qmake for qt4')
+ qtbin=self.cmd_and_log([self.env.QMAKE,'-query','QT_INSTALL_BINS']).strip()+os.sep
+ def find_bin(lst,var):
+ if var in env:
+ return
+ for f in lst:
+ try:
+ ret=self.find_program(f,path_list=paths)
+ except self.errors.ConfigurationError:
+ pass
+ else:
+ env[var]=ret
+ break
+ find_bin(['uic-qt3','uic3'],'QT_UIC3')
+ find_bin(['uic-qt4','uic'],'QT_UIC')
+ if not env['QT_UIC']:
+ self.fatal('cannot find the uic compiler for qt4')
+ try:
+ uicver=self.cmd_and_log(env['QT_UIC']+" -version 2>&1").strip()
+ except self.errors.ConfigurationError:
+ self.fatal('this uic compiler is for qt3, add uic for qt4 to your path')
+ uicver=uicver.replace('Qt User Interface Compiler ','').replace('User Interface Compiler for Qt','')
+ self.msg('Checking for uic version','%s'%uicver)
+ if uicver.find(' 3.')!=-1:
+ self.fatal('this uic compiler is for qt3, add uic for qt4 to your path')
+ find_bin(['moc-qt4','moc'],'QT_MOC')
+ find_bin(['rcc'],'QT_RCC')
+ find_bin(['lrelease-qt4','lrelease'],'QT_LRELEASE')
+ find_bin(['lupdate-qt4','lupdate'],'QT_LUPDATE')
+ env['UIC3_ST']='%s -o %s'
+ env['UIC_ST']='%s -o %s'
+ env['MOC_ST']='-o'
+ env['ui_PATTERN']='ui_%s.h'
+ env['QT_LRELEASE_FLAGS']=['-silent']
+ env.MOCCPPPATH_ST='-I%s'
+ env.MOCDEFINES_ST='-D%s'
+@conf
+def find_qt4_libraries(self):
+ qtlibs=getattr(Options.options,'qtlibs',None)or os.environ.get("QT4_LIBDIR",None)
+ if not qtlibs:
+ try:
+ qtlibs=self.cmd_and_log([self.env.QMAKE,'-query','QT_INSTALL_LIBS']).strip()
+ except Errors.WafError:
+ qtdir=self.cmd_and_log([self.env.QMAKE,'-query','QT_INSTALL_PREFIX']).strip()+os.sep
+ qtlibs=os.path.join(qtdir,'lib')
+ self.msg('Found the Qt4 libraries in',qtlibs)
+ qtincludes=os.environ.get("QT4_INCLUDES",None)or self.cmd_and_log([self.env.QMAKE,'-query','QT_INSTALL_HEADERS']).strip()
+ env=self.env
+ if not'PKG_CONFIG_PATH'in os.environ:
+ os.environ['PKG_CONFIG_PATH']='%s:%s/pkgconfig:/usr/lib/qt4/lib/pkgconfig:/opt/qt4/lib/pkgconfig:/usr/lib/qt4/lib:/opt/qt4/lib'%(qtlibs,qtlibs)
+ try:
+ if os.environ.get("QT4_XCOMPILE",None):
+ raise self.errors.ConfigurationError()
+ self.check_cfg(atleast_pkgconfig_version='0.1')
+ except self.errors.ConfigurationError:
+ for i in self.qt4_vars:
+ uselib=i.upper()
+ if Utils.unversioned_sys_platform()=="darwin":
+ frameworkName=i+".framework"
+ qtDynamicLib=os.path.join(qtlibs,frameworkName,i)
+ if os.path.exists(qtDynamicLib):
+ env.append_unique('FRAMEWORK_'+uselib,i)
+ self.msg('Checking for %s'%i,qtDynamicLib,'GREEN')
+ else:
+ self.msg('Checking for %s'%i,False,'YELLOW')
+ env.append_unique('INCLUDES_'+uselib,os.path.join(qtlibs,frameworkName,'Headers'))
+ elif env.DEST_OS!="win32":
+ qtDynamicLib=os.path.join(qtlibs,"lib"+i+".so")
+ qtStaticLib=os.path.join(qtlibs,"lib"+i+".a")
+ if os.path.exists(qtDynamicLib):
+ env.append_unique('LIB_'+uselib,i)
+ self.msg('Checking for %s'%i,qtDynamicLib,'GREEN')
+ elif os.path.exists(qtStaticLib):
+ env.append_unique('LIB_'+uselib,i)
+ self.msg('Checking for %s'%i,qtStaticLib,'GREEN')
+ else:
+ self.msg('Checking for %s'%i,False,'YELLOW')
+ env.append_unique('LIBPATH_'+uselib,qtlibs)
+ env.append_unique('INCLUDES_'+uselib,qtincludes)
+ env.append_unique('INCLUDES_'+uselib,os.path.join(qtincludes,i))
+ else:
+ for k in("lib%s.a","lib%s4.a","%s.lib","%s4.lib"):
+ lib=os.path.join(qtlibs,k%i)
+ if os.path.exists(lib):
+ env.append_unique('LIB_'+uselib,i+k[k.find("%s")+2:k.find('.')])
+ self.msg('Checking for %s'%i,lib,'GREEN')
+ break
+ else:
+ self.msg('Checking for %s'%i,False,'YELLOW')
+ env.append_unique('LIBPATH_'+uselib,qtlibs)
+ env.append_unique('INCLUDES_'+uselib,qtincludes)
+ env.append_unique('INCLUDES_'+uselib,os.path.join(qtincludes,i))
+ uselib=i.upper()+"_debug"
+ for k in("lib%sd.a","lib%sd4.a","%sd.lib","%sd4.lib"):
+ lib=os.path.join(qtlibs,k%i)
+ if os.path.exists(lib):
+ env.append_unique('LIB_'+uselib,i+k[k.find("%s")+2:k.find('.')])
+ self.msg('Checking for %s'%i,lib,'GREEN')
+ break
+ else:
+ self.msg('Checking for %s'%i,False,'YELLOW')
+ env.append_unique('LIBPATH_'+uselib,qtlibs)
+ env.append_unique('INCLUDES_'+uselib,qtincludes)
+ env.append_unique('INCLUDES_'+uselib,os.path.join(qtincludes,i))
+ else:
+ for i in self.qt4_vars_debug+self.qt4_vars:
+ self.check_cfg(package=i,args='--cflags --libs',mandatory=False)
+@conf
+def simplify_qt4_libs(self):
+ env=self.env
+ def process_lib(vars_,coreval):
+ for d in vars_:
+ var=d.upper()
+ if var=='QTCORE':
+ continue
+ value=env['LIBPATH_'+var]
+ if value:
+ core=env[coreval]
+ accu=[]
+ for lib in value:
+ if lib in core:
+ continue
+ accu.append(lib)
+ env['LIBPATH_'+var]=accu
+ process_lib(self.qt4_vars,'LIBPATH_QTCORE')
+ process_lib(self.qt4_vars_debug,'LIBPATH_QTCORE_DEBUG')
+@conf
+def add_qt4_rpath(self):
+ env=self.env
+ if Options.options.want_rpath:
+ def process_rpath(vars_,coreval):
+ for d in vars_:
+ var=d.upper()
+ value=env['LIBPATH_'+var]
+ if value:
+ core=env[coreval]
+ accu=[]
+ for lib in value:
+ if var!='QTCORE':
+ if lib in core:
+ continue
+ accu.append('-Wl,--rpath='+lib)
+ env['RPATH_'+var]=accu
+ process_rpath(self.qt4_vars,'LIBPATH_QTCORE')
+ process_rpath(self.qt4_vars_debug,'LIBPATH_QTCORE_DEBUG')
+@conf
+def set_qt4_libs_to_check(self):
+ if not hasattr(self,'qt4_vars'):
+ self.qt4_vars=QT4_LIBS
+ self.qt4_vars=Utils.to_list(self.qt4_vars)
+ if not hasattr(self,'qt4_vars_debug'):
+ self.qt4_vars_debug=[a+'_debug'for a in self.qt4_vars]
+ self.qt4_vars_debug=Utils.to_list(self.qt4_vars_debug)
+def options(opt):
+ opt.add_option('--want-rpath',action='store_true',default=False,dest='want_rpath',help='enable the rpath for qt libraries')
+ opt.add_option('--header-ext',type='string',default='',help='header extension for moc files',dest='qt_header_ext')
+ for i in'qtdir qtbin qtlibs'.split():
+ opt.add_option('--'+i,type='string',default='',dest=i)
+ opt.add_option('--translate',action="store_true",help="collect translation strings",dest="trans_qt4",default=False)
--- /dev/null
+#! /usr/bin/env python
+# encoding: utf-8
+# WARNING! Do not edit! http://waf.googlecode.com/git/docs/wafbook/single.html#_obtaining_the_waf_file
+
+import os
+from waflib import Task,Options,Utils
+from waflib.TaskGen import before_method,feature,after_method,Task,extension
+from waflib.Configure import conf
+@feature('rubyext')
+@before_method('apply_incpaths','apply_lib_vars','apply_bundle','apply_link')
+def init_rubyext(self):
+ self.install_path='${ARCHDIR_RUBY}'
+ self.uselib=self.to_list(getattr(self,'uselib',''))
+ if not'RUBY'in self.uselib:
+ self.uselib.append('RUBY')
+ if not'RUBYEXT'in self.uselib:
+ self.uselib.append('RUBYEXT')
+@feature('rubyext')
+@before_method('apply_link','propagate_uselib')
+def apply_ruby_so_name(self):
+ self.env['cshlib_PATTERN']=self.env['cxxshlib_PATTERN']=self.env['rubyext_PATTERN']
+@conf
+def check_ruby_version(self,minver=()):
+ if Options.options.rubybinary:
+ self.env.RUBY=Options.options.rubybinary
+ else:
+ self.find_program('ruby',var='RUBY')
+ ruby=self.env.RUBY
+ try:
+ version=self.cmd_and_log([ruby,'-e','puts defined?(VERSION) ? VERSION : RUBY_VERSION']).strip()
+ except Exception:
+ self.fatal('could not determine ruby version')
+ self.env.RUBY_VERSION=version
+ try:
+ ver=tuple(map(int,version.split(".")))
+ except Exception:
+ self.fatal('unsupported ruby version %r'%version)
+ cver=''
+ if minver:
+ if ver<minver:
+ self.fatal('ruby is too old %r'%ver)
+ cver='.'.join([str(x)for x in minver])
+ else:
+ cver=ver
+ self.msg('Checking for ruby version %s'%str(minver or''),cver)
+@conf
+def check_ruby_ext_devel(self):
+ if not self.env.RUBY:
+ self.fatal('ruby detection is required first')
+ if not self.env.CC_NAME and not self.env.CXX_NAME:
+ self.fatal('load a c/c++ compiler first')
+ version=tuple(map(int,self.env.RUBY_VERSION.split(".")))
+ def read_out(cmd):
+ return Utils.to_list(self.cmd_and_log([self.env.RUBY,'-rrbconfig','-e',cmd]))
+ def read_config(key):
+ return read_out('puts Config::CONFIG[%r]'%key)
+ ruby=self.env['RUBY']
+ archdir=read_config('archdir')
+ cpppath=archdir
+ if version>=(1,9,0):
+ ruby_hdrdir=read_config('rubyhdrdir')
+ cpppath+=ruby_hdrdir
+ cpppath+=[os.path.join(ruby_hdrdir[0],read_config('arch')[0])]
+ self.check(header_name='ruby.h',includes=cpppath,errmsg='could not find ruby header file')
+ self.env.LIBPATH_RUBYEXT=read_config('libdir')
+ self.env.LIBPATH_RUBYEXT+=archdir
+ self.env.INCLUDES_RUBYEXT=cpppath
+ self.env.CFLAGS_RUBYEXT=read_config('CCDLFLAGS')
+ self.env.rubyext_PATTERN='%s.'+read_config('DLEXT')[0]
+ flags=read_config('LDSHARED')
+ while flags and flags[0][0]!='-':
+ flags=flags[1:]
+ if len(flags)>1 and flags[1]=="ppc":
+ flags=flags[2:]
+ self.env.LINKFLAGS_RUBYEXT=flags
+ self.env.LINKFLAGS_RUBYEXT+=read_config('LIBS')
+ self.env.LINKFLAGS_RUBYEXT+=read_config('LIBRUBYARG_SHARED')
+ if Options.options.rubyarchdir:
+ self.env.ARCHDIR_RUBY=Options.options.rubyarchdir
+ else:
+ self.env.ARCHDIR_RUBY=read_config('sitearchdir')[0]
+ if Options.options.rubylibdir:
+ self.env.LIBDIR_RUBY=Options.options.rubylibdir
+ else:
+ self.env.LIBDIR_RUBY=read_config('sitelibdir')[0]
+@conf
+def check_ruby_module(self,module_name):
+ self.start_msg('Ruby module %s'%module_name)
+ try:
+ self.cmd_and_log([self.env['RUBY'],'-e','require \'%s\';puts 1'%module_name])
+ except Exception:
+ self.end_msg(False)
+ self.fatal('Could not find the ruby module %r'%module_name)
+ self.end_msg(True)
+@extension('.rb')
+def process(self,node):
+ tsk=self.create_task('run_ruby',node)
+class run_ruby(Task.Task):
+ run_str='${RUBY} ${RBFLAGS} -I ${SRC[0].parent.abspath()} ${SRC}'
+def options(opt):
+ opt.add_option('--with-ruby-archdir',type='string',dest='rubyarchdir',help='Specify directory where to install arch specific files')
+ opt.add_option('--with-ruby-libdir',type='string',dest='rubylibdir',help='Specify alternate ruby library path')
+ opt.add_option('--with-ruby-binary',type='string',dest='rubybinary',help='Specify alternate ruby binary')
--- /dev/null
+#! /usr/bin/env python
+# encoding: utf-8
+# WARNING! Do not edit! http://waf.googlecode.com/git/docs/wafbook/single.html#_obtaining_the_waf_file
+
+import os
+from waflib import Utils
+from waflib.Tools import ccroot,ar
+from waflib.Configure import conf
+@conf
+def find_scc(conf):
+ v=conf.env
+ cc=None
+ if v['CC']:cc=v['CC']
+ elif'CC'in conf.environ:cc=conf.environ['CC']
+ if not cc:cc=conf.find_program('cc',var='CC')
+ if not cc:conf.fatal('Could not find a Sun C compiler')
+ cc=conf.cmd_to_list(cc)
+ try:
+ conf.cmd_and_log(cc+['-flags'])
+ except Exception:
+ conf.fatal('%r is not a Sun compiler'%cc)
+ v['CC']=cc
+ v['CC_NAME']='sun'
+@conf
+def scc_common_flags(conf):
+ v=conf.env
+ v['CC_SRC_F']=[]
+ v['CC_TGT_F']=['-c','-o']
+ if not v['LINK_CC']:v['LINK_CC']=v['CC']
+ v['CCLNK_SRC_F']=''
+ v['CCLNK_TGT_F']=['-o']
+ v['CPPPATH_ST']='-I%s'
+ v['DEFINES_ST']='-D%s'
+ v['LIB_ST']='-l%s'
+ v['LIBPATH_ST']='-L%s'
+ v['STLIB_ST']='-l%s'
+ v['STLIBPATH_ST']='-L%s'
+ v['SONAME_ST']='-Wl,-h,%s'
+ v['SHLIB_MARKER']='-Bdynamic'
+ v['STLIB_MARKER']='-Bstatic'
+ v['cprogram_PATTERN']='%s'
+ v['CFLAGS_cshlib']=['-Kpic','-DPIC']
+ v['LINKFLAGS_cshlib']=['-G']
+ v['cshlib_PATTERN']='lib%s.so'
+ v['LINKFLAGS_cstlib']=['-Bstatic']
+ v['cstlib_PATTERN']='lib%s.a'
+def configure(conf):
+ conf.find_scc()
+ conf.find_ar()
+ conf.scc_common_flags()
+ conf.cc_load_tools()
+ conf.cc_add_flags()
+ conf.link_add_flags()
--- /dev/null
+#! /usr/bin/env python
+# encoding: utf-8
+# WARNING! Do not edit! http://waf.googlecode.com/git/docs/wafbook/single.html#_obtaining_the_waf_file
+
+import os
+from waflib import Utils
+from waflib.Tools import ccroot,ar
+from waflib.Configure import conf
+@conf
+def find_sxx(conf):
+ v=conf.env
+ cc=None
+ if v['CXX']:cc=v['CXX']
+ elif'CXX'in conf.environ:cc=conf.environ['CXX']
+ if not cc:cc=conf.find_program('CC',var='CXX')
+ if not cc:cc=conf.find_program('c++',var='CXX')
+ if not cc:conf.fatal('Could not find a Sun C++ compiler')
+ cc=conf.cmd_to_list(cc)
+ try:
+ conf.cmd_and_log(cc+['-flags'])
+ except Exception:
+ conf.fatal('%r is not a Sun compiler'%cc)
+ v['CXX']=cc
+ v['CXX_NAME']='sun'
+@conf
+def sxx_common_flags(conf):
+ v=conf.env
+ v['CXX_SRC_F']=[]
+ v['CXX_TGT_F']=['-c','-o']
+ if not v['LINK_CXX']:v['LINK_CXX']=v['CXX']
+ v['CXXLNK_SRC_F']=[]
+ v['CXXLNK_TGT_F']=['-o']
+ v['CPPPATH_ST']='-I%s'
+ v['DEFINES_ST']='-D%s'
+ v['LIB_ST']='-l%s'
+ v['LIBPATH_ST']='-L%s'
+ v['STLIB_ST']='-l%s'
+ v['STLIBPATH_ST']='-L%s'
+ v['SONAME_ST']='-Wl,-h,%s'
+ v['SHLIB_MARKER']='-Bdynamic'
+ v['STLIB_MARKER']='-Bstatic'
+ v['cxxprogram_PATTERN']='%s'
+ v['CXXFLAGS_cxxshlib']=['-Kpic','-DPIC']
+ v['LINKFLAGS_cxxshlib']=['-G']
+ v['cxxshlib_PATTERN']='lib%s.so'
+ v['LINKFLAGS_cxxstlib']=['-Bstatic']
+ v['cxxstlib_PATTERN']='lib%s.a'
+def configure(conf):
+ conf.find_sxx()
+ conf.find_ar()
+ conf.sxx_common_flags()
+ conf.cxx_load_tools()
+ conf.cxx_add_flags()
+ conf.link_add_flags()
--- /dev/null
+#! /usr/bin/env python
+# encoding: utf-8
+# WARNING! Do not edit! http://waf.googlecode.com/git/docs/wafbook/single.html#_obtaining_the_waf_file
+
+import os,re
+from waflib import Utils,Task,Errors,Logs
+from waflib.TaskGen import feature,before_method
+re_bibunit=re.compile(r'\\(?P<type>putbib)\[(?P<file>[^\[\]]*)\]',re.M)
+def bibunitscan(self):
+ node=self.inputs[0]
+ nodes=[]
+ if not node:return nodes
+ code=node.read()
+ for match in re_bibunit.finditer(code):
+ path=match.group('file')
+ if path:
+ for k in['','.bib']:
+ Logs.debug('tex: trying %s%s'%(path,k))
+ fi=node.parent.find_resource(path+k)
+ if fi:
+ nodes.append(fi)
+ else:
+ Logs.debug('tex: could not find %s'%path)
+ Logs.debug("tex: found the following bibunit files: %s"%nodes)
+ return nodes
+exts_deps_tex=['','.ltx','.tex','.bib','.pdf','.png','.eps','.ps']
+exts_tex=['.ltx','.tex']
+re_tex=re.compile(r'\\(?P<type>include|bibliography|putbib|includegraphics|input|import|bringin|lstinputlisting)(\[[^\[\]]*\])?{(?P<file>[^{}]*)}',re.M)
+g_bibtex_re=re.compile('bibdata',re.M)
+class tex(Task.Task):
+ bibtex_fun,_=Task.compile_fun('${BIBTEX} ${BIBTEXFLAGS} ${SRCFILE}',shell=False)
+ bibtex_fun.__doc__="""
+ Execute the program **bibtex**
+ """
+ makeindex_fun,_=Task.compile_fun('${MAKEINDEX} ${MAKEINDEXFLAGS} ${SRCFILE}',shell=False)
+ makeindex_fun.__doc__="""
+ Execute the program **makeindex**
+ """
+ def exec_command(self,cmd,**kw):
+ bld=self.generator.bld
+ try:
+ if not kw.get('cwd',None):
+ kw['cwd']=bld.cwd
+ except AttributeError:
+ bld.cwd=kw['cwd']=bld.variant_dir
+ return Utils.subprocess.Popen(cmd,**kw).wait()
+ def scan_aux(self,node):
+ nodes=[node]
+ re_aux=re.compile(r'\\@input{(?P<file>[^{}]*)}',re.M)
+ def parse_node(node):
+ code=node.read()
+ for match in re_aux.finditer(code):
+ path=match.group('file')
+ found=node.parent.find_or_declare(path)
+ if found and found not in nodes:
+ Logs.debug('tex: found aux node '+found.abspath())
+ nodes.append(found)
+ parse_node(found)
+ parse_node(node)
+ return nodes
+ def scan(self):
+ node=self.inputs[0]
+ nodes=[]
+ names=[]
+ seen=[]
+ if not node:return(nodes,names)
+ def parse_node(node):
+ if node in seen:
+ return
+ seen.append(node)
+ code=node.read()
+ global re_tex
+ for match in re_tex.finditer(code):
+ for path in match.group('file').split(','):
+ if path:
+ add_name=True
+ found=None
+ for k in exts_deps_tex:
+ Logs.debug('tex: trying %s%s'%(path,k))
+ found=node.parent.find_resource(path+k)
+ if found and not found in self.outputs:
+ nodes.append(found)
+ add_name=False
+ for ext in exts_tex:
+ if found.name.endswith(ext):
+ parse_node(found)
+ break
+ if add_name:
+ names.append(path)
+ parse_node(node)
+ for x in nodes:
+ x.parent.get_bld().mkdir()
+ Logs.debug("tex: found the following : %s and names %s"%(nodes,names))
+ return(nodes,names)
+ def check_status(self,msg,retcode):
+ if retcode!=0:
+ raise Errors.WafError("%r command exit status %r"%(msg,retcode))
+ def bibfile(self):
+ need_bibtex=False
+ try:
+ for aux_node in self.aux_nodes:
+ ct=aux_node.read()
+ if g_bibtex_re.findall(ct):
+ need_bibtex=True
+ break
+ except(OSError,IOError):
+ Logs.error('error bibtex scan')
+ else:
+ if need_bibtex:
+ Logs.warn('calling bibtex')
+ self.env.env={}
+ self.env.env.update(os.environ)
+ self.env.env.update({'BIBINPUTS':self.TEXINPUTS,'BSTINPUTS':self.TEXINPUTS})
+ self.env.SRCFILE=self.aux_nodes[0].name[:-4]
+ self.check_status('error when calling bibtex',self.bibtex_fun())
+ def bibunits(self):
+ try:
+ bibunits=bibunitscan(self)
+ except OSError:
+ Logs.error('error bibunitscan')
+ else:
+ if bibunits:
+ fn=['bu'+str(i)for i in xrange(1,len(bibunits)+1)]
+ if fn:
+ Logs.warn('calling bibtex on bibunits')
+ for f in fn:
+ self.env.env={'BIBINPUTS':self.TEXINPUTS,'BSTINPUTS':self.TEXINPUTS}
+ self.env.SRCFILE=f
+ self.check_status('error when calling bibtex',self.bibtex_fun())
+ def makeindex(self):
+ try:
+ idx_path=self.idx_node.abspath()
+ os.stat(idx_path)
+ except OSError:
+ Logs.warn('index file %s absent, not calling makeindex'%idx_path)
+ else:
+ Logs.warn('calling makeindex')
+ self.env.SRCFILE=self.idx_node.name
+ self.env.env={}
+ self.check_status('error when calling makeindex %s'%idx_path,self.makeindex_fun())
+ def run(self):
+ env=self.env
+ if not env['PROMPT_LATEX']:
+ env.append_value('LATEXFLAGS','-interaction=batchmode')
+ env.append_value('PDFLATEXFLAGS','-interaction=batchmode')
+ env.append_value('XELATEXFLAGS','-interaction=batchmode')
+ fun=self.texfun
+ node=self.inputs[0]
+ srcfile=node.abspath()
+ texinputs=self.env.TEXINPUTS or''
+ self.TEXINPUTS=node.parent.get_bld().abspath()+os.pathsep+node.parent.get_src().abspath()+os.pathsep+texinputs+os.pathsep
+ self.cwd=self.inputs[0].parent.get_bld().abspath()
+ Logs.warn('first pass on %s'%self.__class__.__name__)
+ self.env.env={}
+ self.env.env.update(os.environ)
+ self.env.env.update({'TEXINPUTS':self.TEXINPUTS})
+ self.env.SRCFILE=srcfile
+ self.check_status('error when calling latex',fun())
+ self.aux_nodes=self.scan_aux(node.change_ext('.aux'))
+ self.idx_node=node.change_ext('.idx')
+ self.bibfile()
+ self.bibunits()
+ self.makeindex()
+ hash=''
+ for i in range(10):
+ prev_hash=hash
+ try:
+ hashes=[Utils.h_file(x.abspath())for x in self.aux_nodes]
+ hash=Utils.h_list(hashes)
+ except(OSError,IOError):
+ Logs.error('could not read aux.h')
+ pass
+ if hash and hash==prev_hash:
+ break
+ Logs.warn('calling %s'%self.__class__.__name__)
+ self.env.env={}
+ self.env.env.update(os.environ)
+ self.env.env.update({'TEXINPUTS':self.TEXINPUTS})
+ self.env.SRCFILE=srcfile
+ self.check_status('error when calling %s'%self.__class__.__name__,fun())
+class latex(tex):
+ texfun,vars=Task.compile_fun('${LATEX} ${LATEXFLAGS} ${SRCFILE}',shell=False)
+class pdflatex(tex):
+ texfun,vars=Task.compile_fun('${PDFLATEX} ${PDFLATEXFLAGS} ${SRCFILE}',shell=False)
+class xelatex(tex):
+ texfun,vars=Task.compile_fun('${XELATEX} ${XELATEXFLAGS} ${SRCFILE}',shell=False)
+class dvips(Task.Task):
+ run_str='${DVIPS} ${DVIPSFLAGS} ${SRC} -o ${TGT}'
+ color='BLUE'
+ after=['latex','pdflatex','xelatex']
+class dvipdf(Task.Task):
+ run_str='${DVIPDF} ${DVIPDFFLAGS} ${SRC} ${TGT}'
+ color='BLUE'
+ after=['latex','pdflatex','xelatex']
+class pdf2ps(Task.Task):
+ run_str='${PDF2PS} ${PDF2PSFLAGS} ${SRC} ${TGT}'
+ color='BLUE'
+ after=['latex','pdflatex','xelatex']
+@feature('tex')
+@before_method('process_source')
+def apply_tex(self):
+ if not getattr(self,'type',None)in['latex','pdflatex','xelatex']:
+ self.type='pdflatex'
+ tree=self.bld
+ outs=Utils.to_list(getattr(self,'outs',[]))
+ self.env['PROMPT_LATEX']=getattr(self,'prompt',1)
+ deps_lst=[]
+ if getattr(self,'deps',None):
+ deps=self.to_list(self.deps)
+ for filename in deps:
+ n=self.path.find_resource(filename)
+ if not n:
+ self.bld.fatal('Could not find %r for %r'%(filename,self))
+ if not n in deps_lst:
+ deps_lst.append(n)
+ for node in self.to_nodes(self.source):
+ if self.type=='latex':
+ task=self.create_task('latex',node,node.change_ext('.dvi'))
+ elif self.type=='pdflatex':
+ task=self.create_task('pdflatex',node,node.change_ext('.pdf'))
+ elif self.type=='xelatex':
+ task=self.create_task('xelatex',node,node.change_ext('.pdf'))
+ task.env=self.env
+ if deps_lst:
+ try:
+ lst=tree.node_deps[task.uid()]
+ for n in deps_lst:
+ if not n in lst:
+ lst.append(n)
+ except KeyError:
+ tree.node_deps[task.uid()]=deps_lst
+ if self.type=='latex':
+ if'ps'in outs:
+ tsk=self.create_task('dvips',task.outputs,node.change_ext('.ps'))
+ tsk.env.env={'TEXINPUTS':node.parent.abspath()+os.pathsep+self.path.abspath()+os.pathsep+self.path.get_bld().abspath()}
+ if'pdf'in outs:
+ tsk=self.create_task('dvipdf',task.outputs,node.change_ext('.pdf'))
+ tsk.env.env={'TEXINPUTS':node.parent.abspath()+os.pathsep+self.path.abspath()+os.pathsep+self.path.get_bld().abspath()}
+ elif self.type=='pdflatex':
+ if'ps'in outs:
+ self.create_task('pdf2ps',task.outputs,node.change_ext('.ps'))
+ self.source=[]
+def configure(self):
+ v=self.env
+ for p in'tex latex pdflatex xelatex bibtex dvips dvipdf ps2pdf makeindex pdf2ps'.split():
+ try:
+ self.find_program(p,var=p.upper())
+ except self.errors.ConfigurationError:
+ pass
+ v['DVIPSFLAGS']='-Ppdf'
--- /dev/null
+#! /usr/bin/env python
+# encoding: utf-8
+# WARNING! Do not edit! http://waf.googlecode.com/git/docs/wafbook/single.html#_obtaining_the_waf_file
+
+import os.path,shutil,re
+from waflib import Context,Task,Utils,Logs,Options,Errors
+from waflib.TaskGen import extension,taskgen_method
+from waflib.Configure import conf
+class valac(Task.Task):
+ vars=["VALAC","VALAC_VERSION","VALAFLAGS"]
+ ext_out=['.h']
+ def run(self):
+ cmd=[self.env['VALAC']]+self.env['VALAFLAGS']
+ cmd.extend([a.abspath()for a in self.inputs])
+ ret=self.exec_command(cmd,cwd=self.outputs[0].parent.abspath())
+ if ret:
+ return ret
+ for x in self.outputs:
+ if id(x.parent)!=id(self.outputs[0].parent):
+ shutil.move(self.outputs[0].parent.abspath()+os.sep+x.name,x.abspath())
+ if self.generator.dump_deps_node:
+ self.generator.dump_deps_node.write('\n'.join(self.generator.packages))
+ return ret
+valac=Task.update_outputs(valac)
+@taskgen_method
+def init_vala_task(self):
+ self.profile=getattr(self,'profile','gobject')
+ if self.profile=='gobject':
+ self.uselib=Utils.to_list(getattr(self,'uselib',[]))
+ if not'GOBJECT'in self.uselib:
+ self.uselib.append('GOBJECT')
+ def addflags(flags):
+ self.env.append_value('VALAFLAGS',flags)
+ if self.profile:
+ addflags('--profile=%s'%self.profile)
+ if hasattr(self,'threading'):
+ if self.profile=='gobject':
+ if not'GTHREAD'in self.uselib:
+ self.uselib.append('GTHREAD')
+ else:
+ Logs.warn("Profile %s means no threading support"%self.profile)
+ self.threading=False
+ if self.threading:
+ addflags('--threading')
+ valatask=self.valatask
+ self.is_lib='cprogram'not in self.features
+ if self.is_lib:
+ addflags('--library=%s'%self.target)
+ h_node=self.path.find_or_declare('%s.h'%self.target)
+ valatask.outputs.append(h_node)
+ addflags('--header=%s'%h_node.name)
+ valatask.outputs.append(self.path.find_or_declare('%s.vapi'%self.target))
+ if getattr(self,'gir',None):
+ gir_node=self.path.find_or_declare('%s.gir'%self.gir)
+ addflags('--gir=%s'%gir_node.name)
+ valatask.outputs.append(gir_node)
+ self.vala_target_glib=getattr(self,'vala_target_glib',getattr(Options.options,'vala_target_glib',None))
+ if self.vala_target_glib:
+ addflags('--target-glib=%s'%self.vala_target_glib)
+ addflags(['--define=%s'%x for x in getattr(self,'vala_defines',[])])
+ packages_private=Utils.to_list(getattr(self,'packages_private',[]))
+ addflags(['--pkg=%s'%x for x in packages_private])
+ def _get_api_version():
+ api_version='1.0'
+ if hasattr(Context.g_module,'API_VERSION'):
+ version=Context.g_module.API_VERSION.split(".")
+ if version[0]=="0":
+ api_version="0."+version[1]
+ else:
+ api_version=version[0]+".0"
+ return api_version
+ self.includes=Utils.to_list(getattr(self,'includes',[]))
+ self.uselib=self.to_list(getattr(self,'uselib',[]))
+ valatask.install_path=getattr(self,'install_path','')
+ valatask.vapi_path=getattr(self,'vapi_path','${DATAROOTDIR}/vala/vapi')
+ valatask.pkg_name=getattr(self,'pkg_name',self.env['PACKAGE'])
+ valatask.header_path=getattr(self,'header_path','${INCLUDEDIR}/%s-%s'%(valatask.pkg_name,_get_api_version()))
+ valatask.install_binding=getattr(self,'install_binding',True)
+ self.packages=packages=Utils.to_list(getattr(self,'packages',[]))
+ self.vapi_dirs=vapi_dirs=Utils.to_list(getattr(self,'vapi_dirs',[]))
+ includes=[]
+ if hasattr(self,'use'):
+ local_packages=Utils.to_list(self.use)[:]
+ seen=[]
+ while len(local_packages)>0:
+ package=local_packages.pop()
+ if package in seen:
+ continue
+ seen.append(package)
+ try:
+ package_obj=self.bld.get_tgen_by_name(package)
+ except Errors.WafError:
+ continue
+ package_name=package_obj.target
+ package_node=package_obj.path
+ package_dir=package_node.path_from(self.path)
+ for task in package_obj.tasks:
+ for output in task.outputs:
+ if output.name==package_name+".vapi":
+ valatask.set_run_after(task)
+ if package_name not in packages:
+ packages.append(package_name)
+ if package_dir not in vapi_dirs:
+ vapi_dirs.append(package_dir)
+ if package_dir not in includes:
+ includes.append(package_dir)
+ if hasattr(package_obj,'use'):
+ lst=self.to_list(package_obj.use)
+ lst.reverse()
+ local_packages=[pkg for pkg in lst if pkg not in seen]+local_packages
+ addflags(['--pkg=%s'%p for p in packages])
+ for vapi_dir in vapi_dirs:
+ v_node=self.path.find_dir(vapi_dir)
+ if not v_node:
+ Logs.warn('Unable to locate Vala API directory: %r'%vapi_dir)
+ else:
+ addflags('--vapidir=%s'%v_node.abspath())
+ addflags('--vapidir=%s'%v_node.get_bld().abspath())
+ self.dump_deps_node=None
+ if self.is_lib and self.packages:
+ self.dump_deps_node=self.path.find_or_declare('%s.deps'%self.target)
+ valatask.outputs.append(self.dump_deps_node)
+ self.includes.append(self.bld.srcnode.abspath())
+ self.includes.append(self.bld.bldnode.abspath())
+ for include in includes:
+ try:
+ self.includes.append(self.path.find_dir(include).abspath())
+ self.includes.append(self.path.find_dir(include).get_bld().abspath())
+ except AttributeError:
+ Logs.warn("Unable to locate include directory: '%s'"%include)
+ if self.is_lib and valatask.install_binding:
+ headers_list=[o for o in valatask.outputs if o.suffix()==".h"]
+ try:
+ self.install_vheader.source=headers_list
+ except AttributeError:
+ self.install_vheader=self.bld.install_files(valatask.header_path,headers_list,self.env)
+ vapi_list=[o for o in valatask.outputs if(o.suffix()in(".vapi",".deps"))]
+ try:
+ self.install_vapi.source=vapi_list
+ except AttributeError:
+ self.install_vapi=self.bld.install_files(valatask.vapi_path,vapi_list,self.env)
+ gir_list=[o for o in valatask.outputs if o.suffix()=='.gir']
+ try:
+ self.install_gir.source=gir_list
+ except AttributeError:
+ self.install_gir=self.bld.install_files(getattr(self,'gir_path','${DATAROOTDIR}/gir-1.0'),gir_list,self.env)
+@extension('.vala','.gs')
+def vala_file(self,node):
+ try:
+ valatask=self.valatask
+ except AttributeError:
+ valatask=self.valatask=self.create_task('valac')
+ self.init_vala_task()
+ valatask.inputs.append(node)
+ c_node=node.change_ext('.c')
+ valatask.outputs.append(c_node)
+ self.source.append(c_node)
+@conf
+def find_valac(self,valac_name,min_version):
+ valac=self.find_program(valac_name,var='VALAC')
+ try:
+ output=self.cmd_and_log(valac+' --version')
+ except Exception:
+ valac_version=None
+ else:
+ ver=re.search(r'\d+.\d+.\d+',output).group(0).split('.')
+ valac_version=tuple([int(x)for x in ver])
+ self.msg('Checking for %s version >= %r'%(valac_name,min_version),valac_version,valac_version and valac_version>=min_version)
+ if valac and valac_version<min_version:
+ self.fatal("%s version %r is too old, need >= %r"%(valac_name,valac_version,min_version))
+ self.env['VALAC_VERSION']=valac_version
+ return valac
+@conf
+def check_vala(self,min_version=(0,8,0),branch=None):
+ if not branch:
+ branch=min_version[:2]
+ try:
+ find_valac(self,'valac-%d.%d'%(branch[0],branch[1]),min_version)
+ except self.errors.ConfigurationError:
+ find_valac(self,'valac',min_version)
+@conf
+def check_vala_deps(self):
+ if not self.env['HAVE_GOBJECT']:
+ pkg_args={'package':'gobject-2.0','uselib_store':'GOBJECT','args':'--cflags --libs'}
+ if getattr(Options.options,'vala_target_glib',None):
+ pkg_args['atleast_version']=Options.options.vala_target_glib
+ self.check_cfg(**pkg_args)
+ if not self.env['HAVE_GTHREAD']:
+ pkg_args={'package':'gthread-2.0','uselib_store':'GTHREAD','args':'--cflags --libs'}
+ if getattr(Options.options,'vala_target_glib',None):
+ pkg_args['atleast_version']=Options.options.vala_target_glib
+ self.check_cfg(**pkg_args)
+def configure(self):
+ self.load('gnu_dirs')
+ self.check_vala_deps()
+ self.check_vala()
+ self.env.VALAFLAGS=['-C','--quiet']
+def options(opt):
+ opt.load('gnu_dirs')
+ valaopts=opt.add_option_group('Vala Compiler Options')
+ valaopts.add_option('--vala-target-glib',default=None,dest='vala_target_glib',metavar='MAJOR.MINOR',help='Target version of glib for Vala GObject code generation')
--- /dev/null
+#! /usr/bin/env python
+# encoding: utf-8
+# WARNING! Do not edit! http://waf.googlecode.com/git/docs/wafbook/single.html#_obtaining_the_waf_file
+
+import os,sys
+from waflib.TaskGen import feature,after_method
+from waflib import Utils,Task,Logs,Options
+testlock=Utils.threading.Lock()
+@feature('test')
+@after_method('apply_link')
+def make_test(self):
+ if getattr(self,'link_task',None):
+ self.create_task('utest',self.link_task.outputs)
+class utest(Task.Task):
+ color='PINK'
+ after=['vnum','inst']
+ vars=[]
+ def runnable_status(self):
+ if getattr(Options.options,'no_tests',False):
+ return Task.SKIP_ME
+ ret=super(utest,self).runnable_status()
+ if ret==Task.SKIP_ME:
+ if getattr(Options.options,'all_tests',False):
+ return Task.RUN_ME
+ return ret
+ def run(self):
+ filename=self.inputs[0].abspath()
+ self.ut_exec=getattr(self.generator,'ut_exec',[filename])
+ if getattr(self.generator,'ut_fun',None):
+ self.generator.ut_fun(self)
+ try:
+ fu=getattr(self.generator.bld,'all_test_paths')
+ except AttributeError:
+ fu=os.environ.copy()
+ lst=[]
+ for g in self.generator.bld.groups:
+ for tg in g:
+ if getattr(tg,'link_task',None):
+ lst.append(tg.link_task.outputs[0].parent.abspath())
+ def add_path(dct,path,var):
+ dct[var]=os.pathsep.join(Utils.to_list(path)+[os.environ.get(var,'')])
+ if Utils.is_win32:
+ add_path(fu,lst,'PATH')
+ elif Utils.unversioned_sys_platform()=='darwin':
+ add_path(fu,lst,'DYLD_LIBRARY_PATH')
+ add_path(fu,lst,'LD_LIBRARY_PATH')
+ else:
+ add_path(fu,lst,'LD_LIBRARY_PATH')
+ self.generator.bld.all_test_paths=fu
+ cwd=getattr(self.generator,'ut_cwd','')or self.inputs[0].parent.abspath()
+ testcmd=getattr(Options.options,'testcmd',False)
+ if testcmd:
+ self.ut_exec=(testcmd%self.ut_exec[0]).split(' ')
+ proc=Utils.subprocess.Popen(self.ut_exec,cwd=cwd,env=fu,stderr=Utils.subprocess.PIPE,stdout=Utils.subprocess.PIPE)
+ (stdout,stderr)=proc.communicate()
+ tup=(filename,proc.returncode,stdout,stderr)
+ self.generator.utest_result=tup
+ testlock.acquire()
+ try:
+ bld=self.generator.bld
+ Logs.debug("ut: %r",tup)
+ try:
+ bld.utest_results.append(tup)
+ except AttributeError:
+ bld.utest_results=[tup]
+ finally:
+ testlock.release()
+def summary(bld):
+ lst=getattr(bld,'utest_results',[])
+ if lst:
+ Logs.pprint('CYAN','execution summary')
+ total=len(lst)
+ tfail=len([x for x in lst if x[1]])
+ Logs.pprint('CYAN',' tests that pass %d/%d'%(total-tfail,total))
+ for(f,code,out,err)in lst:
+ if not code:
+ Logs.pprint('CYAN',' %s'%f)
+ Logs.pprint('CYAN',' tests that fail %d/%d'%(tfail,total))
+ for(f,code,out,err)in lst:
+ if code:
+ Logs.pprint('CYAN',' %s'%f)
+def set_exit_code(bld):
+ lst=getattr(bld,'utest_results',[])
+ for(f,code,out,err)in lst:
+ if code:
+ msg=[]
+ if out:
+ msg.append('stdout:%s%s'%(os.linesep,out.decode('utf-8')))
+ if err:
+ msg.append('stderr:%s%s'%(os.linesep,err.decode('utf-8')))
+ bld.fatal(os.linesep.join(msg))
+def options(opt):
+ opt.add_option('--notests',action='store_true',default=False,help='Exec no unit tests',dest='no_tests')
+ opt.add_option('--alltests',action='store_true',default=False,help='Exec all unit tests',dest='all_tests')
+ opt.add_option('--testcmd',action='store',default=False,help='Run the unit tests using the test-cmd string'' example "--test-cmd="valgrind --error-exitcode=1'' %s" to run under valgrind',dest='testcmd')
--- /dev/null
+#! /usr/bin/env python
+# encoding: utf-8
+# WARNING! Do not edit! http://waf.googlecode.com/git/docs/wafbook/single.html#_obtaining_the_waf_file
+
+import re,traceback
+from waflib import Task,Logs,Utils
+from waflib.TaskGen import extension
+from waflib.Tools import c_preproc
+@extension('.rc')
+def rc_file(self,node):
+ obj_ext='.rc.o'
+ if self.env['WINRC_TGT_F']=='/fo':
+ obj_ext='.res'
+ rctask=self.create_task('winrc',node,node.change_ext(obj_ext))
+ try:
+ self.compiled_tasks.append(rctask)
+ except AttributeError:
+ self.compiled_tasks=[rctask]
+re_lines=re.compile('(?:^[ \t]*(#|%:)[ \t]*(ifdef|ifndef|if|else|elif|endif|include|import|define|undef|pragma)[ \t]*(.*?)\s*$)|''(?:^\w+[ \t]*(ICON|BITMAP|CURSOR|HTML|FONT|MESSAGETABLE|TYPELIB|REGISTRY|D3DFX)[ \t]*(.*?)\s*$)',re.IGNORECASE|re.MULTILINE)
+class rc_parser(c_preproc.c_parser):
+ def filter_comments(self,filepath):
+ code=Utils.readf(filepath)
+ if c_preproc.use_trigraphs:
+ for(a,b)in c_preproc.trig_def:code=code.split(a).join(b)
+ code=c_preproc.re_nl.sub('',code)
+ code=c_preproc.re_cpp.sub(c_preproc.repl,code)
+ ret=[]
+ for m in re.finditer(re_lines,code):
+ if m.group(2):
+ ret.append((m.group(2),m.group(3)))
+ else:
+ ret.append(('include',m.group(5)))
+ return ret
+ def addlines(self,node):
+ self.currentnode_stack.append(node.parent)
+ filepath=node.abspath()
+ self.count_files+=1
+ if self.count_files>c_preproc.recursion_limit:
+ raise c_preproc.PreprocError("recursion limit exceeded")
+ pc=self.parse_cache
+ Logs.debug('preproc: reading file %r',filepath)
+ try:
+ lns=pc[filepath]
+ except KeyError:
+ pass
+ else:
+ self.lines.extend(lns)
+ return
+ try:
+ lines=self.filter_comments(filepath)
+ lines.append((c_preproc.POPFILE,''))
+ lines.reverse()
+ pc[filepath]=lines
+ self.lines.extend(lines)
+ except IOError:
+ raise c_preproc.PreprocError("could not read the file %s"%filepath)
+ except Exception:
+ if Logs.verbose>0:
+ Logs.error("parsing %s failed"%filepath)
+ traceback.print_exc()
+class winrc(Task.Task):
+ run_str='${WINRC} ${WINRCFLAGS} ${CPPPATH_ST:INCPATHS} ${DEFINES_ST:DEFINES} ${WINRC_TGT_F} ${TGT} ${WINRC_SRC_F} ${SRC}'
+ color='BLUE'
+ def scan(self):
+ tmp=rc_parser(self.generator.includes_nodes)
+ tmp.start(self.inputs[0],self.env)
+ nodes=tmp.nodes
+ names=tmp.names
+ if Logs.verbose:
+ Logs.debug('deps: deps for %s: %r; unresolved %r'%(str(self),nodes,names))
+ return(nodes,names)
+def configure(conf):
+ v=conf.env
+ v['WINRC_TGT_F']='-o'
+ v['WINRC_SRC_F']='-i'
+ if not conf.env.WINRC:
+ if v.CC_NAME=='msvc':
+ conf.find_program('RC',var='WINRC',path_list=v['PATH'])
+ v['WINRC_TGT_F']='/fo'
+ v['WINRC_SRC_F']=''
+ else:
+ conf.find_program('windres',var='WINRC',path_list=v['PATH'])
+ if not conf.env.WINRC:
+ conf.fatal('winrc was not found!')
+ v['WINRCFLAGS']=[]
--- /dev/null
+#! /usr/bin/env python
+# encoding: utf-8
+# WARNING! Do not edit! http://waf.googlecode.com/git/docs/wafbook/single.html#_obtaining_the_waf_file
+
+from waflib.Tools import ccroot,ar
+from waflib.Configure import conf
+@conf
+def find_xlc(conf):
+ cc=conf.find_program(['xlc_r','xlc'],var='CC')
+ cc=conf.cmd_to_list(cc)
+ conf.get_xlc_version(cc)
+ conf.env.CC_NAME='xlc'
+ conf.env.CC=cc
+@conf
+def xlc_common_flags(conf):
+ v=conf.env
+ v['CC_SRC_F']=[]
+ v['CC_TGT_F']=['-c','-o']
+ if not v['LINK_CC']:v['LINK_CC']=v['CC']
+ v['CCLNK_SRC_F']=[]
+ v['CCLNK_TGT_F']=['-o']
+ v['CPPPATH_ST']='-I%s'
+ v['DEFINES_ST']='-D%s'
+ v['LIB_ST']='-l%s'
+ v['LIBPATH_ST']='-L%s'
+ v['STLIB_ST']='-l%s'
+ v['STLIBPATH_ST']='-L%s'
+ v['RPATH_ST']='-Wl,-rpath,%s'
+ v['SONAME_ST']=[]
+ v['SHLIB_MARKER']=[]
+ v['STLIB_MARKER']=[]
+ v['LINKFLAGS_cprogram']=['-Wl,-brtl']
+ v['cprogram_PATTERN']='%s'
+ v['CFLAGS_cshlib']=['-fPIC']
+ v['LINKFLAGS_cshlib']=['-G','-Wl,-brtl,-bexpfull']
+ v['cshlib_PATTERN']='lib%s.so'
+ v['LINKFLAGS_cstlib']=[]
+ v['cstlib_PATTERN']='lib%s.a'
+def configure(conf):
+ conf.find_xlc()
+ conf.find_ar()
+ conf.xlc_common_flags()
+ conf.cc_load_tools()
+ conf.cc_add_flags()
+ conf.link_add_flags()
--- /dev/null
+#! /usr/bin/env python
+# encoding: utf-8
+# WARNING! Do not edit! http://waf.googlecode.com/git/docs/wafbook/single.html#_obtaining_the_waf_file
+
+from waflib.Tools import ccroot,ar
+from waflib.Configure import conf
+@conf
+def find_xlcxx(conf):
+ cxx=conf.find_program(['xlc++_r','xlc++'],var='CXX')
+ cxx=conf.cmd_to_list(cxx)
+ conf.get_xlc_version(cxx)
+ conf.env.CXX_NAME='xlc++'
+ conf.env.CXX=cxx
+@conf
+def xlcxx_common_flags(conf):
+ v=conf.env
+ v['CXX_SRC_F']=[]
+ v['CXX_TGT_F']=['-c','-o']
+ if not v['LINK_CXX']:v['LINK_CXX']=v['CXX']
+ v['CXXLNK_SRC_F']=[]
+ v['CXXLNK_TGT_F']=['-o']
+ v['CPPPATH_ST']='-I%s'
+ v['DEFINES_ST']='-D%s'
+ v['LIB_ST']='-l%s'
+ v['LIBPATH_ST']='-L%s'
+ v['STLIB_ST']='-l%s'
+ v['STLIBPATH_ST']='-L%s'
+ v['RPATH_ST']='-Wl,-rpath,%s'
+ v['SONAME_ST']=[]
+ v['SHLIB_MARKER']=[]
+ v['STLIB_MARKER']=[]
+ v['LINKFLAGS_cxxprogram']=['-Wl,-brtl']
+ v['cxxprogram_PATTERN']='%s'
+ v['CXXFLAGS_cxxshlib']=['-fPIC']
+ v['LINKFLAGS_cxxshlib']=['-G','-Wl,-brtl,-bexpfull']
+ v['cxxshlib_PATTERN']='lib%s.so'
+ v['LINKFLAGS_cxxstlib']=[]
+ v['cxxstlib_PATTERN']='lib%s.a'
+def configure(conf):
+ conf.find_xlcxx()
+ conf.find_ar()
+ conf.xlcxx_common_flags()
+ conf.cxx_load_tools()
+ conf.cxx_add_flags()
+ conf.link_add_flags()
--- /dev/null
+#! /usr/bin/env python
+# encoding: utf-8
+# WARNING! Do not edit! http://waf.googlecode.com/git/docs/wafbook/single.html#_obtaining_the_waf_file
+
+import os,sys,errno,traceback,inspect,re,shutil,datetime,gc
+import subprocess
+try:
+ from collections import deque
+except ImportError:
+ class deque(list):
+ def popleft(self):
+ return self.pop(0)
+try:
+ import _winreg as winreg
+except ImportError:
+ try:
+ import winreg
+ except ImportError:
+ winreg=None
+from waflib import Errors
+try:
+ from collections import UserDict
+except ImportError:
+ from UserDict import UserDict
+try:
+ from hashlib import md5
+except ImportError:
+ try:
+ from md5 import md5
+ except ImportError:
+ pass
+try:
+ import threading
+except ImportError:
+ class threading(object):
+ pass
+ class Lock(object):
+ def acquire(self):
+ pass
+ def release(self):
+ pass
+ threading.Lock=threading.Thread=Lock
+else:
+ run_old=threading.Thread.run
+ def run(*args,**kwargs):
+ try:
+ run_old(*args,**kwargs)
+ except(KeyboardInterrupt,SystemExit):
+ raise
+ except Exception:
+ sys.excepthook(*sys.exc_info())
+ threading.Thread.run=run
+SIG_NIL='iluvcuteoverload'
+O644=420
+O755=493
+rot_chr=['\\','|','/','-']
+rot_idx=0
+try:
+ from collections import defaultdict
+except ImportError:
+ class defaultdict(dict):
+ def __init__(self,default_factory):
+ super(defaultdict,self).__init__()
+ self.default_factory=default_factory
+ def __getitem__(self,key):
+ try:
+ return super(defaultdict,self).__getitem__(key)
+ except KeyError:
+ value=self.default_factory()
+ self[key]=value
+ return value
+is_win32=sys.platform in('win32','cli')
+indicator='\x1b[K%s%s%s\r'
+if is_win32 and'NOCOLOR'in os.environ:
+ indicator='%s%s%s\r'
+def readf(fname,m='r',encoding='ISO8859-1'):
+ if sys.hexversion>0x3000000 and not'b'in m:
+ m+='b'
+ f=open(fname,m)
+ try:
+ txt=f.read()
+ finally:
+ f.close()
+ txt=txt.decode(encoding)
+ else:
+ f=open(fname,m)
+ try:
+ txt=f.read()
+ finally:
+ f.close()
+ return txt
+def writef(fname,data,m='w',encoding='ISO8859-1'):
+ if sys.hexversion>0x3000000 and not'b'in m:
+ data=data.encode(encoding)
+ m+='b'
+ f=open(fname,m)
+ try:
+ f.write(data)
+ finally:
+ f.close()
+def h_file(fname):
+ f=open(fname,'rb')
+ m=md5()
+ try:
+ while fname:
+ fname=f.read(200000)
+ m.update(fname)
+ finally:
+ f.close()
+ return m.digest()
+if hasattr(os,'O_NOINHERIT'):
+ def readf_win32(f,m='r',encoding='ISO8859-1'):
+ flags=os.O_NOINHERIT|os.O_RDONLY
+ if'b'in m:
+ flags|=os.O_BINARY
+ if'+'in m:
+ flags|=os.O_RDWR
+ try:
+ fd=os.open(f,flags)
+ except OSError:
+ raise IOError('Cannot read from %r'%f)
+ if sys.hexversion>0x3000000 and not'b'in m:
+ m+='b'
+ f=os.fdopen(fd,m)
+ try:
+ txt=f.read()
+ finally:
+ f.close()
+ txt=txt.decode(encoding)
+ else:
+ f=os.fdopen(fd,m)
+ try:
+ txt=f.read()
+ finally:
+ f.close()
+ return txt
+ def writef_win32(f,data,m='w',encoding='ISO8859-1'):
+ if sys.hexversion>0x3000000 and not'b'in m:
+ data=data.encode(encoding)
+ m+='b'
+ flags=os.O_CREAT|os.O_TRUNC|os.O_WRONLY|os.O_NOINHERIT
+ if'b'in m:
+ flags|=os.O_BINARY
+ if'+'in m:
+ flags|=os.O_RDWR
+ try:
+ fd=os.open(f,flags)
+ except OSError:
+ raise IOError('Cannot write to %r'%f)
+ f=os.fdopen(fd,m)
+ try:
+ f.write(data)
+ finally:
+ f.close()
+ def h_file_win32(fname):
+ try:
+ fd=os.open(fname,os.O_BINARY|os.O_RDONLY|os.O_NOINHERIT)
+ except OSError:
+ raise IOError('Cannot read from %r'%fname)
+ f=os.fdopen(fd,'rb')
+ m=md5()
+ try:
+ while fname:
+ fname=f.read(200000)
+ m.update(fname)
+ finally:
+ f.close()
+ return m.digest()
+ readf_old=readf
+ writef_old=writef
+ h_file_old=h_file
+ readf=readf_win32
+ writef=writef_win32
+ h_file=h_file_win32
+try:
+ x=''.encode('hex')
+except LookupError:
+ import binascii
+ def to_hex(s):
+ ret=binascii.hexlify(s)
+ if not isinstance(ret,str):
+ ret=ret.decode('utf-8')
+ return ret
+else:
+ def to_hex(s):
+ return s.encode('hex')
+to_hex.__doc__="""
+Return the hexadecimal representation of a string
+
+:param s: string to convert
+:type s: string
+"""
+listdir=os.listdir
+if is_win32:
+ def listdir_win32(s):
+ if not s:
+ try:
+ import ctypes
+ except ImportError:
+ return[x+':\\'for x in list('ABCDEFGHIJKLMNOPQRSTUVWXYZ')]
+ else:
+ dlen=4
+ maxdrives=26
+ buf=ctypes.create_string_buffer(maxdrives*dlen)
+ ndrives=ctypes.windll.kernel32.GetLogicalDriveStringsA(maxdrives*dlen,ctypes.byref(buf))
+ return[str(buf.raw[4*i:4*i+2].decode('ascii'))for i in range(int(ndrives/dlen))]
+ if len(s)==2 and s[1]==":":
+ s+=os.sep
+ if not os.path.isdir(s):
+ e=OSError('%s is not a directory'%s)
+ e.errno=errno.ENOENT
+ raise e
+ return os.listdir(s)
+ listdir=listdir_win32
+def num2ver(ver):
+ if isinstance(ver,str):
+ ver=tuple(ver.split('.'))
+ if isinstance(ver,tuple):
+ ret=0
+ for i in range(4):
+ if i<len(ver):
+ ret+=256**(3-i)*int(ver[i])
+ return ret
+ return ver
+def ex_stack():
+ exc_type,exc_value,tb=sys.exc_info()
+ exc_lines=traceback.format_exception(exc_type,exc_value,tb)
+ return''.join(exc_lines)
+def to_list(sth):
+ if isinstance(sth,str):
+ return sth.split()
+ else:
+ return sth
+re_nl=re.compile('\r*\n',re.M)
+def str_to_dict(txt):
+ tbl={}
+ lines=re_nl.split(txt)
+ for x in lines:
+ x=x.strip()
+ if not x or x.startswith('#')or x.find('=')<0:
+ continue
+ tmp=x.split('=')
+ tbl[tmp[0].strip()]='='.join(tmp[1:]).strip()
+ return tbl
+def split_path(path):
+ return path.split('/')
+def split_path_cygwin(path):
+ if path.startswith('//'):
+ ret=path.split('/')[2:]
+ ret[0]='/'+ret[0]
+ return ret
+ return path.split('/')
+re_sp=re.compile('[/\\\\]')
+def split_path_win32(path):
+ if path.startswith('\\\\'):
+ ret=re.split(re_sp,path)[2:]
+ ret[0]='\\'+ret[0]
+ return ret
+ return re.split(re_sp,path)
+if sys.platform=='cygwin':
+ split_path=split_path_cygwin
+elif is_win32:
+ split_path=split_path_win32
+split_path.__doc__="""
+Split a path by / or \\. This function is not like os.path.split
+
+:type path: string
+:param path: path to split
+:return: list of strings
+"""
+def check_dir(path):
+ if not os.path.isdir(path):
+ try:
+ os.makedirs(path)
+ except OSError ,e:
+ if not os.path.isdir(path):
+ raise Errors.WafError('Cannot create the folder %r'%path,ex=e)
+def def_attrs(cls,**kw):
+ for k,v in kw.items():
+ if not hasattr(cls,k):
+ setattr(cls,k,v)
+def quote_define_name(s):
+ fu=re.compile("[^a-zA-Z0-9]").sub("_",s)
+ fu=fu.upper()
+ return fu
+def h_list(lst):
+ m=md5()
+ m.update(str(lst))
+ return m.digest()
+def h_fun(fun):
+ try:
+ return fun.code
+ except AttributeError:
+ try:
+ h=inspect.getsource(fun)
+ except IOError:
+ h="nocode"
+ try:
+ fun.code=h
+ except AttributeError:
+ pass
+ return h
+reg_subst=re.compile(r"(\\\\)|(\$\$)|\$\{([^}]+)\}")
+def subst_vars(expr,params):
+ def repl_var(m):
+ if m.group(1):
+ return'\\'
+ if m.group(2):
+ return'$'
+ try:
+ return params.get_flat(m.group(3))
+ except AttributeError:
+ return params[m.group(3)]
+ return reg_subst.sub(repl_var,expr)
+def destos_to_binfmt(key):
+ if key=='darwin':
+ return'mac-o'
+ elif key in('win32','cygwin','uwin','msys'):
+ return'pe'
+ return'elf'
+def unversioned_sys_platform():
+ s=sys.platform
+ if s=='java':
+ from java.lang import System
+ s=System.getProperty('os.name')
+ if s=='Mac OS X':
+ return'darwin'
+ elif s.startswith('Windows '):
+ return'win32'
+ elif s=='OS/2':
+ return'os2'
+ elif s=='HP-UX':
+ return'hpux'
+ elif s in('SunOS','Solaris'):
+ return'sunos'
+ else:s=s.lower()
+ if s=='powerpc':
+ return'darwin'
+ if s=='win32'or s.endswith('os2')and s!='sunos2':return s
+ return re.split('\d+$',s)[0]
+def nada(*k,**kw):
+ pass
+class Timer(object):
+ def __init__(self):
+ self.start_time=datetime.datetime.utcnow()
+ def __str__(self):
+ delta=datetime.datetime.utcnow()-self.start_time
+ days=int(delta.days)
+ hours=delta.seconds//3600
+ minutes=(delta.seconds-hours*3600)//60
+ seconds=delta.seconds-hours*3600-minutes*60+float(delta.microseconds)/1000/1000
+ result=''
+ if days:
+ result+='%dd'%days
+ if days or hours:
+ result+='%dh'%hours
+ if days or hours or minutes:
+ result+='%dm'%minutes
+ return'%s%.3fs'%(result,seconds)
+if is_win32:
+ old=shutil.copy2
+ def copy2(src,dst):
+ old(src,dst)
+ shutil.copystat(src,dst)
+ setattr(shutil,'copy2',copy2)
+if os.name=='java':
+ try:
+ gc.disable()
+ gc.enable()
+ except NotImplementedError:
+ gc.disable=gc.enable
+def read_la_file(path):
+ sp=re.compile(r'^([^=]+)=\'(.*)\'$')
+ dc={}
+ for line in readf(path).splitlines():
+ try:
+ _,left,right,_=sp.split(line.strip())
+ dc[left]=right
+ except ValueError:
+ pass
+ return dc
+def nogc(fun):
+ def f(*k,**kw):
+ try:
+ gc.disable()
+ ret=fun(*k,**kw)
+ finally:
+ gc.enable()
+ return ret
+ f.__doc__=fun.__doc__
+ return f
+def run_once(fun):
+ cache={}
+ def wrap(k):
+ try:
+ return cache[k]
+ except KeyError:
+ ret=fun(k)
+ cache[k]=ret
+ return ret
+ wrap.__cache__=cache
+ return wrap
+def get_registry_app_path(key,filename):
+ if not winreg:
+ return None
+ try:
+ result=winreg.QueryValue(key,"Software\\Microsoft\\Windows\\CurrentVersion\\App Paths\\%s.exe"%filename[0])
+ except WindowsError:
+ pass
+ else:
+ if os.path.isfile(result):
+ return result
--- /dev/null
+#! /usr/bin/env python
+# encoding: utf-8
+# WARNING! Do not edit! http://waf.googlecode.com/git/docs/wafbook/single.html#_obtaining_the_waf_file
+
--- /dev/null
+#! /usr/bin/env python
+# encoding: utf-8
+# WARNING! Do not edit! http://waf.googlecode.com/git/docs/wafbook/single.html#_obtaining_the_waf_file
+
+import sys,os
+try:
+ if not(sys.stderr.isatty()and sys.stdout.isatty()):
+ raise ValueError('not a tty')
+ from ctypes import*
+ class COORD(Structure):
+ _fields_=[("X",c_short),("Y",c_short)]
+ class SMALL_RECT(Structure):
+ _fields_=[("Left",c_short),("Top",c_short),("Right",c_short),("Bottom",c_short)]
+ class CONSOLE_SCREEN_BUFFER_INFO(Structure):
+ _fields_=[("Size",COORD),("CursorPosition",COORD),("Attributes",c_short),("Window",SMALL_RECT),("MaximumWindowSize",COORD)]
+ class CONSOLE_CURSOR_INFO(Structure):
+ _fields_=[('dwSize',c_ulong),('bVisible',c_int)]
+ sbinfo=CONSOLE_SCREEN_BUFFER_INFO()
+ csinfo=CONSOLE_CURSOR_INFO()
+ hconsole=windll.kernel32.GetStdHandle(-11)
+ windll.kernel32.GetConsoleScreenBufferInfo(hconsole,byref(sbinfo))
+ if sbinfo.Size.X<9 or sbinfo.Size.Y<9:raise ValueError('small console')
+ windll.kernel32.GetConsoleCursorInfo(hconsole,byref(csinfo))
+except Exception:
+ pass
+else:
+ import re,threading
+ is_vista=getattr(sys,"getwindowsversion",None)and sys.getwindowsversion()[0]>=6
+ try:
+ _type=unicode
+ except NameError:
+ _type=str
+ to_int=lambda number,default:number and int(number)or default
+ wlock=threading.Lock()
+ STD_OUTPUT_HANDLE=-11
+ STD_ERROR_HANDLE=-12
+ class AnsiTerm(object):
+ def __init__(self):
+ self.encoding=sys.stdout.encoding
+ self.hconsole=windll.kernel32.GetStdHandle(STD_OUTPUT_HANDLE)
+ self.cursor_history=[]
+ self.orig_sbinfo=CONSOLE_SCREEN_BUFFER_INFO()
+ self.orig_csinfo=CONSOLE_CURSOR_INFO()
+ windll.kernel32.GetConsoleScreenBufferInfo(self.hconsole,byref(self.orig_sbinfo))
+ windll.kernel32.GetConsoleCursorInfo(hconsole,byref(self.orig_csinfo))
+ def screen_buffer_info(self):
+ sbinfo=CONSOLE_SCREEN_BUFFER_INFO()
+ windll.kernel32.GetConsoleScreenBufferInfo(self.hconsole,byref(sbinfo))
+ return sbinfo
+ def clear_line(self,param):
+ mode=param and int(param)or 0
+ sbinfo=self.screen_buffer_info()
+ if mode==1:
+ line_start=COORD(0,sbinfo.CursorPosition.Y)
+ line_length=sbinfo.Size.X
+ elif mode==2:
+ line_start=COORD(sbinfo.CursorPosition.X,sbinfo.CursorPosition.Y)
+ line_length=sbinfo.Size.X-sbinfo.CursorPosition.X
+ else:
+ line_start=sbinfo.CursorPosition
+ line_length=sbinfo.Size.X-sbinfo.CursorPosition.X
+ chars_written=c_int()
+ windll.kernel32.FillConsoleOutputCharacterA(self.hconsole,c_wchar(' '),line_length,line_start,byref(chars_written))
+ windll.kernel32.FillConsoleOutputAttribute(self.hconsole,sbinfo.Attributes,line_length,line_start,byref(chars_written))
+ def clear_screen(self,param):
+ mode=to_int(param,0)
+ sbinfo=self.screen_buffer_info()
+ if mode==1:
+ clear_start=COORD(0,0)
+ clear_length=sbinfo.CursorPosition.X*sbinfo.CursorPosition.Y
+ elif mode==2:
+ clear_start=COORD(0,0)
+ clear_length=sbinfo.Size.X*sbinfo.Size.Y
+ windll.kernel32.SetConsoleCursorPosition(self.hconsole,clear_start)
+ else:
+ clear_start=sbinfo.CursorPosition
+ clear_length=((sbinfo.Size.X-sbinfo.CursorPosition.X)+sbinfo.Size.X*(sbinfo.Size.Y-sbinfo.CursorPosition.Y))
+ chars_written=c_int()
+ windll.kernel32.FillConsoleOutputCharacterA(self.hconsole,c_wchar(' '),clear_length,clear_start,byref(chars_written))
+ windll.kernel32.FillConsoleOutputAttribute(self.hconsole,sbinfo.Attributes,clear_length,clear_start,byref(chars_written))
+ def push_cursor(self,param):
+ sbinfo=self.screen_buffer_info()
+ self.cursor_history.append(sbinfo.CursorPosition)
+ def pop_cursor(self,param):
+ if self.cursor_history:
+ old_pos=self.cursor_history.pop()
+ windll.kernel32.SetConsoleCursorPosition(self.hconsole,old_pos)
+ def set_cursor(self,param):
+ y,sep,x=param.partition(';')
+ x=to_int(x,1)-1
+ y=to_int(y,1)-1
+ sbinfo=self.screen_buffer_info()
+ new_pos=COORD(min(max(0,x),sbinfo.Size.X),min(max(0,y),sbinfo.Size.Y))
+ windll.kernel32.SetConsoleCursorPosition(self.hconsole,new_pos)
+ def set_column(self,param):
+ x=to_int(param,1)-1
+ sbinfo=self.screen_buffer_info()
+ new_pos=COORD(min(max(0,x),sbinfo.Size.X),sbinfo.CursorPosition.Y)
+ windll.kernel32.SetConsoleCursorPosition(self.hconsole,new_pos)
+ def move_cursor(self,x_offset=0,y_offset=0):
+ sbinfo=self.screen_buffer_info()
+ new_pos=COORD(min(max(0,sbinfo.CursorPosition.X+x_offset),sbinfo.Size.X),min(max(0,sbinfo.CursorPosition.Y+y_offset),sbinfo.Size.Y))
+ windll.kernel32.SetConsoleCursorPosition(self.hconsole,new_pos)
+ def move_up(self,param):
+ self.move_cursor(y_offset=-to_int(param,1))
+ def move_down(self,param):
+ self.move_cursor(y_offset=to_int(param,1))
+ def move_left(self,param):
+ self.move_cursor(x_offset=-to_int(param,1))
+ def move_right(self,param):
+ self.move_cursor(x_offset=to_int(param,1))
+ def next_line(self,param):
+ sbinfo=self.screen_buffer_info()
+ self.move_cursor(x_offset=-sbinfo.CursorPosition.X,y_offset=to_int(param,1))
+ def prev_line(self,param):
+ sbinfo=self.screen_buffer_info()
+ self.move_cursor(x_offset=-sbinfo.CursorPosition.X,y_offset=-to_int(param,1))
+ def rgb2bgr(self,c):
+ return((c&1)<<2)|(c&2)|((c&4)>>2)
+ def set_color(self,param):
+ cols=param.split(';')
+ sbinfo=CONSOLE_SCREEN_BUFFER_INFO()
+ windll.kernel32.GetConsoleScreenBufferInfo(self.hconsole,byref(sbinfo))
+ attr=sbinfo.Attributes
+ for c in cols:
+ if is_vista:
+ c=int(c)
+ else:
+ c=to_int(c,0)
+ if c in range(30,38):
+ attr=(attr&0xfff0)|self.rgb2bgr(c-30)
+ elif c in range(40,48):
+ attr=(attr&0xff0f)|(self.rgb2bgr(c-40)<<4)
+ elif c==0:
+ attr=self.orig_sbinfo.Attributes
+ elif c==1:
+ attr|=0x08
+ elif c==4:
+ attr|=0x80
+ elif c==7:
+ attr=(attr&0xff88)|((attr&0x70)>>4)|((attr&0x07)<<4)
+ windll.kernel32.SetConsoleTextAttribute(self.hconsole,attr)
+ def show_cursor(self,param):
+ csinfo.bVisible=1
+ windll.kernel32.SetConsoleCursorInfo(self.hconsole,byref(csinfo))
+ def hide_cursor(self,param):
+ csinfo.bVisible=0
+ windll.kernel32.SetConsoleCursorInfo(self.hconsole,byref(csinfo))
+ ansi_command_table={'A':move_up,'B':move_down,'C':move_right,'D':move_left,'E':next_line,'F':prev_line,'G':set_column,'H':set_cursor,'f':set_cursor,'J':clear_screen,'K':clear_line,'h':show_cursor,'l':hide_cursor,'m':set_color,'s':push_cursor,'u':pop_cursor,}
+ ansi_tokens=re.compile('(?:\x1b\[([0-9?;]*)([a-zA-Z])|([^\x1b]+))')
+ def write(self,text):
+ try:
+ wlock.acquire()
+ for param,cmd,txt in self.ansi_tokens.findall(text):
+ if cmd:
+ cmd_func=self.ansi_command_table.get(cmd)
+ if cmd_func:
+ cmd_func(self,param)
+ else:
+ self.writeconsole(txt)
+ finally:
+ wlock.release()
+ def writeconsole(self,txt):
+ chars_written=c_int()
+ writeconsole=windll.kernel32.WriteConsoleA
+ if isinstance(txt,_type):
+ writeconsole=windll.kernel32.WriteConsoleW
+ TINY_STEP=3000
+ for x in range(0,len(txt),TINY_STEP):
+ tiny=txt[x:x+TINY_STEP]
+ writeconsole(self.hconsole,tiny,len(tiny),byref(chars_written),None)
+ def flush(self):
+ pass
+ def isatty(self):
+ return True
+ sys.stderr=sys.stdout=AnsiTerm()
+ os.environ['TERM']='vt100'
--- /dev/null
+#! /usr/bin/env python
+# encoding: utf-8
+# WARNING! Do not edit! http://waf.googlecode.com/git/docs/wafbook/single.html#_obtaining_the_waf_file
+
--- /dev/null
+#! /usr/bin/env python
+# encoding: utf-8
+# WARNING! Do not edit! http://waf.googlecode.com/git/docs/wafbook/single.html#_obtaining_the_waf_file
+
+import sys
+from waflib import ConfigSet,Logs,Options,Scripting,Task,Build,Configure,Node,Runner,TaskGen,Utils,Errors,Context
+sys.modules['Environment']=ConfigSet
+ConfigSet.Environment=ConfigSet.ConfigSet
+sys.modules['Logs']=Logs
+sys.modules['Options']=Options
+sys.modules['Scripting']=Scripting
+sys.modules['Task']=Task
+sys.modules['Build']=Build
+sys.modules['Configure']=Configure
+sys.modules['Node']=Node
+sys.modules['Runner']=Runner
+sys.modules['TaskGen']=TaskGen
+sys.modules['Utils']=Utils
+from waflib.Tools import c_preproc
+sys.modules['preproc']=c_preproc
+from waflib.Tools import c_config
+sys.modules['config_c']=c_config
+ConfigSet.ConfigSet.copy=ConfigSet.ConfigSet.derive
+ConfigSet.ConfigSet.set_variant=Utils.nada
+Build.BuildContext.add_subdirs=Build.BuildContext.recurse
+Build.BuildContext.new_task_gen=Build.BuildContext.__call__
+Build.BuildContext.is_install=0
+Node.Node.relpath_gen=Node.Node.path_from
+def name_to_obj(self,s,env=None):
+ Logs.warn('compat: change "name_to_obj(name, env)" by "get_tgen_by_name(name)"')
+ return self.get_tgen_by_name(s)
+Build.BuildContext.name_to_obj=name_to_obj
+def env_of_name(self,name):
+ try:
+ return self.all_envs[name]
+ except KeyError:
+ Logs.error('no such environment: '+name)
+ return None
+Build.BuildContext.env_of_name=env_of_name
+def set_env_name(self,name,env):
+ self.all_envs[name]=env
+ return env
+Configure.ConfigurationContext.set_env_name=set_env_name
+def retrieve(self,name,fromenv=None):
+ try:
+ env=self.all_envs[name]
+ except KeyError:
+ env=ConfigSet.ConfigSet()
+ self.prepare_env(env)
+ self.all_envs[name]=env
+ else:
+ if fromenv:Logs.warn("The environment %s may have been configured already"%name)
+ return env
+Configure.ConfigurationContext.retrieve=retrieve
+Configure.ConfigurationContext.sub_config=Configure.ConfigurationContext.recurse
+Configure.ConfigurationContext.check_tool=Configure.ConfigurationContext.load
+Configure.conftest=Configure.conf
+Configure.ConfigurationError=Errors.ConfigurationError
+Options.OptionsContext.sub_options=Options.OptionsContext.recurse
+Options.OptionsContext.tool_options=Context.Context.load
+Options.Handler=Options.OptionsContext
+Task.simple_task_type=Task.task_type_from_func=Task.task_factory
+Task.TaskBase.classes=Task.classes
+def setitem(self,key,value):
+ if key.startswith('CCFLAGS'):
+ key=key[1:]
+ self.table[key]=value
+ConfigSet.ConfigSet.__setitem__=setitem
+@TaskGen.feature('d')
+@TaskGen.before('apply_incpaths')
+def old_importpaths(self):
+ if getattr(self,'importpaths',[]):
+ self.includes=self.importpaths
+from waflib import Context
+eld=Context.load_tool
+def load_tool(*k,**kw):
+ ret=eld(*k,**kw)
+ if'set_options'in ret.__dict__:
+ Logs.warn('compat: rename "set_options" to options')
+ ret.options=ret.set_options
+ if'detect'in ret.__dict__:
+ Logs.warn('compat: rename "detect" to "configure"')
+ ret.configure=ret.detect
+ return ret
+Context.load_tool=load_tool
+rev=Context.load_module
+def load_module(path):
+ ret=rev(path)
+ if'set_options'in ret.__dict__:
+ Logs.warn('compat: rename "set_options" to "options" (%r)'%path)
+ ret.options=ret.set_options
+ if'srcdir'in ret.__dict__:
+ Logs.warn('compat: rename "srcdir" to "top" (%r)'%path)
+ ret.top=ret.srcdir
+ if'blddir'in ret.__dict__:
+ Logs.warn('compat: rename "blddir" to "out" (%r)'%path)
+ ret.out=ret.blddir
+ return ret
+Context.load_module=load_module
+old_post=TaskGen.task_gen.post
+def post(self):
+ self.features=self.to_list(self.features)
+ if'cc'in self.features:
+ Logs.warn('compat: the feature cc does not exist anymore (use "c")')
+ self.features.remove('cc')
+ self.features.append('c')
+ if'cstaticlib'in self.features:
+ Logs.warn('compat: the feature cstaticlib does not exist anymore (use "cstlib" or "cxxstlib")')
+ self.features.remove('cstaticlib')
+ self.features.append(('cxx'in self.features)and'cxxstlib'or'cstlib')
+ if getattr(self,'ccflags',None):
+ Logs.warn('compat: "ccflags" was renamed to "cflags"')
+ self.cflags=self.ccflags
+ return old_post(self)
+TaskGen.task_gen.post=post
+def waf_version(*k,**kw):
+ Logs.warn('wrong version (waf_version was removed in waf 1.6)')
+Utils.waf_version=waf_version
+import os
+@TaskGen.feature('c','cxx','d')
+@TaskGen.before('apply_incpaths','propagate_uselib_vars')
+@TaskGen.after('apply_link','process_source')
+def apply_uselib_local(self):
+ env=self.env
+ from waflib.Tools.ccroot import stlink_task
+ self.uselib=self.to_list(getattr(self,'uselib',[]))
+ self.includes=self.to_list(getattr(self,'includes',[]))
+ names=self.to_list(getattr(self,'uselib_local',[]))
+ get=self.bld.get_tgen_by_name
+ seen=set([])
+ tmp=Utils.deque(names)
+ if tmp:
+ Logs.warn('compat: "uselib_local" is deprecated, replace by "use"')
+ while tmp:
+ lib_name=tmp.popleft()
+ if lib_name in seen:
+ continue
+ y=get(lib_name)
+ y.post()
+ seen.add(lib_name)
+ if getattr(y,'uselib_local',None):
+ for x in self.to_list(getattr(y,'uselib_local',[])):
+ obj=get(x)
+ obj.post()
+ if getattr(obj,'link_task',None):
+ if not isinstance(obj.link_task,stlink_task):
+ tmp.append(x)
+ if getattr(y,'link_task',None):
+ link_name=y.target[y.target.rfind(os.sep)+1:]
+ if isinstance(y.link_task,stlink_task):
+ env.append_value('STLIB',[link_name])
+ else:
+ env.append_value('LIB',[link_name])
+ self.link_task.set_run_after(y.link_task)
+ self.link_task.dep_nodes+=y.link_task.outputs
+ tmp_path=y.link_task.outputs[0].parent.bldpath()
+ if not tmp_path in env['LIBPATH']:
+ env.prepend_value('LIBPATH',[tmp_path])
+ for v in self.to_list(getattr(y,'uselib',[])):
+ if not env['STLIB_'+v]:
+ if not v in self.uselib:
+ self.uselib.insert(0,v)
+ if getattr(y,'export_includes',None):
+ self.includes.extend(y.to_incnodes(y.export_includes))
+@TaskGen.feature('cprogram','cxxprogram','cstlib','cxxstlib','cshlib','cxxshlib','dprogram','dstlib','dshlib')
+@TaskGen.after('apply_link')
+def apply_objdeps(self):
+ names=getattr(self,'add_objects',[])
+ if not names:
+ return
+ names=self.to_list(names)
+ get=self.bld.get_tgen_by_name
+ seen=[]
+ while names:
+ x=names[0]
+ if x in seen:
+ names=names[1:]
+ continue
+ y=get(x)
+ if getattr(y,'add_objects',None):
+ added=0
+ lst=y.to_list(y.add_objects)
+ lst.reverse()
+ for u in lst:
+ if u in seen:continue
+ added=1
+ names=[u]+names
+ if added:continue
+ y.post()
+ seen.append(x)
+ for t in getattr(y,'compiled_tasks',[]):
+ self.link_task.inputs.extend(t.outputs)
+@TaskGen.after('apply_link')
+def process_obj_files(self):
+ if not hasattr(self,'obj_files'):
+ return
+ for x in self.obj_files:
+ node=self.path.find_resource(x)
+ self.link_task.inputs.append(node)
+@TaskGen.taskgen_method
+def add_obj_file(self,file):
+ if not hasattr(self,'obj_files'):self.obj_files=[]
+ if not'process_obj_files'in self.meths:self.meths.append('process_obj_files')
+ self.obj_files.append(file)
+old_define=Configure.ConfigurationContext.__dict__['define']
+@Configure.conf
+def define(self,key,val,quote=True):
+ old_define(self,key,val,quote)
+ if key.startswith('HAVE_'):
+ self.env[key]=1
+old_undefine=Configure.ConfigurationContext.__dict__['undefine']
+@Configure.conf
+def undefine(self,key):
+ old_undefine(self,key)
+ if key.startswith('HAVE_'):
+ self.env[key]=0
+def set_incdirs(self,val):
+ Logs.warn('compat: change "export_incdirs" by "export_includes"')
+ self.export_includes=val
+TaskGen.task_gen.export_incdirs=property(None,set_incdirs)
--- /dev/null
+#! /usr/bin/env python
+# encoding: utf-8
+# WARNING! Do not edit! http://waf.googlecode.com/git/docs/wafbook/single.html#_obtaining_the_waf_file
+
+import os
+all_modifs={}
+def fixdir(dir):
+ global all_modifs
+ for k in all_modifs:
+ for v in all_modifs[k]:
+ modif(os.path.join(dir,'waflib'),k,v)
+def modif(dir,name,fun):
+ if name=='*':
+ lst=[]
+ for y in'. Tools extras'.split():
+ for x in os.listdir(os.path.join(dir,y)):
+ if x.endswith('.py'):
+ lst.append(y+os.sep+x)
+ for x in lst:
+ modif(dir,x,fun)
+ return
+ filename=os.path.join(dir,name)
+ f=open(filename,'r')
+ try:
+ txt=f.read()
+ finally:
+ f.close()
+ txt=fun(txt)
+ f=open(filename,'w')
+ try:
+ f.write(txt)
+ finally:
+ f.close()
+def subst(*k):
+ def do_subst(fun):
+ global all_modifs
+ for x in k:
+ try:
+ all_modifs[x].append(fun)
+ except KeyError:
+ all_modifs[x]=[fun]
+ return fun
+ return do_subst
+@subst('*')
+def r1(code):
+ code=code.replace(',e:',',e:')
+ code=code.replace("",'')
+ code=code.replace('','')
+ return code
+@subst('Runner.py')
+def r4(code):
+ code=code.replace('next(self.biter)','self.biter.next()')
+ return code
top = '.'
out = 'build'
+def add_option_enable_disable(ctx, name, default = None, help_str = None, help_disable_str = None):
+ if help_str == None:
+ help_str = 'enable ' + name + ' support'
+ if help_disable_str == None:
+ help_disable_str = 'do not ' + help_str
+ ctx.add_option('--enable-' + name, action = 'store_true', default = default,
+ dest = 'enable_' + name,
+ help = help_str)
+ ctx.add_option('--disable-' + name, action = 'store_false',
+ #default = default,
+ dest = 'enable_' + name,
+ help = help_disable_str )
+
def options(ctx):
- ctx.add_option('--enable-double', action='store_true', default=False,
- help='compile aubio in double precision mode')
- ctx.add_option('--enable-fftw3f', action='store_true', default=False,
- help='compile with fftw3f instead of ooura (recommended)')
- ctx.add_option('--enable-fftw3', action='store_true', default=False,
- help='compile with fftw3 instead of ooura (recommended in double precision)')
- ctx.add_option('--enable-complex', action='store_true', default=False,
- help='compile with C99 complex')
- ctx.add_option('--enable-jack', action='store_true', default=None,
- help='compile with jack support')
- ctx.add_option('--enable-lash', action='store_true', default=None,
- help='compile with lash support')
- ctx.add_option('--enable-sndfile', action='store_true', default=None,
- help='compile with libsndfile support')
- ctx.add_option('--enable-samplerate', action='store_true', default=None,
- help='compile with libsamplerate support')
+ add_option_enable_disable(ctx, 'double', default = False,
+ help_str = 'compile aubio in double precision mode')
+ add_option_enable_disable(ctx, 'fftw3f', default = False,
+ help_str = 'compile with fftw3f instead of ooura (recommended)', help_disable_str = 'do not compile with fftw3f')
+ add_option_enable_disable(ctx, 'fftw3', default = False,
+ help_str = 'compile with fftw3 instead of ooura', help_disable_str = 'do not compile with fftw3')
+ add_option_enable_disable(ctx, 'complex', default = False,
+ help_str ='compile with C99 complex', help_disable_str = 'do not use C99 complex (default)' )
+ add_option_enable_disable(ctx, 'jack', default = None,
+ help_str = 'compile with jack (auto)', help_disable_str = 'disable jack support')
+ add_option_enable_disable(ctx, 'lash', default = None,
+ help_str = 'compile with LASH (auto)', help_disable_str = 'disable LASH' )
+ add_option_enable_disable(ctx, 'sndfile', default = None,
+ help_str = 'compile with sndfile (auto)', help_disable_str = 'disable sndfile')
+ add_option_enable_disable(ctx, 'samplerate', default = None,
+ help_str = 'compile with samplerate (auto)', help_disable_str = 'disable samplerate')
+
ctx.add_option('--with-target-platform', type='string',
help='set target platform for cross-compilation', dest='target_platform')
ctx.load('compiler_c')
ctx.load('waf_unit_test')
+ ctx.load('gnu_dirs')
def configure(ctx):
from waflib import Options
ctx.load('compiler_c')
ctx.load('waf_unit_test')
+ ctx.load('gnu_dirs')
ctx.env.CFLAGS += ['-g', '-Wall', '-Wextra']
if Options.options.target_platform:
ctx.env.FRAMEWORK = ['CoreFoundation', 'AudioToolbox', 'Accelerate']
ctx.define('HAVE_ACCELERATE', 1)
- if Options.platform == 'ios':
+ if Options.platform in [ 'ios', 'iosimulator' ]:
ctx.env.CC = 'clang'
ctx.env.LD = 'clang'
ctx.env.LINK_CC = 'clang'
- SDKVER="6.1"
- DEVROOT="/Applications/Xcode.app/Contents/Developer/Platforms/iPhoneOS.platform/Developer"
- SDKROOT="%(DEVROOT)s/SDKs/iPhoneOS%(SDKVER)s.sdk" % locals()
- ctx.env.FRAMEWORK = ['CoreFoundation', 'AudioToolbox', 'Accelerate']
ctx.define('HAVE_ACCELERATE', 1)
- ctx.env.CFLAGS += [ '-miphoneos-version-min=6.1', '-arch', 'armv7',
- '--sysroot=%s' % SDKROOT]
- ctx.env.LINKFLAGS += ['-std=c99', '-arch', 'armv7', '--sysroot=%s' %
- SDKROOT]
+ ctx.define('TARGET_OS_IPHONE', 1)
+ ctx.env.FRAMEWORK = ['CoreFoundation', 'AudioToolbox', 'Accelerate']
+ SDKVER="7.0"
+ MINSDKVER="6.1"
+ if Options.platform == 'ios':
+ DEVROOT="/Applications/Xcode.app/Contents/Developer/Platforms/iPhoneOS.platform/Developer"
+ SDKROOT="%(DEVROOT)s/SDKs/iPhoneOS%(SDKVER)s.sdk" % locals()
+ ctx.env.CFLAGS += [ '-arch', 'armv7' ]
+ ctx.env.CFLAGS += [ '-arch', 'armv7s' ]
+ ctx.env.LINKFLAGS += ['-arch', 'armv7']
+ ctx.env.LINKFLAGS += ['-arch', 'armv7s']
+ else:
+ DEVROOT="/Applications/Xcode.app/Contents/Developer/Platforms/iPhoneSimulator.platform/Developer"
+ SDKROOT="%(DEVROOT)s/SDKs/iPhoneSimulator%(SDKVER)s.sdk" % locals()
+ ctx.env.CFLAGS += [ '-arch', 'i386' ]
+ ctx.env.LINKFLAGS += ['-arch', 'i386']
+ ctx.env.CFLAGS += [ '-miphoneos-version-min=' + MINSDKVER ]
+ ctx.env.CFLAGS += [ '--sysroot=%s' % SDKROOT]
+ ctx.env.CFLAGS += ['-std=c99']
+ ctx.env.LINKFLAGS += ['-std=c99']
+ ctx.env.LINKFLAGS += ['--sysroot=%s' % SDKROOT]
# check for required headers
ctx.check(header_name='stdlib.h')
ctx.check_cfg(package = 'fftw3f', atleast_version = '3.0.0',
args = '--cflags --libs', mandatory = False)
ctx.define('HAVE_FFTW3', 1)
+
+ # fftw disabled, use ooura
+ if 'HAVE_FFTW3F' in ctx.env.define_key:
+ ctx.msg('Checking for FFT implementation', 'fftw3f')
+ elif 'HAVE_FFTW3' in ctx.env.define_key:
+ ctx.msg('Checking for FFT implementation', 'fftw3')
+ elif 'HAVE_ACCELERATE' in ctx.env.define_key:
+ ctx.msg('Checking for FFT implementation', 'vDSP')
else:
- # fftw disabled, use ooura
- if 'HAVE_ACCELERATE' in ctx.env.define_key:
- ctx.msg('Checking for FFT implementation', 'vDSP')
- else:
- ctx.msg('Checking for FFT implementation', 'ooura')
- pass
+ ctx.msg('Checking for FFT implementation', 'ooura')
if (Options.options.enable_jack != False):
ctx.check_cfg(package = 'jack', atleast_version = '0.15.0',
# add sub directories
bld.recurse('src')
from waflib import Options
- if Options.platform != 'ios':
+ if Options.platform not in ['ios', 'iosimulator']:
bld.recurse('examples')
bld.recurse('tests')
"""
- # create the aubio.pc file for pkg-config
- if ctx.env['TARGET_PLATFORM'] == 'linux':
- aubiopc = ctx.new_task_gen('subst')
- aubiopc.source = 'aubio.pc.in'
- aubiopc.target = 'aubio.pc'
- aubiopc.install_path = '${PREFIX}/lib/pkgconfig'
+ # install woodblock sound
+ bld.install_files('${PREFIX}/share/sounds/aubio/',
+ 'sounds/woodblock.aiff')
+ """
+
+ bld( source = 'aubio.pc.in' )
# build manpages from sgml files
- if ctx.env['DOCBOOKTOMAN']:
- import TaskGen
+ if bld.env['DOCBOOKTOMAN']:
+ from waflib import TaskGen
+ if 'MANDIR' not in bld.env:
+ bld.env['MANDIR'] = bld.env['PREFIX'] + '/share/man'
TaskGen.declare_chain(
- name = 'docbooktoman',
- rule = '${DOCBOOKTOMAN} ${SRC} > ${TGT}',
- ext_in = '.sgml',
- ext_out = '.1',
- reentrant = 0,
+ name = 'docbooktoman',
+ rule = '${DOCBOOKTOMAN} ${SRC} > ${TGT}',
+ ext_in = '.sgml',
+ ext_out = '.1',
+ reentrant = False,
+ install_path = '${MANDIR}/man1',
)
- manpages = ctx.new_task_gen(name = 'docbooktoman',
- source=ctx.path.ant_glob('doc/*.sgml'))
- ctx.install_files('${MANDIR}/man1', ctx.path.ant_glob('doc/*.1'))
+ bld( source = bld.path.ant_glob('doc/*.sgml') )
- # install woodblock sound
- bld.install_files('${PREFIX}/share/sounds/aubio/',
- 'sounds/woodblock.aiff')
"""
+ bld(rule = 'doxygen ${SRC}', source = 'web.cfg') #, target = 'doc/web/index.html')
+ """
+
def shutdown(bld):
from waflib import Options, Logs
- if Options.platform == 'ios':
+ if Options.platform in ['ios', 'iosimulator']:
msg ='aubio built for ios, contact the author for a commercial license'
Logs.pprint('RED', msg)
msg =' Paul Brossier <piem@aubio.org>'
Logs.pprint('RED', msg)
+
+
+def dist(ctx):
+ ctx.excl = ' **/.waf-1* **/*~ **/*.pyc **/*.swp **/.lock-w* **/.git*'
+ ctx.excl += ' **/build/*'
+ ctx.excl += ' **/python/gen **/python/build **/python/dist'
+ ctx.excl += ' **/**.zip **/**.tar.bz2'
+ ctx.excl += ' **/doc/full/*'
+ ctx.excl += ' **/python/*.db'
+ ctx.excl += ' **/python.old/*'
projects / aubio.git / commitdiff